Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Poly-L-lysine, succinylated | Poly-L-lysine, succinylated. |  |
| Poly-L-ornithine hydrochloride | White crystalline solid or powder to syrup; Slight savoury aroma. CAS No. 26982-21-8. Molecular formula: C5H13ClN2O2. Mole weight: 168.62g/mol. IUPAC Name: (2S)-2,5-diaminopentanoic acid;hydrochloride. SMILES: C(CC(C(=O)O)N)CN.Cl. InChI: InChI=1S/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1. | |
| Poly-L-ornithine solution | Poly-L-ornithine solution. CAS No. 27378-49-0. Molecular formula: C5H13BrN2O2. Mole weight: 213.07g/mol. IUPAC Name: 2,5-diaminopentanoic acid;hydrobromide. SMILES: C(CC(C(=O)O)N)CN.Br. InChI: InChI=1S/C5H12N2O2.BrH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H. | |
| Poly-L-threonine | Poly-L-threonine. CAS No. 82822-12-6. Molecular formula: C10H10N4O2. Mole weight: 218.21g/mol. IUPAC Name: 2-[5-(4-methylphenyl)tetrazol-2-yl]acetic acid. SMILES: CC1=CC=C(C=C1)C2=NN(N=N2)CC(=O)O. InChI: InChI=1S/C10H10N4O2/c1-7-2-4-8(5-3-7)10-11-13-14(12-10)6-9(15)16/h2-5H,6H2,1H3,(H,15,16). | |
| POLY-L-TYROSINE | Solid;Colourless silky needles or white crystalline powder; odourless. CAS No. 25619-78-7. Molecular formula: C9H11NO3;C9H11NO3. Mole weight: 181.19g/mol. IUPAC Name: (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid. SMILES: C1=CC(=CC=C1CC(C(=O)O)N)O. InChI: InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1. | |
| Poly(Lys, Phe) 1:1 hydrobromide | Poly(Lys, Phe) 1:1 hydrobromide. CAS No. 26700-39-0. | |
| Poly(maleic anhydride-alt-1-octadecene) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: maleic copolymer, maleated copolymer, maleated polymer. | |
| Poly(methacrylic acid, sodium salt) solution | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: Sodium polymethacrylate, Sodium polymethacrylic acid, Poly(methacrylic acid) sodium salt. CAS No. 54193-36-1. Molecular formula: [CH2C(CH3)(CO2Na)]n. Mole weight: average Mn ~5,400 average Mw ~9,500 by GPC. IUPAC Name: sodium;2-methylprop-2-enoate. SMILES: CC(=C)C(=O)O[Na]. InChI: 1S/C4H6O2.Na/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1. | |
| Poly(methyl acrylate), azide terminated | Poly(methyl acrylate), azide terminated. | |
| Poly(methyl acrylate) solution | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: Methyl acrylate homopolymer, Acrylic acid methyl ester polymer. CAS No. 9003-21-8. Molecular formula: (C4H6O2)n. Mole weight: average Mw ~40,000 by GPC. SMILES: COC(=O)C=C. | |
| Poly(methylhydrosiloxane), trimethylsilyl terminated | Poly(methylhydrosiloxane), trimethylsilyl terminated. Alternative Names: Methyl hydrogen polysiloxane. CAS No. 63148-57-2. Molecular formula: (CH3)3SiO[SiH(CH3)O]nSi(CH3)3. Mole weight: Mn ~390. SMILES: [H][Si](C)(C)O.C[Si](C)(C)C.C[Si](C)(C)O. | |
| Poly(methyl methacrylate-co-ethyl acrylate) | Poly(methyl methacrylate-co-ethyl acrylate). CAS No. 9010-88-2. Molecular formula: [CH2C(CH3)(CO2CH3)]X[CH2CH(CO2C2H5]Y. Mole weight: 200.23g/mol. IUPAC Name: ethyl prop-2-enoate;methyl 2-methylprop-2-enoate. SMILES: CCOC(=O)C=C.CC(=C)C(=O)OC. InChI: 1S/2C5H8O2/c1-4(2)5(6)7-3;1-3-5(6)7-4-2/h1H2,2-3H3;3H,1,4H2,2H3. | |
