Alfa Chemistry Materials 6 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Dioctyl Sebacate | COLOURLESS OILY LIQUID. Molecular formula: C26H50O4;CH3(CH2)3CH(C2H5)CH2OOC(CH2)8COOCH2CH(C2H5)(CH2)3CH3;C26H50O4. Mole weight: 426.7g/mol. IUPAC Name: dioctyl decanedioate. SMILES: CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC. InChI: InChI=1S/C26H50O4/c1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2/h3-24H2,1-2H3. |  |
| Dioctyl Sebacate (DOS) | Dioctyl Sebacate (DOS). | |
| Dioctyl Terephthalate (DOTP) | Dioctyl Terephthalate (DOTP). | |
| Dioxybenzone | 2,2'-dihydroxy-4-methoxybenzophenone is a yellow powder. (NTP, 1992);DryPowder. CAS No. 131-53-3. Molecular formula: C14H12O4. Mole weight: 244.24g/mol. IUPAC Name: (2-hydroxy-4-methoxyphenyl)-(2-hydroxyphenyl)methanone. SMILES: COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2O)O. InChI: InChI=1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3. | |
| Dipentaerythritol | DryPowder; PelletsLargeCrystals. Molecular formula: C10H22O7. Mole weight: 254.28g/mol. IUPAC Name: 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol. SMILES: C(C(CO)(CO)COCC(CO)(CO)CO)O. InChI: InChI=1S/C10H22O7/c11-1-9(2-12,3-13)7-17-8-10(4-14,5-15)6-16/h11-16H,1-8H2. | |
| Dipentaerythritol Hexaacrylate | Liquid; WetSolid. Molecular formula: C28H34O13. Mole weight: 578.6g/mol. IUPAC Name: [3-prop-2-enoyloxy-2-[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate. SMILES: C=CC(=O)OCC(COCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C. InChI: InChI=1S/C28H34O13/c1-7-21(29)36-15-27(16-37-22(30)8-2,17-38-23(31)9-3)13-35-14-28(18-39-24(32)10-4,19-40-25(33)11-5)20-41-26(34)12-6/h7-12H,1-6,13-20H2. | |
| Dipentaerythritol Pentaacrylate Monoundecylate | Dipentaerythritol Pentaacrylate Monoundecylate. | |
| Dipentaerythritol Triacrylate Triundecylate | Dipentaerythritol Triacrylate Triundecylate. | |
| DIPENTINE | DIPENTINE. | |
| Diphenyl Carbonate | Diphenyl Carbonate. Molecular formula: C13H10O3. Mole weight: 214.22g/mol. IUPAC Name: diphenyl carbonate. SMILES: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2. InChI: InChI=1S/C13H10O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H. | |
| Diphenyl Isodecyl Phosphite | Liquid. Molecular formula: C22H31O3P. Mole weight: 374.5g/mol. IUPAC Name: 8-methylnonyl diphenyl phosphite. SMILES: CC(C)CCCCCCCOP(OC1=CC=CC=C1)OC2=CC=CC=C2. InChI: InChI=1S/C22H31O3P/c1-20(2)14-8-4-3-5-13-19-23-26(24-21-15-9-6-10-16-21)25-22-17-11-7-12-18-22/h6-7,9-12,15-18,20H,3-5,8,13-14,19H2,1-2H3. | |
| Diphenyl Phthalate | Diphenyl Phthalate. Molecular formula: C20H14O4. Mole weight: 318.3g/mol. IUPAC Name: diphenyl benzene-1,2-dicarboxylate. SMILES: C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2C(=O)OC3=CC=CC=C3. InChI: InChI=1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H. | |
| Dipropylene Glycol Diacrylate, (stabilized with MEHQ) | Dipropylene Glycol Diacrylate, (stabilized with MEHQ). CAS No. 57472-68-1. | |
| Dipropylene Glycol Dibenzoate (DPGDB) | Dipropylene Glycol Dibenzoate (DPGDB). | |
| di(propylene glycol) tert-butyl ether | di(propylene glycol) tert-butyl ether. CAS No. 132739-31-2. | |
| Disposable polystyrene weighing dishes (blue) | Disposable polystyrene weighing dishes (blue). | |
| Disposable polystyrene weighing dishes (white) | Disposable polystyrene weighing dishes (white). | |
| Ditridecyl Phthalate, (mixture of branched chain isomers) | Nearly colorless oily liquid. Floats on water. (USCG, 1999);Liquid. CAS No. 75359-31-8. Molecular formula: C34H58O4. Mole weight: 530.8g/mol. IUPAC Name: ditridecyl benzene-1,2-dicarboxylate. SMILES: CCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCCCCC. InChI: InChI=1S/C34H58O4/c1-3-5-7-9-11-13-15-17-19-21-25-29-37-33(35)31-27-23-24-28-32(31)34(36)38-30-26-22-20-18-16-14-12-10-8-6-4-2/h23-24,27-28H,3-22,25-26,29-30H2,1-2H3. | |
