Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Poly(dimethylsiloxane-co-diphenylsiloxane), dihydroxy terminated | 95:5 mole ratio of dimethlsiloxane:diphenylsiloxane. Alternative Names: Hydroxy-terminated di-Me di-Ph siloxanes. CAS No. 68951-93-9. Molecular formula: HOSi(C6H5)2O[Si(CH3)2O]x[Si(C6H5)2O]ySi(C6H5)2OH. Mole weight: 438.8g/mol. IUPAC Name: hydroxy-[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-dimethylsilane. SMILES: C[Si](C)(O)O[Si](C)(C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)(C)O. InChI: InChI=1S/C18H30O5Si4/c1-24(2,19)21-26(5,6)23-27(22-25(3,4)20,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16,19-20H,1-6H3. |  |
| Poly(dimethylsiloxane-co-diphenylsiloxane), divinyl terminated | 84:16 mole ratio of dimethylsiloxane:diphenylsiloxane. CAS No. 68951-96-2. Molecular formula: C18H26O3Si3. Mole weight: 374.7g/mol. IUPAC Name: dimethyl(oxo)silane;ethenyl-hydroxy-dimethylsilane;oxo(diphenyl)silane. SMILES: C[Si](C)=O.C[Si](C)(O)C=C.O=[Si](c1ccccc1)c2ccccc2. InChI: InChI=1S/C12H10OSi.C4H10OSi.C2H6OSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-6(2,3)5;1-4(2)3/h1-10H;4-5H,1H2,2-3H3;1-2H3. | |
| Poly(dimethylsiloxane-co-methylhydrosiloxane), trimethylsilyl terminated | Poly(dimethylsiloxane-co-methylhydrosiloxane), trimethylsilyl terminated. CAS No. 68037-59-2. Molecular formula: C9H28O3Si4. Mole weight: 296.66g/mol. IUPAC Name: dimethyl-[methyl(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilane. SMILES: C[SiH](O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C. InChI: InChI=1S/C9H28O3Si4/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,1-9H3. | |
| Poly[dimethylsiloxane-co-methyl(stearoyloxyalkyl)siloxane] | Poly[dimethylsiloxane-co-methyl(stearoyloxyalkyl)siloxane]. | |
| Polydimethylsiloxane-diacrylamide | Polydimethylsiloxane-diacrylamide. CAS No. 359867-83-7. | |
| Poly(dimethylsiloxane), diglycidyl ether terminated | Poly(dimethylsiloxane), diglycidyl ether terminated. Alternative Names: Octamethylcyclotetrasiloxane homopolymer, SRU. CAS No. 130167-23-6. | |
| Poly(dimethylsiloxane)-graft-polyacrylates | Poly(dimethylsiloxane)-graft-polyacrylates. | |
| Poly(dimethylsiloxane), hydride terminated | Poly(dimethylsiloxane), hydride terminated. Alternative Names: Hydrogen-terminated di-Me silicones. CAS No. 70900-21-9. Molecular formula: C6H20O2Si3. Mole weight: 208.48g/mol. IUPAC Name: bis(dimethylsilyloxy)-dimethylsilane. SMILES: C[Si](C)=O. InChI: InChI=1S/C6H20O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h9-10H,1-6H3. | |
| Poly(dimethylsiloxane), hydroxy terminated | Poly(dimethylsiloxane), hydroxy terminated. Alternative Names: PDMS. CAS No. 70131-67-8. SMILES: C[Si](C)(O)O. | |
| Poly(dimethylsiloxane), monoglycidyl ether terminated | Poly(dimethylsiloxane), monoglycidyl ether terminated. CAS No. 157723-26-7. Molecular formula: Si(CH3)3O[Si(CH3)2O]nSi(CH3)2CH2CH2CH2OCH2(C2H3O). SMILES: C[Si](C)(O)O.C[Si](C)(O)CCCOCC1CO1. | |
| Poly(dimethylsiloxane), monohydroxy terminated | Poly(dimethylsiloxane), monohydroxy terminated. SMILES: C[Si](C)(O)O.CCCC[Si](C)(C)O.C[Si](C)(O)CCCOCCO. | |
