Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| 6-((trimethylsilyl)ethynyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine | 6-((trimethylsilyl)ethynyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine. Molecular formula: C13H17NOSi. Mole weight: 231.36g/mol. IUPAC Name: 2-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-6-yl)ethynyl-trimethylsilane. SMILES: C[Si](C)(C)C#CC1=CC2=C(N=C1)OCCC2. InChI: InChI=1S/C13H17NOSi/c1-16(2,3)8-6-11-9-12-5-4-7-15-13(12)14-10-11/h9-10H,4-5,7H2,1-3H3. |  |
| 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. Molecular formula: C13H18BNO4. Mole weight: 263.1g/mol. IUPAC Name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)OCCO3. InChI: InChI=1S/C13H18BNO4/c1-12(2)13(3,4)19-14(18-12)9-7-10-11(15-8-9)17-6-5-16-10/h7-8H,5-6H2,1-4H3. | |
| 7-Azaindole-5-boronic acid pinacol ester | 7-Azaindole-5-boronic acid pinacol ester. CAS No. 754214-56-7. Molecular formula: C13H17BN2O2. Mole weight: 244.1g/mol. IUPAC Name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine. SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC=C3)N=C2. InChI: InChI=1S/C13H17BN2O2/c1-12(2)13(3,4)18-14(17-12)10-7-9-5-6-15-11(9)16-8-10/h5-8H,1-4H3,(H,15,16). | |
| 7-Carboxy-1-heptanethiol | 7-Carboxy-1-heptanethiol. Alternative Names: 7-CARBOXY-1-HEPTANETHIOL;8-Mercaptooctanoic acid,8-Thiooctanoic acid, MOA;MOA;8-Mercaptooctanoic acid 95%. CAS No. 74328-61-3. Molecular formula: C8H16O2S. Mole weight: 176.27644. Purity: 96%. IUPAC Name: 8-sulfanyloctanoic acid. SMILES: C(CCCC(=O)O)CCCS. | |
| 7-Chloro-5-Iodo-1-(Triisopropylsilyl)-1H-Pyrrolo[2,3-C]Pyridine | 7-Chloro-5-Iodo-1-(Triisopropylsilyl)-1H-Pyrrolo[2,3-C]Pyridine. CAS No. 1198097-05-0. Molecular formula: C16H24ClIN2Si. Mole weight: 434.82g/mol. Purity: 0.95. IUPAC Name: (7-chloro-5-iodopyrrolo[2,3-c]pyridin-1-yl)-tri(propan-2-yl)silane. SMILES: CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=CC(=NC(=C21)Cl)I. InChI: InChI=1S/C16H24ClIN2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-9-14(18)19-16(17)15(13)20/h7-12H,1-6H3. | |
| 7-Chloro-8-(trimethylsilyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine | 7-Chloro-8-(trimethylsilyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. Molecular formula: C10H14ClNO2Si. Mole weight: 243.76g/mol. IUPAC Name: (7-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-8-yl)-trimethylsilane. SMILES: C[Si](C)(C)C1=C2C(=NC=C1Cl)OCCO2. InChI: InChI=1S/C10H14ClNO2Si/c1-15(2,3)9-7(11)6-12-10-8(9)13-4-5-14-10/h6H,4-5H2,1-3H3. | |
| 7-fluoro-2-methylquinolin-8-ylboronic acid | 7-fluoro-2-methylquinolin-8-ylboronic acid. | |
| 7-((Trimethylsilyl)ethynyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine | 7-((Trimethylsilyl)ethynyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. Molecular formula: C12H15NO2Si. Mole weight: 233.34g/mol. IUPAC Name: 2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)ethynyl-trimethylsilane. SMILES: C[Si](C)(C)C#CC1=CC2=C(N=C1)OCCO2. InChI: InChI=1S/C12H15NO2Si/c1-16(2,3)7-4-10-8-11-12(13-9-10)15-6-5-14-11/h8-9H,5-6H2,1-3H3. | |