| Diundecyl Phthalate, (mixture of branched chain isomers) | Diundecyl Phthalate, (mixture of branched chain isomers). CAS No. 96507-86-7. Molecular formula: C30H50O4. Mole weight: 474.7g/mol. IUPAC Name: bis(9-methyldecyl) benzene-1,2-dicarboxylate. SMILES: CC(C)CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC(C)C. InChI: InChI=1S/C30H50O4/c1-25(2)19-13-9-5-7-11-17-23-33-29(31)27-21-15-16-22-28(27)30(32)34-24-18-12-8-6-10-14-20-26(3)4/h15-16,21-22,25-26H,5-14,17-20,23-24H2,1-4H3. | |
| Divinylbenzene, (m- and p- mixture) (contains Ethylvinylbenzene, Diethylbenzene) (stabilized with TBC) | Divinyl benzene appears as a water-white to straw colored liquid. Slightly less dense than water and insoluble in water. Vapors may be toxic. Used in making rubber.;Liquid;COLOURLESS LIQUID WITH CHARACTERISTIC ODOUR.;Pale, straw-colored liquid.;Pale, straw-colored liquid. CAS No. 1321-74-0. Molecular formula: C10H10;C6H4(CH=CH2)2;C10H10. Mole weight: 130.19g/mol. IUPAC Name: 1,2-bis(ethenyl)benzene. SMILES: C=CC1=CC=CC=C1C=C. InChI: InChI=1S/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h3-8H,1-2H2. | |
| Divinylbenzene-styrenesulfonic acid copolymer | Divinylbenzene-styrenesulfonic acid copolymer. CAS No. 39389-20-3. Molecular formula: C18H18O3S. Mole weight: 314.4g/mol. IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid. SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O. InChI: InChI=1S/C10H10.C8H8O3S/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-5-3-4-6-8(7)12(9,10)11/h3-8H,1-2H2;2-6H,1H2,(H,9,10,11). | |
| DL-3-Hydroxybutyric Acid, (contains Polymolecular esterification product) | Solid. CAS No. 300-85-6. Molecular formula: C4H8O3. Mole weight: 104.1g/mol. IUPAC Name: 3-hydroxybutanoic acid. SMILES: CC(CC(=O)O)O. InChI: InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7). | |
| DL-Lactic Acid | Lactic acid appears as a colorless to yellow odorless syrupy liquid. Corrosive to metals and tissue. Used to make cultured dairy products, as a food preservative, and to make chemicals.;Liquid;Colourless or yellowish, nearly odourless, syrupy liquid to solid;liquid;VISCOUS COLOURLESS-TO-YELLOW LIQUID OR COLOURLESS-TO-YELLOW CRYSTALS.;colourless to yellow hygroscopic crystals becoming syrupy liquid; odourless. CAS No. 50-21-5. Molecular formula: C3H6O3;C3H6O3;CH3CHOHCOOH;HC3H5O3;C3H6O3. Mole weight: 90.08g/mol. IUPAC Name: 2-hydroxypropanoic acid. SMILES: CC(C(=O)O)O. InChI: InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6). | |
| DL-Lactic Acid | Lactic acid appears as a colorless to yellow odorless syrupy liquid. Corrosive to metals and tissue. Used to make cultured dairy products, as a food preservative, and to make chemicals.;Liquid;Colourless or yellowish, nearly odourless, syrupy liquid to solid;liquid;VISCOUS COLOURLESS-TO-YELLOW LIQUID OR COLOURLESS-TO-YELLOW CRYSTALS.;colourless to yellow hygroscopic crystals becoming syrupy liquid; odourless. CAS No. 26100-51-6. Molecular formula: C3H6O3;C3H6O3;CH3CHOHCOOH;HC3H5O3;C3H6O3. Mole weight: 90.08g/mol. IUPAC Name: 2-hydroxypropanoic acid. SMILES: CC(C(=O)O)O. InChI: InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6). | |
