Alfa Chemistry Materials 5 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Acryloxytriisopropylsilane | Acryloxytriisopropylsilane. Alternative Names: TIPSA; Tri(isopropyl)silylacrylate; TRIISOPROPYLSILYL ACRYLATE; 2-Propenoic acid,tris(1-methylethyl)silyl ester. CAS No. 157859-20-6. Molecular formula: C12H24O2Si. Mole weight: 228.41 g/mol. Purity: 95%+. IUPAC Name: tri(propan-2-yl)silyl prop-2-enoate. |  |
| Adamantan-1-yl Acrylate (stabilized with BHT) | Adamantan-1-yl Acrylate (stabilized with BHT). CAS No. 121601-93-2. Molecular formula: C13H18O2. Mole weight: 206.28g/mol. IUPAC Name: 1-adamantyl prop-2-enoate. SMILES: C=CC(=O)OC12CC3CC(C1)CC(C3)C2. InChI: InChI=1S/C13H18O2/c1-2-12(14)15-13-6-9-3-10(7-13)5-11(4-9)8-13/h2,9-11H,1,3-8H2. | |
| Allyl 4-hydroxybenzoate | Allyl 4-hydroxybenzoate. Alternative Names: Allyl 4-Hydroxybenzoate, 18982-18-8, 4-Hydroxybenzoic Acid Allyl Ester, Allylparaben, SureCN31182, ACMC-209et7, CTK4E0230, ANW-23465, AG-E-38592, AK136453, KB-250640, Benzoic acid,4-hydroxy-, 2-propen-1-yl ester, I14-102388, Benzoicacid, 4-hydroxy-, 2-propenyl ester (9CI); Benzoic acid, p-hydroxy-, allyl ester(8CI); 4-Hydroxybenzoic acid allyl ester; Allyl 4-hydroxybenzoate; Allylp-hydroxybenzoate; p-Hydroxybenzoic acid allyl ester. CAS No. 18982-18-8. Molecular formula: C10H10O3. Mole weight: 178.18. Purity: 96%. IUPAC Name: prop-2-enyl 4-hydroxybenzoate. SMILES: C=CCOC(=O)C1=CC=C(C=C1)O. | |
| Allyl Acetate | Allyl acetate appears as a liquid. Insoluble in water and slightly less dense than water. Hence floats on water. Poisonous by ingestion and moderately toxic by inhalation and skin contact. Irritating to skin and eyes. CAS No. 591-87-7. Molecular formula: C5H8O2. Mole weight: 100.12g/mol. IUPAC Name: prop-2-enyl acetate. SMILES: CC(=O)OCC=C. InChI: InChI=1S/C5H8O2/c1-3-4-7-5(2)6/h3H,1,4H2,2H3. | |
| Allyl acetate, 99% | Allyl acetate appears as a liquid. Insoluble in water and slightly less dense than water. Hence floats on water. Poisonous by ingestion and moderately toxic by inhalation and skin contact. Irritating to skin and eyes. CAS No. 591-87-7. Molecular formula: C5H8O2. Mole weight: 100.12g/mol. IUPAC Name: prop-2-enyl acetate. SMILES: CC(=O)OCC=C. InChI: InChI=1S/C5H8O2/c1-3-4-7-5(2)6/h3H,1,4H2,2H3. | |
| Allyl Acetoacetate | Allyl Acetoacetate. CAS No. 1118-84-9. Molecular formula: C7H10O3. Mole weight: 142.15g/mol. IUPAC Name: prop-2-enyl 3-oxobutanoate. SMILES: CC(=O)CC(=O)OCC=C. InChI: InChI=1S/C7H10O3/c1-3-4-10-7(9)5-6(2)8/h3H,1,4-5H2,2H3. | |
| Allyl acetoacetate, 97% | Allyl acetoacetate, 97%. CAS No. 1118-84-9. Molecular formula: C7H10O3. Mole weight: 142.15g/mol. IUPAC Name: prop-2-enyl 3-oxobutanoate. SMILES: CC(=O)CC(=O)OCC=C. InChI: InChI=1S/C7H10O3/c1-3-4-10-7(9)5-6(2)8/h3H,1,4-5H2,2H3. | |
| Allyl Acrylate(stabilized with HQ) | Allyl acrylate is a clear colorless liquid. (NTP, 1992). CAS No. 999-55-3. Molecular formula: C6H8O2. Mole weight: 112.13g/mol. IUPAC Name: prop-2-enyl prop-2-enoate. SMILES: C=CCOC(=O)C=C. InChI: InChI=1S/C6H8O2/c1-3-5-8-6(7)4-2/h3-4H,1-2,5H2. | |
