Alfa Chemistry Materials 4 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| DWCNT Type 2 Carbon Nanotubes Double Walled (Short) | DWCNT Type 2 Carbon Nanotubes Double Walled (Short). CAS No. 308068-56-6. |  |
| DWCNT Type 3 Carbon Nanotubes Double-Walled | DWCNT Type 3 Carbon Nanotubes Double-Walled. CAS No. 308068-56-6. | |
| DWCNT Type 4 Carbon Nanotubes Double-Walled | DWCNT Type 4 Carbon Nanotubes Double-Walled. CAS No. 308068-56-6. | |
| Dysprosium(III) Sulfate | Dysprosium(III) Sulfate. Molecular formula: Dy2O12S3. Mole weight: 613.2g/mol. IUPAC Name: dysprosium(3+);trisulfate. SMILES: [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Dy+3].[Dy+3]. InChI: InChI=1S/2Dy.3H2O4S/c;;3*1-5(2,3)4/h;;3*(H2,1,2,3,4)/q2*+3;;;/p-6. | |
| Dysprosium Nitride Industrial Grade 99.9% | Dysprosium Nitride Industrial Grade 99.9%. | |
| Dysprosium Oxide Industrial Grade 99.9% | Dysprosium Oxide Industrial Grade 99.9%. | |
| Dysprosium Powder Purified 99.9% | Dysprosium Powder Purified 99.9%. | |
| Eicosanol | Eicosanol. Alternative Names: Arachidic alcohol. CAS No. 629-96-9. Molecular formula: C20H42O. Mole weight: 298.52. Purity: 99%+. IUPAC Name: icosan-1-ol. SMILES: CCCCCCCCCCCCCCCCCCCCO. | |
| Electroless nickel plating solution | Electroless nickel plating solution. | |
| Electroless nickel plating strike | Electroless nickel plating strike. | |
| Electroless silver plating solution | Electroless silver plating solution. | |
| Endo-3 7 14-trifluoro-1 3 5 7 9 11 14-& | Endo-3 7 14-trifluoro-1 3 5 7 9 11 14-&. Alternative Names: ENDO-3 7 14-TRIFLUORO-1 3 5 7 9 11 14-&;ENDO-3,7,14-TRIFLUORO-1,3,7,14-HEPTACYCLO PENTYLTRICYCLO(7.3.3.1)-HEPTASILOXANE;Trifluoro-POSS(R). CAS No. 307531-89-1. Molecular formula: C35H63F3O9Si7. Mole weight: 881.47. Purity: 96%. IUPAC Name: endo-3,7,14-Trifluoro-1,3,5,7,9,11,14-heptacyclopentyltricyclo[7.3.3.1. SMILES: C1CCC(C1)[Si]23O[Si]4(O[Si](O[Si](O2)(O[Si](O[Si](O3)(O[Si](O4)(C5CCCC5)F)C6CCCC6)(C7CCCC7)F)C8CCCC8)(C9CCCC9)F)C1CCCC1. | |
| endo-DNTT-PMI (DNTT-Precursor) | endo-DNTT-PMI (DNTT-Precursor). Alternative Names: endo-Dinaphthothienothiophene-phenylmaleimide Monoadduct (DNTT-Precursor) endo-Naphtho[2,3-b]naphtho[2',3':4,5]thieno[2,3-d]thiophene N-Phenylmaleimide Monoadduct (DNTT-Precursor). CAS No. 1269669-42-2. Molecular formula: C32H19NO2S2. Mole weight: 513.63. Purity: >97.0%(HPLC). IUPAC Name: 27-phenyl-4,16-dithia-27-azaoctacyclo[16.6.5.02,17.03,15.05,14.07,12.019,24.025,29]nonacosa-2(17),3(15),5,7,9,11,13,19,21,23-decaene-26,28-dione. SMILES: C1=CC=C(C=C1)N2C(=O)C3C(C2=O)C4C5=CC=CC=C5C3C6=C4SC7=C6SC8=CC9=CC=CC=C9C=C87. InChI: InChI=1S/C32H19NO2S2/c34-31-25-23-19-12-6-7-13-20(19)24(26(25)32(35)33(31)18-10-2-1-3-11-18)29-27(23)30-28(37-29)21-14-16-8-4-5-9-17(16)15-22(21)36-30/h1-15,23-26H. | |