| DL-Lactic Acid, Racemic | Lactic acid appears as a colorless to yellow odorless syrupy liquid. Corrosive to metals and tissue. Used to make cultured dairy products, as a food preservative, and to make chemicals.;Liquid;Colourless or yellowish, nearly odourless, syrupy liquid to solid;liquid;VISCOUS COLOURLESS-TO-YELLOW LIQUID OR COLOURLESS-TO-YELLOW CRYSTALS.;colourless to yellow hygroscopic crystals becoming syrupy liquid; odourless. CAS No. 50-21-5. Molecular formula: C3H6O3;C3H6O3;CH3CHOHCOOH;HC3H5O3;C3H6O3. Mole weight: 90.08g/mol. IUPAC Name: 2-hydroxypropanoic acid. SMILES: CC(C(=O)O)O. InChI: InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6). | |
| Docosahexaenoic acid | Docosahexaenoic acid. Alternative Names: cis-4,7,10,13,16,19-Docosahexaenoic acid. CAS No. 6217-54-5. Molecular formula: C22H32O2. Mole weight: 328.49. Purity: 95%. SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O. InChI: InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-. | |
| Dodecan-1-amine | Dodecan-1-amine. Alternative Names: Dodecylamine. CAS No. 124-22-1. Molecular formula: C12H27N. Mole weight: 185.35. Purity: 98%. SMILES: CCCCCCCCCCCCN. InChI: InChI=1S/C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13/h2-13H2,1H3. | |
| Dodecanethiol Functionalized Gold Nanoparticles Solution | Dodecanethiol Functionalized Gold Nanoparticles Solution. Alternative Names: Dodecylthiol functionalized gold nanoparticles. Molecular formula: Au-C12H25S. Mole weight: 398.358469. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: dodecane-1-thiolate; gold(1+). SMILES: CCCCCCCCCCCC[S-].[Au+]. InChI: InChI=1S/C12H26S.Au/c1-2-3-4-5-6-7-8-9-10-11-12-13;/h13H,2-12H2,1H3;/q;+1/p-1. | |
| Dodecyltrimethylammonium bromide | Dodecyltrimethylammonium bromide. Alternative Names: Lauryltrimethylammonium bromide. CAS No. 1119-94-4. Molecular formula: C15H34BrN. Mole weight: 308.35. Purity: >98%. SMILES: CCCCCCCCCCCC[N+](C)(C)C.[Br-]. InChI: InChI=1S/C15H34N.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16(2,3)4;/h5-15H2,1-4H3;1H/q+1;/p-1. | |
| Dodecyltrimethylammonium chloride | Dodecyltrimethylammonium chloride. Alternative Names: Lauryltrimethylammonium chloride. CAS No. 112-00-5. Molecular formula: C15H34ClN. Mole weight: 263.89. Purity: >97%. SMILES: CCCCCCCCCCCC[N+](C)(C)C.[Cl-]. InChI: InChI=1S/C15H34N.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16(2,3)4;/h5-15H2,1-4H3;1H/q+1;/p-1. | |
| dowex 1x4-200 ion-exchange resin | dowex 1x4-200 ion-exchange resin. CAS No. 69011-19-4. Molecular formula: C31H39N. Mole weight: 425.6g/mol. IUPAC Name: 1,2-bis(ethenyl)benzene;N,N-dimethylmethanamine;1-ethenyl-2-ethylbenzene;styrene. SMILES: CCC1=CC=CC=C1C=C.CN(C)C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1C=C. InChI: InChI=1S/C10H12.C10H10.C8H8.C3H9N/c2*1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;1-4(2)3/h3,5-8H,1,4H2,2H3;3-8H,1-2H2;2-7H,1H2;1-3H3. | |
| Dowex®, 1X8-100 Anion Resin | Dowex®, 1X8-100 Anion Resin. Alternative Names: Dowex(r) 1X8-50. CAS No. 69772-06-1. Molecular formula: Dowex®. Mole weight: Dowex®. | |
| Dowex mac-3 ion exchange resin | Dowex mac-3 ion exchange resin. Alternative Names: 2-Propenoic acid,polymer with diethenylbenzene; Acrylic acid,divinylbenzene polymer. CAS No. 9052-45-3. Molecular formula: C13H14O2. Mole weight: 202.2491. Purity: 96%. IUPAC Name: 1,2-bis(ethenyl)benzene;prop-2-enoic acid. | |
| Drop Ceiling Tiles | For unique styling, as well as additional sound deadening, our drop ceiling tiles enhance a room's form and function. Available with a smooth or patterned texture, these tiles will fit any décor. | |
| Dryfast Foam-Type 1 | Dryfast foams are suited for outdoor use where moisture and precipitation like rain is prevalent, such as in patio furniture, including under Phifertex material, or in marine cushioning on personal watercraft. The large, open cells provide a degree of airflow not present in other foams, allowing it to dry quickly, even after complete saturation. | |
