Alfa Chemistry Materials 6 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Polyethylene glycol diacid 600 | Due to its specific melting range the product may be solid, liquid, a solidified melt or a supercooled melt. Alternative Names: Polyethylene glycol diacid 600, Polyethylene glycol bis(carboxymethyl) ether. CAS No. 39927-08-7. Molecular formula: HOOCCH2(OCH2CH2)nOCH2COOH. |  |
| Poly(ethylene glycol) diacrylate, | Poly(ethylene glycol) diacrylate. CAS No. 26570-48-9. Molecular formula: C8H10O4. Mole weight: 170.16g/mol. IUPAC Name: 2-prop-2-enoyloxyethyl prop-2-enoate. SMILES: C=CC(=O)OCCOC(=O)C=C. InChI: InChI=1S/C8H10O4/c1-3-7(9)11-5-6-12-8(10)4-2/h3-4H,1-2,5-6H2. | |
| Poly(ethylene glycol) diacrylate, average Mn~575, contains 400-600ppm MEHQ as stabilizer | Poly(ethylene glycol) diacrylate, average Mn~575, contains 400-600ppm MEHQ as stabilizer. CAS No. 26570-48-9. Molecular formula: C8H10O4. Mole weight: 170.16g/mol. IUPAC Name: 2-prop-2-enoyloxyethyl prop-2-enoate. SMILES: C=CC(=O)OCCOC(=O)C=C. InChI: InChI=1S/C8H10O4/c1-3-7(9)11-5-6-12-8(10)4-2/h3-4H,1-2,5-6H2. | |
| Poly(ethylene glycol) diacrylate, average Mn~700 | Poly(ethylene glycol) diacrylate, average Mn~700. CAS No. 26570-48-9. Molecular formula: C8H10O4. Mole weight: 170.16g/mol. IUPAC Name: 2-prop-2-enoyloxyethyl prop-2-enoate. SMILES: C=CC(=O)OCCOC(=O)C=C. InChI: InChI=1S/C8H10O4/c1-3-7(9)11-5-6-12-8(10)4-2/h3-4H,1-2,5-6H2. | |
| Poly(ethylene glycol) diacrylate (average MW ~600, Contains 400-600ppm MEHQ stabilizer) | Poly(ethylene glycol) diacrylate (average MW ~600, Contains 400-600ppm MEHQ stabilizer). CAS No. 26570-48-9. IUPAC Name: 2-prop-2-enoyloxyethyl prop-2-enoate. SMILES: C=CC(=O)OCCOC(=O)C=C. InChI: InChI=1S/C8H10O4/c1-3-7(9)11-5-6-12-8(10)4-2/h3-4H,1-2,5-6H2. | |
| Polyethylene Glycol Diglycidyl Ether | Polyethylene Glycol Diglycidyl Ether. | |
| Polyethylene glycol dimesylate | Polyethylene glycol dimesylate. CAS No. 52410-74-9. Molecular formula: C4H10O6S2. Mole weight: 218.3g/mol. IUPAC Name: 2-methylsulfonyloxyethyl methanesulfonate. SMILES: CS(=O)(=O)OCCOS(=O)(=O)C. InChI: InChI=1S/C4H10O6S2/c1-11(5,6)9-3-4-10-12(2,7)8/h3-4H2,1-2H3. | |
| Polyethylene glycol Dimethacrylate n?4 (stabilized with MEHQ) | Polyethylene glycol Dimethacrylate n?4 (stabilized with MEHQ). CAS No. 25852-47-5. Molecular formula: C3H5C(O)(OCH2CH2)nOC(O)C3H5. IUPAC Name: 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OCCOC(=O)C(=C)C. InChI: InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3. | |
| Polyethylene Glycol Dimethacrylate, n(=:)4 (stabilized with MEHQ) | Polyethylene Glycol Dimethacrylate, n(=:)4 (stabilized with MEHQ). CAS No. 25852-47-5. | |
| Polyethylene glycol dimethyl ether | Due to its specific melting range the product may be solid, liquid, a solidified melt or a supercooled melt. Alternative Names: Polyethylene glycol dimethyl ether 2000. CAS No. 24991-55-7. Molecular formula: CH3O(CH2CH2O)nCH3. | |
| Polyethylene glycol dimethyl ether 500, (stabilised) for synthesis | Due to its specific melting range the product may be solid, liquid, a solidified melt or a supercooled melt. Alternative Names: Polyethylene glycol dimethyl ether 500. CAS No. 24991-55-7. Molecular formula: CH3O(CH2CH2O)nCH3. Mole weight: 530.65g/mol. | |
| Poly(ethylene glycol) dimethyl ether (average Mn ~500, contains 100 ppm BHT as stabilizer) | Poly(ethylene glycol) dimethyl ether (average Mn ~500, contains 100 ppm BHT as stabilizer). CAS No. 24991-55-7. Molecular formula: C2+2nH6+4nO1+n. IUPAC Name: 1,2-dimethoxyethane. SMILES: COCCOC. InChI: InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3. | |
