Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Potassium bromide crystal optic rectangle, 38.5mm x 19.5mm x 4mm, unpolished | Potassium bromide crystal optic rectangle, 38.5mm x 19.5mm x 4mm, unpolished. |  |
| Potassium bromide crystal optic rectangle, 41mm x 23mm x 6mm, polished both sides | Potassium bromide crystal optic rectangle, 41mm x 23mm x 6mm, polished both sides. | |
| Potassium bromide crystal optic rectangle, 41mm x 23mm x 6mm, unpolished | Potassium bromide crystal optic rectangle, 41mm x 23mm x 6mm, unpolished. | |
| Potassium carbonate | Potassium carbonate (K2CO3) is a white salt, soluble in water (insoluble in ethanol) which forms a strongly alkaline solution. It can be made as the product of potassium hydroxide's absorbent reaction with carbon dioxide. It is deliquescent, often appearing a damp or wet solid. Potassium carbonate is used in the production of soap and glass. Alternative Names: Dipotassium cabonate. CAS No. 584-08-7. Molecular formula: CK2O3. Mole weight: 138.205. Purity: 99%+. IUPAC Name: Dipotassium;carbonate. SMILES: C(=O)([O-])[O-].[K+].[K+]. InChI: InChI=1S/CH2O3.2K/c2-1(3)4;/h(H2,2,3,4);/q;2*+1/p-2. | |
| Potassium chloride crystal optic disc, 13mm x 1mm, polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 13mm x 2mm, polished both sides | Potassium chloride crystal optic disc, 13mm x 2mm, polished both sides. | |
| Potassium chloride crystal optic disc, 13mm x 2mm, unpolished | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 22mm x 4mm, polished both sides | Potassium chloride crystal optic disc, 22mm x 4mm, polished both sides. | |
| Potassium chloride crystal optic disc, 25mm x 2mm, polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 25mm x 4mm, polished both sides | Potassium chloride crystal optic disc, 25mm x 4mm, polished both sides. | |
| Potassium chloride crystal optic disc, 25mm x 5mm, unpolished | Potassium chloride crystal optic disc, 25mm x 5mm, unpolished. | |
| Potassium chloride crystal optic disc, 32mm x 3mm (drilled), polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 32mm x 3mm, polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 32mm x 3mm, unpolished | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic disc, 38mm x 6mm, polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic rectangle, 30mm x 15mm x 4mm, (drilled), polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic rectangle, 30mm x 15mm x 4mm, polished both sides | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic rectangle, 30mm x 15mm x 4mm, unpolished | Potassium chloride crystal optic rectangle, 30mm x 15mm x 4mm, unpolished. | |
| Potassium chloride crystal optic rectangle, 38.5mm x 19.5mm x 4mm, (drilled), polished both sides | Potassium chloride crystal optic rectangle, 38.5mm x 19.5mm x 4mm, (drilled), polished both sides. | |
