Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Water-soluble CdSe-like quantum dots (positive charge) | Water-soluble CdSe-like quantum dots (positive charge). |  |
| Water-soluble CdS quantum dots (carboxy amino modification) | Water-soluble CdS quantum dots (carboxy amino modification). | |
| Water soluble CdTe/CdS quantum dots | Water soluble CdTe/CdS quantum dots. | |
| Water soluble CdTe/CdS/ZnS quantum dots | Water soluble CdTe/CdS/ZnS quantum dots. | |
| Water soluble CdTe/ZnS/CdS quantum dots | Water soluble CdTe/ZnS/CdS quantum dots. | |
| Water-soluble CdTe/ZnS quantum dots | Water-soluble CdTe/ZnS quantum dots. | |
| Woods alloy | Woods alloy. Alternative Names: BISMUTH LEAD TIN CADMIUM;ALLOY ACCORDING TO WOOD;WOODS METAL;WOODS METAL;WOODS ALLOY;WOODS ALLOY;Alloy Woods ;WOODS METAL, STICK. CAS No. 76093-98-6. Molecular formula: BiCdPdSn. Mole weight: 546.52. Purity: sticks. IUPAC Name: bismuth; cadmium; lead; tin. | |
| WS2 single-layer quantum dot powder | WS2 single-layer quantum dot powder. | |
| WS2 single-layer quantum dot solution | WS2 single-layer quantum dot solution. | |
| WSe2 single-layer quantum dot powder | WSe2 single-layer quantum dot powder. | |
| WSe2 single-layer quantum dot solution | WSe2 single-layer quantum dot solution. | |
| Ytterbium fluoride | Ytterbium fluoride. Molecular formula: YbF3. Mole weight: 230.0g/mol. Purity: 0.9999. IUPAC Name: ytterbium(3+);trifluoride. InChI: InChI=1S/3FH.Yb/h3*1H;/q;;;+3/p-3. | |
| Yttrium Aluminum lump, 99.9% (metals basis excluding Ca), Ca 1% max | Yttrium Aluminum lump, 99.9% (metals basis excluding Ca), Ca 1% max. | |
| Yttrium fluoride | Yttrium fluoride. Molecular formula: YF3. Mole weight: 145.9010g/mol. Purity: 0.9999. IUPAC Name: trifluoroyttrium. InChI: InChI=1S/3FH.Y/h3*1H;/q;;;+3/p-3. | |
| Yttrium(III) oxide sputtering target, 50.8mm (2.0in) dia x 3.18mm (0.125in) thick, 99.99% (metals basis) | Yttrium(III) oxide sputtering target, 50.8mm (2.0in) dia x 3.18mm (0.125in) thick, 99.99% (metals basis). | |
| Yttrium(III) oxide sputtering target, 76.2mm (3.0in) dia x 3.18mm (0.125in) thick, 99.99% (metals basis) | Yttrium(III) oxide sputtering target, 76.2mm (3.0in) dia x 3.18mm (0.125in) thick, 99.99% (metals basis). | |
| Yttrium oxide | DryPowder; OtherSolid; PelletsLargeCrystals;DryPowder. Molecular formula: Y2O3. Mole weight: 225.810g/mol. Purity: 0.9999. IUPAC Name: oxygen(2-);yttrium(3+). InChI: InChI=1S/3O.2Y/q3*-2;2*+3. | |
| Yttrium Oxide, Europium Doped | Yttrium oxide, europium doped is generally immediately available in most volumes. Alternative Names: Europium doped yttria, Europium yttrium oxide, Red phosphor, Phosphor Type 1134, Yttrium Oxide, Europium-activated, Y1.92Eu0.08O3. CAS No. 68585-82-0. Molecular formula: Y1.92Eu0.08O3. Mole weight: 230.85. Purity: 99%|99.9%|99.99%|99.999%. InChI: InChI=1S/3O.2Y/q3*-2;2*+3. | |
| Y-zeolite | Y-zeolite. CAS No. 12173-28-3. | |