| Poly(methyl methacrylate-co-ethylene glycol dimethacrylate) | Particles of this polymer can be prepared by dispersion polymerization. CAS No. 25777-71-3. Molecular formula: [-CH2C(CH3)(CO2CH3)-]X[CH2(C-)(CH3)CO2CH2CH2O2C(C-)(CH3)CH2-]Y. Mole weight: 298.33g/mol. IUPAC Name: methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate. SMILES: COC(=O)C(C)=C.CC(=C)C(=O)OCCOC(=O)C(C)=C. InChI: 1S/C10H14O4.C5H8O2/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-4(2)5(6)7-3/h1,3,5-6H2,2,4H3;1H2,2-3H3. | |
| Poly(methyl methacrylate-co-methacrylic acid) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: Poly(methacrylic acid-co-methyl methacrylate). CAS No. 25086-15-1. Molecular formula: C9H14O4. Mole weight: average Mn ~15,000 by GPC average Mw ~34,000 by GPC. IUPAC Name: methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid. SMILES: CC(=C)C(=O)O.CC(=C)C(=O)OC. InChI: 1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3,(H,5,6). | |
| Poly(methyl methacrylate), isotactic | i-PMMA can be prepared from t-C4H9MgBr. Structure of crystalline isotactic poly(methyl methacrylate) (i-PMMA) was investigated by X-ray diffraction and infra red spectroscopic techniques. Alternative Names: Isotactic PMMA,Isotactic methyl methacrylate polymer,Isotactic poly(methyl methacrylate). CAS No. 25188-98-1. Molecular formula: (C5H8O2)n. Mole weight: 395.33g/mol. IUPAC Name: diethoxyphosphoryl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoacetate. SMILES: CCOP(=O)(OCC)OC(=O)C(=NOCC(=O)OC)C1=CSC(=N1)N. InChI: InChI=1S/C12H18N3O8PS/c1-4-21-24(18,22-5-2)23-11(17)10(8-7-25-12(13)14-8)15-20-6-9(16)19-3/h7H,4-6H2,1-3H3,(H2,13,14)/b15-10-. | |
| Poly(methyl vinyl ether-alt-maleic acid) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: Methyl vinyl ether-maleic acid copolymer, Poly(maleic acid-methyl vinyl ether), Methoxyethylene-maleic acid copolymer. CAS No. 25153-40-6. Molecular formula: [CH2CH(OCH3)CH(CO2H)CH(CO2H)]n. Mole weight: average Mn ~960,000 average Mw ~1,980,000 by LS. IUPAC Name: (E)-but-2-enedioic acid;methoxyethene. SMILES: COC=C.OC(=O)\C=C\C(O)=O. InChI: 1S/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-. | |
| Poly(methyl vinyl ether-alt-maleic anhydride) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: maleic copolymer, maleated copolymer, maleated polymer. CAS No. 9011-16-9. Molecular formula: C7H8O4. Mole weight: average Mn ~311,000 average Mw ~1,080,000. IUPAC Name: furan-2,5-dione;methoxyethene. SMILES: COC=C.C1=CC(=O)OC1=O. InChI: 1S/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3-4-2/h1-2H;3H,1H2,2H3. | |
| Poly(methyl vinyl ether) solution | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. CAS No. 9003-9-2. Molecular formula: (C3H6O)n. Mole weight: 58.08g/mol. IUPAC Name: methoxyethene. SMILES: COC=C. InChI: 1S/C3H6O/c1-3-4-2/h3H,1H2,2H3. | |
| Poly[n,N-(1,3-phenylene)isophthalamide] | Poly[n,N-(1,3-phenylene)isophthalamide]. Alternative Names: POLY[N,N-(1,3-PHENYLENE)ISOPHTHALAMIDE];1,3-Benzenedicarbonyldichloride,polymerwith1,3-benzenediamine. CAS No. 25765-47-3. Molecular formula: (C14H14N2O2)n. | |
