Alfa Chemistry Materials 6 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| α-D-Glucose (10mM in DMSO) | α-D-Glucose (10mM in DMSO). |  |
| α-D-Glucose (96%) | α-D-Glucose (96%). CAS No. 492-62-6. Molecular formula: C6H12O6. Mole weight: 180.16g/mol. IUPAC Name: (2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. SMILES: C(C1C(C(C(C(O1)O)O)O)O)O. InChI: InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1. | |
| ALPHALAC | ALPHALAC. | |
| α-MaleiMidopropionyl-ω-succiniMidyl-12(ethylene glycol) | α-MaleiMidopropionyl-ω-succiniMidyl-12(ethylene glycol). CAS No. 756525-92-5. Molecular formula: C38H63N3O19. Mole weight: 865.9g/mol. IUPAC Name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. SMILES: C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN2C(=O)C=CC2=O. InChI: InChI=1S/C38H63N3O19/c42-33(5-8-40-34(43)1-2-35(40)44)39-7-10-49-12-14-51-16-18-53-20-22-55-24-26-57-28-30-59-32-31-58-29-27-56-25-23-54-21-19-52-17-15-50-13-11-48-9-6-38(47)60-41-36(45)3-4-37(41)46/h1-2H,3-32H2,(H,39,42). | |
| α, ω-Bis{2-[(3-carboxy-1-oxopropyl)amino]ethyl}Polyethylene glycol (Mr 3000) | α, ω-Bis{2-[(3-carboxy-1-oxopropyl)amino]ethyl}Polyethylene glycol (Mr 3000). Alternative Names: O,O'-Bis[2-(succinylamino)ethyl]polyethylene glycol. CAS No. 74558-41-1. Molecular formula: HOOCCH2CH2CONH(CH2CH2O)nCH2CH2NHCOCH2CH2COOH. IUPAC Name: 4-[2-[2-[2-(3-carboxypropanoylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid. SMILES: C(CC(=O)O)C(=O)NCCOCCOCCNC(=O)CCC(=O)O. InChI: InChI=1S/C14H24N2O8/c17-11(1-3-13(19)20)15-5-7-23-9-10-24-8-6-16-12(18)2-4-14(21)22/h1-10H2,(H,15,17)(H,16,18)(H,19,20)(H,21,22). | |
| alpha-Quarterthiophene | alpha-Quarterthiophene. CAS No. 5632-29-1. Molecular formula: C16H10S4. Mole weight: 330.5g/mol. IUPAC Name: 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. SMILES: C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4. InChI: InChI=1S/C16H10S4/c1-3-11(17-9-1)13-5-7-15(19-13)16-8-6-14(20-16)12-4-2-10-18-12/h1-10H. | |
| AlSi10Mg Aluminum Alloy Powder | AlSi10Mg Aluminum Alloy Powder. | |
| Also Nameel F46 Tubing | Also Nameel F46 Tubing. | |
| AlTiVFeCr High-Entropy Alloy | Unlike most current alloy materials, high-entropy alloys are alloy materials that contain equimolar or approximately equimolar elements. AlTiVFeCr High-Entropy Alloy is composed of Al, Ti, V, and Fe. | |
| Alumina nanowire dispersion | Alumina nanowire dispersion. | |
| Alumina nanowires 4nm | Alumina nanowires 4nm. | |
| Alumina nanowires B | Alumina nanowires B. | |
| Aluminium Diboride AlB2 Powder | Aluminium Diboride AlB2 Powder. CAS No. 12041-50-8. Molecular formula: AlB2. Mole weight: 48.6. Purity: 99%. | |
| Aluminium Oxide, alpha | Aluminium Oxide, alpha. Purity: > 99.8%. | |
| Aluminium Oxide, gamma | Aluminium Oxide, gamma. Purity: > 99.9%. | |
| Aluminium oxide nanowires | Aluminium oxide nanowires. CAS No. 1344-28-1. Molecular formula: Al2O3. Purity: > 99.99%. | |
| Aluminium Oxide, theta | Aluminium Oxide, theta. Purity: > 99.8% (after ignition); loss after ignition: < 3%. | |
| Aluminized Protective Clothing | Aluminized Protective Clothing. | |
| Aluminum Carbon Nanotubes | Aluminum Carbon Nanotubes are generally immediately available in most volumes. Additional technical, research and safety (MSDS) information is available. Carbon Nanotubes are Single-Walled, Double Walled and Multi-Walled black nano scale cylindrical tubes of graphitic carbon with numerous applications. Carbon Nanotubes are the stiffest and strongest known fibers and have unique electrical properties. When used as reinforcement fibers, carbon nanotubes can improve the quality and properties of metal, polymer and