| ZIF-8 | ZIF-8. Molecular formula: C8H10N4Zn. Mole weight: 227.6g/mol. IUPAC Name: zinc;2-methylimidazol-3-ide. InChI: InChI=1S/2C4H5N2.Zn/c2*1-4-5-2-3-6-4;/h2*2-3H,1H3;/q2*-1;+2. | |
| Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine | Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine. Alternative Names: ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE;zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23;ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23 , 24,25-HEXADECAFLUORO-PHTHALOCYANINE;Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hex. CAS No. 31396-84-6. Molecular formula: C32F16N8Zn. Mole weight: 865.7g/mol. IUPAC Name: zinc;5,6,7,8,14,15,16,17,23,24,25,26,32,33,34,35-hexadecafluoro-2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13(18),14,16,19(39),20,22(27),23,25,28,30(37),31(36),32,34-nonadecaene. SMILES: C12=C(C(=C(C(=C1F)F)F)F)C3=NC4=NC(=NC5=C6C(=C([N-]5)N=C7C8=C(C(=C(C(=C8F)F)F)F)C(=N7)N=C2[N-]3)C(=C(C(=C6F)F)F)F)C9=C4C(=C(C(=C9F)F)F)F.[Zn+2]. InChI: InChI=1S/C32F16N8.Zn/c33-9-1-2(10(34)18(42)17(9)41)26-49-25(1)53-27-3-4(12(36)20(44)19(43)11(3)35)29(50-27)55-31-7-8(16(40)24(48)23(47)15(7)39)32(52-31)56-30-6-5(28(51-30)54-26)13(37)21(45)22(46)14(6)38;/q-2;+2. | |
| Zinc acetate | Zinc acetate. Alternative Names: Diacetic acid zinc salt. CAS No. 557-34-6. Molecular formula: C2H4O2Zn++. Mole weight: 183.5. Purity: 95%+. IUPAC Name: Zinc;diacetate. SMILES: CC(=O)[O-].CC(=O)[O-].[Zn+2]. InChI: InChI=1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;+2/p-2. | |
| Zinc Copper composite, -100 mesh, 99% (metals basis) | Zinc Copper composite, -100 mesh, 99% (metals basis). | |
| Zinc hexafluoroacetylacetonate dihydrate | Zinc hexafluoroacetylacetonate dihydrate. Alternative Names: Hexafluoroacetylacetone zinc derivative. CAS No. 16743-33-2. Molecular formula: C10H6F12O6Zn. Mole weight: 515.5. Purity: 95%+. IUPAC Name: Zinc;1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;dihydrate. SMILES: C(=C(C(F)(F)F)[O-])C(=O)C(F)(F)F.C(=C(C(F)(F)F)[O-])C(=O)C(F)(F)F.O.O.[Zn+2]. InChI: InChI=1S/2C5H2F6O2.2H2O.Zn/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1,12H;2*1H2;/q;+2/p-2. | |
| Zinc iodide | Zinc iodide. Alternative Names: Hydriodic acid zinc salt (2:1). CAS No. 10139-47-6. Molecular formula: ZnI2. Mole weight: 319.2. Purity: 99%+. IUPAC Name: Diiodozinc. SMILES: [Zn](I)I. InChI: InChI=1S/2HI.Zn/h2*1H;/q;+2/p-2. | |
| Zinc neodecanoate | Zinc neodecanoate. Alternative Names: Neodecanoic acid, zinc salt. CAS No. 27253-29-8. Molecular formula: C20H38O4Zn. Mole weight: 407.92. Purity: 96%. IUPAC Name: Zinc;2-ethyl-2,5-dimethylhexanoate. SMILES: CCC(C)(CCC(C)C)C(=O)[O-].CCC(C)(CCC(C)C)C(=O)[O-].[Zn+2]. InChI: WLNWJZARHGYNBL-UHFFFAOYSA-L. | |
| Zinc oxalate | Zinc oxalate. Alternative Names: Zinc oxalate hydrate. CAS No. 547-68-2. Molecular formula: C2H2O4Zn. Mole weight: 155.4. Purity: 99%+. IUPAC Name: Oxalic acid;zinc. SMILES: C(=O)(C(=O)O)O.[Zn]. InChI: InChI=1S/C2H2O4.Zn/c3-1(4)2(5)6;/h(H,3,4)(H,5,6). | |