| Allyl Acrylate (stabilized with MEHQ) | Allyl acrylate is a clear colorless liquid. (NTP, 1992). CAS No. 999-55-3. Molecular formula: C6H8O2. Mole weight: 112.13g/mol. IUPAC Name: prop-2-enyl prop-2-enoate. SMILES: C=CCOC(=O)C=C. InChI: InChI=1S/C6H8O2/c1-3-5-8-6(7)4-2/h3-4H,1-2,5H2. | |
| Allylamine hydrochloride | Allylamine hydrochloride. Alternative Names: 3-Aminopropene hydrochloride, Mono-allylamine hydrochloride. CAS No. 10017-11-5. Molecular formula: C3H8ClN. Mole weight: 93.56. Purity: MP 118-120deg. IUPAC Name: prop-2-en-1-amine;hydrochloride. SMILES: Cl.NCC=C. InChI: 1S/C3H7N.ClH/c1-2-3-4;/h2H,1,3-4H2;1H. | |
| Allylbenzene | Allylbenzene. Alternative Names: HJWLCRVIBGQPNF-UHFFFAOYSA-N;ALLYLBENZENE;AN-44168;FT-0622040;KS-00000EWU;Prop-2-enylbenzene;ANW-75659;ZINC1561526;H251;AC1Q2A77. CAS No. 300-57-2. Molecular formula: C9H10. Mole weight: 118.18. Purity: 95%+. IUPAC Name: prop-2-enylbenzene. SMILES: C=CCC1=CC=CC=C1. InChI: InChI=1S/C9H10/c1-2-6-9-7-4-3-5-8-9/h2-5,7-8H,1,6H2. | |
| Allyl benzoate | Allyl benzoate. CAS No. 583-04-0. Molecular formula: C10H10O2. Mole weight: 162.18g/mol. IUPAC Name: prop-2-enyl benzoate. SMILES: C=CCOC(=O)C1=CC=CC=C1. InChI: InChI=1S/C10H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h2-7H,1,8H2. | |
| Allyl Benzoate, ≥98% | Allyl Benzoate, ≥98%. CAS No. 583-04-0. Molecular formula: C10H10O2. Mole weight: 162.18g/mol. IUPAC Name: prop-2-enyl benzoate. SMILES: C=CCOC(=O)C1=CC=CC=C1. InChI: InChI=1S/C10H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h2-7H,1,8H2. | |
| Allyl benzyl ether | Allyl benzyl ether. Alternative Names: 3-(Benzyloxy)propene, 3-(Benzyloxy)-1-propene. CAS No. 14593-43-2. Molecular formula: C6H5CH2OCH2CH=CH2. Mole weight: 148.20. IUPAC Name: prop-2-enoxymethylbenzene. SMILES: C=CCOCc1ccccc1. InChI: 1S/C10H12O/c1-2-8-11-9-10-6-4-3-5-7-10/h2-7H,1,8-9H2. | |
| Allyl butyl ether | Allyl butyl ether. Alternative Names: Butyl allyl ether, 1-(Allyloxy)butane. CAS No. 3739-64-8. Molecular formula: CH2=CHCH2OCH2CH2CH2CH3. Mole weight: 114.19. Purity: 96%. IUPAC Name: 1-prop-2-enoxybutane. SMILES: CCCCOCC=C. InChI: 1S/C7H14O/c1-3-5-7-8-6-4-2/h4H,2-3,5-7H2,1H3. | |
| Allyl chloroacetate | Allyl chloroacetate. Alternative Names: Chloroacetic acid allyl ester. CAS No. 2916-14-5. Molecular formula: ClCH2CO2CH2CH=CH2. Mole weight: 134.56. Purity: 98 %. IUPAC Name: prop-2-enyl 2-chloroacetate. SMILES: ClCC(=O)OCC=C. InChI: 1S/C5H7ClO2/c1-2-3-8-5(7)4-6/h2H,1,3-4H2. | |
| Allyl chloroacetate, 98% | Allyl chloroacetate, 98%. CAS No. 2916-14-5. Molecular formula: C5H7ClO2. Mole weight: 134.56g/mol. IUPAC Name: prop-2-enyl 2-chloroacetate. SMILES: C=CCOC(=O)CCl. InChI: InChI=1S/C5H7ClO2/c1-2-3-8-5(7)4-6/h2H,1,3-4H2. | |
| Allyl(chloro)dimethylsilane | Allyl(chloro)dimethylsilane. Alternative Names: Allylchlorodimethylsilane; chloro-dimethyl-prop-2-enylsilane; ALLYLDIMETHYLCHLOROSILANE; Allyl(chloro)dimethylsilane; Allyldimethylsilyl Chloride. CAS No. 4028-23-3. Molecular formula: C5H11ClSi. Mole weight: 134.68. Purity: 95%+. IUPAC Name: chloro-dimethyl-prop-2-enylsilane. SMILES: C[Si](C)(CC=C)Cl. | |
| Allyl Cyanide | Liquid. CAS No. 109-75-1. Molecular formula: C4H5N. Mole weight: 67.09g/mol. IUPAC Name: but-3-enenitrile. SMILES: C=CCC#N. InChI: InChI=1S/C4H5N/c1-2-3-4-5/h2H,1,3H2. | |
