Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Lithium bromide | Lithium bromide. Alternative Names: LITHIUM BROMIDE HYDRATE;LITHIUM BROMIDE, HYDROUS;LITHIUM BROMIDE MONOHYDRATE;LITHIUM BROMIDE HYDRATE, 99.999%;lithium bromide hydrate, puratronic;Lithium bromide;Lithium bromide hydrate, Puratronic(R), 99.995% (metals basis);Lithium bromide hydrate, Purat. CAS No. 85017-82-9. Molecular formula: BrLi. Mole weight: 86.85. Purity: 96%. IUPAC Name: lithium;bromide;hydrate. SMILES: [Li+].O.[Br-]. |  |
| Lithium Carbonate | Lithium Carbonate is a water insoluble Lithium source that can easily be converted to other Lithium compounds, such as the oxide by heating (calcination). Carbonate compounds also give off carbon dioxide when treated with dilute acids. Lithium Carbonate is generally immediately available in most volumes. Alternative Names: Quilonum retard. CAS No. 554-13-2. Molecular formula: Li2CO3. Mole weight: 73.9. Purity: 99%+. IUPAC Name: Dilithium;carbonate. SMILES: [Li+].[Li+].C(=O)([O-])[O-]. InChI: InChI=1S/CH2O3.2Li/c2-1(3)4;/h(H2,2,3,4);/q;2*+1/p-2. | |
| Lithium chloride hydrate | Lithium chloride hydrate. Alternative Names: LITHIUM CHLORIDE 1-HYDRATE;LITHIUM CHLORIDE, GAMMA IRRADIATED, 8M;LITHIUM CHLORIDE MONOHYDRATE;Lithium chloride hydrate, 99.99+% metals basis;hydrate/monohydrateortrihydrate;Lithium hcloride monohydrate;lithium chloride hydrate, puratronic;Lithium chlorid. CAS No. 85144-11-2. Molecular formula: ClH2LiO. Mole weight: 60.41. Purity: 96%. IUPAC Name: (4-methylcyclohexyl)sulfanylmethylbenzene. | |
| Lithium chloride/potassium chloride eutectic | Lithium chloride/potassium chloride eutectic. CAS No. 65567-96-6. Molecular formula: Cl2KLi. Mole weight: 117g/mol. IUPAC Name: lithium;potassium;dichloride. SMILES: [Li+].[Cl-].[Cl-].[K+]. InChI: InChI=1S/2ClH.K.Li/h2*1H;;/q;;2*+1/p-2. | |
| Lithium cobalt(III) oxide | DryPowder. CAS No. 12190-79-3. Molecular formula: LiCoO2;CoLiO2. Mole weight: 97.9g/mol. IUPAC Name: lithium;oxido(oxo)cobalt. SMILES: [Li+].[O-][Co]=O. InChI: InChI=1S/Co.Li.2O/q;+1;;-1. | |
| Lithium cobalt phosphate | Lithium cobalt phosphate. CAS No. 13824-63-0. Molecular formula: CoLiO4P. Mole weight: 160.9g/mol. IUPAC Name: lithium;cobalt(2+);phosphate. SMILES: [Li+].[O-]P(=O)([O-])[O-].[Co+2]. InChI: InChI=1S/Co.Li.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q+2;+1;/p-3. | |
| Lithium Difluoro(oxalato)borate | Lithium Difluoro(oxalato)borate (LiDFOB) is a high performance lithium ion battery electrolyte material with similar properties to lithium tetrafluoroborate (LiBF4) and lithium bis(oxalato)borate (LiBOB). Alternative Names: LIF2OB, LIFOB, LIODFB, Lithium difluoro(ethanedioato)borate, Lithium oxalate difluoroborate, Lithium oxalatodigluoroborate, lithium difluoro-oxalatoborate. CAS No. 409071-16-5. Molecular formula: LiBF2(C2O4). Mole weight: 143.77000000000001. IUPAC Name: lithium;2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione. SMILES: [Li+].[B-]1(OC(=O)C(=O)O1)(F)F. InChI: [Li+].[B-]1(OC(=O)C(=O)O1)(F)F. | |
| Lithium diisobutyl-tert-butoxyaluminum hydride solution | Lithium diisobutyl-tert-butoxyaluminum hydride solution. CAS No. 77299-63-9. Molecular formula: C12H27AlLiO. Mole weight: 221.3g/mol. SMILES: [Li+].CC(C)C[Al-](CC(C)C)OC(C)(C)C. InChI: InChI=1S/C4H9O.2C4H9.Al.Li/c1-4(2,3)5;2*1-4(2)3;;/h1-3H3;2*4H,1H2,2-3H3;;/q-1;;;;+1. | |
