Alfa Chemistry Analytical Products 4 - Products
Alfa Chemistry is a global leading supplier of analytical chemistry reagents, providing a wide range of analytical chemicals such as analytical standards for a variety of analytical applications.
| Product | Description | |
|---|---|---|
| 8arm-PEG10K 7arm-OH, 1arm-COOH, tripentaerythritol core | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). |  |
| 8arm-PEG10K-Acrylate | Hexaglycerol core, average Mn 10000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-COOH, hexaglycerol core | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-COOH, tripentaerythritol core | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-Maleimide | hexaglycerol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-Maleimide | tripentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-NH2, hexaglycerol core | HCl Salt, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-NH2, tripentaerythritol core | HCl Salt, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-SH | hexaglycerol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-SH, tripentaerythritol core | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG10K-Vinylsulfone, tripentaerythritol core | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K 7arm-OH, 1arm-COOH | Hexaglycerol core, average Mn 20000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K 7arm-OH, 1arm-COOH, tripentaerythritol core | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-Acrylate | tripentaerythritol core, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-COOH | hexaglycerol core, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-COOH, tripentaerythritol core | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-Maleimide | hexaglycerol core, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-Maleimide | tripentaerythritol core, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-NH2, hexaglycerol core | HCl Salt, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-NH2, tripentaerythritol core | HCl Salt, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-Norbornene, tripentaerythritol core | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-SH | hexaglycerol core, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-SH, tripentaerythritol core | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG20K-Vinylsulfone, tripentaerythritol core | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG40K-COOH | hexaglycerol core, average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG40K-Maleimide | hexaglycerol core, average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG40K-NH2 | hexaglycerol core, HCl Salt, average Mn 40,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG40K-Succinimidyl Glutarate | Hexaglycerol core, average Mn 40000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8arm-PEG40K-Succinimidyl Succinate | Hexaglycerol core, average Mn 40000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 8-Chloro-11-(piperidin-4-ylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine | 8-Chloro-11-(piperidin-4-ylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine. Uses: For analytical and research use. Group: Impurity standards. CAS No. 117811-20-8. Pack Sizes: 2.5MG. IUPAC Name: 8-chloro-11-piperidin-4-ylidenebenzo[1,2]cyclohepta[2,4-b]pyridine. Molecular formula: C19H17ClN2. Mole weight: 308.80. Catalog: APS117811208. SMILES: Clc1ccc2C(=C3CCNCC3)c4ncccc4C=Cc2c1. Format: Neat. Shipping: Room Temperature. | |
| 8-Chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine | 8-Chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Desfluoromidazolam, Midazolam Imp. G (EP), 8-Chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine,4H-Imidazo[1,5-a][1,4]benzodiazepine, 8-chloro-1-methyl-6-phenyl-. CAS No. 59467-86-6. IUPAC Name: 8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine. Molecular formula: C18H14ClN3. Mole weight: 307.78. Catalog: APS59467866. SMILES: Cc1ncc2CN=C(c3ccccc3)c4cc(Cl)ccc4n12. Format: Neat. | |
| 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-Imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic Acid | 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-Imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic Acid. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 8-Chloro-6-(O-Fluorophenyl)-1-Methyl-4H-Imidazo(1,5-A)(1,4)Benzodiazepine-3-Carboxylic Acid; 8-Chloro-6-(O-Fluorophenyl)-1-Methyl-4H-Imidazo[1,5-A][1,4]Benzodiazepine-3-Carboxylic Acid; UNII-P5URY5OSB9; P5URY5OSB9; EINECS 261-777-1; SCHEMBL1311112. CAS No. 59468-44-9. IUPAC Name: 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid. Molecular formula: C19H13ClFN3O2. Mole weight: 369.78. Catalog: APS59468449. SMILES: Cc1nc(C(=O)O)c2CN=C(c3ccccc3F)c4cc(Cl)ccc4n12. Format: Neat. | |