| Allyl cyanide, 98% | Liquid. CAS No. 109-75-1. Molecular formula: C4H5N. Mole weight: 67.09g/mol. IUPAC Name: but-3-enenitrile. SMILES: C=CCC#N. InChI: InChI=1S/C4H5N/c1-2-3-4-5/h2H,1,3H2. | |
| Allyl cyanoacetate | Allyl cyanoacetate. Alternative Names: Cyanoacetic acid allyl ester. CAS No. 13361-32-5. Molecular formula: NCCH2CO2CH2CH=CH2. Mole weight: 125.13. IUPAC Name: prop-2-enyl 2-cyanoacetate. SMILES: C=CCOC(=O)CC#N. InChI: 1S/C6H7NO2/c1-2-5-9-6(8)3-4-7/h2H,1,3,5H2. | |
| ALLYLCYCLOHEXANE | ALLYLCYCLOHEXANE. CAS No. 2114-42-3. Molecular formula: C9H16. Mole weight: 124.22g/mol. Purity: BP 150-151deg. IUPAC Name: prop-2-enylcyclohexane. SMILES: C=CCC1CCCCC1. InChI: InChI=1S/C9H16/c1-2-6-9-7-4-3-5-8-9/h2,9H,1,3-8H2. | |
| Allylcyclohexane, ≥97% | Allylcyclohexane, ≥97%. CAS No. 2114-42-3. Molecular formula: C9H16. Mole weight: 124.22g/mol. IUPAC Name: prop-2-enylcyclohexane. SMILES: C=CCC1CCCCC1. InChI: InChI=1S/C9H16/c1-2-6-9-7-4-3-5-8-9/h2,9H,1,3-8H2. | |
| Allyl Ethyl Carbonate | Allyl Ethyl Carbonate. CAS No. 1469-70-1. Molecular formula: C6H10O3. Mole weight: 130.14g/mol. IUPAC Name: ethyl prop-2-enyl carbonate. SMILES: CCOC(=O)OCC=C. InChI: InChI=1S/C6H10O3/c1-3-5-9-6(7)8-4-2/h3H,1,4-5H2,2H3. | |
| Allyl Ethyl Carbonate, ≥97% | Allyl Ethyl Carbonate, ≥97%. CAS No. 1469-70-1. Molecular formula: C6H10O3. Mole weight: 130.14g/mol. IUPAC Name: ethyl prop-2-enyl carbonate. SMILES: CCOC(=O)OCC=C. InChI: InChI=1S/C6H10O3/c1-3-5-9-6(7)8-4-2/h3H,1,4-5H2,2H3. | |
| Allyl Ethyl Ether | Allyl ethyl ether appears as a liquid. Insoluble in water and less dense than water. Hence floats on water. Emits acrid irritating fumes when heated to high temperature. Used to make other chemicals. CAS No. 557-31-3. Molecular formula: C5H10O. Mole weight: 86.13g/mol. IUPAC Name: 3-ethoxyprop-1-ene. SMILES: CCOCC=C. InChI: InChI=1S/C5H10O/c1-3-5-6-4-2/h3H,1,4-5H2,2H3. | |
| Allyl Ethyl Ether, 95% | Allyl ethyl ether appears as a liquid. Insoluble in water and less dense than water. Hence floats on water. Emits acrid irritating fumes when heated to high temperature. Used to make other chemicals. CAS No. 557-31-3. Molecular formula: C5H10O. Mole weight: 86.13g/mol. IUPAC Name: 3-ethoxyprop-1-ene. SMILES: CCOCC=C. InChI: InChI=1S/C5H10O/c1-3-5-6-4-2/h3H,1,4-5H2,2H3. | |
| Allyl glycidyl ether, 99% | Allyl glycidyl ether appears as a colorless liquid with a pleasant odor. Slightly less dense than water and insoluble in water. Hence floats on water. Poisonous by ingestion and mildly toxic by inhalation and skin contact. Very irritating to skin and eyes. Used to make other chemicals.;DryPowder; Liquid;COLOURLESS LIQUID WITH CHARACTERISTIC ODOUR.;Colorless liquid with a pleasant odor.;Colorless liquid with a pleasant odor. CAS No. 106-92-3. Molecular formula: C6H10O2;C6H10O2. Mole weight: 114.14g/mol. IUPAC Name: 2-(prop-2-enoxymethyl)oxirane. SMILES: C=CCOCC1CO1. InChI: InChI=1S/C6H10O2/c1-2-3-7-4-6-5-8-6/h2,6H,1,3-5H2. | |