| Potassium chloride crystal optic rectangle, 38.5mm x 19.5mm x 4mm, unpolished | Potassium chloride appears as white colorless cubic crystals. Strong saline taste. (NTP, 1992);DryPowder; DryPowder, Liquid; Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid;Colourless, elongated, prismatic or cubital crystals or white granular powder. Odourless;COLOURLESS HYGROSCOPIC CRYSTALS. Molecular formula: KCl;KCl;KCl;ClK. Mole weight: 74.55g/mol. IUPAC Name: potassium;chloride. SMILES: [Cl-].[K+]. InChI: InChI=1S/ClH.K/h1H;/q;+1/p-1. | |
| Potassium chloride crystal optic rectangle, 41mm x 23mm x 6mm, unpolished | Potassium chloride crystal optic rectangle, 41mm x 23mm x 6mm, unpolished. | |
| Potassium chloropalladite | Potassium chloropalladite. Alternative Names: Dipotassium tetrachloropalladate. CAS No. 10025-98-6. Molecular formula: Cl4K2Pd. Mole weight: 326.41. Purity: 98%. IUPAC Name: dipotassium;tetrachloropalladium(2-). SMILES: Cl[Pd-2](Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/4ClH.2K.Pd/h4*1H;/q;2*+1;+2/p-4. | |
| Potassium cyclobutyltrifluoroborate | Potassium cyclobutyltrifluoroborate. CAS No. 1065010-88-9. Molecular formula: C4H7BF3K. Mole weight: 162.01g/mol. IUPAC Name: potassium;cyclobutyl(trifluoro)boranuide. SMILES: [B-](C1CCC1)(F)(F)F.[K+]. InChI: InChI=1S/C4H7BF3.K/c6-5(7,8)4-2-1-3-4;/h4H,1-3H2;/q-1;+1. | |
| Potassium cyclohexyltrifluoroborate | Potassium cyclohexyltrifluoroborate. Molecular formula: C6H11BF3K. Mole weight: 190.06g/mol. IUPAC Name: potassium;cyclohexyl(trifluoro)boranuide. SMILES: [B-](C1CCCCC1)(F)(F)F.[K+]. InChI: InChI=1S/C6H11BF3.K/c8-7(9,10)6-4-2-1-3-5-6;/h6H,1-5H2;/q-1;+1. | |
| Potassium cyclopentyltrifluoroborate | Potassium cyclopentyltrifluoroborate. Molecular formula: C5H9BF3K. Mole weight: 176.03g/mol. IUPAC Name: potassium;cyclopentyl(trifluoro)boranuide. SMILES: [B-](C1CCCC1)(F)(F)F.[K+]. InChI: InChI=1S/C5H9BF3.K/c7-6(8,9)5-3-1-2-4-5;/h5H,1-4H2;/q-1;+1. | |
| Potassium fluoride on alumina | Potassium fluoride appears as white powder or crystals with a sharp saline taste. Shipped as a solid or an aqueous solution. Strongly irritates skin, eyes and mucous membranes. Toxic by ingestion. Used in insecticides, solder flux and etching glass.;DryPowder; DryPowder, Liquid; Liquid; PelletsLargeCrystals. Molecular formula: KF;FK. Mole weight: 58.097g/mol. IUPAC Name: potassium;fluoride. SMILES: [F-].[K+]. InChI: InChI=1S/FH.K/h1H;/q;+1/p-1. | |
| Potassium (fluorosulfonyl)(trifluoromethanesulfonyl)imide | Potassium (fluorosulfonyl)(trifluoromethanesulfonyl)imide. Alternative Names: Potassium;fluorosulfonyl(trifluoromethylsulfonyl)azanide. CAS No. 860653-59-4. Molecular formula: CF4KNO4S2. Mole weight: 269.24. Purity: 97%+. IUPAC Name: potassium;fluorosulfonyl(trifluoromethylsulfonyl)azanide. SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)F.[K+]. InChI: InChI=1S/CF4NO4S2.K/c2-1(3,4)11(7,8)6-12(5,9)10;/q-1;+1. | |