| Lithium fluoride | OtherSolid. CAS No. 7789-24-4. Molecular formula: FLi;FLi. Mole weight: 26g/mol. IUPAC Name: lithium;fluoride. SMILES: [Li+].[F-]. InChI: InChI=1S/FH.Li/h1H;/q;+1/p-1. | |
| Lithium (fluorosulfonyl)(trifluoromethanesulfonyl)imide | Lithium (fluorosulfonyl)(trifluoromethanesulfonyl)imide. Alternative Names: Lithium;fluorosulfonyl(trifluoromethylsulfonyl)azanide. CAS No. 192998-62-2. Molecular formula: CF4LiNO4S2. Mole weight: 237.07. Purity: 95%+. IUPAC Name: lithium;fluorosulfonyl(trifluoromethylsulfonyl)azanide. SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)F. InChI: InChI=1S/CF4NO4S2.Li/c2-1(3,4)11(7,8)6-12(5,9)10;/q-1;+1. | |
| Lithium hexafluorophosphate solution | Lithium hexafluorophosphate solution. | |
| Lithium Iodide | Lithium Iodide. Alternative Names: Lithium monoiodide. CAS No. 10377-51-2. Molecular formula: LiI. Mole weight: 133.9. Purity: 99%+. IUPAC Name: Lithium;iodide. SMILES: [Li+].[I-]. InChI: InChI=1S/HI.Li/h1H;/q;+1/p-1. | |
| Lithium Iodide Hydrate | Lithium Iodide Hydrate is generally immediately available in most volumes. Alternative Names: Llithium iodide trihydrate. CAS No. 85017-80-7. Molecular formula: LiI ·xH2O. Mole weight: 151.9. Purity: 99%+. IUPAC Name: Lithium;iodide;hydrate. SMILES: [Li+].O.[I-]. InChI: InChI=1S/HI.Li.H2O/h1H;1H2/q;+1;/p-1. | |
| Lithium Iron(III) Oxide | Lithium Iron(III) Oxide is generally immediately available in most volumes. High purity, submicron and nanopowder forms may be considered. Alternative Names: Lithium ferrite; Lithium oxido(oxo)iron. CAS No. 12022-46-7. Molecular formula: FeLiO2. Mole weight: 94.78. Purity: 99%|99.9%|99.99%|99.999%. IUPAC Name: lithium;iron(3+);oxygen(2-). SMILES: [Li+].[O-2].[O-2].[Fe+3]. InChI: InChI=1S/Fe.Li-C.2O/q;+1;;-1. | |
| Lithium iron(II) phosphate | Lithium iron(II) phosphate. CAS No. 15365-14-7. Molecular formula: FeLiO4P;FeLiO4P. Mole weight: 157.8g/mol. IUPAC Name: lithium;iron(2+);phosphate. SMILES: [Li+].[O-]P(=O)([O-])[O-].[Fe+2]. InChI: InChI=1S/Fe.Li.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q+2;+1;/p-3. | |
| Lithium manganese(III,IV) oxide | Lithium manganese(III,IV) oxide. CAS No. 12057-17-9. | |
| Lithium manganese nickel oxide | Lithium manganese nickel oxide. Molecular formula: Li2Mn2Ni2O5. Mole weight: 321.2g/mol. IUPAC Name: dilithium;manganese(2+);nickel(2+);oxygen(2-). SMILES: [Li+].[Li+].[O-2].[O-2].[O-2].[O-2].[O-2].[Mn+2].[Mn+2].[Ni+2].[Ni+2]. InChI: InChI=1S/2Li.2Mn.2Ni.5O/q2*+1;4*+2;5*-2. | |
| Lithium manganese oxide | Lithium manganese oxide. CAS No. 12057-17-9. | |
| Lithium Manganese Oxide | Lithium Manganese Oxide. Purity: >99.9%. | |
| Lithium nickel cobalt aluminium oxide | Lithium nickel cobalt aluminium oxide. | |
| Lithium nickel cobalt aluminium oxide | Lithium nickel cobalt aluminium oxide. CAS No. 193214-24-3. | |
| Lithium Nickel Cobalt Oxide | Lithium Nickel Cobalt Oxide (LNCO) is a two-dimensional positive electrode material used in the newest generarion of lithium-ion batteries. LNCO is highly thermally stable and exhibits high cell voltage and intercalaction reversibility. Lithium Nickel Cobalt Oxide is generally immediately available in most volumes. Alternative Names: LNCO, LiNiCoO, LiNiCoO2, LiNi1-xCoxO2. CAS No. 113066-89-0. Molecular formula: LiNi1-xCoxO2. Mole weight: 365.38. Purity: 99%|99.9%|99.99%|99.999%. InChI: InChI=1S/Co.Li.Ni.O/q+2;;;-2. | |