| Erbium | Erbium. Molecular formula: Er. Mole weight: 167.26g/mol. IUPAC Name: erbium. SMILES: [Er]. InChI: InChI=1S/Er. | |
| Erbium Nitride Industrial Grade 99.9% | Erbium Nitride Industrial Grade 99.9%. | |
| Erbium Oxide | Erbium Oxide. CAS No. 12061-61-4. | |
| (η7-Cycloheptatrienyl)(η5-cyclopentadienyl)titanium(II) | (η7-Cycloheptatrienyl)(η5-cyclopentadienyl)titanium(II). Alternative Names: cycloheptatrienylcyclopentadienyltitanium. CAS No. 51203-49-7. Molecular formula: C12H12Ti. Mole weight: 204.10. Purity: 96%. IUPAC Name: chlorane. SMILES: Cl. | |
| Ethoxy(pentafluoro)cyclotriphosphazene | Ethoxy(pentafluoro)cyclotriphosphazene. Alternative Names: 2-Ethoxy-2,4,4,6,6-pentafluoro-1,3,5,2,4,6-triazatriphosphorine. CAS No. 33027-66-6. Molecular formula: C2H5F5N3OP3. Mole weight: 275. Purity: >98.0%(GC). IUPAC Name: 2-ethoxy-2,4,4,6,6-pentafluoro-1,3,5-triaza-2??5,4??5,6??5-triphosphacyclohexa-1,3,5-triene. SMILES: CCOP1(=NP(=NP(=N1)(F)F)(F)F)F. InChI: InChI=1S/C2H5F5N3OP3/c1-2-11-14(7)9-12(3,4)8-13(5,6)10-14/h2H2,1H3. | |
| Ethyl(2-methoxyethyl)dimethylammonium Bis(fluorosulfonyl)imide | Ethyl(2-methoxyethyl)dimethylammonium Bis(fluorosulfonyl)imide. CAS No. 1235234-35-1. Molecular formula: C7H18F2N2O5S2. Mole weight: 312.35. Purity: >98.0%(T). IUPAC Name: bis(fluorosulfonyl)azanide;ethyl-(2-methoxyethyl)-dimethylazanium. SMILES: CC[N+](C)(C)CCOC.[N-](S(=O)(=O)F)S(=O)(=O)F. InChI: InChI=1S/C7H18NO.F2NO4S2/c1-5-8(2,3)6-7-9-4;1-8(4,5)3-9(2,6)7/h5-7H2,1-4H3;/q+1;-1. | |
| Ethyl 2-[trans-4-[(tert-Butoxycarbonyl)amino]cyclohexyl]acetate, 98% | Ethyl 2-[trans-4-[(tert-Butoxycarbonyl)amino]cyclohexyl]acetate, 98%. CAS No. 946598-34-1. Molecular formula: C15H27NO4. Mole weight: 285.38g/mol. IUPAC Name: ethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate. SMILES: CCOC(=O)CC1CCC(CC1)NC(=O)OC(C)(C)C. InChI: InChI=1S/C15H27NO4/c1-5-19-13(17)10-11-6-8-12(9-7-11)16-14(18)20-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,16,18). | |
| Ethyl(3-methoxypropyl)dimethylammonium Bis(trifluoromethanesulfonyl)imide | Ethyl(3-methoxypropyl)dimethylammonium Bis(trifluoromethanesulfonyl)imide. CAS No. 1373334-05-4. Molecular formula: C10H20F6N2O5S2. Mole weight: 426.39. Purity: >98.0%(T). IUPAC Name: bis(trifluoromethylsulfonyl)azanide;ethyl-(3-methoxypropyl)-dimethylazanium. SMILES: CC[N+](C)(C)CCCOC.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F. InChI: InChI=1S/C8H20NO.C2F6NO4S2/c1-5-9(2,3)7-6-8-10-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-8H2,1-4H3;/q+1;-1. | |