| Allyl hexanoate | Allyl hexanoate. Alternative Names: Hexanoic Acid Allyl Ester; Allyl caproate; Allyl Hexanoate; prop-2-enyl hexanoate. CAS No. 123-68-2. Molecular formula: C9H16O2. Mole weight: 156.22. Purity: 98%. IUPAC Name: prop-2-enyl hexanoate. SMILES: CCCCCC(=O)OCC=C. | |
| Allyl Methacrylate (stabilized with MEHQ) | Liquid;Colorless liquid. CAS No. 96-05-9. Molecular formula: C7H10O2. Mole weight: 126.15g/mol. IUPAC Name: prop-2-enyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OCC=C. InChI: InChI=1S/C7H10O2/c1-4-5-9-7(8)6(2)3/h4H,1-2,5H2,3H3. | |
| Allyl methyl carbonate | Allyl methyl carbonate. Alternative Names: Methyl allyl carbonate. CAS No. 35466-83-2. Molecular formula: CH2=CHCH2OCOOCH3. Mole weight: 116.12. IUPAC Name: methyl prop-2-enyl carbonate. SMILES: COC(=O)OCC=C. InChI: 1S/C5H8O3/c1-3-4-8-5(6)7-2/h3H,1,4H2,2H3. | |
| Allyl Methyl Sulfide | Allyl methyl sulfide is a bioactive organosulfur compound found in garlic. Allyl methyl sulfide exhibits antibacterial, antioxidant and anticancer properties. Alternative Names: 3-Methylthio-1-propene. CAS No. 10152-76-8. Molecular formula: C4H8S. Mole weight: 88.17. Purity: 95%+. IUPAC Name: 3-Methylsulfanylprop-1-ene. SMILES: CSCC=C. InChI: InChI=1S/C4H8S/c1-3-4-5-2/h3H,1,4H2,2H3. | |
| Allyl n-Octyl Ether | Allyl n-Octyl Ether. CAS No. 3295-97-4. Molecular formula: C11H22O. Mole weight: 170.29g/mol. IUPAC Name: 1-prop-2-enoxyoctane. SMILES: CCCCCCCCOCC=C. InChI: InChI=1S/C11H22O/c1-3-5-6-7-8-9-11-12-10-4-2/h4H,2-3,5-11H2,1H3. | |
| Allyl n-Octyl Ether, 95% | Allyl n-Octyl Ether, 95%. CAS No. 3295-97-4. Molecular formula: C11H22O. Mole weight: 170.29g/mol. IUPAC Name: 1-prop-2-enoxyoctane. SMILES: CCCCCCCCOCC=C. InChI: InChI=1S/C11H22O/c1-3-5-6-7-8-9-11-12-10-4-2/h4H,2-3,5-11H2,1H3. | |
| Allyloxytrimethylsilane | Allyloxytrimethylsilane. Alternative Names: Silane,trimethyl(2-propen-1-yloxy)-O-TrimethylsilylallylalcoholTrimethyl(2-propenyloxy)silaneSilane,trimethyl(2-propenyloxy)-Trimethyl(Prop-2-En-1-Yloxy)Silane. CAS No. 18146-00-4. Molecular formula: C6H14OSi. Mole weight: 130.26 g/mol. Purity: >97%. IUPAC Name: trimethyl(prop-2-enoxy)silane. SMILES: C[Si](C)(C)OCC=C. | |
| Allylpentafluorobenzene | Allylpentafluorobenzene. Alternative Names: Allylpentafluorobenzene, Benzene, allylpentafluoro-, A34759_ALDRICH, BENZENE, PENTAFLUORO-2-PROPENYL-, NSC88279, EINECS 217-083-6, 1736-60-3. CAS No. 1736-60-3. Molecular formula: C8H9ClN2OS. Mole weight: 208.13. Purity: 96%. IUPAC Name: 1,2,3,4,5-pentafluoro-6-prop-2-enylbenzene. SMILES: C=CCC1=C(C(=C(C(=C1F)F)F)F)F. | |
| Allylpentafluorobenzene, ≥98% | Allylpentafluorobenzene, ≥98%. CAS No. 1736-60-3. Molecular formula: C9H5F5. Mole weight: 208.13g/mol. IUPAC Name: 1,2,3,4,5-pentafluoro-6-prop-2-enylbenzene. SMILES: C=CCC1=C(C(=C(C(=C1F)F)F)F)F. InChI: InChI=1S/C9H5F5/c1-2-3-4-5(10)7(12)9(14)8(13)6(4)11/h2H,1,3H2. | |
| Allyl phenoxyacetate | Allyl Phenoxyacetate is a synthetic flavoring agent that is a stable, colorless to Light yellow liquid of heavy fruit note odor. It should be stored in glass or tin containers. it is used in pineapple, quince, and fruit flavors with applications in candy and beverages at 1-3 ppm. Alternative Names: Acetic acid, phenoxy-, 2-propenyl ester. CAS No. 7493-74-5. Molecular formula: C11H12O3. Mole weight: 192.21. Purity: 98%+. IUPAC Name: Prop-2-enyl 2-phenoxyacetate. SMILES: C=CCOC(=O)COC1=CC=CC=C1. InChI: InChI=1S/C11H12O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2-7H,1,8-9H2. | |