| Lithium Nickel Dioxide | Lithium Nickel Dioxide (LNO) is a cathode material for use in the newest generarion of lithium-ion batteries and is available in both submicron and nanopowder forms. Alternative Names: Lithium nickel oxide, Lithium nickelate, lithium oxido(oxo)nickel, LNO, CAS 12325-84-7. CAS No. 12031-65-1. Molecular formula: LiNO2. Mole weight: 97.63. Purity: 99%|99.9%|99.99%|99.999%. InChI: InChI=1S/Li.Ni.2O/q+1;;;-1. | |
| Lithium nickel manganese cobalt oxide | Lithium nickel manganese cobalt oxide. | |
| Lithium Nickel Manganese Cobalt Oxide | Lithium Nickel Manganese Cobalt Oxide (NMC, or LiNiMnCo) is a highly thermally stable electrode material used in the newest generation of rechargeable lithium-ion batteries. Alternative Names: NMC, NCM, LiNiMnCo, Li[NiMnCo]O2, LiNi0.33Mn0.33Co0.33O2, CAS 182442-95-1, EC 695-690-9, Cobalt lithium manganese nickel oxide, lini0.8co0.1mn0.1o2, linicomno2, NMC333, NMC 333, NMC 532, NMC 622, NMC 811. CAS No. 346417-97-8. Molecular formula: LiNixMnyCozO2. Mole weight: Variesbycomposition. Purity: 99%|99.9%|99.99%|99.999%. | |
| Lithium Nonafluoro-1-butanesulfonate | Lithium Nonafluoro-1-butanesulfonate. Alternative Names: Lithium Perfluoro-1-butanesulfonate. CAS No. 131651-65-5. Molecular formula: C4F9LiO3S. Mole weight: 306.02999999999997. Purity: >95.0%(T). IUPAC Name: lithium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate. SMILES: [Li+].C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(C(F)(F)F)(F)F. InChI: InChI=1S/C4HF9O3S.Li/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;/h(H,14,15,16);/q;+1/p-1. | |
| Lithium Nonafluoro-1-butanesulfonate, ≥95% | Lithium Nonafluoro-1-butanesulfonate, ≥95%. CAS No. 131651-65-5. Molecular formula: C4F9LiO3S. Mole weight: 306.1g/mol. IUPAC Name: lithium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate. SMILES: [Li+].C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(C(F)(F)F)(F)F. InChI: InChI=1S/C4HF9O3S.Li/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;/h(H,14,15,16);/q;+1/p-1. | |
| Lithium phosphate | DryPowder. Alternative Names: Phosphoricacid,trilithiumsalt. CAS No. 10377-52-3. Molecular formula: Li3O4P. Mole weight: 115.9. Purity: 99%+. IUPAC Name: Trilithium;phosphate. SMILES: [Li+].[Li+].[Li+].[O-]P(=O)([O-])[O-]. InChI: InChI=1S/3Li.H3O4P/c;1-5(2,3)4/h;(H3,1,2,3,4)/q3*+1;/p-3. | |
| Lithium Phosphate Monobasic | Lithium Phosphate Monobasic is generally immediately available in most volumes. Alternative Names: Monolithium phosphate; Lithium dihydrogen orthophosphate; Lithium dihydrophosphate; Lithium dihydrogenorthophosphate. CAS No. 13453-80-0. Molecular formula: LiH2PO4. Mole weight: 103.93. Purity: 99%|99.9%|99.99%|99.999%. IUPAC Name: lithium;dihydrogen phosphate. SMILES: [Li+].OP(=O)(O)[O-]. InChI: InChI=1S/Li.H3O4P/c;1-5(2,3)4/h;(H3,1,2,3,4)/q+1;/p-1. | |
| Lithium Pyruvate Monohydrate [Guaranteed for Standard to GOT, GPT] | Lithium Pyruvate Monohydrate [Guaranteed for Standard to GOT, GPT]. Alternative Names: Pyruvic Acid Lithium Salt Monohydrate. CAS No. 2922-61-4. Molecular formula: C3H3LiO3.H2O. Mole weight: 112.01. Purity: >95.0%(T). IUPAC Name: lithium;2-oxopropanoate. SMILES: [Li+].CC(=O)C(=O)[O-]. InChI: InChI=1S/C3H4O3.Li/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1. | |
| Lithium tetraborate | Lithium tetraborate. Alternative Names: Boric acid dilithium salt. CAS No. 12007-60-2. Molecular formula: B4Li2O7. Mole weight: 169.2. Purity: 99%+. IUPAC Name: Dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxyborinate. SMILES: [Li+].[Li+].B(=O)OB([O-])OB([O-])OB=O. InChI: InChI=1S/B4O7.2Li/c5-1-9-3(7)11-4(8)10-2-6;/q-2;2*+1. | |