| 8-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine | 8-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. Molecular formula: C13H18BNO4. Mole weight: 263.1g/mol. IUPAC Name: 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. SMILES: B1(OC(C(O1)(C)C)(C)C)C2=C3C(=NC=C2)OCCO3. InChI: InChI=1S/C13H18BNO4/c1-12(2)13(3,4)19-14(18-12)9-5-6-15-11-10(9)16-7-8-17-11/h5-6H,7-8H2,1-4H3. | |
| 8-Amino-1-octanethiol hydrochloride | 8-Amino-1-octanethiol hydrochloride. CAS No. 937706-44-0. | |
| 8arm-PEG10K 7arm-OH, 1arm-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 10000. | |
| 8arm-PEG10K 7arm-OH, 1arm-COOH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG 7arm-OH, 1arm-COOH, tripentaerythritol core, 8arm PEG, 7arm-Hydroxyl, 1arm-Carboxyl. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-COOH, hexaglycerol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-COOH, hexaglycerol core, 8arm-PEG-COOH. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-COOH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-COOH, tripentaerythritol core, 8arm-PEG-COOH. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-Maleimide | 8arm-PEG10K-Maleimide. | |
| 8-arm PEG10K-Methacrylate (hexaglycerol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 10000. | |
| 8-arm PEG10K-Methacrylate (tripentaerythritol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-NH2, hexaglycerol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-NH2, hexaglycerol core, 8arm-PEG-NH2. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-NH2, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-NH2, 8arm-PEG-NH2, tripentaerythritol core. Mole weight: average Mn 10000. | |
| 8-arm PEG10K-PCL2K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. | |
| 8-arm PEG10K-PLA2K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. | |
| 8arm-PEG10K-SH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-SH. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-SH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-SH, tripentaerythritol core, 8arm-PEG-SH. Mole weight: average Mn 10000. | |
| 8arm-PEG10K-Succinimidyl Glutarate | 8arm-PEG10K-Succinimidyl Glutarate. | |
| 8arm-PEG10K-Succinimidyl Succinate | 8arm-PEG10K-Succinimidyl Succinate. | |
| 8arm-PEG10K-Vinylsulfone, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-VS, 8arm-PEG-Vinylsulfone, tripentaerythritol core. Mole weight: average Mn 10000. | |
| 8arm-PEG15K-Succinimidyl Glutarate | 8arm-PEG15K-Succinimidyl Glutarate. | |
| 8arm-PEG15K-Succinimidyl Succinate | 8arm-PEG15K-Succinimidyl Succinate. | |
| 8arm-PEG20K 7arm-OH, 1arm-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 20000. | |
| 8arm-PEG20K 7arm-OH, 1arm-COOH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG 7arm-OH, 1arm-COOH, tripentaerythritol core, 8arm PEG, 7arm-Hydroxyl, 1arm-Carboxyl. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-Acrylate, hexaglycerol core. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-COOH. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-COOH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-COOH, tripentaerythritol core, 8arm-PEG-COOH. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-Maleimide | 8arm-PEG20K-Maleimide. | |
