BOC Sciences provides a wide range of research chemicals and biochemicals including inhibitors, building blocks, GMP Products, impurities and metabolites, APIs for Veterinary, Natural Compounds, ADCs, Stem Cell Molecule and chiral compounds.
| Product | Description | |
|---|---|---|
| Fmoc-4-azido-D-phenylalanine | Fmoc-4-azido-D-phenylalanine. Alternative Names: Fmoc-4-azido-D-phenylalanine; Fmoc-p-azido-D-Phe-OH. Grades: ≥ 99% (HPLC). CAS No. 1391586-30-3. Molecular formula: C24H20N4O4. Mole weight: 428.50. |  |
| Fmoc-4-benzoyl-D-phenylalanine | Fmoc-4-benzoyl-D-phenylalanine. Alternative Names: Fmoc-D-Bpa-OH; Fmoc-D-Phe(4-Bz)-OH; Fmoc D Bpa OH. Grades: ≥ 99% (HPLC, Chiral purity). CAS No. 117666-97-4. Molecular formula: C31H25NO5. Mole weight: 491.53. | |
| Fmoc-4-benzoyl-L-phenylalanine | Fmoc-4-benzoyl-L-phenylalanine. Alternative Names: Fmoc-L-Bpa-OH; Fmoc-L-Phe(4-Bz)-OH; Fmoc L Bpa OH. Grades: ≥ 98% (HPLC). CAS No. 117666-96-3. Molecular formula: C31H25NO5. Mole weight: 491.53. | |
| Fmoc-4-(Boc-amino)-D-phenylalanine | Fmoc-4-(Boc-amino)-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-NHBoc)-OH; Fmoc-π-(Boc-amino)-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-Bocaminophenyl)propionic acid. Grades: ≥ 98%. CAS No. 214750-77-3. Molecular formula: C29H30N2O6. Mole weight: 502.57. | |
| Fmoc-4-(Boc-amino)-L-phenylalanine | Fmoc-4-(Boc-amino)-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-NHBoc)-OH; Fmoc-p-(Boc-amino)-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-Boc-aminophenyl)propionic acid. Grades: ≥ 99% (HPLC, Chiral purity). CAS No. 174132-31-1. Molecular formula: C29H30N2O6. Mole weight: 502.57. | |
| Fmoc-4-(Boc-aminomethyl)-D-phenylalanine | Fmoc-4-(Boc-aminomethyl)-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-CH2NHBoc)-OH; Fmoc-p-(Boc-aminomethyl)-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-Boc-aminomethylphenyl)propionic acid. Grades: ≥ 98% (HPLC). CAS No. 268731-06-2. Molecular formula: C30H32N2O6. Mole weight: 516.58. | |
| Fmoc-4-(Boc-aminomethyl)-L-phenylalanine | Fmoc-4-(Boc-aminomethyl)-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-CH2NHBoc)-OH; Fmoc-p-(Boc-aminomethyl)-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-Boc-aminomethylphenyl)propionic acid. Grades: ≥ 98% (HPLC). CAS No. 204715-91-3. Molecular formula: C30H32N2O6. Mole weight: 516.58. | |
| Fmoc-4-Borono-L-Phenylalanine | Fmoc-4-Borono-L-Phenylalanine, a derivative of amino acid utilized for peptide synthesis and asymmetric synthesis catalysis, has garnered significant interest due to its promising therapeutic effects on cancer and diabetes. Numerous studies have been conducted on this compound to explore its potential for treating these diseases. Alternative Names: 4-(Dihydroxyboryl)-N-[(9H-fluoren-9-ylmethoxy)(hydroxy)methylene]-L-phenylalanine. CAS No. 273221-71-9. Molecular formula: C24H22BNO6. Mole weight: 431.2. | |
| Fmoc-4-carboxymethyl-piperazine | Fmoc-4-carboxymethyl-piperazine. Alternative Names: Fmoc-Cmπ-OH; Fmoc Cmπ OH. Grades: ≥ 98% (HPLC). CAS No. 180576-05-0. Molecular formula: C21H22N2O4. Mole weight: 366.41. | |
| Fmoc-4-carboxymethyl-piperidine | Fmoc-4-carboxymethyl-piperidine. Alternative Names: Fmoc-Cmp-OH; Fmoc-4-piperidylacetic acid; Fmoc Cmp OH. Grades: ≥ 99% (HPLC). CAS No. 180181-05-9. Molecular formula: C22H23NO4. Mole weight: 365.42. | |
| Fmoc-4-chloro-D-phenylalanine | Fmoc-4-chloro-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-Cl)-OH; Fmoc-p-chloro-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-chlorophenyl)propionic acid. Grades: ≥ 98% (HPLC). CAS No. 142994-19-2. Molecular formula: C24H20ClNO4. Mole weight: 421.87. | |
| Fmoc-4-chloro-L-phenylalanine | Fmoc-4-chloro-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-Cl)-OH; (S)-2-(Fmoc-amino)-3-(4-chlorophenyl)propionic acid; (S)-Fmoc-2-amino-3-(4-chlorophenyl)propionic acid. Grades: ≥ 99.5% (Chiral HPLC). CAS No. 175453-08-4. Molecular formula: C24H20ClNO4. Mole weight: 421.87. | |