| 8-Hydroxyquinoline | Pesticides & Metabolites; Standards for Environmental Regulatory Methods; Pesticides & Metabolites. Uses: For analytical and research use. Group: Reagents. CAS No. 148-24-3. IUPAC Name: quinolin-8-ol. | |
| 8-Hydroxyquinoline zinc | 99%. Group: Oled and pled materials. | |
| 8-Hydroxy Warfarin ?-D-Glucuronide | 8-Hydroxy Warfarin ?-D-Glucuronide. Uses: For analytical and research use. Group: Impurity standards. CAS No. 1007224-60-3. Molecular formula: C25H24O11. Mole weight: 500.46. Catalog: APB1007224603. | |
| 8-Iodo (2R,3S)-rel-Nadolol | 8-Iodo (2R,3S)-rel-Nadolol. Uses: For analytical and research use. Group: Impurity standards. Pack Sizes: 10MG. Catalog: APS005208. Format: Neat. Shipping: Room Temperature. | |
| 8-Mercaptooctanoic acid | 95%. Group: Self assembly and lithography. | |
| 8-Methyl Etodolac | 8-Methyl Etodolac. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 8-Methyl Etodolac, 2-[(1RS)-1-Ethyl-8-methyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl]acetic Acid,Etodolac Imp. B (EP). CAS No. 41340-19-6. Pack Sizes: 10MG. IUPAC Name: 2-(1-ethyl-8-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid. Molecular formula: C16H19NO3. Mole weight: 273.33. Catalog: APS41340196A. SMILES: CCC1(CC(=O)O)OCCc2c1[nH]c3c(C)cccc23. Format: Neat. Shipping: Room Temperature. | |
| 8-[N-(2-Diphenylmethoxyethyl)-N,N-dimethylaminium]-1,3-dimethylxanthine inner salt | 8-[N-(2-Diphenylmethoxyethyl)-N,N-dimethylaminium]-1,3-dimethylxanthine inner salt. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 8-[N-(2-Diphenylmethoxyethyl)-N,N-dimethylaminium]-1,3-dimethylxanthine inner salt. CAS No. 64487-94-1. IUPAC Name: 2-benzhydryloxyethyl-(1,3-dimethyl-2,6-dioxopurin-7-id-8-yl)-dimethylazanium. Molecular formula: C24H27N5O3. Mole weight: 433.50. Catalog: APS64487941. SMILES: CN1C(=O)N(C)c2nc([n-]c2C1=O)[N+](C)(C)CCOC(c3ccccc3)c4ccccc4. Format: Neat. Shipping: Room Temperature. | |
| 9,10-Anhydro-8-desacetyl-8-carboxy Daunorubicin Hydrochloride | 9,10-Anhydro-8-desacetyl-8-carboxy Daunorubicin Hydrochloride. Uses: For analytical and research use. Group: Impurity standards. Catalog: APS00614. Format: Neat. | |
| 9,10-Anthracenediboronic acid bis(pinacol) ester | 97%. Group: Synthetic tools and reagents. | |
| 9,10-Anthracenedicarboxylic acid | 95%. Group: Materials for hydrogen storage. | |
| 9,10-Bis(2-naphthyl)anthrace | 99% (HPLC). Group: Oled and pled materials. | |
| 9,10-Bis(phenylethynyl)anthracene | 97%. Group: Biosensing and bioimaging. | |
| 9,10-Bis[(triisopropylsilyl)ethynyl]anthracene | >99%. Group: Oled and pled materials. | |
| 9,10-Dichlorooctafluoroanthracene | 97%. Group: Synthetic tools and reagents. | |
| 9,10-Dioxo Ketotifen | 9,10-Dioxo Ketotifen. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 4-(1-Methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-9,10-dione, 9,10-Dioxoketotifen,4H-Benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione, 4-(1-methyl-4-piperidinylidene)-, NSC 282482, 4-(1-Methyl-4-piperidinylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione, Ketotifen EP impurity G, 9,10-Dioxo Ketotifen. CAS No. 43076-16-0. IUPAC Name: 10-(1-methylpiperidin-4-ylidene)benzo[1,2]cyclohepta[2,4-b]thiophene-4,5-dione. Molecular formula: C19H17NO2S. Mole weight: 323.41. Catalog: APS43076160. SMILES: CN1CCC(=C2c3ccccc3C(=O)C(=O)c4sccc24)CC1. Format: Neat. | |
| 9,10-Phenanthrenequinone | ?99%. Group: Oled and pled materials. | |
| 9,11-Dehydro Ethynyl Estradiol | 9,11-Dehydro Ethynyl Estradiol. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 19-Nor-17alpha-pregna-1,3,5(10),9(11)-tetraen-20-yne-3,17-diol, Ethinylestradiol Imp. B (EP), 9,11-Didehydroethinylestradiol. CAS No. 1231-96-5. IUPAC Name: (8S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol. Molecular formula: C20H22O2. Mole weight: 294.39. Catalog: APS1231965. SMILES: C[C@]12CC=C3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC[C@@]2(O)C#C. Format: Neat. | |
| ?9(11)-Estradiol | ?9(11)-Estradiol. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Estradiol Hemihydrate Imp. D (EP),Estra-1,3,5(10),9(11)-tetraene-3,17beta-diol, 9,11-Didehydroestradiol. CAS No. 791-69-5. IUPAC Name: (8S,13S,14S,17S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol. Molecular formula: C18H22O2. Mole weight: 270.37. Catalog: APS791695. SMILES: C[C@]12CC=C3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC[C@@H]2O. Format: Neat. | |