| Polyethylene Glycol Dimethyl Ether (Mw.=ca. 240) | 1,2-dimethoxyethane appears as a liquid with a sharp odor. Less dense than water. Flash point 34°F. Mildly toxic by ingestion and inhalation. Severely irritates skin and eyes. Vapors heavier than air. Used to make other chemicals.;Liquid;Liquid;COLOURLESS LIQUID WITH CHARACTERISTIC ODOUR. CAS No. 24991-55-7. Molecular formula: C4H10O2;CH3OCH2CH2OCH3;C4H10O2;C4H10O2. Mole weight: 90.12g/mol. IUPAC Name: 1,2-dimethoxyethane. SMILES: COCCOC. InChI: InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3. | |
| Poly(ethylene glycol) dimethyl ether (NHD), average Mn ~250 | 1,2-dimethoxyethane appears as a liquid with a sharp odor. Less dense than water. Flash point 34°F. Mildly toxic by ingestion and inhalation. Severely irritates skin and eyes. Vapors heavier than air. Used to make other chemicals.;Liquid;Liquid;COLOURLESS LIQUID WITH CHARACTERISTIC ODOUR. CAS No. 24991-55-7. Molecular formula: C4H10O2;CH3OCH2CH2OCH3;C4H10O2;C4H10O2. Mole weight: 90.12g/mol. IUPAC Name: 1,2-dimethoxyethane. SMILES: COCCOC. InChI: InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3. | |
| Poly(ethylene glycol) dioleate | Poly(ethylene glycol) dioleate. Molecular formula: CH3(CH2)7CH=CH(CH2)7CO(OCH2CH2)nO2C(CH2)7CH=CH(CH2)7CH3. IUPAC Name: 2-[(Z)-octadec-9-enoyl]oxyethyl (Z)-octadec-9-enoate. SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCCOC(=O)CCCCCCCC=CCCCCCCCC. InChI: InChI=1S/C38H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(39)41-35-36-42-38(40)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17-,20-18-. | |
| Polyethylene glycol, HO-PEG-OH (95%, MW1000 Da) | Polyethylene glycol, HO-PEG-OH (95%, MW1000 Da). | |
| Poly(ethylene glycol) methyl ether 2-(dodecylthiocarbonothioylthio)-2-methylpropionate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: Methoxy poly(ethylene oxide)-2-(dodecylthiocarbonothioylthio)-2-methylpropionate, PEG DDMAT macroCTA. Mole weight: average Mn 1,100. | |
| Poly(ethylene glycol) methyl ether 4-cyano-4-[(dodecylsulfanylthiocarbonyl)sulfanyl]pentanoate | Poly(ethylene glycol) methyl ether 4-cyano-4-[(dodecylsulfanylthiocarbonyl)sulfanyl]pentanoate. | |
| Poly(ethylene glycol) methyl ether (4-cyano-4-pentanoate dodecyl trithiocarbonate) (average Mn 5, 400) | Poly(ethylene glycol) methyl ether (4-cyano-4-pentanoate dodecyl trithiocarbonate) (average Mn 5, 400). | |
| Poly(ethylene glycol) methyl ether methacrylate, average Mn~300 | Poly(ethylene glycol) methyl ether methacrylate, average Mn~300. CAS No. 26915-72-0. Molecular formula: C13H24O6. Mole weight: 276.33g/mol. IUPAC Name: 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OCCOCCOCCOCCOC. InChI: InChI=1S/C13H24O6/c1-12(2)13(14)19-11-10-18-9-8-17-7-6-16-5-4-15-3/h1,4-11H2,2-3H3. | |
| Poly(ethylene glycol) methyl ether methacrylate, average Mn~950 | Poly(ethylene glycol) methyl ether methacrylate, average Mn~950. CAS No. 26915-72-0. Molecular formula: C13H24O6. Mole weight: 276.33g/mol. IUPAC Name: 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OCCOCCOCCOCCOC. InChI: InChI=1S/C13H24O6/c1-12(2)13(14)19-11-10-18-9-8-17-7-6-16-5-4-15-3/h1,4-11H2,2-3H3. | |
| Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 10) | Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 10). CAS No. 26027-38-3. | |
| Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 15) | Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 15). CAS No. 26027-38-3. | |
| Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 18) | Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 18). CAS No. 26027-38-3. | |
| Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 2) | Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 2). CAS No. 26027-38-3. | |
| Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 20) | Polyethylene Glycol Mono-4-nonylphenyl Ether (n=approx. 20). CAS No. 26027-38-3. | |
| Polyethylene glycol Monododecyl Ether (Hydroxyl Value 40-60 mgKOH/g) | Polyethylene glycol Monododecyl Ether (Hydroxyl Value 40-60 mgKOH/g). CAS No. 9002-92-0. Molecular formula: HO(CH2CH2O)n(CH2)11CH3. | |
| Polyethyleneglycolmonoisodecylether | Polyethyleneglycolmonoisodecylether. CAS No. 61827-42-7. Molecular formula: C12H26O2. Mole weight: 202.33g/mol. IUPAC Name: 2-(8-methylnonoxy)ethanol. SMILES: CC(C)CCCCCCCOCCO. InChI: InChI=1S/C12H26O2/c1-12(2)8-6-4-3-5-7-10-14-11-9-13/h12-13H,3-11H2,1-2H3. | |
| Poly(ethylene glycol) monolaurate | Poly(ethylene glycol) monolaurate. CAS No. 9004-81-3. Molecular formula: C14H28O3. Mole weight: 244.37g/mol. IUPAC Name: 2-hydroxyethyl dodecanoate. SMILES: CCCCCCCCCCCC(=O)OCCO. InChI: InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-14(16)17-13-12-15/h15H,2-13H2,1H3. | |
| POLYETHYLENE GLYCOL MONOLAURATE N(=:)10 | POLYETHYLENE GLYCOL MONOLAURATE N(=:)10. CAS No. 31943-11-0. Molecular formula: HO(CH2CH2O)nOC(CH2)10CH3. | |
| Polyethylene Glycol Monomethyl Ether 1000 | Polyethylene Glycol Monomethyl Ether 1000. CAS No. 9004-74-4. | |
| Polyethylene Glycol Monomethyl Ether 2000 | Polyethylene Glycol Monomethyl Ether 2000. CAS No. 9004-74-4. | |
| Polyethylene Glycol Monomethyl Ether 400 | Polyethylene Glycol Monomethyl Ether 400. CAS No. 9004-74-4. | |
| Polyethylene Glycol Monomethyl Ether 4000 | Polyethylene Glycol Monomethyl Ether 4000. CAS No. 9004-74-4. | |
| Polyethylene Glycol Monomethyl Ether 550 | Polyethylene Glycol Monomethyl Ether 550. CAS No. 9004-74-4. | |
| poly(ethylene glycol) (n) monomethacrylate | poly(ethylene glycol) (n) monomethacrylate. CAS No. 25736-86-1. | |
| Polyethylene glycol oleyl ether | Polyethylene glycol oleyl ether. CAS No. 9004-98-2. Molecular formula: C18H35(OCH2CH2)nOH. | |
| Poly(ethylene glycol); PEG1540, average Mn 1540 | Poly(ethylene glycol); PEG1540, average Mn 1540. CAS No. 25322-68-3. | |
| Polyethylene glycol Stearylamine n = approximately 10 | Polyethylene glycol Stearylamine n = approximately 10. | |
| Poly(ethylene Glycol Succinate) | Poly(ethylene Glycol Succinate). CAS No. 25569-53-3. Molecular formula: C6H12O6. Mole weight: 180.16g/mol. IUPAC Name: butanedioic acid;ethane-1,2-diol. SMILES: C(CC(=O)O)C(=O)O.C(CO)O. InChI: InChI=1S/C4H6O4.C2H6O2/c5-3(6)1-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2. | |
| Polyethylene glycol trimethylnonyl ether | Polyethylene glycol trimethylnonyl ether. CAS No. 84133-50-6. Mole weight: 596g/mol. | |
| Polyethylene-graft-maleic anhydride (Grafting rate: 8%) | Polyethylene-graft-maleic anhydride (Grafting rate: 8%). CAS No. 9006-26-2. IUPAC Name: ethene;furan-2,5-dione. SMILES: C=C.C1=CC(=O)OC1=O. InChI: InChI=1S/C4H2O3.C2H4/c5-3-1-2-4(6)7-3;1-2/h1-2H;1-2H2. | |
| Polyethylene-graft-maleic anhydride (viscosity 500 cP (140 °C) | Polyethylene-graft-maleic anhydride (viscosity 500 cP (140 °C). CAS No. 9006-26-2. IUPAC Name: ethene;furan-2,5-dione. SMILES: C=C.C1=CC(=O)OC1=O. InChI: InChI=1S/C4H2O3.C2H4/c5-3-1-2-4(6)7-3;1-2/h1-2H;1-2H2. | |
| polyethyleneimine | polyethyleneimine. CAS No. 26658-46-8. | |