| Poly(N-isopropyl acrylamide) | Poly(N-isopropyl acrylamide). | |
| Poly(N-isopropylacrylamide) | Poly(N-isopropylacrylamide). CAS No. 25189-55-3. Molecular formula: C6H11NO. Mole weight: 113.16g/mol. IUPAC Name: N-propan-2-ylprop-2-enamide. SMILES: CC(C)NC(=O)C=C. InChI: InChI=1S/C6H11NO/c1-4-6(8)7-5(2)3/h4-5H,1H2,2-3H3,(H,7,8). | |
| Poly(N-isopropylacrylamide) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: functionalized polyNIPAM, NIPAM polymer, PNIPAM. Molecular formula: C21H25N7S. Mole weight: average Mw 10,000. IUPAC Name: 2-N-(2-methylphenyl)-4-N-(4-methylsulfanylphenyl)-6-piperazin-1-yl-1,3,5-triazine-2,4-diamine. SMILES: CC1=CC=CC=C1NC2=NC(=NC(=N2)NC3=CC=C(C=C3)SC)N4CCNCC4. InChI: InChI=1S/C21H25N7S/c1-15-5-3-4-6-18(15)24-20-25-19(23-16-7-9-17(29-2)10-8-16)26-21(27-20)28-13-11-22-12-14-28/h3-10,22H,11-14H2,1-2H3,(H2,23,24,25,26,27). | |
| Poly(N-isopropyl acrylamide), amine terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: polyacrylamide, functionalized polyNIPAM, functionalized polyacrylamide, PNIPAM-NH2, NIPAM polymer. Molecular formula: H(C6H11NO)n(CH2)NH2. Mole weight: average Mn 2,000. | |
| Poly(N-isopropylacrylamide), amine terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: functionalized polyNIPAM, functionalized polyacrylamide, Polyacrylamide, PNIPAM-NH2, NIPAM polymer, polyNIPAM. Molecular formula: (C6H11NO)nSCH2CH2NH2. Mole weight: Mn 2000-3000 (by HCL Titration). | |
| Poly(N-isopropylacrylamide) azide terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PNIPAM-N3, PNIPAAm, Azide polyNIPAM. Molecular formula: N3(CH2)3OOCC(CH3)2(C6H11NO)nH. Mole weight: average Mn 5,000. | |
| Poly(N-isopropylacrylamide), azide terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: Azide PolyNIPAM, PNIPAAm, PNIPAM-N3. Mole weight: average Mn 15,000. | |
| Poly(N-isopropylacrylamide), carboxylic acid terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PNIPAM-COOH, functionalized polyNIPAM, functionalized polyacrylamide, Polyacrylamide, NIPAM polymer, polyNIPAM. Molecular formula: (C6H11NO)nSCH2CH2CO2H. Mole weight: average Mn 5,000. | |
| Poly(N-isopropylacrylamide-co-acrylamide) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: Poly(NIPAM-co-acrylamide), Acrylamide copolymer. CAS No. 28500-83-6. Molecular formula: (C6H11NO)x (C3H5NO)y. Mole weight: average Mn 20,000-25,000. | |
| Poly(N-isopropylacrylamide-co-acrylic acid) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Molecular formula: (C6H11NO)m (C3H4O2)n. | |
| Poly(N-isopropylacrylamide-co-butylacrylate) | Random copolymer of N-isopropylacrylamide with 12 mole % butylacrylate. This copolymer shows LCST at 15 C (lower temperature than PolyNIPAM). Alternative Names: NIPAM, polyNIPAM-BA, polyNIPAM. Molecular formula: (C6H11NO)m(C7H12O2)n. Mole weight: average Mn 30,000. | |
| Poly(N-isopropylacrylamide-co-methacrylic acid-co-octadecyl acrylate) | Intelligent Swelling/Collapsing copolymer that can be used as a temperature- and pH-sensitive material. Alternative Names: Poly(NIPAM-co-MAA-co-ODA), functionalized polyNIPAM, functionalized polyacrylamide, Polyacrylamide, polyNIPAM. Molecular formula: (C6H11NO)m (C4H6O2)n (C21H40O2)p. Mole weight: Mn 30,000-60,000. | |