| Potassium furan-3-trifluoroborate | Potassium furan-3-trifluoroborate. | |
| Potassium hex-5-enoyltrifluoroborate | Potassium hex-5-enoyltrifluoroborate. CAS No. 1370291-66-9. Mole weight: 204.04. | |
| Potassium hexachloroiridate(IV) | Potassium hexachloroiridate(IV). Alternative Names: Iridium potassium chloride. CAS No. 16920-56-2. Molecular formula: Cl6IrK2. Mole weight: 483.13. Purity: 98%. IUPAC Name: dipotassium;hexachloroiridium(2-). SMILES: Cl[Ir-2](Cl)(Cl)(Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/6ClH.Ir.2K/h6*1H;/q;+4;2*+1/p-6. | |
| Potassium hexachloropalladate(IV) | Potassium hexachloropalladate(IV). Alternative Names: Palladium potassium chloride. CAS No. 16919-73-6. Molecular formula: Cl6K2Pd. Mole weight: 397.3. Purity: 99%+. IUPAC Name: Dipotassium;hexachloropalladium(2-). SMILES: Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/6ClH.2K.Pd/h6*1H;/q;2*+1;+4/p-6. | |
| Potassium hexachlororhodate(III) | Potassium hexachlororhodate(III). Alternative Names: Tripotassium hexachlororhodate. CAS No. 13845-07-3. Molecular formula: Cl6K3Rh. Mole weight: 432.9. Purity: 99%+. IUPAC Name: Tripotassium;hexachlororhodium(3-). SMILES: Cl[Rh-3](Cl)(Cl)(Cl)(Cl)Cl.[K+].[K+].[K+]. InChI: InChI=1S/6ClH.3K.Rh/h6*1H;/q;3*+1;+3/p-6. | |
| Potassium hexacyanochromate(III) | Potassium hexacyanochromate(III). Alternative Names: tripotassium,(oc-6-11)-chromate(3-hexakis(cyano-c)-;POTASSIUM CHROMIC CYANIDE;POTASSIUM HEXACYANOCHROMATE(III);tripotassium hexa(cyano-C)chromate(3-);POTASSIUM HEXACYANOCHROMATE(III), 99.99%;hexacyanochromate;PotassiuM hexacyanochroMate(III) 99.99% trace. CAS No. 13601-11-1. Molecular formula: K3Cr(CN)6. Mole weight: 325.40. | |
| Potassium hexafluoroantimonate(V) | Potassium hexafluoroantimonate(V). Alternative Names: ACMC-20ajup; CTK4D3156; DTXSID30586923; Potassium hexafluoroantimonate; Potassium hexafluoroantimonate(1-); Antimonate(1-),hexafluoro-, potassium (1:1), (OC-6-11)-; AKOS015833661; I14-60707; TR-007360. CAS No. 16893-92-8. Molecular formula: F6KSb. Mole weight: 274.849g/mol. IUPAC Name: potassium;hexafluoroantimony(1-). SMILES: F[Sb-](F)(F)(F)(F)F.[K+]. InChI: InChI=1S/6FH.K.Sb/h6*1H;;/q;;;;;;+1;+5/p-6. | |
| Potassium hexafluoroarsenate(V) | Potassium hexafluoroarsenate(V). Alternative Names: potassium ion hexafluoro-$l^{5}-arsanuide; EINECS 241-102-7; AC1L4MJ2; DITNVAZRXJOPSJ-UHFFFAOYSA-N; MFCD00042546; A811190; Potassium hexafluoroarsenate(1-); potassium hexafluoroarsenic(1-); ANW-22449; CHEBI:82182. CAS No. 17029-22-0. Molecular formula: AsF6K. Mole weight: 228.01g/mol. IUPAC Name: potassium;hexafluoroarsenic(1-). SMILES: F[As-](F)(F)(F)(F)F.[K+]. InChI: InChI=1S/AsF6.K/c2-1(3,4,5,6)7;/q-1;+1. | |