| Ethyl 4-[(4-Methoxybenzylidene)amino]cinnamate | Ethyl 4-[(4-Methoxybenzylidene)amino]cinnamate. Alternative Names: 4-(p-Anisalamino)cinnamic Acid Ethyl Ester. CAS No. 6421-30-3. Molecular formula: C19H19NO3. Mole weight: 309.37. Purity: 98%+. IUPAC Name: ethyl (E)-3-[4-[(4-methoxyphenyl)methylideneamino]phenyl]prop-2-enoate. SMILES: CCOC(=O)/C=C/C1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC. InChI: InChI=1S/C19H19NO3/c1-3-23-19(21)13-8-15-4-9-17(10-5-15)20-14-16-6-11-18(22-2)12-7-16/h4-14H,3H2,1-2H3/b13-8+,20-14?. | |
| Ethylamine HydroIodide | Ethylamine HydroIodide. Alternative Names: Ethylammonium Iodide; EAI. CAS No. 506-58-1. Molecular formula: C2H7N·HI. Mole weight: 173.00 g/mol. Purity: >98.0%(T)(N). IUPAC Name: ethanamine;hydroiodide. SMILES: CCN.I. InChI: InChI=1S/C2H7N.HI/c1-2-3;/h2-3H2,1H3;1H. | |
| Ethyl(dimethyl)(2-phenylethyl)ammonium Bis(trifluoromethanesulfonyl)imide | Ethyl(dimethyl)(2-phenylethyl)ammonium Bis(trifluoromethanesulfonyl)imide. Alternative Names: Ethyl(dimethyl)phenethylammonium Bis(trifluoromethanesulfonyl)imide. CAS No. 1804970-28-2. Molecular formula: C14H20F6N2O4S2. Mole weight: 458.43. Purity: >98.0%(T). IUPAC Name: bis(trifluoromethylsulfonyl)azanide;ethyl-dimethyl-(2-phenylethyl)azanium. SMILES: CC[N+](C)(C)CCC1=CC=CC=C1.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F. InChI: 1S/C12H20N.C2F6NO4S2/c1-4-13(2,3)11-10-12-8-6-5-7-9-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-9H,4,10-11H2,1-3H3;/q+1;-1. | |
| Ethylenediamine DihydroBromide | Ethylenediamine DihydroBromide. CAS No. 624-59-9. Molecular formula: C2H8N2 2HBr. Mole weight: 221.92 g/mol. Purity: >97.0%(T)(N). IUPAC Name: ethane-1,2-diamine;dihydrobromide. SMILES: C(CN)N.Br.Br. InChI: InChI=1S/C2H8N2/c3-1-2-4/h1-4H2. | |
| Ethylene glycol bis(propionitrile)ether | Ethylene glycol bis(propionitrile)ether. Alternative Names: 1,2-Bis(2-cyanoethoxy)ethane, 3,3-(Ethylenedioxy)dipropionitrile, Ethylene glycol bis(cyanoethyl) ether, 1,2-Bis(beta-cyanoethoxyethane), Ethylene glycol bis(2-cyanoethyl) ether, MolPort-003-910-171, 1,2-Bis(beta-cyanoethyloxy)ethane, CID76921, NSC69063, 1,2-Bis(.beta.-cyanoethoxyethane), EINECS 222-208-2, NSC 69063, Propionitrile, 3,3-(ethylenedioxy)di-, ZINC01695418, 1,2-Bis(.beta.-cyanoethyloxy)ethane, 3,3-(Ethylenedioxy)dipropiononitrile, Ethylene glycol bis(propionitrile) ether, Ethylene glycol di-beta-cyanoethyl ether, Ethylene glycol-bis-(2-cyanoethyl ether), Ethylene glycol di-.beta.-cyanoethyl ether. CAS No. 3386-87-6. Molecular formula: C8H12N2O2. Mole weight: 168.19. Purity: >97.0%(GC). IUPAC Name: 3-[2-(2-cyanoethoxy)ethoxy]propanenitrile. SMILES: C(COCCOCCC#N)C#N. | |