| Poly(N-isopropyl acrylamide-co-(N-methacryloxysuccinimide)) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PNIPAM. Molecular formula: C4H7O2[C6H11NO]x[C8H9NO3]yC13H25S3. Mole weight: average Mn 5,000. | |
| Poly(N-isopropylacrylamide), maleimide terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: P(NIPAM)n-NH-maleimide, functionalized polyNIPAM, functionalized polyacrylamide, Polyacrylamide, polyNIPAM. Molecular formula: (C6H11NO)n SCH2CH2NH(CO)CH2CH2CH2(C4H2NO2). Mole weight: average Mn 2,000. | |
| Poly(N-isopropylacrylamide), N-hydroxysuccinimide (NHS) ester terminated | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: functionalized polyNIPAM, functionalized polyacrylamide, Polyacrylamide, NIPAM polymer, PNIPAM-NHS, polyNIPAM. Molecular formula: (C6H11NO)n SCH2CH2COO(C4H4NO2). Mole weight: average Mn 2,000. | |
| Poly(N-isopropylacrylamide) triethoxysilane terminated | Poly(N-isopropylacrylamide) triethoxysilane terminated. | |
| Poly(N-isopropyl acylamide-co-3-(trimethoxysilyl)propyl methacrylate) | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PNIPAM. Mole weight: average Mn 10000. | |
| Poly(N,N-dimethylacrylamide), DDMAT terminated | Need help choosing the correct RAFT Agent? Please consult the RAFT Agent to Monomer compatibility table. Alternative Names: polydimethylacrylamide methylpropionic acid dodecyltrithiocarbonate, PDMAM, polyDMAM. Molecular formula: HOCOCH(CH3)2(CH2CHCON(CH3)2)nSCS2C12H25. Mole weight: average Mn 10,000. | |
| Poly(octadecyl methacrylate) solution | Poly(octadecyl methacrylate) may be used to prepare block copolymers to form molecular brushes. Alternative Names: Poly(octadecyl methacrylate),Poly(stearyl methacrylate). CAS No. 25639-21-8. Molecular formula: (C22H42O2)n. Mole weight: 338.6g/mol. IUPAC Name: 2-methyloctadecyl prop-2-enoate. SMILES: CCCCCCCCCCCCCCCCCCOC(=O)C(C)=C. InChI: InChI=1S/C22H42O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(3)20-24-22(23)5-2/h5,21H,2,4,6-20H2,1,3H3. | |
| Poly[[octahydro-5-(methoxycarbonyl)-5-methyl-4,7-methano-1 H-indene-1,3-diyl]-1,2-ethanediyl] | Poly[[octahydro-5-(methoxycarbonyl)-5-methyl-4,7-methano-1 H-indene-1,3-diyl]-1,2-ethanediyl]. Alternative Names: POLY[[OCTAHYDRO-5-(METHOXYCARBONYL)-5-METHYL-4,7-METHANO-1 H-INDENE-1,3-DIYL]-1,2-ETHANEDIYL];poly((octahydro-5-(methoxycarbonyl)-5-me-4,7-meth;POLY((OCTAHYDRO-5-(METHOXYCARBONYL)-5-ME -4,7-METHANO-1H-INDENEDIYL)-ETHANEDIYL). CAS No. 123322-60-1. Molecular formula: (C15H20O2)n. | |
| Polyoxyethylene bis(azide) | Polyoxyethylene bis(azide). CAS No. 82055-94-5. | |
| Poly(p-dioxanone-co-glycolide-co-lactide | An absorbable, biocompatible block copolymer. Alternative Names: PDS-PGLA, PDO-PGLA. Molecular formula: CH3(C4H6O3)m(C4H4O4)n(C6H8O4)oCH3. | |
| Poly(p-dioxanone-co-L-lactide) | This product we offer is a degradable polymer. Alternative Names: PDS-PLLA, PDO-PLLA. Molecular formula: CH3(C4H6O3)m(C6H8O4)nCH3. | |
| Poly(Pro-Gly-Pro) | Poly(Pro-Gly-Pro). CAS No. 25104-46-5. | |
