Alfa Chemistry Analytical Products 4 - Products
Alfa Chemistry is a global leading supplier of analytical chemistry reagents, providing a wide range of analytical chemicals such as analytical standards for a variety of analytical applications.
| Product | Description | |
|---|---|---|
| 4arm-PEG10K-Maleimide | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). |  |
| 4arm-PEG10K-NH2 | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-SH | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Ester | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Glutaramide | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Glutarate | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Succinate | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Vinylsulfone | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K 2arm-OH, 2arm-NH2 | HCl Salt, average Mn 20000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K 3arm-OH, 1arm-NH2 | HCl Salt, average Mn 20000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-COOH | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Isocyanate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Maleimide | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-NH2 | HCl Salt, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-SH | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Ester | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Glutaramide | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Glutarate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Succinate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Vinylsulfone | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2500-PCL2500 | PEG average Mn 2,500, PCL average Mn 2,500. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2500-PLA3500 | PEG average Mn 2,500, PCL average Mn 3,500. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2K-NH2 | average Mn 2,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG3K 3arm-OH, 1arm-COOH | average Mn 3000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-COOH | average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-Maleimide | average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-NH2 | HCl Salt, average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-Succinimidyl Carboxymethyl Ester | average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-Succinimidyl Glutarate | average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG40K-Succinimidyl Succinate | average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K 1arm-OH, 3arm-COOH | average Mn 5000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K 3arm-OH, 1arm-COOH | average Mn 5000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K-COOH | average Mn 5,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K-NH2 | HCl Salt, average Mn 5,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K-SH | average Mn 5,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG5K-Succinimidyl Carboxymethyl Ester | average Mn 5,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| [4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile | 98%. Group: Oled and pled materials. | |
| 4-Bromo-4?,4??-dimethyltriphenylamine | 97%. Group: Synthetic tools and reagents. | |