| Allyl phenylacetate | Colourless, slightly viscous liquid with a honey-like odour. CAS No. 1797-74-6. Molecular formula: C11H12O2. Mole weight: 176.21g/mol. Purity: BP 89-93deg/3mm. IUPAC Name: prop-2-enyl 2-phenylacetate. SMILES: C=CCOC(=O)CC1=CC=CC=C1. InChI: InChI=1S/C11H12O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2-7H,1,8-9H2. | |
| Allyl Phenylacetate, ≥98% | Colourless, slightly viscous liquid with a honey-like odour. CAS No. 1797-74-6. Molecular formula: C11H12O2. Mole weight: 176.21g/mol. IUPAC Name: prop-2-enyl 2-phenylacetate. SMILES: C=CCOC(=O)CC1=CC=CC=C1. InChI: InChI=1S/C11H12O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2-7H,1,8-9H2. | |
| Allyl phenyl carbonate | Allyl phenyl carbonate. Alternative Names: Carbonic Acid Allyl Phenyl Ester. CAS No. 16308-68-2. Molecular formula: C10H10O3. Mole weight: 178.18. Purity: 97%. IUPAC Name: phenyl prop-2-enyl carbonate. SMILES: C=CCOC(=O)OC1=CC=CC=C1. | |
| Allyl phenyl ether | Allyl phenyl ether. Alternative Names: (2-propenyloxy)-benzen;(prop-2-enyloxy)-benzene;3-Phenoxypropene;Allyl phenoxylate;Ether, allyl phenyl;ether,allylphenyl;Phenyl 2-propenyl ether;Phenylpropenyl ether. CAS No. 1746-13-0. Molecular formula: C6H5OCH2CH=CH2. Mole weight: 134.18. IUPAC Name: prop-2-enoxybenzene. SMILES: C=CCOc1ccccc1. InChI: 1S/C9H10O/c1-2-8-10-9-6-4-3-5-7-9/h2-7H,1,8H2. | |
| Allyl p-Tolyl Ether | Allyl p-Tolyl Ether. CAS No. 23431-48-3. Molecular formula: C10H12O. Mole weight: 148.2g/mol. IUPAC Name: 1-methyl-4-prop-2-enoxybenzene. SMILES: CC1=CC=C(C=C1)OCC=C. InChI: InChI=1S/C10H12O/c1-3-8-11-10-6-4-9(2)5-7-10/h3-7H,1,8H2,2H3. | |
| Allyl p-Tolyl Ether, ≥95% | Allyl p-Tolyl Ether, ≥95%. CAS No. 23431-48-3. Molecular formula: C10H12O. Mole weight: 148.2g/mol. IUPAC Name: 1-methyl-4-prop-2-enoxybenzene. SMILES: CC1=CC=C(C=C1)OCC=C. InChI: InChI=1S/C10H12O/c1-3-8-11-10-6-4-9(2)5-7-10/h3-7H,1,8H2,2H3. | |
| Allylsuccinic anhydride | Allylsuccinic anhydride. CAS No. 7539-12-0. Molecular formula: C7H8O3. Mole weight: 140.14g/mol. IUPAC Name: 3-prop-2-enyloxolane-2,5-dione. SMILES: C=CCC1CC(=O)OC1=O. InChI: InChI=1S/C7H8O3/c1-2-3-5-4-6(8)10-7(5)9/h2,5H,1,3-4H2. | |
| Allylsuccinic Anhydride, 97% | Allylsuccinic Anhydride, 97%. CAS No. 7539-12-0. Molecular formula: C7H8O3. Mole weight: 140.14g/mol. IUPAC Name: 3-prop-2-enyloxolane-2,5-dione. SMILES: C=CCC1CC(=O)OC1=O. InChI: InChI=1S/C7H8O3/c1-2-3-5-4-6(8)10-7(5)9/h2,5H,1,3-4H2. | |
| Allyl trifluoroacetate | Allyl trifluoroacetate. Alternative Names: ALLYL-(TRIFLUORACETAT);ALLYL TRIFLUORACETATE;ALLYL TRIFLUOROACETATE;TIMTEC-BB SBB006598;TRIFLUOROACETIC ACID ALLYL ESTER;Acetic acid, trifluoro-, 2-propenyl ester;Acetic acid, trifluoro-, allyl ester;Trifluoroacetic acid, 2-propenyl ester. CAS No. 383-67-5. Molecular formula: C5H5F3O2. Mole weight: 154.09. Purity: 96%. IUPAC Name: prop-2-enyl 2,2,2-trifluoroacetate. SMILES: C=CCOC(=O)C(F)(F)F. | |