| Poly(propylene glycol) | Polypropylene glycol appears as colorless liquid that is odorless or has a mild sweet odor. May float or sink in water. (USCG, 1999). CAS No. 25322-69-4. Molecular formula: C6H14O3. Mole weight: 134.17g/mol. IUPAC Name: 2-(2-hydroxypropoxy)propan-1-ol. SMILES: CC(CO)OCC(C)O. InChI: InChI=1S/C6H14O3/c1-5(8)4-9-6(2)3-7/h5-8H,3-4H2,1-2H3. | |
| Polypropylene glycol | Polypropylene glycol appears as colorless liquid that is odorless or has a mild sweet odor. May float or sink in water. (USCG, 1999). Alternative Names: PPG;Polyoxypropylene;Oxirane, methyl-, homopolymer;Propane-1,2-diol, propoxylated. CAS No. 25322-69-4. Molecular formula: (C3H6O)n.H2O. Mole weight: 134.17g/mol. IUPAC Name: 2-(2-Hydroxypropoxy)propan-1-ol. SMILES: CC(CO)OCC(C)O. InChI: DUFKCOQISQKSAV-UHFFFAOYSA-N. | |
| Poly(propylene glycol) bis(2-aminopropyl ether) | Poly(propylene glycol) bis(2-aminopropyl ether). CAS No. 9046-10-0. Molecular formula: C4H9NO2. Mole weight: 103.12g/mol. IUPAC Name: (3S,4S)-pyrrolidine-3,4-diol. SMILES: C1C(C(CN1)O)O. InChI: InChI=1S/C4H9NO2/c6-3-1-5-2-4(3)7/h3-7H,1-2H2/t3-,4-/m0/s1. | |
| Poly(propylene glycol)-block-poly(ethylene glycol)-block-poly(propylene glycol) | Liquid. CAS No. 9003-11-6. Molecular formula: C5H10O2. Mole weight: 102.13g/mol. IUPAC Name: 2-methyloxirane;oxirane. SMILES: CC1CO1.C1CO1. InChI: InChI=1S/C3H6O.C2H4O/c1-3-2-4-3;1-2-3-1/h3H,2H2,1H3;1-2H2. | |
| Poly(propylene glycol) diglycidyl ether | Poly(propylene glycol) diglycidyl ether. CAS No. 26142-30-3. | |
| Poly(propylene glycol) monobutyl ether | Liquid;COLOURLESS LIQUID. CAS No. 9003-13-8. Molecular formula: C10H22O3;C10H22O3. Mole weight: 190.28g/mol. IUPAC Name: 1-(1-butoxypropan-2-yloxy)propan-2-ol. SMILES: CCCCOCC(C)OCC(C)O. InChI: InChI=1S/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3. | |
| Poly(propylene oxide)cyclocarbonate terminated | Poly(propylene oxide)cyclocarbonate terminated. Alternative Names: methyl-oxiranpolymerwithcarbondioxide;POLY(PROPYLENE CARBONATE);POLY(PROPYLENE OXIDE) CYCLOCARBONATE TERMINATED;METHYLOXIRANE, POLYMER WITH CARBON DIOXIDE;propylene carbonate homopolymer;Carbon dioxide-methyloxirane copolymer;Carbon dioxide-propylene oxid. CAS No. 25511-85-7. Molecular formula: [CH(CH3)CH2OCO2]n. | |
| Polypropylene oxide,monoamine terminated | Liquid. Alternative Names: oxirane,methyl-,polymerwithoxirane,2-aminopropylmethylether;POLY(PROPYLENE OXIDE), MONOAMINE TERMINATED;Methoxypoly(oxyethylene/oxypropylene)-2-propylamine;Methyloxirane polymer with oxirane, 2-aminopropyl methyl ether;polyethylene/propylene glycol 2-amin. CAS No. 83713-01-3. Molecular formula: C9H19NO2. Mole weight: 173.25g/mol. IUPAC Name: 2-methyloxirane;1-(2-methyloxiran-2-yl)propan-2-amine. SMILES: CC1CO1.CC(CC1(CO1)C)N. InChI: InChI=1S/C6H13NO.C3H6O/c1-5(7)3-6(2)4-8-6;1-3-2-4-3/h5H,3-4,7H2,1-2H3;3H,2H2,1H3. | |