| Ethylene Glycol Diphenyl Ether | WetSolid. CAS No. 104-66-5. Molecular formula: C14H14O2. Mole weight: 214.26g/mol. IUPAC Name: 2-phenoxyethoxybenzene. SMILES: C1=CC=C(C=C1)OCCOC2=CC=CC=C2. InChI: InChI=1S/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2. | |
| Ethyltrichlorosilane | Ethyltrichlorosilane appears as a colorless fuming liquid with a pungent odor. Flash point 57°F. Boiling point 211.1°F (99.5°C). Vapor and liquid may cause burns. Denser than water. Vapors heavier than air.;Liquid. CAS No. 115-21-9. Molecular formula: C2H5Cl3Si. Mole weight: 163.5g/mol. IUPAC Name: trichloro(ethyl)silane. SMILES: CC[Si](Cl)(Cl)Cl. InChI: InChI=1S/C2H5Cl3Si/c1-2-6(3,4)5/h2H2,1H3. | |
| Ethyltrimethylammonium Iodide, 98% | Ethyltrimethylammonium Iodide, 98%. CAS No. 51-93-4. Molecular formula: C5H14IN. Mole weight: 215.08g/mol. IUPAC Name: ethyl(trimethyl)azanium;iodide. SMILES: CC[N+](C)(C)C.[I-]. InChI: InChI=1S/C5H14N.HI/c1-5-6(2,3)4;/h5H2,1-4H3;1H/q+1;/p-1. | |
| Ethyltripropylammonium Iodide, 99% | Ethyltripropylammonium Iodide, 99%. CAS No. 15066-80-5. Molecular formula: C11H26IN. Mole weight: 299.24g/mol. IUPAC Name: ethyl(tripropyl)azanium;iodide. SMILES: CCC[N+](CC)(CCC)CCC.[I-]. InChI: InChI=1S/C11H26N.HI/c1-5-9-12(8-4,10-6-2)11-7-3;/h5-11H2,1-4H3;1H/q+1;/p-1. | |
| Ethynyl(diphenyl)phosphine Oxide | Ethynyl(diphenyl)phosphine Oxide. CAS No. 6104-48-9. Molecular formula: C14H11OP. Mole weight: 226.21g/mol. IUPAC Name: [ethynyl(phenyl)phosphoryl]benzene. SMILES: C#CP(=O)(C1=CC=CC=C1)C2=CC=CC=C2. InChI: InChI=1S/C14H11OP/c1-2-16(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h1,3-12H. | |
| exo-2,3-Epoxynorbornane | exo-2,3-Epoxynorbornane. Alternative Names: ENB. CAS No. 3146-39-2. Molecular formula: C7H10O. Mole weight: 110.15. IUPAC Name: 3-oxatricyclo[3.2.1.02,4]octane. SMILES: C1C[C@H]2C[C@@H]1[C@@H]3O[C@H]23. InChI: 1S/C7H10O/c1-2-5-3-4(1)6-7(5)8-6/h4-7H,1-3H2/t4-,5+,6+,7-. | |
| exo-5-Norbornene-2-methanol | exo-5-Norbornene-2-methanol. Alternative Names: exo-5-Norbornenyl methyl alcohol. CAS No. 13360-81-1. Molecular formula: C8H12O. Mole weight: 124.18g/mol. IUPAC Name: 2-bicyclo[2.2.1]hept-5-enylmethanol. SMILES: C1C2CC(C1C=C2)CO. InChI: InChI=1S/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2. | |
| exo-DNTT-PMI (DNTT-Precursor) | exo-DNTT-PMI (DNTT-Precursor). Alternative Names: exo-Dinaphthothienothiophene-phenylmaleimide Monoadduct (DNTT-Precursor) exo-Naphtho[2,3-b]naphtho[2',3':4,5]thieno[2,3-d]thiophene N-Phenylmaleimide Monoadduct (DNTT-Precursor). CAS No. 1269669-43-3. Molecular formula: C32H19NO2S2. Mole weight: 513.63. Purity: >95.0%(HPLC). IUPAC Name: 27-phenyl-4,16-dithia-27-azaoctacyclo[16.6.5.02,17.03,15.05,14.07,12.019,24.025,29]nonacosa-2(17),3(15),5,7,9,11,13,19,21,23-decaene-26,28-dione. SMILES: C1=CC=C(C=C1)N2C(=O)C3C(C2=O)C4C5=CC=CC=C5C3C6=C4SC7=C6SC8=CC9=CC=CC=C9C=C87. InChI: InChI=1S/C32H19NO2S2/c34-31-25-23-19-12-6-7-13-20(19)24(26(25)32(35)33(31)18-10-2-1-3-11-18)29-27(23)30-28(37-29)21-14-16-8-4-5-9-17(16)15-22(21)36-30/h1-15,23-26H. | |