| Allyl Trifluoroacetate, ≥95% | Allyl Trifluoroacetate, ≥95%. CAS No. 383-67-5. Molecular formula: C5H5F3O2. Mole weight: 154.09g/mol. IUPAC Name: prop-2-enyl 2,2,2-trifluoroacetate. SMILES: C=CCOC(=O)C(F)(F)F. InChI: InChI=1S/C5H5F3O2/c1-2-3-10-4(9)5(6,7)8/h2H,1,3H2. | |
| α,α,α',α'-Tetramethyl-1,3-benzenedipropionic Acid | α,α,α',α'-Tetramethyl-1,3-benzenedipropionic Acid. CAS No. 819050-88-9. Molecular formula: C16H22O4. Mole weight: 278.34g/mol. IUPAC Name: 3-[3-(2-carboxy-2-methylpropyl)phenyl]-2,2-dimethylpropanoic acid. SMILES: CC(C)(CC1=CC(=CC=C1)CC(C)(C)C(=O)O)C(=O)O. InChI: InChI=1S/C16H22O4/c1-15(2,13(17)18)9-11-6-5-7-12(8-11)10-16(3,4)14(19)20/h5-8H,9-10H2,1-4H3,(H,17,18)(H,19,20). | |
| α,α,α',α'-Tetramethyl-1,3-benzenedipropionic Acid, ≥98% | α,α,α',α'-Tetramethyl-1,3-benzenedipropionic Acid, ≥98%. CAS No. 819050-88-9. Molecular formula: C16H22O4. Mole weight: 278.34g/mol. IUPAC Name: 3-[3-(2-carboxy-2-methylpropyl)phenyl]-2,2-dimethylpropanoic acid. SMILES: CC(C)(CC1=CC(=CC=C1)CC(C)(C)C(=O)O)C(=O)O. InChI: InChI=1S/C16H22O4/c1-15(2,13(17)18)9-11-6-5-7-12(8-11)10-16(3,4)14(19)20/h5-8H,9-10H2,1-4H3,(H,17,18)(H,19,20). | |
| α,α,α'-Tris(4-hydroxyphenyl)-1-ethyl-4-isopropylbenzene | Liquid. CAS No. 110726-28-8. Molecular formula: C29H28O3. Mole weight: 424.5g/mol. IUPAC Name: 4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]phenol. SMILES: CC(C)(C1=CC=C(C=C1)C(C)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O. InChI: InChI=1S/C29H28O3/c1-28(2,21-8-14-25(30)15-9-21)20-4-6-22(7-5-20)29(3,23-10-16-26(31)17-11-23)24-12-18-27(32)19-13-24/h4-19,30-32H,1-3H3. | |
| α,α'-Bis(4-aminophenyl)-1,4-diisopropylbenzene | α,α'-Bis(4-aminophenyl)-1,4-diisopropylbenzene. CAS No. 2716-10-1. Molecular formula: C24H28N2. Mole weight: 344.5g/mol. IUPAC Name: 4-[2-[4-[2-(4-aminophenyl)propan-2-yl]phenyl]propan-2-yl]aniline. SMILES: CC(C)(C1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)N)C3=CC=C(C=C3)N. InChI: InChI=1S/C24H28N2/c1-23(2,19-9-13-21(25)14-10-19)17-5-7-18(8-6-17)24(3,4)20-11-15-22(26)16-12-20/h5-16H,25-26H2,1-4H3. | |
| α,α'-Bis(4-hydroxy-3,5-dimethylphenyl)-1,4-diisopropylbenzene | α,α'-Bis(4-hydroxy-3,5-dimethylphenyl)-1,4-diisopropylbenzene. CAS No. 36395-57-0. Molecular formula: C28H34O2. Mole weight: 402.6g/mol. IUPAC Name: 4-[2-[4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]phenyl]propan-2-yl]-2,6-dimethylphenol. SMILES: CC1=CC(=CC(=C1O)C)C(C)(C)C2=CC=C(C=C2)C(C)(C)C3=CC(=C(C(=C3)C)O)C. InChI: InChI=1S/C28H34O2/c1-17-13-23(14-18(2)25(17)29)27(5,6)21-9-11-22(12-10-21)28(7,8)24-15-19(3)26(30)20(4)16-24/h9-16,29-30H,1-8H3. | |
| α,α'-Bis(4-hydroxy-3,5-dimethylphenyl)-1,4-diisopropylbenzene, ≥98% | α,α'-Bis(4-hydroxy-3,5-dimethylphenyl)-1,4-diisopropylbenzene, ≥98%. CAS No. 36395-57-0. Molecular formula: C28H34O2. Mole weight: 402.6g/mol. IUPAC Name: 4-[2-[4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]phenyl]propan-2-yl]-2,6-dimethylphenol. SMILES: CC1=CC(=CC(=C1O)C)C(C)(C)C2=CC=C(C=C2)C(C)(C)C3=CC(=C(C(=C3)C)O)C. InChI: InChI=1S/C28H34O2/c1-17-13-23(14-18(2)25(17)29)27(5,6)21-9-11-22(12-10-21)28(7,8)24-15-19(3)26(30)20(4)16-24/h9-16,29-30H,1-8H3. | |