| Polypyrrole | Polypyrrole (PPy) is a conductive and highly stable polymer, doped with proprietary organic acids. It may be prepared by standard electrochemical technique. PPy may also be prepared by reacting β-napthalene sulfonic acid (NSA) and ammonium peroxo-disulphate in aqueous medium. The charges on the surfaces can be easily modified by doping the polymer during its synthesis.Solubility and conductivity measurements of PPy doped with camphor sulfonic and dodecyl benzene sulfonic acid has been reported. Polypyrrole(PPy) is a π-conjugated conductive polymer that can be electrochemically synthesized and deposited on a variety of surfaces. The deposited PPy can be used in a wide range of sensor based applications due to the following properties: Ion exchange capacity. Electrochromic effects. Redox activity. Corrosion resistant. Catalytic activity. Alternative Names: PPy. Molecular formula: C4H5N. Mole weight: 67.09g/mol. IUPAC Name: 1H-pyrrole. SMILES: C1=CNC=C1. InChI: InChI=1S/C4H5N/c1-2-4-5-3-1/h1-5H. | |
| Polypyrrole-block-poly(caprolactone) | Sheet resistance, spin cast thin films: 10,000-50,000 Ohms/sqAverage transmittance: 70-90%Biodegradble conducting polymer for bomedical applications. PCL diol blocks have average molecular weight 2000 and PPy block have an average molecular weight of 4000 with a 25% doping level. Good biocompatibility with expected weight loss of 40% at 200 days in pH=7 buffer. Alternative Names: Biotron PP-NM,PCL-block-PPy. | |
| Poly[(R)-3-hydroxybutyric acid] | Biocompatible, biodegradable polymer. Alternative Names: PHB, (R)-3-Hydroxybutyric acid polymerized. CAS No. 29435-48-1. Molecular formula: [COCH2CH(CH3)O]n. Mole weight: 260.28g/mol. IUPAC Name: [4-oxo-4-(4-oxobutan-2-yloxy)butan-2-yl] 3-hydroxybutanoate. SMILES: CC(O)CC(O)=O. InChI: InChI=1S/C12H20O6/c1-8(14)6-11(15)18-10(3)7-12(16)17-9(2)4-5-13/h5,8-10,14H,4,6-7H2,1-3H3. | |
| Poly(sebacic acid), diacetoxy terminated | This product we offer is a degradable polymer. Molecular formula: C2H3O2 (C10H16O3)n C2H3O. | |
| Poly [silicone-alt-PEG] dimethacrylate | Poly [silicone-alt-PEG] dimethacrylate. | |
| Poly(sodium 4-styrenesulfonate) | DryPowder. CAS No. 25704-18-1. Molecular formula: C8H7NaO3S. Mole weight: 206.2g/mol. IUPAC Name: sodium;4-ethenylbenzenesulfonate. SMILES: C=CC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]. InChI: InChI=1S/C8H8O3S.Na/c1-2-7-3-5-8(6-4-7)12(9,10)11;/h2-6H,1H2,(H,9,10,11);/q;+1/p-1. | |
| Poly(sodium 4-styrenesulfonate) solution | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: PSS, Poly(4-styrenesulfonic acid) sodium salt. CAS No. 25704-18-1. Molecular formula: (C8H7NaO3S)n. Mole weight: average Mw ~70,000. IUPAC Name: sodium;4-ethenylbenzenesulfonate. SMILES: C=CC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]. InChI: 1S/C8H8O3S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h2-6H,1H2,(H,9,10,11). | |
| Poly(styrene)-block-poly(ethylene glycol) | Poly(styrene)-block-poly(ethylene glycol). | |
| Polystyrene-b-poly(4-vinyl pyridine) | Polystyrene-b-poly(4-vinyl pyridine). Alternative Names: POLY(4-VINYL PYRIDINE)-B-POLYSTYRENE-B-POLY(4-VINYL PYRIDINE);POLY(4-VINYLPYRIDINE-CO-STYRENE);POLYSTYRENE-B-POLY(4-VINYL PYRIDINE);4-vinylpyridine/ styrene copolymer;Poly(4-vinylpyridine-co-styrene) powder. CAS No. 26222-40-2. | |