ceramics. Carbon nanotubes can behave like a conductive metallic or semiconductor depending on their structure, which is useful for nanoscale electronic devices and in electrically conductive films in coatings, plastics, nanowire, nanofiber and in certain bioscience applications. Recently, carbon nanotubes have been demonstrated to create the "darkest" known material absorbing all wavelengths or "colors" of light which will prove useful in solar and electronic applications. Alternative Names: Aluminium, aluminio, alluminio, aluminyum. Molecular formula: Al-C. Purity: 99%, 99.9%, 99.99%, 99.999%. | |
| Aluminum chlorhydrate | Aluminum chlorhydrate. CAS No. 1327-41-9. | |
| Aluminum Matrix Composite Fatigue Specimen/Tensile Specimen/Cube Specimen | Aluminum Matrix Composite Fatigue Specimen/Tensile Specimen/Cube Specimen. | |
| Aluminum-nickel alloy | Aluminum-nickel alloy. Alternative Names: Nickel aluminum, 99.0% min (metals basis); Nickel-aluminium alloy; RP18439; Aluminum-nickel alloy, purum, 50% Al basis, 50% Ni basis; Nickel aluminum alloy powder; Raney nickel aluminium; Raney nickel aluminum alloy; nickel-aluminium; Z3705; Nickel Aluminide Powder. CAS No. 12635-27-7. Molecular formula: AlNi. Mole weight: 85.675g/mol. IUPAC Name: aluminum;nickel. SMILES: [Al].[Ni]. InChI: InChI=1S/Al.Ni. | |
| Aluminum Oxide Nanoparticles / Nanopowder | Aluminum oxide is a white odorless crystalline powder. Water insoluble. Properties (both physical and chemical) vary according to the method of preparation; different methods give different crystalline modifications. The variety formed at very high temperature is quite inert chemically.;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid; WetSolid, Liquid;WHITE POWDER.;White, odorless, crystalline powder.;White, odorless, crystalline powder. Alternative Names: aluminum oxide nanoparticle dispersion. CAS No. 1344-28-1. Molecular formula: Al2O3;Al2O3;Al2O3. Mole weight: 101.96. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: dialuminum;oxygen(2-). SMILES: [O-2].[O-2].[O-2].[Al+3].[Al+3]. InChI: InChI=1S/2Al.3O/q2*+3;3*-2. | |
| Aluminum Oxide Nanowires | Aluminum Oxide Nanowires. Alternative Names: Alumina; aluminium oxide; aluminum(III) oxide; aluminium(III) oxide; aloxide; aloxite; alundum; oxo-oxoalumanyloxy-alumane, sapphire; corundum; aluminum trioxide; alumina ceramic; alpha-Corundum; bauxite; Electrocorundum; keto-ketoalumanyloxy-alumane; α-Al2O3; α alumina; alpha alumina. CAS No. 1344-28-1. Molecular formula: Al2O3. Mole weight: 101.96. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: Oxo(oxoalumanyloxy) alumane. SMILES: O=[Al]O[Al]=O. InChI: InChI=1S/2Al.3O. | |
| Aluminum Oxide Nanowires Properties | Aluminum Oxide Nanowires Properties. CAS No. 1344-28-1. Mole weight: 101.96 g/mol. Purity: (99%, 99.9%, 99.99%). | |
| AMBERLITE DP-1 | AMBERLITE DP-1. CAS No. 64333-21-7. | |
| AMBERLITE IRA-404 | AMBERLITE IRA-404. CAS No. 149146-26-9. | |
| Amberlite(R)xad-4 | Amberlite(R)xad-4. CAS No. 37380-42-0. Molecular formula: Amberlite74. Purity: 96%. | |
| AMBERLITE IRP-69 | AMBERLITE IRP-69. CAS No. 55464-99-8. | |
| Amberlite LA 2 | Amberlite LA 2. CAS No. 11128-96-4. Purity: 96%. | |
| amberlite(r) ira-35 | amberlite(r) ira-35. CAS No. 76930-03-5. | |
| amberlite(r) ira-67 | amberlite(r) ira-67. CAS No. 9056-59-1. | |
| amberlite(r) irc-50 | amberlite(r) irc-50. CAS No. 9002-29-3. Molecular formula: C23H37Cl2N3O. Mole weight: 442.5g/mol. IUPAC Name: (9-amino-3-bicyclo[3.3.1]nonanyl)-(4-benzyl-5-methyl-1,4-diazepan-1-yl)methanone;dihydrochloride. SMILES: CC1CCN(CCN1CC2=CC=CC=C2)C(=O)C3CC4CCCC(C3)C4N.Cl.Cl. InChI: InChI=1S/C23H35N3O.2ClH/c1-17-10-11-25(12-13-26(17)16-18-6-3-2-4-7-18)23(27)21-14-19-8-5-9-20(15-21)22(19)24;;/h2-4,6-7,17,19-22H,5,8-16,24H2,1H3;2*1H. | |