| α,α'-Bis(4-hydroxyphenyl)-1,4-diisopropylbenzene | α,α'-Bis(4-hydroxyphenyl)-1,4-diisopropylbenzene. CAS No. 2167-51-3. Molecular formula: C24H26O2. Mole weight: 346.5g/mol. IUPAC Name: 4-[2-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]propan-2-yl]phenol. SMILES: CC(C)(C1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)O)C3=CC=C(C=C3)O. InChI: InChI=1S/C24H26O2/c1-23(2,19-9-13-21(25)14-10-19)17-5-7-18(8-6-17)24(3,4)20-11-15-22(26)16-12-20/h5-16,25-26H,1-4H3. | |
| alpha-carboline, 99% | alpha-carboline, 99%. CAS No. 244-76-8. Molecular formula: C11H8N2. Mole weight: 168.19g/mol. IUPAC Name: 9H-pyrido[2,3-b]indole. SMILES: C1=CC=C2C(=C1)C3=C(N2)N=CC=C3. InChI: InChI=1S/C11H8N2/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-7H,(H,12,13). | |
| α-Methylene-γ-butyrolactone | α-Methylene-γ-butyrolactone. Alternative Names: 3-Methylenedihydro-2(3H)-furanone, Tulipane, alpha-Methylene-gamma-butyrolactone. CAS No. 547-65-9. Molecular formula: C5H6O2. Mole weight: 98.1g/mol. Purity: 97%. IUPAC Name: 3-methylideneoxolan-2-one. SMILES: C=C1CCOC1=O. InChI: InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h1-3H2. | |
| α-Methylene-γ-valerolactone (stabilized with HQ) | α-Methylene-γ-valerolactone (stabilized with HQ). CAS No. 62873-16-9. Molecular formula: C6H8O2. Mole weight: 112.13g/mol. IUPAC Name: 5-methyl-3-methylideneoxolan-2-one. SMILES: CC1CC(=C)C(=O)O1. InChI: InChI=1S/C6H8O2/c1-4-3-5(2)8-6(4)7/h5H,1,3H2,2H3. | |
| α-NPD | α-NPD. CAS No. 495416-60-9. Molecular formula: C46H36N2. Mole weight: 616.8g/mol. IUPAC Name: N-[3-methyl-4-[2-methyl-4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine. SMILES: CC1=C(C=CC(=C1)N(C2=CC=CC=C2)C3=CC=CC4=CC=CC=C43)C5=C(C=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC8=CC=CC=C87)C. InChI: InChI=1S/C46H36N2/c1-33-31-39(47(37-19-5-3-6-20-37)45-25-13-17-35-15-9-11-23-43(35)45)27-29-41(33)42-30-28-40(32-34(42)2)48(38-21-7-4-8-22-38)46-26-14-18-36-16-10-12-24-44(36)46/h3-32H,1-2H3. | |
| α-Octithiophene, ≥95% | α-Octithiophene, ≥95%. CAS No. 113728-71-5. Molecular formula: C32H18S8. Mole weight: 659g/mol. IUPAC Name: 2-thiophen-2-yl-5-[5-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene. SMILES: C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=C(S4)C5=CC=C(S5)C6=CC=C(S6)C7=CC=C(S7)C8=CC=CS8. InChI: InChI=1S/C32H18S8/c1-3-19(33-17-1)21-5-7-23(35-21)25-9-11-27(37-25)29-13-15-31(39-29)32-16-14-30(40-32)28-12-10-26(38-28)24-8-6-22(36-24)20-4-2-18-34-20/h1-18H. | |
| α-Quaterthiophene, ≥95% | α-Quaterthiophene, ≥95%. CAS No. 5632-29-1. Molecular formula: C16H10S4. Mole weight: 330.5g/mol. IUPAC Name: 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. SMILES: C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4. InChI: InChI=1S/C16H10S4/c1-3-11(17-9-1)13-5-7-15(19-13)16-8-6-14(20-16)12-4-2-10-18-12/h1-10H. | |
| α-Quinquethiophene, ≥95% | α-Quinquethiophene, ≥95%. CAS No. 5660-45-7. Molecular formula: C20H12S5. Mole weight: 412.6g/mol. IUPAC Name: 2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene. SMILES: C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=C(S4)C5=CC=CS5. InChI: InChI=1S/C20H12S5/c1-3-13(21-11-1)15-5-7-17(23-15)19-9-10-20(25-19)18-8-6-16(24-18)14-4-2-12-22-14/h1-12H. | |