| Poly(styrene-co-allyl alcohol) | Poly(styrene-co-allyl alcohol). CAS No. 25119-62-4. Molecular formula: C11H14O. Mole weight: 162.23g/mol. IUPAC Name: prop-2-en-1-ol;styrene. SMILES: C=CCO.C=CC1=CC=CC=C1. InChI: InChI=1S/C8H8.C3H6O/c1-2-8-6-4-3-5-7-8;1-2-3-4/h2-7H,1H2;2,4H,1,3H2. | |
| Poly(styrene-co-chloromethylstyrene) | Poly(styrene-co-chloromethylstyrene). | |
| Poly(styrene-co-maleic acid), partial isobutyl ester | 1:<1 mole ratio of styrene:maleic anhydride. Alternative Names: maleic copolymer, maleated copolymer, maleated polymer. CAS No. 28571-95-1. Molecular formula: [CH2CH(C6H5)]x[CH(CO2R)CH(CO2R)]y, R = H or -CH2CH(CH3)2. Mole weight: average Mv ~65,000. SMILES: OC(=O)\C=C\C(O)=O.C=Cc1ccccc1.CC(C)COC(=O)\C=C\C(=O)OCC(C)C. | |
| Poly(styrene-co-maleic acid),partial isobutyl/methyl mixed ester | Poly(styrene-co-maleic acid),partial isobutyl/methyl mixed ester. Alternative Names: 2-Butenedioicacid(Z)-,monomethylester,polymerwithethenylbenzene,2,5-furandioneand(Z)-2-methylpropylhydrogen2-butenedioate;andioneand(z)-2-methylpropylhydrogen2-butenedioate;POLY(STYRENE-CO-MALEIC ACID), PARTIAL ISOBUTYL/METHYL MIXED ESTER;POLY(STYRENE-CO-. CAS No. 63528-92-7. Molecular formula: ClH. Mole weight: 36.46094;g/mol. Purity: 96%. IUPAC Name: chlorane. SMILES: Cl. | |
| Poly(styrene-co-maleic anhydride), cumene terminated | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: maleic copolymer, Poly(styrene-co-maleic anhydride), maleated copolymer, maleated polymer. CAS No. 26762-29-8. Mole weight: average Mn ~1,900 by GPC. InChI: 1S/C9H12.C8H8.C4H2O3/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h3-8H,1-2H3;2-7H,1H2;1-2H. | |
| Poly(styrene-co-maleic anhydride), partial isooctyl ester, cumene terminated | Poly(styrene-co-maleic anhydride), partial isooctyl ester, cumene terminated. CAS No. 160611-46-1. | |
| Poly(styrene-co-methacrylic acid | Poly(styrene-co-methacrylic acid. | |
| Poly(styrene-co-methyl methacrylate) | Poly(styrene-co-methyl methacrylate). CAS No. 25034-86-0. Molecular formula: C13H16O2. Mole weight: 204.26g/mol. IUPAC Name: methyl 2-methylprop-2-enoate;styrene. SMILES: CC(=C)C(=O)OC.C=CC1=CC=CC=C1. InChI: InChI=1S/C8H8.C5H8O2/c1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h2-7H,1H2;1H2,2-3H3. | |
| Poly(styrene-co-vinylbenzyl chloride-co-divinylbenzene) | Poly(styrene-co-vinylbenzyl chloride-co-divinylbenzene). Alternative Names: POLY(STYRENE-CO-VINYLBENZYL CHLORIDE-CO-DIVINYLBENZENE);poly(vinylbenzyl chloride), 60/40 mixture of 3- A;Poly(vinylbenzyl chloride),60/40 mixture of 3- and 4-isomers;POLY(STYRENE-CO-VINYLBENZYL CHLORIDE-CO DIVINYLBENZENE)50-100 MESH,1.7-2.2MMOL;POLY(STYR. CAS No. 121961-20-4. Molecular formula: [CH2CH(C6H4CH2Cl)]n. Mole weight: 459.878160 [g/mol]. Purity: 96%. IUPAC Name: 1-[1,5-bis[4-(chloromethyl)phenyl]hexan-3-yl]-4-(chloromethyl)benzene. | |
| Polystyrene, monocarboxy terminated | Polystyrene is a colorless and transparent thermoplastic, among which expanded polystyrene is commonly known as Styrofoam. Alternative Names: PS-COOH. Molecular formula: [CH2CH(C6H5)]n CO2H. Mole weight: Mw ~200,000 by GPC. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.