| Expandable graphite | This halogen free flame retardant has a wide range of expansion temperature and can be used for foams, paints, resins, rubber and more. Expandable Graphite is a stratiform graphite and contains acids between each stratums. Once its heated, acid generates gas and stratiforms are expanded. This expanded stable structure puts off a fire by cutting off the supply of air. (LOI is 28 by adding 15% in Polypropylene). Purity: 99 %. | |
| FAPbI3 CH(NH2)2PbI3, Formamidinium Iodide Perovskite, >99% | FAPbI3 CH(NH2)2PbI3, Formamidinium Iodide Perovskite, >99%. CAS No. 1451592-07-6. | |
| Ferric Oxide (Alpha) Nanopowder | Ferric Oxide (Alpha) Nanopowder. CAS No. 1309-37-1. | |
| Ferric Oxide (Gamma) Nanopowder | Ferric Oxide (Gamma) Nanopowder. CAS No. 1309-37-1. | |
| (Ferrocenylmethyl)trimethylammonium Iodide | (Ferrocenylmethyl)trimethylammonium Iodide. CAS No. 12086-40-7. Molecular formula: C14H20FeIN. Mole weight: 385.07. Purity: >96.0%T. | |
| Ferromagnetic nanoparticles | Ferromagnetic nanoparticles. | |
| Ferrous Ferric Oxide Nanopowder (Type 1) | Ferrous Ferric Oxide Nanopowder (Type 1). CAS No. 1317-61-9. | |
| Ferrous Ferric Oxide Nanopowder (Type 2) | Ferrous Ferric Oxide Nanopowder (Type 2). CAS No. 1317-61-9. | |
| Ferrous sulfate, >98% | Ferrous sulfate appears as a greenish or yellow-brown crystalline solid. Density 15.0 lb /gal. Melts at 64°C and loses the seven waters of hydration at 90°C. The primary hazard is the threat to the environment. Immediate steps should be taken to limit its spread to the environment. Used for water or sewage treatment, as a fertilizer ingredient.;DryPowder; DryPowder, PelletsLargeCrystals; Liquid; OtherSolid; PelletsLargeCrystals. CAS No. 7720-78-7. Molecular formula: FeO4S;FeO4S. Mole weight: 151.91g/mol. IUPAC Name: iron(2+);sulfate. SMILES: [O-]S(=O)(=O)[O-].[Fe+2]. InChI: InChI=1S/Fe.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2. | |
| FK 102 Co(III) PF6 Salt Complex, 98% | FK 102 Co(III) PF6 Salt Complex, 98%. CAS No. 1346416-71-4. | |
| FK 102 Co(III) TFSI Salt Complex, 98% | FK 102 Co(III) TFSI Salt Complex, 98%. CAS No. 2057441-94-6. | |
| FK 102 Co(II) PF6 Salt Complex, 98% | FK 102 Co(II) PF6 Salt Complex, 98%. CAS No. 1392221-69-0. | |