| Lithium tetrachloroaurate(iII)99.995% | Lithium tetrachloroaurate(iII)99.995%. Alternative Names: LITHIUM TETRACHLOROAURATE(III)99.995%. CAS No. 3145-91-3. Molecular formula: AuCl4Li. Mole weight: 345.71955. Purity: 96%. IUPAC Name: lithium;tetrachlorogold(1-). SMILES: [Li+].Cl[Au-](Cl)(Cl)Cl. | |
| Lithium Tetrafluoroborate | Lithium Tetrafluoroborate is generally immediately available in most volumes. Alternative Names: Lithium boridefluoride. CAS No. 14283-07-9. Molecular formula: LiBF4. Mole weight: 93.8. Purity: 99%+. IUPAC Name: Lithium;tetrafluoroborate. SMILES: [Li+].[B-](F)(F)(F)F. InChI: InChI=1S/BF4.Li/c2-1(3,4)5;/q-1;+1. | |
| Lithium titanate | Lithium titanate. Molecular formula: Li2O3Ti. Mole weight: 109.8g/mol. IUPAC Name: dilithium;dioxido(oxo)titanium. SMILES: [Li+].[Li+].[O-][Ti](=O)[O-]. InChI: InChI=1S/2Li.3O.Ti/q2*+1;;2*-1. | |
| Lithium Trifluoromethanesulfonate | Lithium Trifluoromethanesulfonate. Alternative Names: Lithium triflate. CAS No. 33454-82-9. Molecular formula: CF3LiO3S. Mole weight: 156. Purity: 99%+. IUPAC Name: Lithium;trifluoromethanesulfonate. SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[O-]. InChI: InChI=1S/CHF3O3S.Li/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1. | |
| Lithium(trimethylsilyl)acetylide | Lithium(trimethylsilyl)acetylide. Alternative Names: (Trimethylsilyl)ethynyllithium, Lithium (trimethylsilyl)acetylide solution, 54655-07-1, AC1MP96Y, 335452_ALDRICH, lithium (trimethylsilyl)ethynide, lithium ethynyl(trimethyl)silane, CTK3J1052, AKOS000121171, AKOS015950607, I14-17205. CAS No. 54655-07-1. Molecular formula: C5H9LiSi. Mole weight: 104.15. Purity: 96%. IUPAC Name: lithium;ethynyl(trimethyl)silane. SMILES: [Li+].C[Si](C)(C)C#[C-]. | |
| Low endotoxin gelatin from porcine skin | Gelatin is a protein product obtained from the degradation of collagen. It is almost odorless and tasteless. It absorbs water and swells in cold water, and can swell to 5 to 12 times its original weight. Soluble in hot water, glycerol and acetic acid, insoluble in ethanol, ether, chloroform and other organic solvents. It can be stored for a long time in dry conditions, and it is easily deteriorated by bacteria when exposed to moisture in humid air. Gelatin is a kind of macromolecular hydrophilic colloid, which is partially degraded by collagen in connective tissues such as animal skin, bone, sarcolemma, and muscle to become white or light yellow, translucent, slightly glossy flakes or powders. Gelatin is widely used in food, pharmaceutical and chemical industries. CAS No. 9000-70-8. Mole weight: ≤ 6500. Purity: ≥70 % protein basis (biuret). | |
| Magnesium,[1,1'-biphenyl]-3-ylbromo- | Magnesium,[1,1'-biphenyl]-3-ylbromo-. Alternative Names: 3-Biphenylmagnesium bromide, AKOS015909157, I14-34005, 103068-18-4. CAS No. 103068-18-4. Molecular formula: C12H9BrMg. Mole weight: 257.41. Purity: 96%. IUPAC Name: magnesium;phenylbenzene;bromide. SMILES: C1=CC=C(C=C1)C2=C[C-]=CC=C2.[Mg+2].[Br-]. | |
| Magnesium,[3,5-bis(trifluoromethyl)phenyl]bromo- | Magnesium,[3,5-bis(trifluoromethyl)phenyl]bromo-. Alternative Names: Magnesium,[3,5-bis(trifluoromethyl)phenyl]bromo-, 112981-69-8, 3,5-Bis(trifluoromethyl)phenylmagnesium bromide solution, ACMC-20mhbp, 639052_ALDRICH, CTK4A8065, AKOS015908861, AG-D-32561, I14-34207, 3,5-Bis(trifluoromethyl)phenylmagnesium bromide solution. CAS No. 112981-69-8. Molecular formula: C8H3BrF6Mg. Mole weight: 317.3088392. Purity: 96%. IUPAC Name: magnesium;1,3-bis(trifluoromethyl)benzene-5-ide;bromide. SMILES: C1=[C-]C=C(C=C1C(F)(F)F)C(F)(F)F.[Mg+2].[Br-]. | |