| Amberlite XAD-16 | Amberlite XAD-16. CAS No. 104219-63-8. | |
| AMbersep 900(OH), ion exchange resin Suppliers | AMbersep 900(OH), ion exchange resin Suppliers. CAS No. 9017-79-2. | |
| Amidinothiourea | Amidinothiourea. Molecular formula: C2H6N4S. Mole weight: 118.16g/mol. IUPAC Name: diaminomethylidenethiourea. SMILES: C(=NC(=S)N)(N)N. InChI: InChI=1S/C2H6N4S/c3-1(4)6-2(5)7/h(H6,3,4,5,6,7). | |
| Amikacin impurity I | Amikacin impurity I. Alternative Names: (S)-(-)-4-Amino-2-hydroxybutyric acid. CAS No. 40371-51-5. Molecular formula: C4H9NO3. Mole weight: 119.12. Purity: 97%. SMILES: C(CN)[C@@H](C(=O)O)O. InChI: InChI=1S/C4H9NO3/c5-2-1-3(6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1. | |
| Amine curing agent | Amine curing agent. | |
| Amino acrylate | Amino acrylate. Molecular formula: C3H5NO2. Mole weight: 87.08g/mol. IUPAC Name: amino prop-2-enoate. SMILES: C=CC(=O)ON. InChI: InChI=1S/C3H5NO2/c1-2-3(5)6-4/h2H,1,4H2. | |
| Aminobenzyl Alcohol | Aminobenzyl Alcohol. Molecular formula: C7H9NO. Mole weight: 123.15g/mol. IUPAC Name: amino(phenyl)methanol. SMILES: C1=CC=C(C=C1)C(N)O. InChI: InChI=1S/C7H9NO/c8-7(9)6-4-2-1-3-5-6/h1-5,7,9H,8H2. | |
| Amino Blue Polystyrene Particles Crosslinked | Amino Blue Polystyrene Particles Crosslinked. | |
| Aminoethyl Ethanolamine | Aminoethyl Ethanolamine. | |
| Amino Magnetic Particles, Cross-linked | Amino Magnetic Particles, Cross-linked. | |
| (Aminomethyl)polystyrene) (1.0-2.0 mmol/g) | 200-400 mesh, extent of labeling: 1.0-2.0 mmol/g loading, 2 % cross-linked. Alternative Names: AM-polystyrene; Benzylamine polymer-bound; Poly(styrene-co-divinylbenzene), aminomethylated; Poly(styrene-co-vinylbenzylamine-co-divinylbenzene; Polystyrene crosslinked with divinylbenzene, aminomethylated. | |
| Aminomethyl Polystyrene Resin | Aminomethyl Polystyrene Resin. Alternative Names: AM Polystyrene Benzylamine, polymer bound Poly(styrene-co-vinylbenzylamine-co-divinylbenzene) Poly(styrene-co-divinylbenzene), aminomethylated. CAS No. 89551-24-6. | |
| AminOMethyl Polystyrene Resin (0.5~1.5mmol/g, 100~200 mesh, 1% DVB) | AminOMethyl Polystyrene Resin (0.5~1.5mmol/g, 100~200 mesh, 1% DVB). | |
| Aminomethyl polystyrene resin (cross-linked with 1% DVB (200-400mesh) (2.0-3.0mmol/g)) | Aminomethyl polystyrene resin (cross-linked with 1% DVB (200-400mesh) (2.0-3.0mmol/g)). | |
| Amino-PEG12-acid | Amino-PEG12-acid. CAS No. 1186194-33-1. Molecular formula: C27H55NO14. Mole weight: 617.7g/mol. Purity: 95%+. IUPAC Name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. SMILES: C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O. InChI: InChI=1S/C27H55NO14/c28-2-4-32-6-8-34-10-12-36-14-16-38-18-20-40-22-24-42-26-25-41-23-21-39-19-17-37-15-13-35-11-9-33-7-5-31-3-1-27(29)30/h1-26,28H2,(H,29,30). | |
| Amino PMMA Blue Polystyrene Particles | Amino PMMA Blue Polystyrene Particles. | |
| Amino-polystyrene Particles, Cross-linked | Amino-polystyrene Particles, Cross-linked. | |
| Aminopropyltrimethoxysilane | Aminopropyltrimethoxysilane. Alternative Names: 3-Aminopropyltrimethoxysilane. CAS No. 13822-56-5. Molecular formula: C6H17NO3Si. Mole weight: 179.29. Purity: 97%. SMILES: CO[Si](CCCN)(OC)OC. InChI: InChI=1S/C6H17NO3Si/c1-8-11(9-2,10-3)6-4-5-7/h4-7H2,1-3H3. | |
| Amino resin | Melamine formaldehyde is used for the treatment of heavy fabrics, draperies, coatings, collars, and apparel; in water- and oil-repellent and flame-retardant hrllsIies (effective on synthetic and natural fibers). CAS No. 9003-8-1. | |
| AMINO RESINS | AMINO RESINS. | |
