Alfa Chemistry Materials 3 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Sapphire sphere; diameter(mm), 1.50; grade 25 | Sapphire sphere; diameter(mm), 1.50; grade 25. |  |
| Sapphire sphere; diameter(mm), 1.59 (1/16in); grade 25 | Sapphire sphere; diameter(mm), 1.59 (1/16in); grade 25. | |
| Sapphire sphere; diameter(mm), 1.75; grade 25 | Sapphire sphere; diameter(mm), 1.75; grade 25. | |
| Sapphire sphere; diameter(mm), 2.00; grade 25 | Sapphire sphere; diameter(mm), 2.00; grade 25. | |
| Sapphire sphere; diameter(mm), 2.50; grade 25 | Sapphire sphere; diameter(mm), 2.50; grade 25. | |
| Sapphire sphere; diameter(mm), 3.00; grade 25 | Sapphire sphere; diameter(mm), 3.00; grade 25. | |
| Sapphire sphere; diameter(mm), 3.18 (1/8in); grade 25 | Sapphire sphere; diameter(mm), 3.18 (1/8in); grade 25. | |
| Sapphire sphere; diameter(mm), 3.50; grade 25 | Sapphire sphere; diameter(mm), 3.50; grade 25. | |
| Sapphire sphere; diameter(mm), 4.00; grade 25 | Sapphire sphere; diameter(mm), 4.00; grade 25. | |
| Sapphire sphere; diameter(mm), 4.78 (3/16in); grade 25 | Sapphire sphere; diameter(mm), 4.78 (3/16in); grade 25. | |
| Sapphire sphere; diameter(mm), 5.00; grade 25 | Sapphire sphere; diameter(mm), 5.00; grade 25. | |
| Sea salts | Sea salts. | |
| sec-Butylmagnesium chloride lithium chloride complex solution | sec-Butylmagnesium chloride lithium chloride complex solution. | |
| sec-Butylzinc bromide solution | sec-Butylzinc bromide solution. CAS No. 171860-66-5. Molecular formula: C4H9BrZn. Mole weight: 202.4g/mol. IUPAC Name: bromozinc(1+);butane. SMILES: CC[CH-]C.[Zn+]Br. InChI: InChI=1S/C4H9.BrH.Zn/c1-3-4-2;;/h3H,4H2,1-2H3;1H;/q-1;;+2/p-1. | |
| Selenium | Selenium is a reddish colored powder that may become black upon exposure to air. It is toxic by ingestion. It is used to manufacture electronic components and rubber.;DryPowder; DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals;GREY SOLID IN VARIOUS FORMS.;COLOURLESS COMPRESSED LIQUEFIED GAS WITH CHARACTERISTIC ODOUR.;Amorphous or crystalline, red to gray solid.;Amorphous or crystalline, red to gray solid. [Note: Occurs as an impurity in most sulfide ores.]. CAS No. 7782-49-2. Molecular formula: H2Se;Se. Mole weight: 78.97g/mol. IUPAC Name: selenium. SMILES: [Se]. InChI: InChI=1S/Se. | |
| Selenium tetrachloride | Selenium tetrachloride. CAS No. 10026-03-6. Molecular formula: SeCl4;SeCl4;Cl4Se. Mole weight: 220.8g/mol. SMILES: Cl[Se](Cl)(Cl)Cl. InChI: InChI=1S/Cl4Se/c1-5(2,3)4. | |