| Polyethyleneimine (ca. 30% in Water) | Ethyleneimine, stabilized appears as a clear colorless liquid with an ammonia-like odor. Flash point 12°F. Less dense than water. Flammable over a wide range of vapor-air concentrations. Vapors irritate the skin, eyes, nose, and throat. May be toxic by prolonged inhalation, skin absorption, or ingestion. Carcinogenic. Vapors heavier than air. May polymerize exothermically if heated or contaminated. If the polymerization takes place inside a container, the container may rupture violently.;COLOURLESS LIQUID WITH PUNGENT ODOUR.;Colorless liquid with an ammonia-like odor.;Colorless liquid with an ammonia-like odor. [Note: Usually contains inhibitors to prevent polymerization.]. CAS No. 9002-98-6. Molecular formula: C2H5N;CH2NHCH2;C2H5N. Mole weight: 43.07g/mol. IUPAC Name: aziridine. SMILES: C1CN1. InChI: InChI=1S/C2H5N/c1-2-3-1/h3H,1-2H2. | |
| Poly(ethyleneimine) solution, average Mn ~1,800 by GPC, average Mw ~2,000 by LS, 50 wt. % in H2O | Poly(ethyleneimine) solution, average Mn ~1,800 by GPC, average Mw ~2,000 by LS, 50 wt. % in H2O. CAS No. 25987-06-8. | |
| Polyethylene Naphthalate, (PEN), film, thickness 0.0013 mm, size 150×150 mm, condition biaxially oriented | Polyethylene Naphthalate, (PEN), film, thickness 0.0013 mm, size 150×150 mm, condition biaxially oriented. | |
| Polyethylene Naphthalate, (PEN), granule, 5 mm nominal granule size, weight 100 g, condition additive free polymer | Polyethylene Naphthalate, (PEN), granule, 5 mm nominal granule size, weight 100 g, condition additive free polymer. | |
| Polyethylene oxide | Polyethylene oxide. CAS No. 68441-17-8. | |
| Polyethylene oxide (Absolute viscosity~2350mpa. s) | Polyethylene oxide (Absolute viscosity~2350mpa. s). CAS No. 68441-17-8. Molecular formula: HO(CH2CH2O)nH. IUPAC Name: 6-hydroxy-5-methyl-4,11-dioxoundecanoic acid. SMILES: CC(C(CCCCC=O)O)C(=O)CCC(=O)O. InChI: InChI=1S/C12H20O5/c1-9(11(15)6-7-12(16)17)10(14)5-3-2-4-8-13/h8-10,14H,2-7H2,1H3,(H,16,17). | |
| Poly(ethylene oxide), average Mn 3500 | Poly(ethylene oxide), average Mn 3500. CAS No. 25322-68-3. | |
| Polyethylene oxide, average Mv ~1,000,000,powder | Polyethylene oxide, average Mv ~1,000,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~100,000,powder | Polyethylene oxide, average Mv ~100,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~2,000,000,powder | Polyethylene oxide, average Mv ~2,000,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~300,000,powder | Polyethylene oxide, average Mv ~300,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~4,000,000,powder | Polyethylene oxide, average Mv ~4,000,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~5,000,000,powder | Polyethylene oxide, average Mv ~5,000,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~6,000,000,powder | Polyethylene oxide, average Mv ~6,000,000,powder. CAS No. 68441-17-8. | |
| Polyethylene oxide, average Mv ~600,000,powder | Polyethylene oxide, average Mv ~600,000,powder. CAS No. 68441-17-8. | |
| polyethylene, oxidized | polyethylene, oxidized. CAS No. 68441-17-8. | |
| Polyethylene,oxidized | Polyethylene,oxidized. Alternative Names: PEO. CAS No. 68441-17-8 / 25322-68-3. Mole weight: 0.00000. Purity: 96%. IUPAC Name: Ethene,homopolymer,oxidized. | |
| Polyethylene Polyamines | Polyethylene Polyamines. | |
| Polyethylene-polypropylene glycol | Polyethylene-polypropylene glycol. Alternative Names: BLOCK COPOLYMER OF POLYETHYLENE AND POLYPROPYLENE GLYCOL;SYNPERONIC F 108;SYNPERONIC L 121;SYNPERONIC L 122;SYNPERONIC P 105;SYNPERONIC P 85;SYNPERONIC PE(R)/F68;SYNPERONIC PE(R)/L61. Molecular formula: H(OCH2CH2)x(OCH2CHCH3)y(OCH2CH2)zOH. | |