| Amino Superparamagnetic Microparticles | Amino Superparamagnetic Microparticles. Alternative Names: Paramagnetic microparticles, SPHERO. Molecular formula: Fe3O4. | |
| Ammonia as Nitrogen 1000 μg/mL in H2O | Ammonia as Nitrogen 1000 μg/mL in H2O. | |
| Ammonia as Nitrogen from Ammonium Chloride at 100 μg/mL in H2O | Ammonia as Nitrogen from Ammonium Chloride at 100 μg/mL in H2O. | |
| Ammonia water | Ammonia water. CAS No. 1336-21-6. | |
| Ammonium fluoride aq. solution | Ammonium fluoride aq. solution. CAS No. 12125-01-8. | |
| Ammonium hydrogenphosphate, matrix modifier solution | Ammonium hydrogenphosphate, matrix modifier solution. | |
| Ammonium Persulfate | Ammonium persulfate appears as a white crystalline solid. A strong oxidizing agent. Does not burn readily, but may cause spontaneous ignition of organic materials. Used as a bleaching agent and as a food preservative.;DryPowder; OtherSolid; PelletsLargeCrystals;COLOURLESS CRYSTALS OR WHITE POWDER.;A white crystalline solid. Molecular formula: H8N2O8S2;(NH4)2S2O8;(NH4)2S2O8;H8N2O8S2. Mole weight: 228.21g/mol. IUPAC Name: diazanium;sulfonatooxy sulfate. SMILES: [NH4+].[NH4+].[O-]S(=O)(=O)OOS(=O)(=O)[O-]. InChI: InChI=1S/2H3N.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h2*1H3;(H,1,2,3)(H,4,5,6). | |
| Ammonium Persulfate Etchant | For brasses, especially brasses containing Cobalt (250 ml). | |
| Ammonium Polyacrylate | Liquid. Molecular formula: C3H7NO2. Mole weight: 89.09g/mol. IUPAC Name: azanium;prop-2-enoate. SMILES: C=CC(=O)[O-].[NH4+]. InChI: InChI=1S/C3H4O2.H3N/c1-2-3(4)5;/h2H,1H2,(H,4,5);1H3. | |
| Ammonium polyphosphate, | Ammonium polyphosphate. CAS No. 68333-79-9. Molecular formula: H12N3O4P. Mole weight: 149.09g/mol. IUPAC Name: triazanium;phosphate. SMILES: [NH4+].[NH4+].[NH4+].[O-]P(=O)([O-])[O-]. InChI: InChI=1S/3H3N.H3O4P/c;;;1-5(2,3)4/h3*1H3;(H3,1,2,3,4). | |
| Ammonium Polyphosphate | Ammonium Polyphosphate. | |
| Ammonium Thiocyanate | Ammonium thiocyanate is a colorless crystalline solid. It is soluble in water. The primary hazard is the threat posed to the environment. Immediate steps should be taken to limit its spread to the environment. It is used in chemical analysis, in photography, as a fertilizer, and for many other uses.;DryPowder; OtherSolid; PelletsLargeCrystals. Molecular formula: NH4SCN;CH4N2S. Mole weight: 76.12g/mol. IUPAC Name: azanium;thiocyanate. SMILES: C(#N)[S-].[NH4+]. InChI: InChI=1S/CHNS.H3N/c2-1-3;/h3H;1H3. | |
| Amylopectin Hydrate (Amylose free), from Waxy Corn | Solid. CAS No. 9037-22-3. Molecular formula: C30H52O26. Mole weight: 828.7g/mol. IUPAC Name: (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-6-[[(2R,3S,4R,5R,6R)-4,5-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol. SMILES: C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC4C(OC(C(C4O)O)O)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)CO)O)O)O)O. InChI: InChI=1S/C30H52O26/c31-1-6-11(35)13(37)19(43)28(50-6)55-24-9(4-34)52-27(21(45)16(24)40)48-5-10-25(56-29-20(44)14(38)12(36)7(2-32)51-29)17(41)22(46)30(53-10)54-23-8(3-33)49-26(47)18(42)15(23)39/h6-47H,1-5H2/t6-,7-,8-,9-,10-,11-,12-,13+,14+,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26+,27+,28-,29-,30-/m1/s1. | |
| Anacardic Acid | Solid. Molecular formula: C22H36O3. Mole weight: 348.5g/mol. IUPAC Name: 2-hydroxy-6-pentadecylbenzoic acid. SMILES: CCCCCCCCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O. InChI: InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25). | |
| Anatase nanowires A | Anatase nanowires A. | |
| Anatase nanowires B | Anatase nanowires B. | |
| anhydride copolymer | anhydride copolymer. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.