| Potassium indole-5-trifluoroborate | Potassium indole-5-trifluoroborate. CAS No. 1111733-03-9. Molecular formula: C8H6BF3KN. Mole weight: 223.05g/mol. IUPAC Name: potassium;trifluoro(1H-indol-5-yl)boranuide. SMILES: [B-](C1=CC2=C(C=C1)NC=C2)(F)(F)F.[K+]. InChI: InChI=1S/C8H6BF3N.K/c10-9(11,12)7-1-2-8-6(5-7)3-4-13-8;/h1-5,13H;/q-1;+1. | |
| Potassium indole-6-trifluoroborate | Potassium indole-6-trifluoroborate. | |
| Potassium Ion Selective Electrode Solutions | Potassium Ion Selective Electrode Solutions. | |
| Potassium isopropenyltrifluoroborate | Potassium isopropenyltrifluoroborate. Alternative Names: POTASSIUM ISOPROPENYLTRIFLUOROBORATE, 395083-14-4, Potassium (prop-1-en-2-yl)trifluoroborate, CTK8E9111, MolPort-016-582-067, AKOS006280789, RP01555, AK-88675, Potassium trifluoro(prop-1-en-2-yl)borate, W5981, C-2238, potassium ion trifluoro(prop-1-en-2-yl)boranuide. CAS No. 395083-14-4. Molecular formula: C3H5BF3.K. Mole weight: 147.975. Purity: 96%. IUPAC Name: potassium;trifluoro(prop-1-en-2-yl)boranuide. SMILES: [B-](C(=C)C)(F)(F)F.[K+]. | |
| Potassium isopropyltrifluoroborate | Potassium isopropyltrifluoroborate. Molecular formula: C3H7BF3K. Mole weight: 149.99g/mol. IUPAC Name: potassium;trifluoro(propan-2-yl)boranuide. SMILES: [B-](C(C)C)(F)(F)F.[K+]. InChI: InChI=1S/C3H7BF3.K/c1-3(2)4(5,6)7;/h3H,1-2H3;/q-1;+1. | |
| Potassium nickel(IV) paraperiodate | Potassium nickel(IV) paraperiodate. | |
| Potassium nicotinoyltrifluoroborate | Potassium nicotinoyltrifluoroborate. CAS No. 1622923-57-2. | |
| Potassium osmate(vi)dihydrate | Potassium osmate(vi)dihydrate. Alternative Names: POTASSIUM OSMIUM OXIDE(VI);POTASSIUM OSMATE DIHYDRATE;POTASSIUM OSMATE(VI) DIHYDRATE;Potassium osmium oxide(VI) dihydrate;Potassium osmate(VI) dihydrate, 51.0-52.0% Os;Potassiumosmate(VI)dihydrate,99%;Osmate (OsO42-), dipotassium, dihydrate, (T-4)-;potass. CAS No. 10022-66-9. Molecular formula: H4K2O6Os. Mole weight: 368.5g/mol. Purity: Os 51.5%. IUPAC Name: dipotassium;dioxido(dioxo)osmium;dihydrate. SMILES: O.O.[O-][Os](=O)(=O)[O-].[K+].[K+]. InChI: InChI=1S/2K.2H2O.4O.Os/h;;2*1H2;;;;;/q2*+1;;;;;2*-1. | |
| Potassium pentachloronitrosylruthenate(II) | Potassium pentachloronitrosylruthenate(II). Alternative Names: Dipotassium pentachloronitrosylruthenate. CAS No. 14854-54-7. Molecular formula: Cl5K2NORu-. Mole weight: 386.54. Purity: 99%+. IUPAC Name: dipotassium;nitroxyl anion;pentachlororuthenium(2-). SMILES: [N-]=O.Cl[Ru-2](Cl)(Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/5ClH.2K.NO.Ru/c;;;;;;;1-2;/h5*1H;;;;/q;;;;;2*+1;-1;+3/p-5. | |
| Potassium phenyltrifluoroborate | Potassium phenyltrifluoroborate. Alternative Names: Potassium phenyltrifluoroborate, 153766-81-5, Potassium trifluoro(phenyl)borate, potassium trifluoro(phenyl)boranuide, PubChem11425, 563951_ALDRICH, Potassium phenyltrifluoroborate,, MolPort-001-772-358, ACN-S003885, ACT10970, AKOS009158898, AKOS015909133, AB08670, PC11221, potassium ion trifluoro(phenyl)boranuide, AK105337, potassium tris(fluoranyl)-phenyl-boranuide, P1582, B-3020, BENZENETRIFLUOROBORIC ACID POTASSIUM SALT. CAS No. 153766-81-5. Molecular formula: C6H5BF3.K. Mole weight: 184.01. Purity: >98.0%(LC). IUPAC Name: potassium;trifluoro(phenyl)boranuide. SMILES: [B-](C1=CC=CC=C1)(F)(F)F.[K+]. | |