| Dryfast Foam-Type 2 | Dryfast foams are suited for outdoor use where moisture and precipitation are prevalent, such as in patio furniture, including under Phifertex material, or in marine cushioning on personal watercraft. The large, open cells provide a degree of airflow not present in other foams, allowing it to dry quickly, even after complete saturation. | |
| duolite c-26 ion-exchange resin | duolite c-26 ion-exchange resin. CAS No. 68441-33-8. | |
| Duralink HTS | Duralink HTS. Molecular formula: C6H12Na2O6S4. Mole weight: 354.4g/mol. IUPAC Name: disodium;1,6-bis(sulfonatosulfanyl)hexane. SMILES: C(CCCSS(=O)(=O)[O-])CCSS(=O)(=O)[O-].[Na+].[Na+]. InChI: InChI=1S/C6H14O6S4.2Na/c7-15(8,9)13-5-3-1-2-4-6-14-16(10,11)12;;/h1-6H2,(H,7,8,9)(H,10,11,12);;/q;2*+1/p-2. | |
| (E)-2-Decenoic acid | (E)-2-Decenoic acid. Alternative Names: trans-2-Decenoic acid. CAS No. 334-49-6. Molecular formula: C10H18O2. Mole weight: 170.25. Purity: 97%. SMILES: CCCCCCC/C=C/C(=O)O. InChI: InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/b9-8+. | |
| (E)-Dodec-2-enoic acid | (E)-Dodec-2-enoic acid. Alternative Names: trans-2-Dodecenoic Acid. CAS No. 32466-54-9. Molecular formula: C12H22O2. Mole weight: 198.30. Purity: 98%. SMILES: CCCCCCCCC/C=C/C(=O)O. InChI: InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+. | |
| Eggcrate Charcoal Firm Foam | With its classic shape, our high-quality eggcrate charcoal firm foam offers extra cushioning and airflow while still being one of the most economical choices on the market today. It replicates the effects of standard charcoal firm sheet foam more economically, due to our cutting process and the shape adds extra benefits. | |
| Eggcrate Charcoal Regular Foam | With its familiar, classic design, charcoal regular eggcrate foam replicates the effects of charcoal regular sheet foam more economically, due to our cutting process. Its non-soiling surface makes it appropriate for use in any area charcoal regular foam can be applied. | |
| Eggcrate-Charcoal Regular Foam Top/Lid | Eggcrate toppers and lids are a perfect complement to your custom packaging or casing when placed over your Pick and Pull Grid core design. | |
| Eggcrate Pink Anti-Static Foam Top/Lid | Eggcrate toppers and lids are a perfect complement to your custom packaging or casing when placed over your Pick and Pull Grid core design. | |
| Elaidic acid | Elaidic acid. Alternative Names: trans-9-Oleic acid. CAS No. 112-79-8. Molecular formula: C18H34O2. Mole weight: 282.47. Purity: >97%. SMILES: CCCCCCCC/C=C/CCCCCCCC(=O)O. InChI: InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+. | |
| Elemi | Elemi. CAS No. 9000-75-3. Molecular formula: CAS: 9000-75-3. Purity: soft. | |
| Endotoxin Free Gold Nanoparticles | Endotoxin Free Gold Nanoparticles. Purity: >99% reactant free. | |
| Endotoxin Free Gold Nanourchins | Cytodiagnostics gold nanourchins are unique spherical gold nanoparticles with spiky protrusions, which result in absorption of light in the far-red. They are made using a unique proprietary protocol resulting in pure, reactant-free particles with excellent size distribution. | |
| Engineering Plastic | Engineering Plastic. | |
| Engineering plastics | Engineering plastics. | |
| (E)-Oct-2-enoic acid | (E)-Oct-2-enoic acid. Alternative Names: 2-Octenoic acid,predominantly trans. CAS No. 1871-67-6. Molecular formula: C8H14O2. Mole weight: 142.20. Purity: 98%. SMILES: CCCCC/C=C/C(=O)O. InChI: InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/b7-6+. | |
| EPDM | EPDM. CAS No. 25038-36-2. | |
| EPDM chip | EPDM chip. | |
| EPDM Rubber | EPDM Rubber. | |
| epichlorohydrin rubber | epichlorohydrin rubber. | |