| 4'-(Bromomethyl)-[1,1'-biphenyl]-2-carboxamide | 4'-(Bromomethyl)-[1,1'-biphenyl]-2-carboxamide. Uses: For analytical and research use. Group: Impurity standards. CAS No. 147404-72-6. IUPAC Name: 2-[4-(bromomethyl)phenyl]benzamide. Molecular formula: C14H12BrNO. Mole weight: 290.16. Catalog: APS147404726. SMILES: NC(=O)c1ccccc1c2ccc(CBr)cc2. Format: Neat. | |
| 4'-(Bromomethyl)-[1,1'-biphenyl]-2-carboxylic Acid | 4'-(Bromomethyl)-[1,1'-biphenyl]-2-carboxylic Acid. Uses: For analytical and research use. Group: Impurity standards. CAS No. 150766-86-2. Pack Sizes: 500MG. IUPAC Name: 2-[4-(bromomethyl)phenyl]benzoic acid. Molecular formula: C14H11BrO2. Mole weight: 291.14. Catalog: APS150766862. SMILES: OC(=O)c1ccccc1c2ccc(CBr)cc2. Format: Neat. Shipping: Room Temperature. | |
| 4?-Bromomethyl-2-biphenylcarbonitrile | 97%. Group: Liquid crystals. | |
| 4'-(Bromomethyl)biphenyl-2-carboxylic Acid tert-Butyl Ester | 4'-(Bromomethyl)biphenyl-2-carboxylic Acid tert-Butyl Ester. Uses: For analytical and research use. Group: Impurity standards. CAS No. 114772-40-6. IUPAC Name: tert-butyl 2-[4-(bromomethyl)phenyl]benzoate. Molecular formula: C18H19BrO2. Mole weight: 347.25. Catalog: APS114772406. SMILES: CC(C)(C)OC(=O)c1ccccc1c2ccc(CBr)cc2. Format: Neat. | |
| 4-Bromo Riluzole | 4-Bromo Riluzole. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 4-Bromo-6-(trifluoromethoxy)-2-benzothiazolamine, 4-Bromoriluzole. CAS No. 144631-82-3. Pack Sizes: 100MG. IUPAC Name: 4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine. Molecular formula: C8H4BrF3N2OS. Mole weight: 313.09. Catalog: APS144631823. SMILES: Nc1nc2c(Br)cc(OC(F)(F)F)cc2s1. Format: Neat. Shipping: Room Temperature. | |
| 4-Butoxybenzoic acid | 98%. Group: Liquid crystals. | |
| 4-Butylbenzoic acid | 99%. Group: Liquid crystals. | |
| (4-Carboxy-3-ethoxy)phenyl Acetic Acid | (4-Carboxy-3-ethoxy)phenyl Acetic Acid. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Repaglinide Imp. A (EP), 4-Carboxy-3-ethoxybenzeneacetic acid, 4-Carboxymethyl-2-ethoxybenzoic acid,Benzeneacetic acid, 4-carboxy-3-ethoxy-. CAS No. 220438-80-2. IUPAC Name: 4-(carboxymethyl)-2-ethoxybenzoic acid. Molecular formula: C11H12O5. Mole weight: 224.21. Catalog: APS220438802. SMILES: CCOc1cc(CC(=O)O)ccc1C(=O)O. Format: Neat. | |
| 4-Carboxy-TEMPO, free radical | 97%. Group: Electron spin resonance (esr/epr) spectroscopy. | |
| 4-Chloro-4-methyl-5-methylene-1,3-dioxolan-2-one (~90%) | 4-Chloro-4-methyl-5-methylene-1,3-dioxolan-2-one (~90%). Uses: For analytical and research use. Group: Impurity standards. CAS No. 95579-71-8. IUPAC Name: 4-chloro-4-methyl-5-methylene-1,3-dioxolan-2-one. Molecular formula: C5H5ClO3. Mole weight: 148.544. Catalog: APS95579718. SMILES: CC1(Cl)OC(=O)OC1=C. Format: Neat. | |
| 4'-Chloro Clomiphene Citrate(E/Z Mixture) | 4'-Chloro Clomiphene Citrate(E/Z Mixture). Uses: For analytical and research use. Group: Impurity standards. CAS No. 14158-75-9. Pack Sizes: 25MG. IUPAC Name: 2-[4-[2-chloro-2-(4-chlorophenyl)-1-phenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid. Molecular formula: C26H27Cl2NO.C6H8O7. Mole weight: 632.53. Catalog: APS14158759. SMILES: CCN(CC)CCOc1ccc(cc1)C(=C(Cl)c2ccc(Cl)cc2)c3ccccc3.OC(=O)CC(O)(CC(=O)O)C(=O)O. Format: Neat. Shipping: Room Temperature. | |