| Poly(Dimethylsiloxane), Vinyl Terminated | Liquid. Alternative Names: PDMS. CAS No. 68083-19-2. Molecular formula: C8H18OSi2. Mole weight: 186.4g/mol. Purity: 0.95. IUPAC Name: ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane. SMILES: C[Si](C)=O. InChI: InChI=1S/C8H18OSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-8H,1-2H2,3-6H3. | |
| Poly(dioxanone-co-glycolide) | Poly(dioxanone-co-glycolide) is a biodegradable copolymer synthesized from the ring-opening polymerization of p-dioxanone and glycolide. Due to the ester linkages found in the polymer backbone, these polymers are able to degrade via hydrolysis. With different degrees of aliphatic character, the ratio of the two monomers affects the rate of hydrolysis and therefore the rate of degradation. Other factors that affect the degradation of these materials could include the end application or post-polymerization processing methods. Alternative Names: PDS-PGA, PDO-PGA. Molecular formula: (C4H6O3)m(C4H4O4)n. | |
| Poly(dioxanone-co-L-lactide) | Poly(dioxanone-co-L-lactide) is a biodegradable copolymer synthesized from the ring-opening polymerization of p-dioxanone and lactide. Due to the ester linkages found in the polymer backbone, these polymers are able to degrade via hydrolysis. With different degrees of aliphatic character, the ratio of the two monomers affects the rate of hydrolysis and therefore the rate of degradation. Other factors that affect the degradation of these materials could include the end application or post-polymerization processing methods. Alternative Names: PDO-PLA, PDS-PLA. Molecular formula: (C4H6O3)m(C6H8O4)n. | |
| Poly(D,L-lactide) | Poly(D,L-lactide). CAS No. 26680-10-4. Molecular formula: C6H8O4. Mole weight: 144.12g/mol. IUPAC Name: 3,6-dimethyl-1,4-dioxane-2,5-dione. SMILES: CC1C(=O)OC(C(=O)O1)C. InChI: InChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3. | |
| Poly(D,L-lactide-block-acrylic acid) | The PLLA-block-PAA is a biocompatible diblock copolymer which forms cylindrical micelles. The PLLA is hydrophobic and a degradable block and the PAA is hydrophilic. Alternative Names: PDLLA -b-PAA 5kDa, Polylactide-block-polyacrylic acid, PLA-PAA. Molecular formula: C13H25S3(C3H4O2)xC6H9NO(C3H4O2)yH. Mole weight: PAA Mn 18,000 PDLLA Mn 5,000. | |
| Poly(D,L-lactide)-b-poly(ethylene glycol)-b-poly(D,L-lactide) | Poly(D,L-lactide)-b-poly(ethylene glycol)-b-poly(D,L-lactide). | |
| Poly(D,L-lactide-co-glycolide)-block-poly(ethylene glycol)-block-poly(D,L-lactide-co-glycolide) based poly(ether ester urethane) | The polymers are bioresorbable aliphatic polyesters comprised of a range of different ratios of lactide and glycolide monomers, PLA stereochemistries, and end-group functionalization. These biodegradeable homopolymers and copolymers of lactide and glycolide afford a variety of properties that range from very stiff, hard semi-crystalline materials with long degradation times, to softer, amorphous materials with faster degradation rates. Alternative Names: poly(ester ether urethane), PLGA-PEG-PLGA urethane, PEEU. Molecular formula: [C2H2N2O2R[(C3H4O2)x(C2H2O2)y]m[C2H4O]lO[(C3H4O2)x(C2H2O2)y]m]n. Mole weight: PEG average Mn 400 average Mn (6,000-15,000). SMILES: CC(N[R]NC(OC(C)C(OCC(OCCOC(C(C)OC(COC)=O)=O)=O)=O)=O)=O.CC(N[R]NC(OCCCOC)=O)=O. | |