| Epoxide resin, | Solid. CAS No. 61788-97-4. Molecular formula: C21H23ClFNO2. Mole weight: 375.9g/mol. IUPAC Name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one. SMILES: C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F. InChI: InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2. | |
| Epoxide resin, E-44 | Solid. CAS No. 61788-97-4. Molecular formula: C21H23ClFNO2. Mole weight: 375.9g/mol. IUPAC Name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one. SMILES: C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F. InChI: InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2. | |
| Epoxy acrylate | Epoxy acrylate. Molecular formula: C6H6O5. Mole weight: 158.11g/mol. IUPAC Name: prop-2-enoyloxy prop-2-eneperoxoate. SMILES: C=CC(=O)OOOC(=O)C=C. InChI: InChI=1S/C6H6O5/c1-3-5(7)9-11-10-6(8)4-2/h3-4H,1-2H2. | |
| Epoxy Polymer | Epoxy Polymer. | |
| Epoxy Resins | Solid. Alternative Names: Epoxy resin. CAS No. 61788-97-4. Molecular formula: C21H23ClFNO2. Mole weight: 375.9g/mol. IUPAC Name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one. SMILES: C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F. InChI: InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2. | |
| epsilon-Caprolactone | Liquid;COLOURLESS HYGROSCOPIC LIQUID WITH CHARACTERISTIC ODOUR. CAS No. 502-44-3. Molecular formula: C6H10O2;C6H10O2. Mole weight: 114.14g/mol. IUPAC Name: oxepan-2-one. SMILES: C1CCC(=O)OCC1. InChI: InChI=1S/C6H10O2/c7-6-4-2-1-3-5-8-6/h1-5H2. | |
| Erucic acid | Erucic acid. Alternative Names: (13Z)-13-Docosenoic acid. CAS No. 112-86-7. Molecular formula: C22H42O2. Mole weight: 338.58. Purity: >85%. SMILES: CCCCCCCC/C=C\CCCCCCCCCCCC(=O)O. InChI: InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H,23,24)/b10-9-. | |
| Erythritol | White, odourless, non-hygroscopic, heat-stable crystals with a sweetness of approximately 60-80 % that of sucrose.;Solid. Molecular formula: C4H10O4;C4H10O4. Mole weight: 122.12g/mol. IUPAC Name: (2S,3R)-butane-1,2,3,4-tetrol. SMILES: C(C(C(CO)O)O)O. InChI: InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+. | |
| Erythritol Anhydride | D,l-1,2:3,4-diepoxybutane is a colorless to yellow liquid. (NTP, 1992). Molecular formula: C4H6O2. Mole weight: 86.09g/mol. IUPAC Name: (2S)-2-[(2R)-oxiran-2-yl]oxirane. SMILES: C1C(O1)C2CO2. InChI: InChI=1S/C4H6O2/c1-3(5-1)4-2-6-4/h3-4H,1-2H2/t3-,4+. | |
| Esterified polystyrene maleic anhydride copolymer, Mn ~2800, acid value: 185mg KOH/g | Esterified polystyrene maleic anhydride copolymer, Mn ~2800, acid value: 185mg KOH/g. CAS No. 9011-13-6. Molecular formula: C12H10O3. Mole weight: 202.212g/mol. | |
| Ethane-1,2-diyldiphosphonic acid | Ethane-1,2-diyldiphosphonic acid. Alternative Names: 1,2-Ethylenediphosphonicacid. CAS No. 6145-31-9. Molecular formula: C2H8O6P2. Mole weight: 190.03. Purity: 98%. SMILES: C(CP(=O)(O)O)P(=O)(O)O. InChI: InChI=1S/C2H8O6P2/c3-9(4,5)1-2-10(6,7)8/h1-2H2,(H2,3,4,5)(H2,6,7,8). | |
| Ethanol (99.5) | Ethanol (99.5). Alternative Names: Ethyl alcohol. CAS No. 64-17-5. | |
| ethene,2-methylprop-2-enoic acid | ethene,2-methylprop-2-enoic acid. CAS No. 25053-53-6. Molecular formula: C6H10O2. Mole weight: 114.14g/mol. IUPAC Name: ethene;2-methylprop-2-enoic acid. SMILES: CC(=C)C(=O)O.C=C. InChI: InChI=1S/C4H6O2.C2H4/c1-3(2)4(5)6;1-2/h1H2,2H3,(H,5,6);1-2H2. | |
| Ethene Butyl Acrylate | Ethene Butyl Acrylate. | |
| ethene,ethenol | ethene,ethenol. CAS No. 25067-34-9. Molecular formula: C4H8O. Mole weight: 72.11g/mol. IUPAC Name: ethene;ethenol. SMILES: C=C.C=CO. InChI: InChI=1S/C2H4O.C2H4/c1-2-3;1-2/h2-3H,1H2;1-2H2. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.