| Potassium propynyltrifluoroborate | Potassium propynyltrifluoroborate. Molecular formula: C3H3BF3K. Mole weight: 145.96g/mol. IUPAC Name: potassium;trifluoro(prop-1-ynyl)boranuide. SMILES: [B-](C#CC)(F)(F)F.[K+]. InChI: InChI=1S/C3H3BF3.K/c1-2-3-4(5,6)7;/h1H3;/q-1;+1. | |
| Potassium p-tolyltrifluoroborate | Potassium p-tolyltrifluoroborate. CAS No. 216434-82-1. Molecular formula: C7H7BF3K. Mole weight: 198.04g/mol. IUPAC Name: potassium;trifluoro-(4-methylphenyl)boranuide. SMILES: [B-](C1=CC=C(C=C1)C)(F)(F)F.[K+]. InChI: InChI=1S/C7H7BF3.K/c1-6-2-4-7(5-3-6)8(9,10)11;/h2-5H,1H3;/q-1;+1. | |
| Potassium pyrimidine-5-trifluoroborate | Potassium pyrimidine-5-trifluoroborate. CAS No. 1242733-91-0. Molecular formula: C4H3BF3KN2. Mole weight: 185.99g/mol. IUPAC Name: potassium;trifluoro(pyrimidin-5-yl)boranuide. SMILES: [B-](C1=CN=CN=C1)(F)(F)F.[K+]. InChI: InChI=1S/C4H3BF3N2.K/c6-5(7,8)4-1-9-3-10-2-4;/h1-3H;/q-1;+1. | |
| Potassium quinoline-6-trifluoroborate | Potassium quinoline-6-trifluoroborate. Molecular formula: C9H3BF3KN. Mole weight: 232.03g/mol. SMILES: [B-]C1=CC2=C(C=C1)N=C(C(=C2F)F)F.[K+]. InChI: InChI=1S/C9H3BF3N.K/c10-4-1-2-6-5(3-4)7(11)8(12)9(13)14-6;/h1-3H;/q-1;+1. | |
| Potassium quinoline-8-trifluoroborate | Potassium quinoline-8-trifluoroborate. Molecular formula: C9H6BF3KN. Mole weight: 235.06g/mol. IUPAC Name: potassium;trifluoro(quinolin-8-yl)boranuide. SMILES: [B-](C1=C2C(=CC=C1)C=CC=N2)(F)(F)F.[K+]. InChI: InChI=1S/C9H6BF3N.K/c11-10(12,13)8-5-1-3-7-4-2-6-14-9(7)8;/h1-6H;/q-1;+1. | |
| Potassium tellurite | Potassium tellurite. Alternative Names: POTASSIUM TELLURITE (IV);POTASSIUM TELLURITE;dipotassiumtrioxotellurate;potassiumtellurate(iv;telluricacid(h2teo3),dipotassiumsalt;telluricacid,dipotassiumsalt;Tellurousacid,dipotassiumsalt;10% POTASSIUMTELLURITE SOLUTION. CAS No. 7790-58-1. Molecular formula: K2O3Te. Mole weight: 253.79. Purity: Purity >98%. IUPAC Name: dipotassium tellurite. SMILES: [O-][Te](=O)[O-].[K+].[K+]. | |
| Potassium tetraborate tetrahydrate | Potassium tetraborate tetrahydrate. Alternative Names: Boron potassium oxide tetrahydrate. CAS No. 12045-78-2. Molecular formula: B4H8K2O11. Mole weight: 305.5. Purity: 99%+. IUPAC Name: dipotassium dioxido-[(4-oxoboranyloxy-1,3,2,4-dioxadiboretan-2-yl)oxy]borane tetrahydrate. | |
| Potassium tetrabromoaurate(III) hydrate | Potassium tetrabromoaurate(III) hydrate. | |