| Silane,1,1',1''-methylidynetris[1,1,1-trimethyl- | Silane,1,1',1''-methylidynetris[1,1,1-trimethyl-. Alternative Names: Tris(trimethylsilyl)methane, 1068-69-5, AC1LD5EB, 302600_ALDRICH, CTK0H4108, Silane, methylidynetris[trimethyl-, AKOS002669422, AG-D-21588, bis(trimethylsilyl)methyl-trimethylsilane, FT-0633276, I14-39635, 2,4-Disilapentane,2,2,4,4-tetramethyl-3-(trimethylsilyl)- (6CI,7CI,8CI);Silane,methylidynetris[trimethyl- (9CI);Methylidynetris[trimethylsilane];Silane,1,1,1-methylidynetris[1,1,1-trimethyl-. CAS No. 1068-69-5. Molecular formula: C10H28Si3. Mole weight: 232.59. Purity: 96%. IUPAC Name: bis(trimethylsilyl)methyl-trimethylsilane. SMILES: C[Si](C)(C)C([Si](C)(C)C)[Si](C)(C)C. | |
| Silane,acetyltrimethyl- | Silane,acetyltrimethyl-. Alternative Names: Trimethylsilyl acetate, Acetoxytrimethylsilane, Trimethylacetoxysilane, (Acetato)trimethylsilane, (Trimethylsilyl)acetic acid, Silanol, trimethyl-, acetate, NCIOpen2_001849, Acetic acid, (trimethylsilyl)-, Acetic acid, trimethylsilyl ester, 284459_ALDRICH, Acetic Acid Trimethylsilyl Ester, MolPort-003-929-207, CID75988, NSC96780, EINECS 220-404-2, NSC 96780, Silanol, 1,1,1-trimethyl-, 1-acetate, A1567, I04-0865, 2754-27-0. CAS No. 13411-48-8. Molecular formula: C5H12OSi. Mole weight: 116.23. Purity: 96%. IUPAC Name: trimethylsilyl acetate. SMILES: CC(=O)[Si](C)(C)C. | |
| Silane,hexyl- | Silane,hexyl-. Alternative Names: Hexylsilane, Silane, hexyl-, 53262_ALDRICH, 53262_FLUKA, MolPort-003-936-048, NSC168691, EINECS 214-001-0, CID6328653, NSC 168691, 1072-14-6, 149158-62-3. CAS No. 1072-14-6. Molecular formula: C6H16Si. Mole weight: 116.28. Purity: 96%. IUPAC Name: hexylsilicon. SMILES: CCCCCC[Si]. | |
| Silica,fumed | Transparent to gray, odorless powder. Irritating to the skin and eyes on contact. Inhalation will cause irritation in the respiratory tract. [Note: Amorphous silica is the non-crystalline form of SiO2.];PelletsLargeCrystals, OtherSolid, Liquid;DryPowder; Liquid;DryPowder; OtherSolid;DryPowder; DryPowder, Liquid; DryPowder, OtherSolid; Liquid; OtherSolid; PelletsLargeCrystals; WetSolid; WetSolid, Liquid;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals;DryPowder; OtherSolid;DryPowder; DryPowder, Liquid; DryPowder, OtherSolid; DryPowder, OtherSolid, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, Liquid; DryPowder, PelletsLargeCrystals, OtherSolid; DryPowder, PelletsLargeCrystals, WetSolid; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid; WetSolid, Liquid;PelletsLargeCrystals;White, fluffy powder or granules. Hygroscopic;Solid;FINE WHITE POWDER.;COLOURLESS OR WHITE CRYSTALS.;COLOURLESS WHITE CRYSTALS.;COLOURLESS OR WHITE CRYSTALS.;Solid;Transparent to gray, odorless powder. [Note: Amorphous silica is the non-crystalline form of SiO2.]. CAS No. 112945-52-5. Molecular formula: (SiO2)n;SiO2;SiO2;SiO2;SiO2;SiO2;O2Si. Mole weight: 60.084g/mol. IUPAC Name: dioxosilane. SMILES: O=[Si]=O. InChI: InChI=1S/O2Si/c1-3-2. | |