| 4-Chloro Loratadine | 4-Chloro Loratadine. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Ethyl 4-(4,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)piperidine-1-carboxylate, Loratadine Imp. C (EP). CAS No. 165739-83-3. IUPAC Name: ethyl 4-(4,8-dichloro-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridin-11-ylidene)piperidine-1-carboxylate. Molecular formula: C22H22Cl2N2O2. Mole weight: 417.33. Catalog: APS165739833. SMILES: CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc4c(Cl)ccnc24)CC1. Format: Neat. | |
| 4-Cyano-1-butanethiol | 97%. Group: Self assembly and lithography. | |
| 4-cyclopropyl-2-fluorobenzoic acid | 4-cyclopropyl-2-fluorobenzoic acid. Uses: For analytical and research use. Group: Impurity standards. CAS No. 1247927-81-6. Molecular formula: C10H9FO2. Mole weight: 180.18. Catalog: APB1247927816. | |
| 4-Dechloro-4-hydroxy Diclazuril | 4-Dechloro-4-hydroxy Diclazuril. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 2,6-Dichloro-4-(4,5-dihydro-3,5-dioxo-1,2,4-triazin-2(3H)-yl)-?-(4-hydroxyphenyl)-benzeneacetonitrile,Benzeneacetonitrile, 2,6-dichloro-4-(4,5-dihydro-3,5-dioxo-1,2,4-triazin-2(3H)-yl)-?-(4-hydroxyphenyl)-. CAS No. 112206-71-0. IUPAC Name: 2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-2-(4-hydroxyphenyl)acetonitrile. Molecular formula: C17H10Cl2N4O3. Mole weight: 389.19. Catalog: APS112206710. SMILES: Oc1ccc(cc1)C(C#N)c2c(Cl)cc(cc2Cl)N3N=CC(=O)NC3=O. Format: Neat. | |
| 4-(Decyloxy)benzoic acid | 98%. Group: Liquid crystals. | |
| 4-Demethyltrimethoprim | 4-Demethyltrimethoprim. Uses: For analytical and research use. Group: Impurity standards. Pack Sizes: 10MG. Catalog: APS004725. Format: Neat. Shipping: Room Temperature. | |
| 4-Deschloro-4-(2-furanylmethyl)amino Furosemide | 4-Deschloro-4-(2-furanylmethyl)amino Furosemide. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 2,4-Bis[(furan-2-ylmethyl)amino]-5-sulphamoylbenzoic Acid, Furosemide Imp. D (EP). CAS No. 5046-19-5. IUPAC Name: 2,4-bis(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid. Molecular formula: C17H17N3O6S. Mole weight: 391.40. Catalog: APS5046195. SMILES: NS(=O)(=O)c1cc(C(=O)O)c(NCc2occc2)cc1NCc3occc3. Format: Neat. | |
| 4-Desmethoxy-4-chloro Omeprazole | 4-Desmethoxy-4-chloro Omeprazole. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Omeprazole Imp. H (EP),2-[(RS)-[(4-Chloro-3,5-dimethylpyridin-2-yl)methyl]sulfinyl]-5-methoxy-1H-benzimidazole. CAS No. 863029-89-4. IUPAC Name: 2-[(4-chloro-3,5-dimethylpyridin-2-yl)methylsulfinyl]-5-methoxy-1H-benzimidazole. Molecular formula: C16H16ClN3O2S. Mole weight: 349.84. Catalog: APS863029894. SMILES: COc1ccc2[nH]c(nc2c1)S(=O)Cc3ncc(C)c(Cl)c3C. Format: Neat. | |
| 4-Desmethoxy Omeprazole | 4-Desmethoxy Omeprazole. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Omeprazole Imp. B (EP),Esomeprazole Magnesium Trihydrate Imp. B (EP), Esomeprazole Imp. B (EP), 2-[(RS)-[(3,5-Dimethylpyridin-2-yl)methyl]sulphinyl]-5-methoxy-1H-benzimidazole. CAS No. 110374-16-8. IUPAC Name: 2-[(3,5-dimethylpyridin-2-yl)methylsulfinyl]-5-methoxy-1H-benzimidazole. Molecular formula: C16H17N3O2S. Mole weight: 315.39. Catalog: APS110374168. SMILES: COc1ccc2[nH]c(nc2c1)S(=O)Cc3ncc(C)cc3C. Format: Neat. | |
| 4-Desmethoxypropoxyl-4-chloro Rabeprazole | 4-Desmethoxypropoxyl-4-chloro Rabeprazole. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Rabeprazole Sodium Imp. H (EP), Rabeprazole Imp. H (EP), Rabeprazole USP Related Compound F, 2-[(RS)-[(4-Chloro-3-methylpyridin-2-yl)methyl]sulphinyl]-1H-benzimidazole, Rabeprazole USP RC F,Lansoprazole Imp. F (EP). CAS No. 168167-42-8. IUPAC Name: 2-[(4-chloro-3-methylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole. Molecular formula: C14H12ClN3OS. Mole weight: 305.78. Catalog: APS168167428. SMILES: Cc1c(Cl)ccnc1CS(=O)c2nc3ccccc3[nH]2. Format: Neat. | |