| α-Septithiophene, ≥95% | α-Septithiophene, ≥95%. CAS No. 86100-63-2. Molecular formula: C28H16S7. Mole weight: 576.9g/mol. IUPAC Name: 2,5-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophene. SMILES: C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=C(S4)C5=CC=C(S5)C6=CC=C(S6)C7=CC=CS7. InChI: InChI=1S/C28H16S7/c1-3-17(29-15-1)19-5-7-21(31-19)23-9-11-25(33-23)27-13-14-28(35-27)26-12-10-24(34-26)22-8-6-20(32-22)18-4-2-16-30-18/h1-16H. | |
| α-Sexithiophene | α-Sexithiophene. Alternative Names: 2-Thiophen-2-yl-5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene. CAS No. 88493-55-4. Molecular formula: C24H14S6. Mole weight: 494.75. Purity: 95%+. IUPAC Name: 2-thiophen-2-yl-5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene. SMILES: c1csc(c1)-c2ccc(s2)-c3ccc(s3)-c4ccc(s4)-c5ccc(s5)-c6cccs6. InChI: 1S/C24H14S6/c1-3-15(25-13-1)17-5-7-19(27-17)21-9-11-23(29-21)24-12-10-22(30-24)20-8-6-18(28-20)16-4-2-14-26-16/h1-14H,KUJYDIFFRDAYDH-UHFFFAOYSA-N. | |
| Aluminum 1 8 15 22-tetrakis(phenylthio)& | Aluminum 1 8 15 22-tetrakis(phenylthio)&. Alternative Names: ALUMINUM 1 8 15 22-TETRAKIS(PHENYLTHIO)&;Aluminum 1,8,15,22-tetrakis(phenylthio)-29H,31H-phthalocyanine chloride Dye content 90 %. CAS No. 167093-23-4. Molecular formula: C56H32AlN8S4.Cl. Mole weight: 1007.62. | |
| Aluminum 2,3-naphthalocyanine chloride | Aluminum 2,3-naphthalocyanine chloride. Alternative Names: ALUMINUM 2,3-NAPHTHALOCYANINE CHLORIDE;aluminium 2,3-naphthalocyanine chloride;Aluminum 2,3-naphthalocyanine chloride Dye content 80 %. CAS No. 33273-14-2. Molecular formula: C48H24AlClN8. Mole weight: 775.19. Purity: 96%. IUPAC Name: aluminum-2,3-naphthalocyanine chloride. SMILES: C1=CC=C2C=C3C(=CC2=C1)C4=NC5=C6C=C7C=CC=CC7=CC6=C8N5[Al](N9C(=NC3=N4)C1=CC2=CC=CC=C2C=C1C9=NC1=NC(=N8)C2=CC3=CC=CC=C3C=C21)Cl. | |
| Aluminum acetate,dibasic | Aluminum acetate,dibasic. Alternative Names: ALUMINIUM ACETATE BASIC;ALUMINUM ACETATE, DIBASIC;DIHYDROXYALUMINUM ACETATE;(acetato-o)dihydroxy-aluminu;ALUMINUM ACETATE, BASIC, STABILIZED WITHBORIC ACID;DIHYDROXYALUMINIUMACETATE;Aluminum, (acetato-?O)dihydroxy-;aluminium acetate, basic, water-soluble. CAS No. 7360-44-3. Molecular formula: C2H7AlO4. Mole weight: 122.06g/mol. SMILES: CC(=O)O[Al].O.O. InChI: InChI=1S/C2H4O2.Al.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1. | |
| Aluminum acetylacetonate | Aluminum acetylacetonate. Alternative Names: TRIS(2,4-PENTANEDIONATO)ALUMINIUM;TRIS(2,4-PENTANEDIONATO)ALUMINUM(3);TRIS(2,4-PENTANEDIONATO)ALUMINUM(III);TRIS(ACETYLACETONATO)ALUMINIUM;ACETYLACETIC ACID, ALUMINUM SALT;ACETYLACETONE ALUMINIUM;ACETYLACETONE, ALUMINUM DERIVATIVE;ACETYLACETONE ALUMINUM(I. CAS No. 13963-57-0. Molecular formula: C15H21AlO6. Mole weight: 324.31. | |
| Aluminum chlorohydrate, 98% | Aluminum chlorohydrate, 98%. CAS No. 1327-41-9. | |
| Aluminum phthalocyanine chloride | Aluminum phthalocyanine chloride. Alternative Names: Chloro(phthalocyaninate)aluminium. CAS No. 14154-42-8. Molecular formula: C32H16AlClN8. Mole weight: 574.97. Purity: 95%+. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.