| Magnesium Borohydride Dimethylsulfide Complex | Magnesium Borohydride Dimethylsulfide Complex is generally immediately available in most volumes. Molecular formula: Mg(BH4)2 · x(CH3)2S. Mole weight: 108.1g/mol. Purity: 99% | 99.9% | 99.99% | 99.999%. SMILES: [B-].[B-].CSC.[Mg+2]. InChI: InChI=1S/C2H6S.2B.Mg/c1-3-2;;;/h1-2H3;;;/q;2*-1;+2. | |
| Magnesium bromide diethyl etherate | Magnesium bromide diethyl etherate. Alternative Names: MGBR2 NOET2;MAGNESIUM BROMIDE DIETHYL ETHERATE;MAGNESIUM BROMIDE ETHYL ETHERATE;Magnesium, dibromo1,1-oxybisethane-;Magnesium bromide ethyl etherate,99%;MagnesiuM broMide ethyl etherate, 99% 100GR;MagnesiuM broMide ethyl etherate, 99% 25GR;MagnesiuM broMi. CAS No. 29858-07-9. Molecular formula: C4H10Br2MgO. Mole weight: 258.24g/mol. IUPAC Name: magnesium;ethoxyethane;dibromide. SMILES: CCOCC.[Mg+2].[Br-].[Br-]. InChI: InChI=1S/C4H10O.2BrH.Mg/c1-3-5-4-2;;;/h3-4H2,1-2H3;2*1H;/q;;;+2/p-2. | |
| Magnesium,bromo(1,3-dioxolan-2-ylmethyl)- | Magnesium,bromo(1,3-dioxolan-2-ylmethyl)-. Alternative Names: (1,3-Dioxolan-2-ylmethyl)magnesium bromide solution, 472611_ALDRICH, AKOS015909032, 38177A, I14-33281, 180675-22-3. CAS No. 180675-22-3. Molecular formula: C4H7BrMgO2. Mole weight: 191.31. Purity: 96%. IUPAC Name: magnesium;2-methanidyl-1,3-dioxolane;bromide. SMILES: [CH2-]C1OCCO1.[Mg+2].[Br-]. | |
| Magnesium,bromo-1-naphthalenyl- | Magnesium,bromo-1-naphthalenyl-. Alternative Names: 1-Naphthylmagnesium bromide solution, 703-55-9, 561673_ALDRICH, AKOS016017848, 1-Naphthylmagnesium bromide 0.25 M in Tetrahydrofuran, I14-60605. CAS No. 703-55-9. Molecular formula: C10H7BrMg. Mole weight: 231.3716. Purity: 96%. IUPAC Name: magnesium;1H-naphthalen-1-ide;bromide. SMILES: C1=CC=C2[C-]=CC=CC2=C1.[Mg+2].[Br-]. | |
| Magnesium,bromo(2-methyl-1-naphthalenyl)- | Magnesium,bromo(2-methyl-1-naphthalenyl)-. Alternative Names: 2-Methyl-1-naphthylmagnesium bromide, 21450-90-8, 563692_ALDRICH, AKOS016017713, 2-Methyl-1-naphthylmagnesium bromide 0.25 M in Tetrahydrofuran. CAS No. 21450-90-8. Molecular formula: C11H9BrMg. Mole weight: 245.4. Purity: 96%. IUPAC Name: magnesium;2-methyl-1H-naphthalen-1-ide;bromide. SMILES: CC1=CC=C2C=CC=CC2=[C-]1.[Mg+2].[Br-]. | |
| Magnesium,bromo(2-methylphenyl)- | Magnesium,bromo(2-methylphenyl)-. Alternative Names: Bromo-o-tolylmagnesium, o-Tolylmagnesium Bromide, 298980_ALDRICH, EINECS 213-250-2, o-Tolylmagnesium bromide solution, MolPort-003-929-530, CID101919, T1698, 932-31-0. CAS No. 932-31-0. Molecular formula: C7H7BrMg. Mole weight: 195.34. Purity: 96%. IUPAC Name: magnesium methylbenzene bromide. SMILES: CC1=CC=CC=[C-]1.[Mg+2].[Br-]. | |
| Magnesium,bromo(2-methylpropyl)- | Magnesium,bromo(2-methylpropyl)-. Alternative Names: Isobutylmagnesium bromide solution, 926-62-5, Isobutylmagnesium Bromide, 338257_ALDRICH, ACN-S001871, AKOS015902635, I14-20005. CAS No. 926-62-5. Molecular formula: C4H9BrMg. Mole weight: 161.32. Purity: 96%. IUPAC Name: magnesium;2-methanidylpropane;bromide. SMILES: CC(C)[CH2-].[Mg+2].[Br-]. | |
| Magnesium,bromo(3,7-dimethyloctyl)- | Magnesium,bromo(3,7-dimethyloctyl)-. Alternative Names: Magnesium,bromo(3,7-dimethyloctyl)-, 3,7-Dimethyloctylmagnesium bromide solution, 114499-45-5, ACMC-20mkf3, 637963_ALDRICH, CTK4A8766, AKOS015908965, AG-D-34818, 3,7-Dimethyloctylmagnesium bromide solution;, I14-34300. CAS No. 114499-45-5. Molecular formula: C10H21BrMg. Mole weight: 245.48. Purity: 96%. IUPAC Name: magnesium;2,6-dimethyloctane;bromide. SMILES: CC(C)CCCC(C)C[CH2-].[Mg+2].[Br-]. | |