| Potassium tetrachloropalladate(II) | Potassium tetrachloropalladate(II). Alternative Names: Potassium chloropalladite. CAS No. 10025-98-6. Molecular formula: Cl4K2Pd. Mole weight: 326.4. Purity: 99%+. IUPAC Name: Dipotassium;tetrachloropalladium(2-). SMILES: Cl[Pd-2](Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/4ClH.2K.Pd/h4*1H;/q;2*+1;+2/p-4. | |
| Potassium tetracyanopalladate(II) hydrate | Potassium tetracyanopalladate(II) hydrate. Molecular formula: C4K2N4Pd-4. Mole weight: 288.7g/mol. SMILES: [C-]#N.[C-]#N.[C-]#N.[C-]#N.[K].[K].[Pd]. InChI: InChI=1S/4CN.2K.Pd/c4*1-2;;;/q4*-1;; | |
| Potassium thiophene-2-trifluoroborate | Potassium thiophene-2-trifluoroborate. CAS No. 906674-55-3. Molecular formula: C4H3BF3KS. Mole weight: 190.04g/mol. IUPAC Name: potassium;trifluoro(thiophen-2-yl)boranuide. SMILES: [B-](C1=CC=CS1)(F)(F)F.[K+]. InChI: InChI=1S/C4H3BF3S.K/c6-5(7,8)4-2-1-3-9-4;/h1-3H;/q-1;+1. | |
| Potassium trans-1-propenyltrifluoroborate | Potassium trans-1-propenyltrifluoroborate. CAS No. 804565-39-7. Molecular formula: C3H5BF3K. Mole weight: 147.98g/mol. IUPAC Name: potassium;trifluoro-[(E)-prop-1-enyl]boranuide. SMILES: [B-](C=CC)(F)(F)F.[K+]. InChI: InChI=1S/C3H5BF3.K/c1-2-3-4(5,6)7;/h2-3H,1H3;/q-1;+1/b3-2+. | |
| Potassium Tricyanomethanide, ≥98% | Potassium Tricyanomethanide, ≥98%. CAS No. 34171-69-2. Molecular formula: C4KN3. Mole weight: 129.16g/mol. IUPAC Name: potassium;methanetricarbonitrile. SMILES: C(#N)[C-](C#N)C#N.[K+]. InChI: InChI=1S/C4N3.K/c5-1-4(2-6)3-7;/q-1;+1. | |
| Potassium trifluoro(pentafluoroethyl)borate | Potassium trifluoro(pentafluoroethyl)borate. Alternative Names: MolPort-019-937-884, C-2548, POTASSIUM PENTAFLUOROROETHYLTRIFLUOROBORATE, 476639-90-4. CAS No. 476639-90-4. Molecular formula: C2BF8K. Mole weight: 225.918. Purity: 96%. IUPAC Name: potassium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide. SMILES: [B-](C(C(F)(F)F)(F)F)(F)(F)F.[K+]. | |
| Potassium Tris(trifluoromethanesulfonyl)methanide | Potassium Tris(trifluoromethanesulfonyl)methanide. CAS No. 114395-69-6. Molecular formula: C4F9KO6S3. Mole weight: 450.30. Purity: >98.0%(T). IUPAC Name: potassium;bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane. SMILES: [C-](S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.[K+]. InChI: InChI=1S/C4F9O6S3.K/c5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13;/q-1;+1. | |
| Potassium vinyltrifluoroborate | Potassium vinyltrifluoroborate. Alternative Names: POTASSIUM VINYLTRIFLUOROBORATE;Vinyltrifluoroboric acid potassium salt;Borate(1-), ethenyltrifluoro-, potassium (1:1), (T-4)-;3POTASSIUM VINYLTRIFLUOROBORATE;POTASSIUM VINYLTRIFLUOROBORATE, TECHNICAL;Vinylboronic acid trifluoroborate potassium salt;Potassium ethenyltrifluoroborate;potassiuM trifluoro-vinyl-boron. CAS No. 13682-77-4. Molecular formula: C2H3BF3K. Mole weight: 133.95g/mol. IUPAC Name: potassium;ethenyl(trifluoro)boranuide. SMILES: [B-](C=C)(F)(F)F.[K+]. InChI: InChI=1S/C2H3BF3.K/c1-2-3(4,5)6;/h2H,1H2;/q-1;+1. | |