| 8arm-PEG20K-NH2, hexaglycerol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-NH2, hexaglycerol core, 8arm-PEG-NH2. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-NH2, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-NH2, 8arm-PEG-NH2, tripentaerythritol core. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-Norbornene, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-Norbornene, tripentaerythritol core, 8arm-PEG-NB. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-SH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-SH. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-SH, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-SH, tripentaerythritol core, 8arm-PEG-SH. Mole weight: average Mn 20000. | |
| 8arm-PEG20K-Succinimidyl Glutarate | 8arm-PEG20K-Succinimidyl Glutarate. | |
| 8arm-PEG20K-Succinimidyl Succinate | 8arm-PEG20K-Succinimidyl Succinate. | |
| 8arm-PEG20K-Vinylsulfone, tripentaerythritol core | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-VS, 8arm-PEG-Vinylsulfone, tripentaerythritol core. Mole weight: average Mn 20000. | |
| 8arm-PEG40K-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-COOH. Mole weight: average Mn 40000. | |
| 8arm-PEG40K-Maleimide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-Maleimide. Mole weight: average Mn 40000. | |
| 8arm-PEG40K-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: 8arm-PEG-NH2. Mole weight: average Mn 40000. | |
| 8arm-PEG40K-Succinimidyl Glutarate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 40000. | |
| 8arm-PEG40K-Succinimidyl Succinate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 40000. | |
| 8-arm PEG5K-Acrylate (hexaglycerol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 5000. | |
| 8-arm PEG5K-Acrylate (tripentaerythritol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 5000. | |
| 8-arm PEG5K-Methacrylate (hexaglycerol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 5000. | |
| 8-arm PEG5K-Methacrylate (tripentaerythritol core) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 5000. | |
| 8-arm PEG5K-PCL1K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. | |
| 8-arm PEG5K-PLA1K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Purity: ≥95%. | |
| (8-Methoxy-2-methylquinolin-5-yl)boronic acid trihydrate | (8-Methoxy-2-methylquinolin-5-yl)boronic acid trihydrate. Molecular formula: C11H18BNO6. Mole weight: 271.08g/mol. IUPAC Name: (8-methoxy-2-methylquinolin-5-yl)boronic acid;trihydrate. SMILES: B(C1=C2C=CC(=NC2=C(C=C1)OC)C)(O)O.O.O.O. InChI: InChI=1S/C11H12BNO3.3H2O/c1-7-3-4-8-9(12(14)15)5-6-10(16-2)11(8)13-7;;;/h3-6,14-15H,1-2H3;3*1H2. | |
| 8-Quinolinylboronic acid | 8-Quinolinylboronic acid. CAS No. 86-58-8. Molecular formula: C9H8BNO2. Mole weight: 172.98g/mol. IUPAC Name: quinolin-8-ylboronic acid. SMILES: B(C1=C2C(=CC=C1)C=CC=N2)(O)O. InChI: InChI=1S/C9H8BNO2/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6,12-13H. | |
| 8-((Trimethylsilyl)Ethynyl)-2,3-Dihydro-[1,4]Dioxino[2,3-B]Pyridine | 8-((Trimethylsilyl)Ethynyl)-2,3-Dihydro-[1,4]Dioxino[2,3-B]Pyridine. CAS No. 1246088-47-0. Molecular formula: C12H15NO2Si. Mole weight: 233.34g/mol. Purity: 0.95. IUPAC Name: 2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-8-yl)ethynyl-trimethylsilane. SMILES: C[Si](C)(C)C#CC1=C2C(=NC=C1)OCCO2. InChI: InChI=1S/C12H15NO2Si/c1-16(2,3)9-5-10-4-6-13-12-11(10)14-7-8-15-12/h4,6H,7-8H2,1-3H3. | |