| Poly(D,L-lactide-co-trimethylene carbonate) | Poly(L-lactide-co-trimethylene carbonate) (PLT) copolymers were synthesized by ring opening polymerization of L-lactide (LLA) and trimethylene carbonate (TMC). Alternative Names: PDLA-TMC. Molecular formula: CH3(C3H4O2)m(C4H6O3)nCH3. | |
| POLY-DL-ORNITHINE HYDROBROMIDE | POLY-DL-ORNITHINE HYDROBROMIDE. CAS No. 82682-33-5. | |
| Poly-D-Lysine & Laminin (2.5 ML) | Poly-D-Lysine & Laminin (2.5 ML). | |
| Polyepoxysuccinic acid | Polyepoxysuccinic acid. CAS No. 51274-37-4. Molecular formula: HO(C4H2O5M2)n. Mole weight: 400-1500. | |
| Poly(ε-caprolactone)-b-poly(ethylene glycol)-b-poly(ε-caprolactone) | Poly(ε-caprolactone)-b-poly(ethylene glycol)-b-poly(ε-caprolactone). | |
| Poly-ε-Cbz-L-lysine | Poly-ε-Cbz-L-lysine. CAS No. 25931-47-9. Molecular formula: C14H20N2O4. Mole weight: 280.32g/mol. IUPAC Name: 2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid. SMILES: C1=CC=C(C=C1)COC(=O)NCCCCC(C(=O)O)N. InChI: InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18). | |
| Poly(ethyl acrylate) solution | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: Acrylic acid ethyl ester polymer, Ethyl acrylate homopolymer. CAS No. 9003-32-1. Molecular formula: CH2CHCOOC2H5;C5H8O2;C5H8O2. Mole weight: average Mw ~95,000 by GPC. IUPAC Name: ethyl prop-2-enoate. SMILES: CCOC(=O)C=C. InChI: 1S/C5H8O2/c1-3-5(6)7-4-2/h3H,1,4H2,2H3. | |
| Poly(ethylene-alt-maleic anhydride) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: maleic copolymer, maleated copolymer, maleated polymer. CAS No. 9006-26-2. Mole weight: average Mw 100,000-500,000. InChI: 1S/C4H2O3.C2H4/c5-3-1-2-4(6)7-3;1-2/h1-2H;1-2H2. | |
| Polyethylene-block-poly(ethylene glycol) | We offer you this block copolymer with good biocompatibility. Molecular formula: CH3CH2(CH2CH2)X(OCH2CH2)YOH. Mole weight: average Mn ~1,400. SMILES: C=C.OCCO. | |
| Poly(ethylene-co-acrylic acid) zinc salt | Poly(ethylene-co-acrylic acid) zinc salt. CAS No. 28208-80-2. Molecular formula: C8H10O4Zn. Mole weight: 235.5g/mol. IUPAC Name: zinc;ethene;prop-2-enoate. SMILES: C=C.C=CC(=O)[O-].C=CC(=O)[O-].[Zn+2]. InChI: InChI=1S/2C3H4O2.C2H4.Zn/c2*1-2-3(4)5;1-2;/h2*2H,1H2,(H,4,5);1-2H2;/q;;;+2/p-2. | |
| Poly(ethylene-co-ethyl acrylate) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. CAS No. 9010-86-0. Molecular formula: (CH2CH2)x[CH2CH(CO2C2H5)]y. Mole weight: 128.17g/mol. IUPAC Name: ethene;ethyl prop-2-enoate. SMILES: C=C.CCOC(=O)C=C. InChI: 1S/C5H8O2.C2H4/c1-3-5(6)7-4-2;1-2/h3H,1,4H2,2H3;1-2H2. | |
| Poly(ethylene-co-propylene-co-5-methylene-2-norbornene) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: Ethylene-ethylidenenorbornene-propylene copolymer. CAS No. 25038-36-2. InChI: 1S/C9H12.C3H6.C2H4/c1-2-8-5-7-3-4-9(8)6-7;1-3-2;1-2/h2-4,7,9H,5-6H2,1H3;3H,1H2,2H3;1-2H2/b8-2+; | |