| Zinc oxide ink for inkjet printing | Helios'Ink H-SZ01034, semi conductive ink developed for the printed electronics is particularly well suited for OPV and PV. Helios'Ink H-SZ01034, semi conductive ink shows great performance on Drop on Demand (DOD) inkjet printers, blade coating, and spin coating and is compatible with various flexible substrates (polyimide, PET, PET/ITO, etc.) but also Glass/ITO. Alternative Names: Zinc oxide dispersion,Zinc oxide suspension,ZnO ink,ZnO nanoparticle ink. Molecular formula: ZnO. | |
| Zinc oxide ink for spin coating/slot-die coating | H-SZ41029 semi conductive ink developed for the printed electronics is particularly well suited for flexible OLED and OPV. H-SZ41029 semi conductive ink shows great performance on spin coating and slot die coating and is compatible with various flexible substrates (polyimide, PET, PET/ITO, etc.) but also Glass/ITO. Alternative Names: Zinc oxide dispersion,Zinc oxide suspension,ZnO ink,ZnO nanoparticle ink. Molecular formula: ZnO. | |
| Zinc oxide nanoparticle ink | Zinc oxide nanoparticle ink are nanoparticle-based printing inks allowing processing temperatures of 80°C. Zinc oxide nanoparticle ink is an electron selective interface layer ink containing zinc oxide (ZnO) nanoparticles in isopropanol. ZnO nanoparticle ink functions well as electron extraction layer (EEL) materials in solar cells. Alternative Names: Avantama N-10-Screen,Nanograde N-10-Screen,ZnO ink,ZnO nanoparticle ink. Molecular formula: ZnO. | |
| Zinc oxide sputtering target, 50.8mm (2.0in) dia x 6.35mm (0.250in) thick, 99.9% (metals basis) | Zinc oxide sputtering target, 50.8mm (2.0in) dia x 6.35mm (0.250in) thick, 99.9% (metals basis). | |
| Zinc oxide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.250in) thick, 99.9% (metals basis) | Zinc oxide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.250in) thick, 99.9% (metals basis). | |
| Zinc sulfate heptahydrate | Liquid;GRANULES OR CRYSTALLINE POWDER. Alternative Names: Zinc sulfate, 7-hydrate. CAS No. 7446-20-0. Molecular formula: H14O11SZn. Mole weight: 287.6. Purity: 99%+. IUPAC Name: Zinc;sulfate;heptahydrate. SMILES: O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[Zn+2]. InChI: InChI=1S/H2O4S.7H2O.Zn/c1-5(2,3)4;/h(H2,1,2,3,4);7*1H2;/q;+2/p-2. | |
| Zinc sulfide | Zinc sulfide appears as a yellowish-white powder in a liquid. Insoluble in water and denser than water. Primary hazard is to the environment. Immediate steps should be taken to limit spread to the environment. Easily penetrates the soil to contaminate groundwater and nearby waterways.;DryPowder; OtherSolid; PelletsLargeCrystals;WHITE-TO-YELLOW CRYSTALS OR POWDER. Molecular formula: ZnS. Mole weight: 97.4g/mol. Purity: 0.9999. IUPAC Name: sulfanylidenezinc. InChI: InChI=1S/S.Zn. | |