| Silicotungstic acid hydrate | Silicotungstic acid hydrate. Alternative Names: SILICOTUNGSTIC ACID;SILICOTUNGSTIC ACID HYDRATE;TUNGSTOSILICIC ACID HYDRATE;TUNGSTOSILICIC ACID;WOLFRAMOSILICIC ACID HYDRATE;Silicowolframic acid, Tungstosilicic acid ;SILICOTUNGSTIC ACID N-HYDRATE;Silicotungstic acid hydrate, 99.9+% metals basis. CAS No. 12027-43-9. Molecular formula: H6O41SiW12. Mole weight: 2896g/mol. Purity: Purity >98%. IUPAC Name: silicic acid;1,3,5-trioxa-2??6,4??6,6??6-tritungstacyclohexane 2,2,4,4,6,6-hexaoxide;hydrate. SMILES: O.O[Si](O)(O)O.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1. InChI: InChI=1S/H4O4Si.H2O.36O.12W/c1-5(2,3)4;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/h1-4H;1H2;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;; | |
| Silver,[2-(hydroxy-ko)propanoato-ko]- | Silver,[2-(hydroxy-ko)propanoato-ko]-. Alternative Names: SILVER LACTATE;SILVER LACTATE HEMIHYDRATE;SILVER LACTATE HYDRATE;SILVER LACTATE MONOHYDRATE;(lactato-O1,O2)silver;Lactic acid, silver(1+) salt;Nsc112242;Propanoic acid, 2-hydroxy-, monosilver(1+) salt. CAS No. 15768-18-0. Molecular formula: C3H5AgO3. Mole weight: 197.9461. Purity: 96%. IUPAC Name: 2-hydroxypropanoic acid; silver. SMILES: CC(C(=O)[O-])O.O.[Ag+]. | |
| Silver chloride crystal optic disc, 13mm x 1mm, polished both sides | Silver chloride crystal optic disc, 13mm x 1mm, polished both sides. | |
| Silver chloride crystal optic disc, 13mm x 2mm, polished both sides | Silver chloride crystal optic disc, 13mm x 2mm, polished both sides. | |
| Silver chloride crystal optic disc, 25mm x 2mm, polished both sides | Liquid; WetSolid. Molecular formula: AgCl;AgCl. Mole weight: 143.32g/mol. IUPAC Name: chlorosilver. SMILES: Cl[Ag]. InChI: InChI=1S/Ag.ClH/h;1H/q+1;/p-1. | |
| Silver chloride crystal optic disc, 25mm x 4mm, polished both sides | Silver chloride crystal optic disc, 25mm x 4mm, polished both sides. | |
| Silver chloride crystal optic disc, 32mm x 3mm, polished both sides | Liquid; WetSolid. Molecular formula: AgCl;AgCl. Mole weight: 143.32g/mol. IUPAC Name: chlorosilver. SMILES: Cl[Ag]. InChI: InChI=1S/Ag.ClH/h;1H/q+1;/p-1. | |
| Silver Hexafluoroantimonate(V) | Silver Hexafluoroantimonate(V). Alternative Names: KS-00000USA; silver hexakis(fluoranyl)antimony(1-); I14-16528; RTR-011786; silver hexafluorostibate(V); 26042-64-8; Ag.F6Sb; CTK3J2354; silver hexafluorostiboranuide; GSXFODUDOAXUBF-UHFFFAOYSA-H. CAS No. 26042-64-8. Molecular formula: AgF6Sb. Mole weight: 343.619g/mol. IUPAC Name: silver;hexafluoroantimony(1-). SMILES: F[Sb-](F)(F)(F)(F)F.[Ag+]. InChI: InChI=1S/Ag.6FH.Sb/h;6*1H;/q+1;;;;;;;+5/p-6. | |