| FK 102 Co(II) TFSI Salt Complex, 98% | FK 102 Co(II) TFSI Salt Complex, 98%. | |
| Flash-ignited Carbon Nanotubes, >70%,ID: 20-50nm,OD: 30-60nm,Length: 1-10μm | Flash-ignited Carbon Nanotubes, >70%,ID: 20-50nm,OD: 30-60nm,Length: 1-10μm. CAS No. 308068-56-6. | |
| Flash-ignited Carbon Nanotubes, OD:2-50nm,Length:~50 μm | Flash-ignited Carbon Nanotubes, OD:2-50nm,Length:~50 μm. CAS No. 308068-56-6. | |
| FLAVANTHRONE | FLAVANTHRONE. Alternative Names: Flavanthrone;C.I. VAT YELLOW 1;VAT Yellow 1. CAS No. 475-71-8. Molecular formula: C28H12N2O2. Mole weight: 408.41. Purity: 98+%. IUPAC Name: Benzo[h]Benz[5,6]Acridino[2,1,9,8-Klmna]Acridine-8,16-Dione. SMILES: C1=CC=C2C(=C1)C3=NC4=C5C6=C(C=C4)C(=O)C7=CC=CC=C7C6=NC8=C5C3=C(C2=O)C=C8. | |
| Fluoranthene | Fluoranthene appears as light yellow fine crystals. (NTP, 1992);Liquid. Alternative Names: 1,2-Benzacenaphthene. CAS No. 206-44-0. Molecular formula: C16H10. Mole weight: 202.25. IUPAC Name: fluoranthene. SMILES: C1=CC=C2C(=C1)C3=CC=CC4=C3C2=CC=C4. InChI: InChI=1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H. | |
| Fluorene, Reagent | Fluorene is a white leaflets. Sublimes easily under a vacuum. Fluorescent when impure. (NTP, 1992). CAS No. 86-73-7. Molecular formula: C13H10. Mole weight: 166.22g/mol. IUPAC Name: 9H-fluorene. SMILES: C1C2=CC=CC=C2C3=CC=CC=C31. InChI: InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2. | |
| Fluorene Zone Refined (number of passes:70) | Fluorene is a white leaflets. Sublimes easily under a vacuum. Fluorescent when impure. (NTP, 1992). CAS No. 86-73-7. Molecular formula: C13H10. Mole weight: 166.22g/mol. IUPAC Name: 9H-fluorene. SMILES: C1C2=CC=CC=C2C3=CC=CC=C31. InChI: InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2. | |
| Fluorene, Zone Refined (number of passes:70) | Fluorene is a white leaflets. Sublimes easily under a vacuum. Fluorescent when impure. (NTP, 1992). CAS No. 86-73-7. Molecular formula: C13H10. Mole weight: 166.22g/mol. IUPAC Name: 9H-fluorene. SMILES: C1C2=CC=CC=C2C3=CC=CC=C31. InChI: InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2. | |
| Fluorescent nanodiamond | Fluorescent nanodiamond. | |
| Fluorescent quantum dots | Fluorescent quantum dots. | |
| Fluorescent quantum dots, | Fluorescent quantum dots. | |
| Fluorescent quantum dots, fluorescence λem 525 nm,0.05 μmol/L | Fluorescent quantum dots, fluorescence λem 525 nm,0.05 μmol/L. | |
| Fluorescent quantum dots, fluorescence λem 565 nm,0.05 μmol/L | Fluorescent quantum dots, fluorescence λem 565 nm,0.05 μmol/L. | |
| Fluorescent quantum dots, fluorescence λem 578 nm,0.05 μmol/L | Fluorescent quantum dots, fluorescence λem 578 nm,0.05 μmol/L. | |