| 9,10-Anthracenediboronic acid bis(pinacol) ester | 9,10-Anthracenediboronic acid bis(pinacol) ester is an anthracene based ester that has a conjugated structure. It is an electron rich building block that can be used as an electron donating molecule in the formation of donor-acceptor based organic semiconductor devices. Its planarity and rigid molecular structure allow it to have good charge transporting properties. Alternative Names: 9,10-Bis(4,4,5,5-tetramethyl[1.3.2]dioxaborolan-2-yl)anthracene. CAS No. 863992-56-7. Molecular formula: C26H32B2O4. Mole weight: 430.15. Purity: ≥ 97%. IUPAC Name: 4,4,5,5-tetramethyl-2-[10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-yl]-1,3,2-dioxaborolane. SMILES: CC1(C)OB(OC1(C)C)c2c3ccccc3c(B4OC(C)(C)C(C)(C)O4)c5ccccc25. InChI: 1S/C26H32B2O4/c1-23(2)24(3,4)30-27(29-23)21-17-13-9-11-15-19(17)22(20-16-12-10-14-18(20)21)28-31-25(5,6)26(7,8)32-28/h9-16H,1-8H3. | |
| 9,9-Bis[4-(2-hydroxyethoxy)phenyl]fluorene | 9,9-Bis[4-(2-hydroxyethoxy)phenyl]fluorene. CAS No. 117344-32-8. Molecular formula: C29H26O4. Mole weight: 438.5g/mol. IUPAC Name: 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol. SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC=C(C=C4)OCCO)C5=CC=C(C=C5)OCCO. InChI: InChI=1S/C29H26O4/c30-17-19-32-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)33-20-18-31)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-16,30-31H,17-20H2. | |
| 9,9-Di(2-ethylhexyl)fluorene-2,7-diboronic acid bis(1,3-propanediol) ester solution | 9,9-Di(2-ethylhexyl)fluorene-2,7-diboronic acid bis(1,3-propanediol) ester solution. Alternative Names: 9,9-Di(2'-ethylhexyl)fluorene-2,7-bis(trimethylene borate) solution. CAS No. 344782-49-6. Molecular formula: C35H52B2O6. Mole weight: 558.41. Purity: ≥ 97%. IUPAC Name: 2-[7-(1,3,2-dioxaborinan-2-yloxy)-9,9-bis(2-ethylhexyl)fluoren-2-yl]oxy-1,3,2-dioxaborinane. SMILES: CCCCC(CC)CC1(CC(CC)CCCC)c2cc(ccc2-c3ccc(cc13)B4OCCCO4)B5OCCCO5. InChI: 1S/C35H52B2O4/c1-5-9-13-27(7-3)25-35(26-28(8-4)14-10-6-2)33-23-29(36-38-19-11-20-39-36)15-17-31(33)32-18-16-30(24-34(32)35)37-40-21-12-22-41-37/h15-18,23-24,27-28H,5-14,19-22,25-26H2,1-4H3. | |
| 9,9-Didodecylfluorene-2,7-diboronic acid | 9,9-Didodecylfluorene-2,7-diboronic acid. CAS No. 480424-86-0. Molecular formula: C37H60B2O4. Mole weight: 590.5g/mol. IUPAC Name: (7-borono-9,9-didodecylfluoren-2-yl)boronic acid. SMILES: B(C1=CC2=C(C=C1)C3=C(C2(CCCCCCCCCCCC)CCCCCCCCCCCC)C=C(C=C3)B(O)O)(O)O. InChI: InChI=1S/C37H60B2O4/c1-3-5-7-9-11-13-15-17-19-21-27-37(28-22-20-18-16-14-12-10-8-6-4-2)35-29-31(38(40)41)23-25-33(35)34-26-24-32(39(42)43)30-36(34)37/h23-26,29-30,40-43H,3-22,27-28H2,1-2H3. | |
| 9,9-Dihexylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester | 9,9-Dihexylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester. CAS No. 250597-29-6. Molecular formula: C31H44B2O4. Mole weight: 502.3g/mol. IUPAC Name: 2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dihexylfluoren-2-yl]-1,3,2-dioxaborinane. SMILES: B1(OCCCO1)C2=CC3=C(C=C2)C4=C(C3(CCCCCC)CCCCCC)C=C(C=C4)B5OCCCO5. InChI: InChI=1S/C31H44B2O4/c1-3-5-7-9-17-31(18-10-8-6-4-2)29-23-25(32-34-19-11-20-35-32)13-15-27(29)28-16-14-26(24-30(28)31)33-36-21-12-22-37-33/h13-16,23-24H,3-12,17-22H2,1-2H3. | |