| Poly(ethylene-co-vinyl acetate) | Poly(ethylene-co-vinyl acetate). CAS No. 24937-78-8. Molecular formula: C6H10O2. Mole weight: 114.14g/mol. IUPAC Name: ethene;ethenyl acetate. SMILES: CC(=O)OC=C.C=C. InChI: InChI=1S/C4H6O2.C2H4/c1-3-6-4(2)5;1-2/h3H,1H2,2H3;1-2H2. | |
| Poly(ethylene glycol), 16 hydroxyl dendron, generation 3 | Poly(ethylene glycol), 16 hydroxyl dendron, generation 3. | |
| Poly(ethylene glycol) 2-aminoethyl ether acetic acid | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: PEG average Mn 5000 (n~110) average Mn 5000. | |
| Poly(ethylene glycol) 2-aminoethyl ether acetic acid | Poly(ethylene glycol) 2-aminoethyl ether acetic acid. CAS No. 139729-28-5. | |
| Poly(ethylene glycol) 2-aminoethyl ether biotin | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: PEG average Mn 3,400 (n~77). | |
| Poly(ethylene glycol) 4-cyano-4-(phenylcarbonothioylthio)pentanoate | Poly(ethylene glycol) 4-cyano-4-(phenylcarbonothioylthio)pentanoate. | |
| Poly(ethylene glycol), 4 hydroxyl dendron, generation 1 | Poly(ethylene glycol), 4 hydroxyl dendron, generation 1. | |
| Poly(ethylene glycol), 8 hydroxyl dendron, generation 2 | Poly(ethylene glycol), 8 hydroxyl dendron, generation 2. CAS No. 352708-21-5. | |
| Poly(ethylene glycol) α-hydroxy-ω-azido terminated | Poly(ethylene glycol) α-hydroxy-ω-azido terminated. | |
| Poly(ethylene glycol), α-maleimidopropionamide-ω-formyl terminated | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: average Mn 3000. | |
| Poly(ethylene glycol) bis(2-bromoisobutyrate) | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: PEG-ATRP, PEG-Bib, Dibromoisobutyryl PEG. CAS No. 467254-02-0. Mole weight: PEG average Mn 300 (n ~ 7) average Mn 700. | |
| Poly(ethylene glycol) bis(2-bromoisobutyrate) | Poly(ethylene glycol) bis(2-bromoisobutyrate). | |
| Poly(ethylene glycol) bis(amine) | Poly(ethylene glycol) bis(amine). CAS No. 24991-53-5. | |
| Poly(ethylene glycol) bisazide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Mole weight: PEG average Mn 10000 (n~230) average Mn 10000. | |
| Poly(ethylene glycol) bisazide | Poly(ethylene glycol) bisazide. CAS No. 82055-94-5. | |
| Poly(ethylene glycol) bis(carboxymethyl) ether | Poly(ethylene glycol) bis(carboxymethyl) ether. Alternative Names: Polyoxyethylene bis(acetic acid). CAS No. 39927-08-7. Molecular formula: C4H10O5. Mole weight: 138.12. Purity: >90%. IUPAC Name: Ethane-1,2-diol;2-hydroxyacetic acid. SMILES: C(CO)O.C(C(=O)O)O. InChI: InChI=1S/C2H4O3.C2H6O2/c3-1-2(4)5;3-1-2-4/h3H,1H2,(H,4,5);3-4H,1-2H2. | |
| Poly(ethylene glycol)-block-polylactide methyl ether | Biodegradable, water-soluble polymer. Alternative Names: PEG-b-PLA. Molecular formula: CH3O(CH2CH2O)x(COCHCH3O)yH. Mole weight: PEG average Mn 750 PLA average Mn 1,000. | |
| Poly(ethylene glycol)-block-poly(N-isopropylacrylamide) | Poly(ethylene glycol)-b-poly(N-isopropylacrylamide) (PEG110-b-PNIPAM44) undergoes thermoresponsive micellization in water, forming micelles of varied size, structure and distribution depending on the concentration of the block copolymer. Alternative Names: PEGylated polyNIPAM, PEG-block-PNIPAM, PEG-b-polyNIPAM, PNIPAAm. Molecular formula: CH3(OC2H4)mC6H7NO2(C6H11NO)nH. Mole weight: PEG Mn 2,000 PNIPAM Mn 24,000. | |