| Silver hexafluoroarsenate | Silver hexafluoroarsenate. Alternative Names: SILVER HEXAFLUOROARSENATE;SILVER HEXAFLUOROARSENATE (V);Silver(I) hexafluoroarsenate(V);Silverhexafluoroarsenate(V),98.5%;Silver hexafluoroarsenate 97%;Silverhexafluoroarsenate97%;silver hexafluoroarsenate(IV);Silver hexafluoroarsenate, 98+%. CAS No. 12005-82-2. Molecular formula: AgAsF6. Mole weight: 296.78. Purity: 96%. IUPAC Name: silver;hexafluoroarsenic(1-). SMILES: F[As-](F)(F)(F)(F)F.[Ag+]. | |
| Silver(I)fluoride | Silver(I)fluoride. Alternative Names: Silver(I) Fluoride; Silver fluoride. CAS No. 7775-41-9. Molecular formula: AgF. Mole weight: 126.8666032. Purity: 96%. IUPAC Name: silver fluoride. SMILES: [F-].[Ag+]. | |
| Silver(II)fluoride | Silver(II)fluoride. Alternative Names: ARGENTIC FLUORIDE;SILVER DIFLUORIDE;SILVER(II) FLUORIDE;argentfluorure;silverfluoride(agf2);Silver(ll) fluoride;Silverfluoride2;Silverfluoridebrownpowder. CAS No. 7783-95-1. Molecular formula: AgF2. Mole weight: 145.87. Purity: 99.5%. IUPAC Name: difluorosilver. SMILES: F[Ag]F. | |
| Silver Ion Selective Electrode Solutions | Silver Ion Selective Electrode Solutions. | |
| Silver(I) selenide | Silver(I) selenide. CAS No. 1302-09-6. Molecular formula: Ag2Se;Ag2Se. Mole weight: 294.71g/mol. SMILES: [Se].[Ag].[Ag]. InChI: InChI=1S/2Ag.Se. | |
| Silver(I) telluride | Silver(I) telluride. CAS No. 12002-99-2. Molecular formula: Ag2Te;Ag2Te. Mole weight: 343.3g/mol. SMILES: [Ag].[Ag].[Te]. InChI: InChI=1S/2Ag.Te. | |
| Silver perchlorate hydrate | Silver perchlorate hydrate. Alternative Names: SILVER PERCHLORATE;SILVER PERCHLORATE HYDRATE;SILVER PERCHLORATE, HYDRATED;SILVER PERCHLORATE MONOHYDRATE;SILVER(I) PERCHLORATE HYDRATE;SILVER(I) PERCHLORATE MONOHYDRATE;SILVER PERCHLORATE MONOHYDRATE, 99.999%;SILVER PERCHLORATE, HYDRATED 99.999%. CAS No. 14242-05-8. Molecular formula: AgClH2O5. Mole weight: 225.33. Purity: 99.9%. IUPAC Name: silver;perchlorate;hydrate. SMILES: O.[O-]Cl(=O)(=O)=O.[Ag+]. | |
| Silver sulfadiazine | Silver sulfadiazine (AgSD), a sulfonamide antibiotic, effects a dual inhibitory action on bacterial growth by its sulfa moiety (SD-SDZ) that prevents bacterial folate absorption and subsequent DNA synthesis. The silver that is released from Silver sulfadiazine binds and disrupts the DNA structure, precluding bacterial DNA replication. Alternative Names: 4-Amino-n-2-pyrimidinylbenzenesulfonamide monosilver salt. CAS No. 22199-08-2. Molecular formula: C10H9AgN4O2S. Mole weight: 357.14. Purity: 99%+. IUPAC Name: Silver;(4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide. SMILES: C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Ag+]. InChI: InChI=1S/C10H9N4O2S.Ag/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;/h1-7H,11H2;/q-1;+1. | |
| Silver tetrafluoroborate | Silver tetrafluoroborate. CAS No. 14104-20-2. Molecular formula: AgBF4;AgBF4. Mole weight: 194.68g/mol. IUPAC Name: silver;tetrafluoroborate. SMILES: [B-](F)(F)(F)F.[Ag+]. InChI: InChI=1S/Ag.BF4/c;2-1(3,4)5/q+1;-1. | |