| Zinc trifluoroacetate hydrate | Zinc trifluoroacetate hydrate. Alternative Names: Trifluoroacetic acid zinc salt. CAS No. 207801-31-8. Molecular formula: C4H2F6O5Zn. Mole weight: 309.4. Purity: 95%+. IUPAC Name: Zinc;2,2,2-trifluoroacetate;hydrate. SMILES: C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].O.[Zn+2]. InChI: InChI=1S/2C2HF3O2.H2O.Zn/c2*3-2(4,5)1(6)7;/h2*(H,6,7);1H2;/q;+2/p-2. | |
| Zirconium Carbide Nanoparticles | Zirconium Carbide Nanoparticles. Alternative Names: ZrC Nanopowder. CAS No. 12070-14-3. Molecular formula: ZrC. Mole weight: 103.23. Purity: 99%, 99.5%, 99.9%, 99.95%, 99.99%, 99.999%. SMILES: [Zr].C. InChI: InChI=1S/CH4.Zr/h1H4. | |
| zirconium dioxide | DryPowder; OtherSolid; PelletsLargeCrystals; WetSolid. Molecular formula: ZrO2. Mole weight: 123.22g/mol. Purity: 0.9999. IUPAC Name: dioxozirconium. InChI: InChI=1S/2O.Zr. | |
| Zirconium(IV) carbonate basic | Zirconium(IV) carbonate basic. Alternative Names: [mu-[carbonato(2-)-o:o']]dihydroxydioxodi-zirconiu;[μ-[carbonato(2-)-O:O']]dihydroxydioxodi-Zirconium;Basiczirconiumcarbonate;ZIRCONIUM BASIC CARBONATE;ZIRCONIUM(IV) CARBONATE BASIC;ZIRCONIUM(IV) CARBONATE HYDROXIDE OXIDE;[mu-[carbonato(2-)-O:O]]dihydroxy. CAS No. 57219-64-4. Molecular formula: CH2O7Zr2. Mole weight: 308.47. | |
| Zirconium(IV) chloride tetrahydrofuran complex (1:2) | Zirconium(IV) chloride tetrahydrofuran complex (1:2). Alternative Names: tetrachlorozirconium; DTXSID4049820; Zirconium(IV) chloride tetrahydrofuran complex (1:2); MFCD00145367; zrcl4(thf)2; SCHEMBL148678; Tetrachlorobis(tetrahydrofuran)zirconium. CAS No. 21959-01-3. Molecular formula: C8H16Cl4O2Zr. Mole weight: 377.238g/mol. IUPAC Name: oxolane;tetrachlorozirconium. SMILES: C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl. InChI: InChI=1S/2C4H8O.4ClH.Zr/c2*1-2-4-5-3-1;;;;;/h2*1-4H2;4*1H;/q;;;;;;+4/p-4. | |
| Zirconium(IV) ethoxide | Zirconium(IV) ethoxide. Alternative Names: Zirconium tetraethoxide. CAS No. 18267-08-8. Molecular formula: C8H24O4Zr. Mole weight: 275.5. Purity: 95%+. IUPAC Name: Ethanol;zirconium. SMILES: CCO.CCO.CCO.CCO.[Zr]. InChI: InChI=1S/4C2H6O.Zr/c4*1-2-3;/h4*3H,2H2,1H3. | |
| Zirconium(IV) Propoxide (ca. 70% in 1-Propanol) | Zirconium(IV) Propoxide (ca. 70% in 1-Propanol). Alternative Names: zirconium(4+); A7Z4N4E80X; TR-010919; KS-000012UL; Tetra n-Propyl Zirconate; Zirconium(IV) propoxide solution; Propyl alcohol, zirconium(4+) salt; zirconium tetra propoxide; 1-Propanol, zirconium(4+) salt; UNII-A7Z4N4E80X. CAS No. 23519-77-9. Molecular formula: C12H28O4Zr. Mole weight: 327.576g/mol. IUPAC Name: propan-1-olate;zirconium(4+). SMILES: CCC[O-].CCC[O-].CCC[O-].CCC[O-].[Zr+4]. InChI: InChI=1S/4C3H7O.Zr/c4*1-2-3-4;/h4*2-3H2,1H3;/q4*-1;+4. | |
| Zirconium nitride | Zirconium nitride. Alternative Names: ZRN;zirconiumnitride(zrn);Zirconiumnitridebrownpowder;ZIRCONIUM NITRIDE, 99+%, 1-2 MICRON POW&;ZIRCONIUM NITRIDE, -325 MESH;Zirconiumnitride,99.5%(metalsbasisexcludingHf),Hf;Zirconiumnitride,98%;ZRN GRADE A ZIRCONIUM NITRIDE: GRADE A. CAS No. 25658-42-8. Molecular formula: ZrN;NZr. Mole weight: 105.23g/mol. Purity: 99.5%. IUPAC Name: azanylidynezirconium. SMILES: N#[Zr]. InChI: InChI=1S/N.Zr. | |