| Povidone | Polyvinylpyrrolidone is a white powder. Compatible with a wide range of hydrophilic and hydrophobic resins. (NTP, 1992);Liquid;White or nearly white powder;YELLOW-TO-BROWN HYGROSCOPIC POWDER.;COLOURLESS-TO-YELLOW LIQUID.;White powder. CAS No. 9003-39-8. Molecular formula: (C6H9NO)n;C6H9NO;C6H9NO. Mole weight: 111.14g/mol. IUPAC Name: 1-ethenylpyrrolidin-2-one. SMILES: C=CN1CCCC1=O. InChI: InChI=1S/C6H9NO/c1-2-7-5-3-4-6(7)8/h2H,1,3-5H2. | |
| Praseodymium(III) bromide | Praseodymium(III) bromide. Alternative Names: PRASEODYMIUM(III) BROMIDE;PRASEODYMIUM BROMIDE;praseodymiumbromide(prbr3);praseodymium tribromide;PRASEODYMIUM(III) BROMIDE, ANHYDROUS, PO WDER, 99.99%;PRASEODYMIUM BROMIDE, 99.999%;praseodymium(iII) bromide, ultra dry;Praseodymium(III) bromide, ultra dry. CAS No. 13536-53-3. Molecular formula: PrBr3. Mole weight: 380.62. Purity: 96%. IUPAC Name: tribromopraseodymium. | |
| Praseodymium(III) oxide | DryPowder. CAS No. 12036-32-7. Molecular formula: O3Pr2. Mole weight: 329.814g/mol. IUPAC Name: oxygen(2-);praseodymium(3+). SMILES: [O-2].[O-2].[O-2].[Pr+3].[Pr+3]. InChI: InChI=1S/3O.2Pr/q3*-2;2*+3. | |
| Propane-1,3-diammonium Bromide | ≥98%. Alternative Names: 1,3-Diaminopropane dihydroBromide, Propane-1,3-diaminium Bromide, 1,3-Propanediamine dihydroBromide, greatcell Solar. CAS No. 18773-03-0. Molecular formula: C3H12Br2N2. Mole weight: 235.95 g/mol. IUPAC Name: propane-1,3-diamine;dihydrobromide. SMILES: C(CN)CN.Br.Br. InChI: InChI=1S/C3H10N2.2BrH/c4-2-1-3-5;;/h1-5H2;2*1H. | |
| Propane-1,3-diammonium Iodide | ≥98%. Alternative Names: 1,3-Propanediamine dihydroIodide, 1,3-Diaminopropane dihydrIodide, greatcell Solar, Propane-1,3-diamino dihydrIodide, 1,3-Propanediamine dihydrIodide. CAS No. 120675-53-8. Molecular formula: C3H12I2N2. Mole weight: 329.95 g/mol. IUPAC Name: propane-1,3-diamine;dihydroiodide. SMILES: C(CN)CN.I.I. InChI: InChI=1S/C3H10N2.2HI/c4-2-1-3-5;;/h1-5H2;2*1H. | |
| Propionic Acid-PEG12-Propionic Acid | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Purity: ≥95%. | |
| Propionic acid-PEG4-Propionic acid | Monodisperse PEG crosslinker. COOH group is stable and can be activated. Alternative Names: PA-PEG4-PA. Molecular formula: C8H14O6. Mole weight: 206.19g/mol. IUPAC Name: 3-[2-(2-carboxyethoxy)ethoxy]propanoic acid. SMILES: OC(CCOCCOCCC(O)=O)=O. InChI: 1S/C8H14O6/c9-7(10)1-3-13-5-6-14-4-2-8(11)12/h1-6H2,(H,9,10)(H,11,12). | |
| Propionic Acid-PEG8-Propionic Acid | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Purity: ≥95%. | |
| Propylene glycol propyl ether | Liquid; WetSolid. CAS No. 1569-01-3. Molecular formula: C6H14O2. Mole weight: 118.17g/mol. IUPAC Name: 1-propoxypropan-2-ol. SMILES: CCCOCC(C)O. InChI: InChI=1S/C6H14O2/c1-3-4-8-5-6(2)7/h6-7H,3-5H2,1-2H3. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.