| Poly(ethylene glycol)-block-poly(propylene glycol)-block-poly(ethylene glycol) | Liquid. CAS No. 9003-11-6. Molecular formula: C5H10O2. Mole weight: 102.13g/mol. IUPAC Name: 2-methyloxirane;oxirane. SMILES: CC1CO1.C1CO1. InChI: InChI=1S/C3H6O.C2H4O/c1-3-2-4-3;1-2-3-1/h3H,2H2,1H3;1-2H2. | |
| Poly(ethylene glycol) diacetylene | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: PEG diacetylene, PEG bis(4-pentynoate)terminated, Poly(ethylene glycol) bis(4-pentynoate) terminated. Mole weight: average Mn 2000. | |
| Poly(ethylene glycol) diacrylamide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. CAS No. 160556-48-9. Mole weight: average Mn 3,700. | |
| Poly(ethylene glycol) diamine | Poly(ethylene glycol) diamine. CAS No. 24991-53-5. | |
| Poly(ethylene glycol) diglycidyl ether | Liquid. CAS No. 72207-80-8. Molecular formula: C8H14O4. Mole weight: 174.19g/mol. IUPAC Name: 2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane. SMILES: C1C(O1)COCCOCC2CO2. InChI: InChI=1S/C8H14O4/c1(9-3-7-5-11-7)2-10-4-8-6-12-8/h7-8H,1-6H2. | |
| Poly(ethylene glycol) dimethyl ether | 1,2-dimethoxyethane appears as a liquid with a sharp odor. Less dense than water. Flash point 34°F. Mildly toxic by ingestion and inhalation. Severely irritates skin and eyes. Vapors heavier than air. Used to make other chemicals.;Liquid;Liquid;COLOURLESS LIQUID WITH CHARACTERISTIC ODOUR. CAS No. 24991-55-7. Molecular formula: C4H10O2;CH3OCH2CH2OCH3;C4H10O2;C4H10O2. Mole weight: 90.12g/mol. IUPAC Name: 1,2-dimethoxyethane. SMILES: COCCOC. InChI: InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3. | |
| Poly(ethylene glycol) dithiol | Poly(ethylene glycol) dithiol. Molecular formula: C4H10OS2. Mole weight: 138.3g/mol. IUPAC Name: 2-(2-sulfanylethoxy)ethanethiol. SMILES: C(CS)OCCS. InChI: InChI=1S/C4H10OS2/c6-3-1-5-2-4-7/h6-7H,1-4H2. | |
| Poly(ethylene glycol) ditosylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: PEG ditosylate. Mole weight: average Mn 20000. | |
| Poly(ethylene glycol) divinyl ether | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. CAS No. 50856-26-3. Molecular formula: C4H10O3. Mole weight: average Mn 250. IUPAC Name: ethane-1,2-diol;ethenol. SMILES: OC=C.OCCO. InChI: InChI=1S/C2H6O2.C2H4O/c3-1-2-4;1-2-3/h3-4H,1-2H2;2-3H,1H2. | |
| Poly(ethylene glycol) methacrylate | Poly(ethylene glycol) methacrylate. CAS No. 25736-86-1. | |
| Poly(ethylene glycol) methyl ether | Poly(ethylene glycol) methyl ether. CAS No. 9004-74-4. | |
| Poly(ethylene glycol) methyl ether (2-methyl-2-propionic acid dodecyl trithiocarbonate) | Poly(ethylene glycol) methyl ether (2-methyl-2-propionic acid dodecyl trithiocarbonate). | |
| Poly(ethylene glycol) methyl ether (4-cyano-4-pentanoate dodecyl trithiocarbonate) | Poly(ethylene glycol) methyl ether (4-cyano-4-pentanoate dodecyl trithiocarbonate). | |
| Poly(ethylene glycol)methyl ether acetylene | Poly(ethylene glycol)methyl ether acetylene. | |
| Poly(ethylene glycol) methyl ether acrylate | 2-methoxyethyl acrylate is a clear colorless liquid with a sharp musty odor. (NTP, 1992);Liquid. CAS No. 32171-39-4. Molecular formula: C6H10O3. Mole weight: 130.14g/mol. IUPAC Name: 2-methoxyethyl prop-2-enoate. SMILES: COCCOC(=O)C=C. InChI: InChI=1S/C6H10O3/c1-3-6(7)9-5-4-8-2/h3H,1,4-5H2,2H3. | |