| Zirconium oxide Aluminum oxide | Zirconium oxide Aluminum oxide. Molecular formula: ZrO2+Al2O3. Purity: 0.999. | |
| Zirconium oxide dichloride | Zirconium oxychloride appears as white or yellow silky odorless crystals.;Liquid; PelletsLargeCrystals. CAS No. 7699-43-6. Molecular formula: ZrOCl2;Cl2H2OZr. Mole weight: 180.14g/mol. IUPAC Name: oxozirconium;dihydrochloride. SMILES: O=[Zr].Cl.Cl. InChI: InChI=1S/2ClH.O.Zr/h2*1H; | |
| Zirconium oxide Tantalum Oxide | Zirconium oxide Tantalum Oxide. Molecular formula: ZrO2+Ta2O5. Purity: 0.9999. | |
| Zirconium oxide Titanium Oxide | Zirconium oxide Titanium Oxide. Molecular formula: ZrO2+Ti3O5. Purity: 0.9999. | |
| Zirconium oxide Yttrium oxide | Zirconium oxide Yttrium oxide. Molecular formula: ZrO2+Y2O3. Purity: 0.9999. | |
| Zirconium oxide/Yttrium oxide sputtering target, 76.2mm (3.0in) dia x 3.18mm (0.13in) thick, 99.9% (metals basis ex. Hf) | Zirconium oxide/Yttrium oxide sputtering target, 76.2mm (3.0in) dia x 3.18mm (0.13in) thick, 99.9% (metals basis ex. Hf). | |
| Zirconium oxide/Yttrium oxide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.25in) thick, 99.9% (metals basis ex. Hf) | Zirconium oxide/Yttrium oxide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.25in) thick, 99.9% (metals basis ex. Hf). | |
| Zirconium oxide Yttrium oxide substrate, 10x10x0.5mm, polished one side, 100 orientation | Zirconium oxide Yttrium oxide substrate, 10x10x0.5mm, polished one side, 100 orientation. | |
| Zirconium oxide Yttrium oxide substrate, 10x10x1mm, polished 2 sides, 100 orientation | Zirconium oxide Yttrium oxide substrate, 10x10x1mm, polished 2 sides, 100 orientation. | |
| Zirconium oxide Yttrium oxide substrate, 10x10x1mm, polished one side, 100 orientation | Zirconium oxide Yttrium oxide substrate, 10x10x1mm, polished one side, 100 orientation. | |
| Zirconyl chloride hydrate | Zirconyl chloride hydrate. Alternative Names: ZIRCONIUM DICHLORIDE OXIDE HYDRATE;ZIRCONIUM(IV)DICHLORIDE OXIDE HYDRATE;ZIRCONYL CHLORIDE HYDRATE;ZIRCONYL CHLORIDE HYDRATE, 99.99%;Zirconiumdichlorideoxide,Puratronic99.9985%(metalsbasis);ZIRCONYL CHLORIDE, OCTAHYDRATE 99.99+% (Low Hf);Zirconium(IV)dich. CAS No. 15461-27-5. Molecular formula: Cl2H4O2Zr. Mole weight: 198.16g/mol. IUPAC Name: oxozirconium;hydrate;dihydrochloride. SMILES: O.O=[Zr].Cl.Cl. InChI: InChI=1S/2ClH.H2O.O.Zr/h2*1H;1H2; | |
| ZnMgO quantum dots | ZnMgO quantum dots. | |
| ZSM-23 | ZSM-23. | |
| ZSM-35 | DryPowder; DryPowder, PelletsLargeCrystals; OtherSolid. CAS No. 1318-02-1. Molecular formula: Al2O5Si. Mole weight: 162.05g/mol. IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane. InChI: InChI=1S/2Al.O2Si.3O/c;;1-3-2;; | |
| ZSM-5 | ZSM-5. CAS No. 12173-28-3. | |
| ZSM-5 Sphere | ZSM-5 Sphere. CAS No. 12173-28-3. | |
| ZSM-5Strip | ZSM-5Strip. CAS No. 12173-28-3. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.