| Magnesium,bromo[(3-bromophenyl)methyl]- | Magnesium,bromo[(3-bromophenyl)methyl]-. Alternative Names: 3-Bromobenzylmagnesium bromide solution, 107549-22-4, 562130_ALDRICH, AKOS015910654, I14-40569, 3-Bromobenzylmagnesium bromide 0.25 M in Diethyl Ether. CAS No. 107549-22-4. Molecular formula: C7H6Br2Mg. Mole weight: 274.24. Purity: 96%. IUPAC Name: magnesium;1-bromo-3-methanidylbenzene;bromide. SMILES: [CH2-]C1=CC(=CC=C1)Br.[Mg+2].[Br-]. | |
| Magnesium,bromo(3-chloro-5-fluorophenyl)- | Magnesium,bromo(3-chloro-5-fluorophenyl)-. Alternative Names: 480438-50-4, 563390_ALDRICH, CTK1D5647, PC6626, SBB098151, AKOS016017675, AG-F-63484, bromo(3-chloro-5-fluorophenyl)magnesium, Magnesium, bromo(3-chloro-5-fluorophenyl)-, 3-Chloro-5-fluorophenylmagnesium bromide solution, 3-Chloro-5-fluorophenylmagnesium bromide 0.5M solution in THF, 3-Chloro-5-fluorophenylmagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 480438-50-4. Molecular formula: C6H3BrClFMg. Mole weight: 233.75. Purity: 96%. IUPAC Name: magnesium;1-chloro-3-fluorobenzene-5-ide;bromide. SMILES: C1=[C-]C=C(C=C1F)Cl.[Mg+2].[Br-]. | |
| Magnesium,bromo(3-fluoro-4-methoxyphenyl)- | Magnesium,bromo(3-fluoro-4-methoxyphenyl)-. Alternative Names: 563706_ALDRICH, PC2304, SBB097491, AKOS015908726, bromo(3-fluoro-4-methoxyphenyl)magnesium, 3-Fluoro-4-methoxyphenylmagnesium bromide, I14-34198, 3-Fluoro-4-methoxyphenylmagnesium bromide 0.5M solution in THF, 3-Fluoro-4-methoxyphenylmagnesium bromide 0.5 M in Tetrahydrofuran, 112780-67-3. CAS No. 112780-67-3. Molecular formula: C7H6BrFMgO. Mole weight: 229.33. Purity: 96%. IUPAC Name: magnesium;1-fluoro-2-methoxybenzene-5-ide;bromide. SMILES: COC1=CC=[C-]C=C1F.[Mg+2].[Br-]. | |
| Magnesium,bromo(3-fluoro-4-methylphenyl)- | Magnesium,bromo(3-fluoro-4-methylphenyl)-. Alternative Names: 185077-02-5, 561711_ALDRICH, MolPort-001-776-216, PC5425, AKOS015909253, bromo(3-fluoro-4-methylphenyl)magnesium, 3-Fluoro-4-methylphenylmagnesium bromide solution, I14-33321, 3-Fluoro-4-methylphenylmagnesium bromide 0.5M solution in THF, 3-Fluoro-4-methylphenylmagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 185077-02-5. Molecular formula: C7H6BrFMg. Mole weight: 213.3299432. Purity: 96%. IUPAC Name: magnesium;1-fluoro-2-methylbenzene-5-ide;bromide. SMILES: CC1=CC=[C-]C=C1F.[Mg+2].[Br-]. | |
| Magnesium,bromo(4-methoxy-3,5-dimethylphenyl)- | Magnesium,bromo(4-methoxy-3,5-dimethylphenyl)-. Alternative Names: 3,5-Dimethyl-4-methoxyphenylmagnesium bromide, 185416-17-5, 563781_ALDRICH, AKOS015909281, I14-33327, 3,5-Dimethyl-4-methoxyphenylmagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 185416-17-5. Molecular formula: C9H11 Br Mg O. Mole weight: 239.4. Purity: 96%. IUPAC Name: magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide. SMILES: CC1=C(C(=C[C-]=C1)C)OC.[Mg+2].[Br-]. | |
| Magnesium,bromo[4-(methylthio)phenyl]- | Magnesium,bromo[4-(methylthio)phenyl]-. Alternative Names: 4-Thioanisolemagnesium bromide solution, 18620-04-7, 561762_ALDRICH, AKOS015909230, I14-33860, 4-Thioanisolemagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 18620-04-7. Molecular formula: C7H7BrMgS. Mole weight: 227.4. Purity: 96%. IUPAC Name: magnesium;methylsulfanylbenzene;bromide. SMILES: CSC1=CC=[C-]C=C1.[Mg+2].[Br-]. | |