| Silyl[(6-O-tert-butyldimethyl)-2,3,-di-O-acetyl)-β-cyclodextrin | Silyl[(6-O-tert-butyldimethyl)-2,3,-di-O-acetyl)-β-cyclodextrin. | |
| SLAP 2,3-Bicyclo-(3,4-THF) N-BnPip Reagent | SLAP 2,3-Bicyclo-(3,4-THF) N-BnPip Reagent. | |
| SLAP 3-SpiroCyHex N-Bn Pip Reagent | SLAP 3-SpiroCyHex N-Bn Pip Reagent. | |
| SLAP 5-TMS TM | SLAP 5-TMS TM. CAS No. 2084112-39-8. | |
| SLAP HydroPyridopyrazine Reagent | SLAP HydroPyridopyrazine Reagent. CAS No. 2023645-22-7. | |
| SLAP HydroPyrrolopyrazine Reagent | SLAP HydroPyrrolopyrazine Reagent. Molecular formula: C9H22N2Si. Mole weight: 186.37g/mol. IUPAC Name: [(2S)-1-(trimethylsilylmethyl)pyrrolidin-2-yl]methanamine. SMILES: C[Si](C)(C)CN1CCCC1CN. InChI: InChI=1S/C9H22N2Si/c1-12(2,3)8-11-6-4-5-9(11)7-10/h9H,4-8,10H2,1-3H3/t9-/m0/s1. | |
| SLAP M | SLAP M. | |
| SLAP N-Bn-3Me-Pip Reagent | SLAP N-Bn-3Me-Pip Reagent. CAS No. 2168413-62-3. | |
| SLAP N-Bn Pip Reagent | SLAP N-Bn Pip Reagent. CAS No. 1908469-38-4. Molecular formula: C13H24N2Si. Mole weight: 236.43g/mol. IUPAC Name: N'-benzyl-N'-(trimethylsilylmethyl)ethane-1,2-diamine. SMILES: C[Si](C)(C)CN(CCN)CC1=CC=CC=C1. InChI: InChI=1S/C13H24N2Si/c1-16(2,3)12-15(10-9-14)11-13-7-5-4-6-8-13/h4-8H,9-12,14H2,1-3H3. | |
| SLAP TA | SLAP TA. CAS No. 2093935-86-3. | |
| SLAP TM | SLAP TM. CAS No. 1226877-72-0. | |
| Small gap fullerene-ethyl nipecotate | Small gap fullerene-ethyl nipecotate are higher order fullerenes with low HOMO-LUMO gaps. These allotropes of carbon are also known as metallofullerenes. They are kinetically unstable and are considered as insoluble small band gap structures. Molecular formula: Linear Formula C60(C8H15NO2)x. Mole weight: 912.81. Purity: ≥95%. InChI: 1S/C. | |
| Small gap fullerenes | Insoluble small gap fullerenes can be extracted into organic solvents by simple chemical redox process. Molecular formula: Linear Formula C60(C8H15NO2)x. Mole weight: 912.81. SMILES: C=1=C2c3c4C=1c5c6c7c8c9c%10c%11c%12c%13C%14=[C]%10=C%15c%16c%17c%14c%18c%13c%19c%20c%12c%21c%11c(c%22c%23c%24c(C2=[C]7%15%22)c%25c3c%26c%27c4c%28c5c(c6%16)c%29c%17c%30c%18c%31c%19c%32c%20c(c%21%23)c%33c%24c%34c%25c%26c%35c%36c%27c%28c%29c%37c%30c%31c%38c%32c%33c%34c%35c%38c%36%37)c89. InChI: 1S/C. | |
| SnAP 2,3-Bicyclo-(3,4-Pyr) M Reagent | SnAP 2,3-Bicyclo-(3,4-Pyr) M Reagent. Molecular formula: C22H46N2O3Sn. Mole weight: 505.3g/mol. IUPAC Name: tert-butyl (3S,4S)-3-amino-4-(tributylstannylmethoxy)pyrrolidine-1-carboxylate. SMILES: CCCC[Sn](CCCC)(CCCC)COC1CN(CC1N)C(=O)OC(C)(C)C. InChI: InChI=1S/C10H19N2O3.3C4H9.Sn/c1-10(2,3)15-9(13)12-5-7(11)8(6-12)14-4;3*1-3-4-2;/h7-8H,4-6,11H2,1-3H3;3*1,3-4H2,2H3;/t7-,8-;;;;/m0./s1. | |