| 9,9-Dioctyl-9H-fluoren-2-amine | 9,9-Dioctyl-9H-fluoren-2-amine. Alternative Names: 2-Amino-9,9-dioctylfluorene. CAS No. 959417-85-7. Mole weight: 405.66. | |
| 9,9-Dioctylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester | It's an aryl boronate ester. Arylboronic acids may be prepared by hydrolysis of boronate esters, and consequently many other boronic acid derivatives (e.g., organotrifluoroborates) are derived. Alternative Names: 9,9-Dioctylfluorene-2,7-bis(trimethylborate). CAS No. 317802-08-7. Molecular formula: C3H6O2BC6H3C(C8H17)2C6H3BO2C3H6. Mole weight: 558.41. Purity: ≥ 97%. IUPAC Name: 2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dioctylfluoren-2-yl]-1,3,2-dioxaborinane. SMILES: CCCCCCCCC1(CCCCCCCC)c2cc(ccc2-c3ccc(cc13)B4OCCCO4)B5OCCCO5. InChI: 1S/C35H52B2O4/c1-3-5-7-9-11-13-21-35(22-14-12-10-8-6-4-2)33-27-29(36-38-23-15-24-39-36)17-19-31(33)32-20-18-30(28-34(32)35)37-40-25-16-26-41-37/h17-20,27-28H,3-16,21-26H2,1-2H3. | |
| 9-Anthraceneboronic acid | 9-Anthraceneboronic acid. Alternative Names: 9-ANTHRACENEBORONIC ACID;ANTHRACENE-9-BORONIC ACID;9-Anthracenylboronic acid;9-Anthrylboronicacid;9-Boronoanthracene;9-Anthracenylboronicacid,9-Anthrylboronicacid;Anthracen-9-ylboronic acid;9-Anthracenylboronic. CAS No. 100622-34-2. Molecular formula: C14H11BO2. Mole weight: 222.05. Purity: 98%. IUPAC Name: anthracen-9-ylboronic acid. SMILES: B(C1=C2C=CC=CC2=CC3=CC=CC=C13)(O)O. | |
| 9-Fluorenylmethylthiol | 9-Fluorenylmethylthiol. CAS No. 957753-00-3. Molecular formula: C14H12S. Mole weight: 212.31g/mol. IUPAC Name: 9H-fluoren-9-ylmethanethiol. SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)CS. InChI: InChI=1S/C14H12S/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14-15H,9H2. | |
| 9-Phenanthrenylboronic acid MIDA ester | 9-Phenanthrenylboronic acid MIDA ester. Molecular formula: C19H16BNO4. Mole weight: 333.1g/mol. IUPAC Name: 6-methyl-2-phenanthren-9-yl-1,3,6,2-dioxazaborocane-4,8-dione. SMILES: B1(OC(=O)CN(CC(=O)O1)C)C2=CC3=CC=CC=C3C4=CC=CC=C24. InChI: InChI=1S/C19H16BNO4/c1-21-11-18(22)24-20(25-19(23)12-21)17-10-13-6-2-3-7-14(13)15-8-4-5-9-16(15)17/h2-10H,11-12H2,1H3. | |
| Acetamidinium Iodide | Acetamidinium Iodide. Alternative Names: 1-aminoethaniminium Iodide. Molecular formula: C2H7IN2. Mole weight: 185.99 g/mol. IUPAC Name: 1-aminoethylideneazanium;iodide. SMILES: CC(=[NH2+])N.[I-]. InChI: InChI=1S/C2H6N2.HI/c1-2(3)4;/h1H3,(H3,3,4);1H. | |
| Acetyl-β-cyclodextrin | Acetyl-β-cyclodextrin. | |
| Acetylene-1,2-diyl bis(boronic acid pinacol ester) | Acetylene-1,2-diyl bis(boronic acid pinacol ester). CAS No. 1010840-17-1. Molecular formula: C14H24B2O4. Mole weight: 278g/mol. IUPAC Name: 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]-1,3,2-dioxaborolane. SMILES: B1(OC(C(O1)(C)C)(C)C)C#CB2OC(C(O2)(C)C)(C)C. InChI: InChI=1S/C14H24B2O4/c1-11(2)12(3,4)18-15(17-11)9-10-16-19-13(5,6)14(7,8)20-16/h1-8H3. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.