| Magnesium,bromo(4-phenoxyphenyl)- | Magnesium,bromo(4-phenoxyphenyl)-. Alternative Names: 561681_ALDRICH, MolPort-003-936-820, 4-PHENOXYPHENYLMAGNESIUM BROMIDE, 4-Phenoxyphenylmagnesium bromide solution, TC-030931, 21473-02-9. CAS No. 21473-02-9. Molecular formula: C12H9BrMgO. Mole weight: 273.41. Purity: 96%. IUPAC Name: magnesium phenoxybenzene bromide. SMILES: C1=CC=C(C=C1)OC2=CC=[C-]C=C2.[Mg+2].[Br-]. | |
| Magnesium,bromo(5-fluoro-2-methoxyphenyl)- | Magnesium,bromo(5-fluoro-2-methoxyphenyl)-. Alternative Names: 561983_ALDRICH, PC9851, SBB097492, AKOS015909037, bromo(5-fluoro-2-methoxyphenyl)magnesium, 3-Fluoro-6-methoxyphenylmagnesium bromide solution, 5-Fluoro-2-methoxyphenylmagnesium bromide solution, I14-33362, 5-Fluoro-2-methoxyphenylmagnesium bromide 0.5M solution in THF, 5-Fluoro-2-methoxyphenylmagnesium bromide 0.5 M in Tetrahydrofuran, 188132-02-7. CAS No. 188132-02-7. Molecular formula: C7H6BrFMgO. Mole weight: 229.33. Purity: 96%. IUPAC Name: magnesium;1-fluoro-4-methoxybenzene-5-ide;bromide. SMILES: COC1=CC=C(C=[C-]1)F.[Mg+2].[Br-]. | |
| Magnesium,bromo(5-fluoro-2-methylphenyl)- | Magnesium,bromo(5-fluoro-2-methylphenyl)-. Alternative Names: 186496-59-3, 561746_ALDRICH, PC4644, SBB094836, AKOS015910625, bromo(5-fluoro-2-methylphenyl)magnesium, 5-Fluoro-2-methylphenylmagnesium bromide, 5-Fluoro-2-methylphenylmagnesium bromide solution, I14-40566, 5-Fluoro-2-methylphenylmagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 186496-59-3. Molecular formula: C7H6BrFMg. Mole weight: 213.33. Purity: 96%. IUPAC Name: magnesium;1-fluoro-4-methylbenzene-5-ide;bromide. SMILES: CC1=CC=C(C=[C-]1)F.[Mg+2].[Br-]. | |
| Magnesium,bromo-9-phenanthrenyl- | Magnesium,bromo-9-phenanthrenyl-. Alternative Names: 9-Phenanthrylmagnesium bromide, 71112-64-6, 563749_ALDRICH, AKOS015913293, I14-45744, 9-Phenanthrylmagnesium bromide 0.5 M in Tetrahydrofuran. CAS No. 71112-64-6. Molecular formula: C14H9BrMg. Mole weight: 281.43. Purity: 96%. IUPAC Name: magnesium;9H-phenanthren-9-ide;bromide. SMILES: C1=CC=C2C(=C1)C=[C-]C3=CC=CC=C32.[Mg+2].[Br-]. | |
| Magnesium,bromo(cyclohexylmethyl)- | Magnesium,bromo(cyclohexylmethyl)-. Alternative Names: 35166-78-0, (Cyclohexylmethyl)magnesium bromide solution, AKOS016017673, Cyclohexylmethylmagnesium bromide 0.25 M in Tetrahydrofuran. CAS No. 35166-78-0. Molecular formula: C7H13BrMg. Mole weight: 201.39. Purity: 96%. IUPAC Name: magnesium;methanidylcyclohexane;bromide. SMILES: [CH2-]C1CCCCC1.[Mg+2].[Br-]. | |
| Magnesium carbonate hydroxide pentahydrate | Magnesium carbonate hydroxide pentahydrate. Alternative Names: MAGNESIUM CARBONATE HYDROXIDE PENTAHYDRATE;MAGNESIUM CARBONATE PENTAHYDRATE;MAGNESIUM CHLORIDE HYDROXIDE;MAGNESIUM OXYCHLORIDE;MAGNESIUM CARBONATE HYDROXIDE PENTA-HYDR ATE, 99.99%;MAGNESIUM CARBONATE HYDROXIDE*PENTAHYDRA TE SIGMAULT;Magnesium carbonate hy. CAS No. 56378-72-4. Molecular formula: C4H14Mg6O21. Mole weight: 543.97. Purity: 99%. IUPAC Name: hexamagnesium tetracarbonate tetrahydroxide pentahydrate. | |
| Magnesium,chloro(3,4-dimethylphenyl)- | Magnesium,chloro(3,4-dimethylphenyl)-. Alternative Names: 3,4-Dimethylphenylmagnesium chloride solution, 102928-12-1, 562068_ALDRICH, AKOS015909154, I14-34000, 3,4-Dimethylphenylmagnesium chloride 0.5 M in Tetrahydrofuran. CAS No. 102928-12-1. Molecular formula: C8H9 Cl Mg. Mole weight: 164.92. Purity: 96%. IUPAC Name: magnesium;1,2-dimethylbenzene-5-ide;chloride. SMILES: CC1=CC=[C-]C=C1C.[Mg+2].[Cl-]. | |