| SnAP 2Me-M Reagent | SnAP 2Me-M Reagent. CAS No. 1557288-07-9. Molecular formula: C16H37NOSn. Mole weight: 378.2g/mol. IUPAC Name: 2-(tributylstannylmethoxy)propan-1-amine. SMILES: CCCC[Sn](CCCC)(CCCC)COC(C)CN. InChI: InChI=1S/C4H10NO.3C4H9.Sn/c1-4(3-5)6-2;3*1-3-4-2;/h4H,2-3,5H2,1H3;3*1,3-4H2,2H3. | |
| SnAP 3Me-M Reagent | SnAP 3Me-M Reagent. CAS No. 1557288-09-1. Molecular formula: C16H37NOSn. Mole weight: 378.2g/mol. IUPAC Name: 1-(tributylstannylmethoxy)propan-2-amine. SMILES: CCCC[Sn](CCCC)(CCCC)COCC(C)N. InChI: InChI=1S/C4H10NO.3C4H9.Sn/c1-4(5)3-6-2;3*1-3-4-2;/h4H,2-3,5H2,1H3;3*1,3-4H2,2H3. | |
| SnAP 3-Spiro-(2-Pyr) M Reagent | SnAP 3-Spiro-(2-Pyr) M Reagent. Molecular formula: C23H48N2O3Sn. Mole weight: 519.3g/mol. IUPAC Name: tert-butyl 3-amino-3-(tributylstannylmethoxymethyl)pyrrolidine-1-carboxylate. SMILES: CCCC[Sn](CCCC)(CCCC)COCC1(CCN(C1)C(=O)OC(C)(C)C)N. InChI: InChI=1S/C11H21N2O3.3C4H9.Sn/c1-10(2,3)16-9(14)13-6-5-11(12,7-13)8-15-4;3*1-3-4-2;/h4-8,12H2,1-3H3;3*1,3-4H2,2H3. | |
| SnAP DA Reagent | SnAP DA Reagent. CAS No. 1577233-73-8. | |
| SnAP-ex 3-N-Boc P Reagent | SnAP-ex 3-N-Boc P Reagent. | |
| SnAP-ex 3-O-MOM P | SnAP-ex 3-O-MOM P. | |
| SnAP M Reagent | SnAP M Reagent. CAS No. 1557288-04-6. Molecular formula: C15H35NOSn. Mole weight: 364.2g/mol. IUPAC Name: 2-(tributylstannylmethoxy)ethanamine. SMILES: CCCC[Sn](CCCC)(CCCC)COCCN. InChI: InChI=1S/3C4H9.C3H8NO.Sn/c3*1-3-4-2;1-5-3-2-4;/h3*1,3-4H2,2H3;1-4H2. | |
| SnAP OA Reagent | SnAP OA Reagent. CAS No. 1577233-70-5. Molecular formula: C16H37NOSn. Mole weight: 378.2g/mol. IUPAC Name: 3-(tributylstannylmethoxy)propan-1-amine. SMILES: CCCC[Sn](CCCC)(CCCC)COCCCN. InChI: InChI=1S/C4H10NO.3C4H9.Sn/c1-6-4-2-3-5;3*1-3-4-2;/h1-5H2;3*1,3-4H2,2H3. | |
| SnAP Pip Reagent | SnAP Pip Reagent. CAS No. 1557287-99-6. Molecular formula: C20H44N2O2Sn. Mole weight: 463.3g/mol. IUPAC Name: tert-butyl N-(2-aminoethyl)-N-(tributylstannylmethyl)carbamate. SMILES: CCCC[Sn](CCCC)(CCCC)CN(CCN)C(=O)OC(C)(C)C. InChI: InChI=1S/C8H17N2O2.3C4H9.Sn/c1-8(2,3)12-7(11)10(4)6-5-9;3*1-3-4-2;/h4-6,9H2,1-3H3;3*1,3-4H2,2H3. | |
| SnAP TM Reagent | SnAP TM Reagent. CAS No. 1452829-00-3. Molecular formula: C15H35NSSn. Mole weight: 380.2g/mol. IUPAC Name: 2-(tributylstannylmethylsulfanyl)ethanamine. SMILES: CCCC[Sn](CCCC)(CCCC)CSCCN. InChI: InChI=1S/3C4H9.C3H8NS.Sn/c3*1-3-4-2;1-5-3-2-4;/h3*1,3-4H2,2H3;1-4H2. | |
| Sodium 2-furyldimethylsilanolate | Sodium 2-furyldimethylsilanolate. CAS No. 879904-88-8. Molecular formula: C6H9NaO2Si. Mole weight: 164.21g/mol. IUPAC Name: sodium;furan-2-yl-dimethyl-oxidosilane. SMILES: C[Si](C)(C1=CC=CO1)[O-].[Na+]. InChI: InChI=1S/C6H9O2Si.Na/c1-9(2,7)6-4-3-5-8-6;/h3-5H,1-2H3;/q-1;+1. | |