| Poly(ethylene glycol) methyl ether amine | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: methoxyPEG amine, PEG NH2, mPEG-NH2, Methoxypolyethylene glycol amine, mPEG amine. CAS No. 80506-64-5. Molecular formula: C25H53NO12. Mole weight: PEG average Mn 450 (n~10) average Mn 500. IUPAC Name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. SMILES: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN. InChI: InChI=1S/C25H53NO12/c1-27-4-5-29-8-9-31-12-13-33-16-17-35-20-21-37-24-25-38-23-22-36-19-18-34-15-14-32-11-10-30-7-6-28-3-2-26/h2-26H2,1H3. | |
| Poly(ethylene glycol) methyl ether azide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Alternative Names: Methoxypolyethylene glycol azide, mPEG-N3, azido mPEG, PEG N3, methoxyPEG azide, mPEG azide. CAS No. 89485-61-0. Mole weight: PEG average Mn 350 (n~8) average Mn 400. | |
| Poly(ethylene glycol) methyl ether-block-poly(D,L lactide) | Poly(ethylene glycol) methyl ether-block-poly(D,L lactide) is an amphiphilic, diblock copolymer composed of a hydrophilic PEG block and a hydrophobic PLA block. Alternative Names: mPEG-PLLA, Biodegradable, PLLA, PEG-PLA, Drug delivery, mPEG-PLA, Block copolymer. Molecular formula: HO[CH(CH3)COO]m[CH2CH2O]nCH3. Mole weight: PDLA average Mn 20,000 (by NMR) PDLLA average Mn 20000 PEG average Mn 5,000 (by NMR) PEG average Mn 5000. | |
| Poly(ethylene glycol) methyl ether-block-poly(D,L lactide)-block-decane | Block copolymer micelles are widely used in drug delivery applications. PEG-PDLLA is a biodegradable polymeric micelle which is used as carriers for hydrophobic drugs like paclitaxel. PEG is the hydrophilic part and PDLLA is the hydrophobic part which forms the micelle core wherein the hydrophobic drug is loaded. Alternative Names: PEG-PDLLA-decane, PEG-b-PLA-b-decane, PEG-PLA. Mole weight: PDLLA average Mn 2,000 PEG average Mn 2,000 average Mn 4,000 (total). | |
| Poly(ethylene glycol) methyl ether-block-poly(ε-caprolactone) | This polymer product is biodegradable. Alternative Names: PEG-PCL, PEG-b-PCL. Molecular formula: CH3(C2H4O)nO(C6H10O2)mH. Mole weight: PCL average Mn 25,000 PEG average Mn 5,000 apparent mol wt 20000-30000 (PCL) apparent mol wt 4000-6000 (PEG). | |
| Poly(ethylene glycol) methyl ether-block-poly(lactide-co-glycolide) | Contains ≤500 ppm impurities by GC, including trace monomer and residual organics. Alternative Names: PEG-PLGA, mPEG-b-PLGA. Molecular formula: H[(C3H4O2)x(C2H2O2)y]mO[C2H4O]nCH3. Mole weight: PEG average Mn 5,000 PLGA Mn 5,000. | |
| Poly(ethylene glycol) methyl ether-block-poly(L-lactide-co-glycolide) | Poly(L-lactide-co-glycolide) (PLGA) is a biodegradable and biocompatible copolymer for use in biomedical research devices, such as grafts, sutures, implants. Alternative Names: PEG-PLGA, PEG-b-PLGA. Molecular formula: CH3[C2H4O]nO[(C2H2O2)x(C3H4O2)y]mH. Mole weight: PEG average Mn 5,000 PLGA average Mn 25,000. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.