| 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfide | 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfide. Uses: For analytical and research use. Group: Impurity standards. CAS No. 103312-62-5. IUPAC Name: 2-[(4-chloro-3-methylpyridin-2-yl)methylsulfanyl]-1H-benzimidazole. Molecular formula: C14H12ClN3S. Mole weight: 289.78. Catalog: APS103312625. SMILES: Cc1c(Cl)ccnc1CSc2nc3ccccc3[nH]2. Format: Neat. | |
| 4-Desmethoxypropoxyl-4-methoxy Rabeprazole | 4-Desmethoxypropoxyl-4-methoxy Rabeprazole. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Rabeprazole Sodium Imp E (EP),2-[[(4-Methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole. CAS No. 102804-77-3. Pack Sizes: 10MG. IUPAC Name: 2-[(4-methoxy-3-methylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole. Molecular formula: C15H15N3O2S. Mole weight: 301.36. Catalog: APS102804773. SMILES: COc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C. Format: Neat. Shipping: Room Temperature. | |
| 4-Desulfo-4-hydroxy Picosulfate Monosodium Salt | 4-Desulfo-4-hydroxy Picosulfate Monosodium Salt. Uses: For analytical and research use. Group: Impurity standards. CAS No. 32500-19-9. Pack Sizes: 500MG. IUPAC Name: sodium;[4-[(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenyl] sulfate. Molecular formula: C18H14NO5S.Na. Mole weight: 379.36. Catalog: APS32500199A. SMILES: [Na+].Oc1ccc(cc1)C(c2ccc(OS(=O)(=O)[O-])cc2)c3ccccn3. Format: Neat. Shipping: Room Temperature. | |
| 4-(Dibenzylamino)benzaldehyde-N,N-diphenylhydrazone | 97%. Group: Oled and pled materials. | |
| 4-Dihydroboldenone | 4-Dihydroboldenone. Uses: For analytical and research use. Group: Impurity standards. CAS No. 10529-96-1. Molecular formula: C19H28O2. Mole weight: 288.43. Catalog: APB10529961. | |
| 4-(+)-(Dimethylamino)-3-methyl-2,2-diphenyl-butyronitrile (Isodidiavalo) >90% | 4-(+)-(Dimethylamino)-3-methyl-2,2-diphenyl-butyronitrile (Isodidiavalo) >90%. Uses: For analytical and research use. Group: Impurity standards. Catalog: APS00443. Format: Neat. | |
| 4-Dimethylaminopyridine | 4-Dimethylaminopyridine. Uses: For analytical and research use. Group: Impurity standards. CAS No. 1122-58-3. Pack Sizes: 5G. IUPAC Name: N,N-dimethylpyridin-4-amine. Molecular formula: C7H10N2. Mole weight: 122.17. Catalog: APS1122583. SMILES: CN(C)c1ccncc1. Format: Neat. Shipping: Room Temperature. | |
| 4-(Diphenylamino)phenylboronic acid pinacol ester | 95%. Group: Synthetic tools and reagents. | |
| 4-(Dodecyloxy)benzoic acid | 98%. Group: Liquid crystals. | |
| 4-Epi-14,15-Dehydrated Pimecrolimus | 4-Epi-14,15-Dehydrated Pimecrolimus. Uses: For analytical and research use. Group: Impurity standards. Catalog: APS00485. Format: Neat. | |
| 4-Epi Minocycline (>80%, contains unidentified salts) | 4-Epi Minocycline (>80%, contains unidentified salts). Uses: For analytical and research use. Group: Impurity standards. CAS No. 43168-51-0. IUPAC Name: (4R,4aS,5aR,12aS)-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide. Molecular formula: C23H27N3O7. Mole weight: 457.48. Catalog: APS43168510. SMILES: CN(C)[C@@H]1[C@@H]2C[C@@H]3Cc4c(ccc(O)c4C(=O)C3=C(O)[C@]2(O)C(=O)C(=C1O)C(=O)N)N(C)C. Format: Neat. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.