| Sodium 3,3'-{[(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)]bis(oxy)}bis(propane-1-sulfonate) | Sodium 3,3'-{[(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)]bis(oxy)}bis(propane-1-sulfonate). CAS No. 953792-48-8. | |
| Sodium arsenyl tartrate hydrate | Sodium arsenyl tartrate hydrate. | |
| Sodium benzyloxide | Sodium benzyloxide. Alternative Names: SODIUM BENZYLOXIDE;SODIUM BENZYLOXIDE, 1.0M SOLUTION IN BEN;Benzenemethanol, sodium salt;sodium benzyloxide solution;Sodium benzyloxide, 1M solution in benzyl alcohol, AcroSeal;Sodium benzyloxide solution 1.0 M in benzyl alcohol. CAS No. 20194-18-7. Molecular formula: C7H7NaO. Mole weight: 130.12. Purity: 96%. IUPAC Name: sodium;phenylmethanolate. SMILES: C1=CC=C(C=C1)C[O-].[Na+]. | |
| Sodium Bis(fluorosulfonyl)imide | Sodium Bis(fluorosulfonyl)imide. Alternative Names: NaFSI. CAS No. 100669-96-3. Molecular formula: F2NNaO4S2. Mole weight: 203.11. Purity: >98.0%(T). IUPAC Name: sodium;bis(fluorosulfonyl)azanide. SMILES: [N-](S(=O)(=O)F)S(=O)(=O)F.[Na+]. InChI: InChI=1S/F2NO4S2.Na/c1-8(4,5)3-9(2,6)7;/q-1;+1. | |
| Sodium Bis(fluorosulfonyl)imide, ≥98% | Sodium Bis(fluorosulfonyl)imide, ≥98%. CAS No. 100669-96-3. Molecular formula: F2NNaO4S2. Mole weight: 203.13g/mol. IUPAC Name: sodium;bis(fluorosulfonyl)azanide. SMILES: [N-](S(=O)(=O)F)S(=O)(=O)F.[Na+]. InChI: InChI=1S/F2NO4S2.Na/c1-8(4,5)3-9(2,6)7;/q-1;+1. | |
| Sodium Bis(nonafluorobutanesulfonyl)imide, ≥97% | Sodium Bis(nonafluorobutanesulfonyl)imide, ≥97%. CAS No. 129135-86-0. Molecular formula: C8F18NNaO4S2. Mole weight: 603.2g/mol. IUPAC Name: sodium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide. SMILES: C(C(C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(F)F.[Na+]. InChI: InChI=1S/C8F18NO4S2.Na/c9-1(10,5(17,18)19)3(13,14)7(23,24)32(28,29)27-33(30,31)8(25,26)4(15,16)2(11,12)6(20,21)22;/q-1;+1. | |
| Sodium Bis(trifluoromethanesulfonyl)imide | Sodium Bis(trifluoromethanesulfonyl)imide. Alternative Names: Bis(trifluoromethanesulfonyl)imide Sodium Salt Sodium Triflimide NaTFSI. CAS No. 91742-21-1. Molecular formula: C2F6NNaO4S2. Mole weight: 303.13. Purity: >98.0%T. IUPAC Name: sodium;bis(trifluoromethylsulfonyl)azanide. SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Na+]. InChI: InChI=1S/C2F6NO4S2.Na/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1. | |
| Sodium bromide | NaBr is an inorganic compound with the formula NaBr. It is a high-melting white, crystalline solid that resembles sodium chloride. It is a widely used source of the bromide ion and has many applications. Alternative Names: Hydrobromic acid sodium salt. CAS No. 7647-15-6. Molecular formula: BrNa. Mole weight: 102.89. Purity: 99%+. IUPAC Name: Sodium;bromide. SMILES: [Na+].[Br-]. InChI: InChI=1S/BrH.Na/h1H;/q;+1/p-1. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.