| Fluorescent quantum dots, fluorescence λem 585 nm,0.05 μmol/L | Fluorescent quantum dots, fluorescence λem 585 nm,0.05 μmol/L. | |
| Fluorescent quantum dots, fluorescence λem 605 nm,0.05 μmol/L | Fluorescent quantum dots, fluorescence λem 605 nm,0.05 μmol/L. | |
| Fluorescent silica nanobeads | Fluorescent silica nanobeads. | |
| Fluorinated Graphene | Fluorinated Graphene. Purity: > 96. | |
| fluorographite(tm) | fluorographite(tm). CAS No. 11113-63-6. Molecular formula: CH4F2. Mole weight: 54.039g/mol. IUPAC Name: methane;molecular fluorine. SMILES: C.FF. InChI: InChI=1S/CH4.F2/c;1-2/h1H4. | |
| Formamidine HydroBromide (Low water content) | Formamidine HydroBromide (Low water content). Alternative Names: FABr (Low water content); Formamidinium Bromide (Low water content). CAS No. 146958-06-7. Molecular formula: CH5BrN2. Mole weight: 124.97 g/mol. Purity: >98.0%(T)(N). IUPAC Name: methanimidamide;hydrobromide. SMILES: C(=N)N.Br. InChI: InChI=1S/CH4N2.BrH/c2-1-3;/h1H,(H3,2,3);1H. | |
| Formamidine HydroIodide (Low water content) | Formamidine HydroIodide (Low water content). Alternative Names: FAI (Low water content); Formamidinium Iodide (Low water content). CAS No. 879643-71-7. Molecular formula: CH5IN2. Mole weight: 171.97 g/mol. Purity: >98.0%(T)(N). IUPAC Name: methanimidamide;hydroiodide. SMILES: C(=N)N.I. InChI: InChI=1S/CH4N2.HI/c2-1-3;/h1H,(H3,2,3);1H. | |
| Fullerene C60 | Fullerene C60. Alternative Names: Buckminsterfullerene C60 (pure),C60 (pure),Carbon C60 (pure). CAS No. 99685-96-8. Molecular formula: C60. Mole weight: 720.66. Purity: >99.5%(HPLC). IUPAC Name: (C60-Ih)[5,6]fullerene. SMILES: C12=C3C4=C5C6=C1C7=C8C9=C1C%10=C%11C(=C29)C3=C2C3=C4C4=C5C5=C9C6=C7C6=C7C8=C1C1=C8C%10=C%10C%11=C2C2=C3C3=C4C4=C5C5=C%11C%12=C(C6=C95)C7=C1C1=C%12C5=C%11C4=C3C3=C5C(=C81)C%10=C23. InChI: InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59. | |
| Fullerene C60 | Fullerene C60. Molecular formula: C60. Mole weight: 720.6g/mol. Purity: 99.5 %. IUPAC Name: (C60-Ih)[5,6]fullerene. SMILES: C12=C3C4=C5C6=C1C7=C8C9=C1C%10=C%11C(=C29)C3=C2C3=C4C4=C5C5=C9C6=C7C6=C7C8=C1C1=C8C%10=C%10C%11=C2C2=C3C3=C4C4=C5C5=C%11C%12=C(C6=C95)C7=C1C1=C%12C5=C%11C4=C3C3=C5C(=C81)C%10=C23. InChI: InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59. | |
| Fullerene-C60, 99.9% | Fullerene-C60, 99.9%. CAS No. 99685-96-8. Molecular formula: C60. Mole weight: 720.6g/mol. IUPAC Name: (C60-Ih)[5,6]fullerene. SMILES: C12=C3C4=C5C6=C1C7=C8C9=C1C%10=C%11C(=C29)C3=C2C3=C4C4=C5C5=C9C6=C7C6=C7C8=C1C1=C8C%10=C%10C%11=C2C2=C3C3=C4C4=C5C5=C%11C%12=C(C6=C95)C7=C1C1=C%12C5=C%11C4=C3C3=C5C(=C81)C%10=C23. InChI: InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.