| Polyethylene-polypropylene glycol, average mol wt 8350 | Liquid. CAS No. 9003-11-6. Molecular formula: C5H10O2. Mole weight: 102.13g/mol. IUPAC Name: 2-methyloxirane;oxirane. SMILES: CC1CO1.C1CO1. InChI: InChI=1S/C3H6O.C2H4O/c1-3-2-4-3;1-2-3-1/h3H,2H2,1H3;1-2H2. | |
| Polyethylene Solid Tube (2.2LB) | Made from 2.2LB density polyethylene foam, this solution offers durability that is never too heavy or weighed down which makes it ideal for a wide range of applications. Closed-cell polyethylene cylinders come in a range of diameters and lengths widely used in masonry and concrete work as a backer rod to fill gaps between slabs before applying filler, saving time and materials. It can also be used in crafts or as padding or cushioning for unique projects. Being smooth, closed-cell foam, it is resistant to moisture. The small diameter of this tubing allows us to spool it for a continuous length, making it excellent for larger projects where consistency is important. | |
| Poly(ethylene succinate), SU,Liquid Phase for GC | Poly(ethylene succinate), SU,Liquid Phase for GC. CAS No. 25569-53-3. Molecular formula: C6H12O6. Mole weight: 180.16g/mol. IUPAC Name: butanedioic acid;ethane-1,2-diol. SMILES: C(CC(=O)O)C(=O)O.C(CO)O. InChI: InChI=1S/C4H6O4.C2H6O2/c5-3(6)1-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2. | |
| Polyethylene Terephthalate | PET is a general-purpose thermoplastic polymer that belongs to the polyester family of polymers. Known for their excellent combination of properties such as mechanical, thermal, chemical resistance as well as dimensional stability, polyester resins are suitable for extruded applications that require clarity, toughness and consistent processing performance. PET can be alloyed and compounded with engineering resins. Polyester resins are low cost, withstand temperatures up to 80?C, offer good wetting to glass fibers, have a relatively low shrinkage of 4% ? 8% during curing, and provide a linear expansion ranging from 100 - 200 x 10-6 K-1. Alternative Names: PET. CAS No. 25038-59-9. Molecular formula: C10H12O6. Mole weight: 228.2g/mol. IUPAC Name: poly(ethylene terephthalate). SMILES: OCCO.OC(=O)c1ccc(cc1)C(O)=O. InChI: InChI=1S/C8H6O4.C2H6O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4/h1-4H,(H,9,10)(H,11,12);3-4H,1-2H2. | |
| Poly Ethylene Terephthalate | Poly Ethylene Terephthalate. | |
| Polyethylene Terephthalate, (polyester, PET, PETP), fabric, weight.m-2-92g, thickness 0.13 mm | PET is a general-purpose thermoplastic polymer that belongs to the polyester family of polymers. Known for their excellent combination of properties such as mechanical, thermal, chemical resistance as well as dimensional stability, polyester resins are suitable for extruded applications that require clarity, toughness and consistent processing performance. PET can be alloyed and compounded with engineering resins. Polyester resins are low cost, withstand temperatures up to 80?C, offer good wetting to glass fibers, have a relatively low shrinkage of 4% ? 8% during curing, and provide a linear expansion ranging from 100 - 200 x 10-6 K-1. | |
| Polyethylene Tube with Hole | Our polyethylene tubes with holes are used in many different areas, including agriculture, construction, and wiring solutions. The foam tubes act as an insulator around tree trunks during freezes. Not only that, our polyethylene cylinders with cut-outs can be used in construction projects as pipe insulation, as well as many other construction uses. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.