| 9,13b-Dehydro Epinastine | 9,13b-Dehydro Epinastine. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: 9H-Dibenz[c,f]imidazo[1,5-a]azepin-3-amine, 9,13b-Dehydro Epinastine, 9,13b-Dehydroepinastine. CAS No. 706753-75-5. Molecular formula: C16H13N3. Mole weight: 247.29. Catalog: APS706753755. SMILES: Nc1ncc2c3ccccc3Cc4ccccc4n12. Format: Neat. | |
| 9,9?-[1,1?-Biphenyl]-4,4?-diylbis[3,6-bis(1,1-dimethyl ethyl)]-9H-carbazole | 99%. Group: Oled and pled materials. | |
| 9,9?-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis-9H-carbazole | 98%. Group: Oled and pled materials. | |
| 9,9-Di-(2?-ethylhexyl)-2,7-dibromofluorene | 98%. Group: Synthetic tools and reagents. | |
| 9,9-Didodecyl-2,7-dibromofluorene | 97%. Group: Synthetic tools and reagents. | |
| 9,9-Dihexyl-2,7-dibromofluorene | 97%. Group: Synthetic tools and reagents. | |
| 9,9-Dimethylfluorene-2-boronic acid pinacol ester | 95%. Group: Synthetic tools and reagents. | |
| 9,9-Dimethyl-N,N?-di(1-naphthyl)-N,N?-diphenyl-9H-fluorene-2,7-diamine | 98% (HPLC). Group: Oled and pled materials. | |
| 9,9-Dioctyl-2,7-dibromofluorene | 96%. Group: Synthetic tools and reagents. | |
| 9,9-Dioctyl-9H-9-silafluorene-2,7-bis(boronic acid pinacol ester) | 97%. Group: Synthetic tools and reagents. | |
| 9,9-Dioctylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester | 97%. Group: Synthetic tools and reagents. | |
| 9,9-Dioctylfluorene-2-boronic acid pinacol ester | 95%. Group: Synthetic tools and reagents. | |
| 9-(9-Heptadecanyl)-9H-carbazole-2,7-diboronic acid bis(pinacol) ester | 97%. Group: Synthetic tools and reagents. | |
| 9,9?-Spirobifluorene | 97%. Group: Synthetic tools and reagents. | |
| 9-Benzyl-9H-carbazole-3-boronic acid pinacol ester | 95%. Group: Synthetic tools and reagents. | |
| 9-Chloro Triamcinolone Acetonide | 9-Chloro Triamcinolone Acetonide. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: Pregna-1,4-diene-3,20-dione, 9-chloro-11?,16?,17,21-tetrahydroxy-, cyclic 16,17-acetal with acetone (7CI,8CI),Pregna-1,4-diene-3,20-dione, 9-chloro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-, (11?,16?)- (9CI), 2H-Naphth[2',1':4,5]indeno[1,2-d][1,3]dioxole, pregna-1,4-diene-3,20-dione deriv. CAS No. 10392-74-2. Molecular formula: C24H31ClO6. Mole weight: 450.95. Catalog: APS10392742. SMILES: CC1(C)O[C@@H]2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@@]4(Cl)[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO. Format: Neat. | |
| 9-cis,13-cis-Retinol 15-Acetate | 9-cis,13-cis-Retinol 15-Acetate. Uses: For analytical and research use. Group: Phytochemicals. Alternative Names: Retinol, acetate, (9-cis,13-cis)- (9CI),Retinol, 15-acetate, (9-cis,13-cis)-, 9,13-cis,cis Vitamin A, Retinol, acetate, 9-cis,13-cis- (8CI). CAS No. 29444-27-7. IUPAC Name: [(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate. Molecular formula: C22H32O2. Mole weight: 328.49. Catalog: APS29444277. SMILES: CC(=O)OC\C=C(\C)/C=C/C=C(/C)\C=C\C1=C(C)CCCC1(C)C. Format: Neat. | |
| 9-cis-Astaxanthin | analytical standard. Group: Colorant standards. | |
| 9-Deschloro-9-bromo Beclomethasone Dipropionate | 9-Deschloro-9-bromo Beclomethasone Dipropionate. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: (11?,16?)-9-Bromo-11-hydroxy-16-methyl-17,21-bis(1-oxopropoxy)pregna-1,4-diene-3,20-dione, 9-Bromo-11?-hydroxy-16?-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl Dipropanoate. CAS No. 52092-14-5. IUPAC Name: [2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-bromo-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate. Molecular formula: C28H37BrO7. Mole weight: 565.49. Catalog: APS52092145. SMILES: CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Br)[C@@H](O)C[C@]12C. Format: Neat. | |
| 9'-Desmethyl Granisetron | 9'-Desmethyl Granisetron. Uses: For analytical and research use. Group: Impurity standards. Alternative Names: endo-N-9-Azabicyclo[3.3.1]non-3-yl-1-methyl-1H-indazole-3-carboxamide,Granisetron Hydrochloride Imp. C (EP), N-[(1R,3r,5S)-9-Azabicyclo[3.3.1]non-3-yl]-1-methyl-1H-indazole-3-carboxamide, N-(3-endo)-9-Azabicyclo[3.3.1]non-3-yl-1-methyl-1H-indazole-3-carboxamide. CAS No. 160177-67-3. IUPAC Name: N-[(1R,5S)-9-azabicyclo[3.3.1]nonan-3-yl]-1-methylindazole-3-carboxamide. Molecular formula: C17H22N4O. Mole weight: 298.38. Catalog: APS160177673. SMILES: Cn1nc(C(=O)N[C@H]2C[C@H]3CCC[C@@H](C2)N3)c4ccccc14. Format: Neat. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.