| Magnesium,chloro[(3-methoxyphenyl)methyl]- | Magnesium,chloro[(3-methoxyphenyl)methyl]-. Alternative Names: 3-Methoxybenzylmagnesium chloride solution, 26905-40-8, 562084_ALDRICH, AKOS015889337, I01-18794, 3-Methoxybenzylmagnesium chloride 0.25 M in Tetrahydrofuran. CAS No. 26905-40-8. Molecular formula: C8H9 Cl Mg O. Mole weight: 180.91. Purity: 96%. IUPAC Name: magnesium;1-methanidyl-3-methoxybenzene;chloride. SMILES: COC1=CC=CC(=C1)[CH2-].[Mg+2].[Cl-]. | |
| Magnesium,chloro[(3-methylphenyl)methyl]- | Magnesium,chloro[(3-methylphenyl)methyl]-. Alternative Names: 3-Methylbenzylmagnesium chloride solution, 29875-06-7, 562157_ALDRICH, AKOS015889345, I01-18820, 3-Methylbenzylmagnesium chloride 0.25 M in Tetrahydrofuran. CAS No. 29875-06-7. Molecular formula: C8H9 Cl Mg. Mole weight: 164.92. Purity: 96%. IUPAC Name: magnesium;1-methanidyl-3-methylbenzene;chloride. SMILES: CC1=CC=CC(=C1)[CH2-].[Mg+2].[Cl-]. | |
| Magnesium,chlorocyclohexyl- | Magnesium,chlorocyclohexyl-. Alternative Names: Chlorocyclohexylmagnesium, Magnesium, chlorocyclohexyl-, CYCLOHEXYLMAGNESIUM CHLORIDE, 224413_ALDRICH, 256692_ALDRICH, HSDB 5772, CID13605, Cyclohexylmagnesium chloride solution, EINECS 213-237-1, 931-51-1. CAS No. 931-51-1. Molecular formula: C6H11ClMg. Mole weight: 142.9095. Purity: 96%. IUPAC Name: magnesium cyclohexane chloride. SMILES: C1CC[CH-]CC1.[Mg+2].[Cl-]. | |
| Magnesium,chlorooctadecyl- | Magnesium,chlorooctadecyl-. Alternative Names: Octadecylmagnesium chloride solution, 394262_ALDRICH, AKOS015908529, FT-0642857, I14-34315, 116980-66-6. CAS No. 116980-66-6. Molecular formula: C18H37ClMg. Mole weight: 313.24. Purity: 96%. IUPAC Name: magnesium;octadecane;chloride. SMILES: CCCCCCCCCCCCCCCCC[CH2-].[Mg+2].[Cl-]. | |
| Magnesium fluoride | Magnesium fluoride. Alternative Names: Aluminum chlorohydrate solution. CAS No. 7783-40-6. Molecular formula: F2Mg. Mole weight: 62.3. Purity: 99%+. SMILES: F[Mg]F. InChI: InChI=1S/2FH.Mg/h2*1H;/q;+2/p-2. | |
| Magnesium(II) Bis(trifluoromethanesulfonyl)imide | Magnesium(II) Bis(trifluoromethanesulfonyl)imide. Alternative Names: Bis(trifluoromethanesulfonyl)imide Magnesium(II) Salt Magnesium(II) Triflimide MgTFSI. CAS No. 133395-16-1. Molecular formula: C4F12MgN2O8S4. Mole weight: 584.58. Purity: >97.0%(T). IUPAC Name: magnesium;bis(trifluoromethylsulfonyl)azanide. SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Mg+2]. InChI: InChI=1S/2C2F6NO4S2.Mg/c2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q2*-1;+2. | |
| Magnesium iodide | Magnesium iodide. Alternative Names: Magnesium iodide, MgI2, Magnesium iodide (MgI2), 394599_ALDRICH, 449911_ALDRICH, 466107_ALDRICH, CID66322, EINECS 233-825-1, 10377-58-9, 61349-42-6, 7790-31-0. CAS No. 10377-58-9. Molecular formula: I2Mg. Purity: 99.9%. IUPAC Name: magnesium diiodide. | |
| Magnesium Perchlorate Hexahydrate | Magnesium Perchlorate Hexahydrate. Alternative Names: Magnesium perchlorate. CAS No. 13446-19-0. Molecular formula: Cl2H12MgO14. Mole weight: 331.3. Purity: 99%+. IUPAC Name: Magnesium;diperchlorate;hexahydrate. SMILES: O.O.O.O.O.O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Mg+2]. InChI: InChI=1S/2ClHO4.Mg.6H2O/c2*2-1(3,4)5;/h2*(H,2,3,4,5);6*1H2/q;+2;/p-2. | |
| Maleimide-PEG5K-OH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: MAL-PEG-OH, Maleimide, Maleimide-PEG-OH. Mole weight: average Mn 5000. | |
| MAL-PEG2000-B-PLA2000 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.