| Fmoc-4-cyano-D-phenylalanine | Fmoc-4-cyano-D-phenylalanine (CAS# 205526-34-7) is a useful research chemical. Alternative Names: Fmoc-4-cyano-D-phenylalanine; Fmoc-π-cyano-D-Phe-OH; (R)-Fmoc-2-amino-(4-cyanophenyl)propanoic acid; FMOC-D-PHE(4-CN)-OH. Grades: ≥ 98 % (HPLC). CAS No. 205526-34-7. Molecular formula: C25H20N2O4. Mole weight: 412.4. | |
| Fmoc-4-cyano-L-phenylalanine | Fmoc-4-cyano-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-CN)-OH; Fmoc-p-cyano-L-Phe-OH; (S)-Fmoc-2-amino-(4-cyanophenyl)propanoic acid. Grades: ≥ 98% (HPLC). CAS No. 173963-93-4. Molecular formula: C25H20N2O4. Mole weight: 412.44. | |
| Fmoc-4-diethylphosphomethyl-D-phenylalanine | Fmoc-4-diethylphosphomethyl-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-CH2PO3Et2)-OH. Grades: ≥ 99% (HPLC). CAS No. 215600-05-8. Molecular formula: C29H32NO7P. Mole weight: 537.51. | |
| Fmoc-4-diethylphosphomethyl-L-phenylalanine | Fmoc-4-diethylphosphomethyl-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-CH2PO3Et2)-OH. Grades: ≥ 99% (HPLC). CAS No. 160253-13-4. Molecular formula: C29H32NO7P. Mole weight: 537.51. | |
| Fmoc-4-ethynylphe | Fmoc-4-ethynylphe. Alternative Names: Fmoc-Phe(ethynyl)-OH; (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-ethynylphenyl)propanoic acid. CAS No. 1228049-41-9. Molecular formula: C26H21NO4. Mole weight: 411.4. | |
| Fmoc-4-fluoro-DL-phenylalanine | Fmoc-4-fluoro-DL-phenylalanine. Alternative Names: Fmoc-DL-Phe(4-F)-OH; Fmoc-p-fluoro-DL-Phe-OH; (RS)-Fmoc-2-amino-3-(4-fluorophenyl)propionic acid. Grades: ≥ 98% (HPLC). CAS No. 264276-42-8. Molecular formula: C24H20FNO4. Mole weight: 405.42. | |
| Fmoc-4-fluoro-D-phenylalanine 4-alkoxybenzyl alcohol resin | Pre-loaded resins for solid phase peptide and organic synthesis. Alternative Names: Fmoc-D-Phe(4-F)-Wang resin. | |
| Fmoc-4-fluoro-L-phenylalanine | Fmoc-4-fluoro-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-F)-OH; Fmoc-p-fluoro-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-fluorophenyl)propionic acid. Grades: ≥ 99% (HPLC). CAS No. 169243-86-1. Molecular formula: C24H20FNO4. Mole weight: 405.42. | |
| Fmoc-4-fluoro-L-phenylalanine 4-alkoxybenzyl alcohol resin | Pre-loaded resins for solid phase peptide and organic synthesis. Alternative Names: Fmoc-L-Phe(4-F)-Wang resin. | |
| Fmoc-4-hydrazinobenzoic acid | Fmoc-4-hydrazinobenzoic acid. Alternative Names: 4-(Fmoc-hydrazino)-benzoic acid. Grades: ≥ 96% (HPLC). CAS No. 214475-53-3. Molecular formula: C22H18N2O4. Mole weight: 374.39. | |
| Fmoc-4-iodo-D-phenylalanine | Fmoc-4-iodo-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-I)-OH; Fmoc-p-iodo-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-iodophenyl)propionic acid. Grades: ≥ 99% (HPLC). CAS No. 205526-29-0. Molecular formula: C24H20INO4. Mole weight: 513.32. | |
| Fmoc-4-iodo-L-phenylalanine | Fmoc-4-iodo-L-phenylalanine can be used in the synthesis of a phosphotyrosine mimetic. Alternative Names: Fmoc-L-Phe(4-I)-OH; Fmoc-p-iodo-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-iodophenyl)propionic acid. Grades: ≥ 99.7% (Chiral HPLC). CAS No. 82565-68-2. Molecular formula: C24H20INO4. Mole weight: 513.32. | |
| Fmoc-4-methyl-D-phenylalanine | Fmoc-4-methyl-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-Me)-OH; Fmoc-π-Me-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-methylphenyl)propionic acid; Fmoc π Me D Phe OH. Grades: ≥ 98% (HPLC). CAS No. 204260-38-8. Molecular formula: C25H23NO4. Mole weight: 401.45. | |
| Fmoc-4-methyl-L-phenylalanine | Fmoc-4-methyl-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-Me)-OH; Fmoc-p-Me-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-methylphenyl)propionic acid; Fmoc p Me L Phe OHb. Grades: ≥ 99% (HPLC). CAS No. 199006-54-7. Molecular formula: C25H23NO4. Mole weight: 401.45. | |
| Fmoc-4-nitro-D-phenylalanine | Fmoc-4-nitro-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-NO2)-OH; Fmoc-π-nitro-D-Phe-OH; (S)-Fmoc-2-amino-3-(4-methylphenyl)propionic acid. Grades: ≥ 99% (HPLC). CAS No. 177966-63-1. Molecular formula: C24H20N2O6. Mole weight: 432.43. | |
| Fmoc-4-nitro-L-phenylalanine | Fmoc-4-nitro-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-NO2)-OH; Fmoc-p-nitro-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-nitrophenyl)propionic acid. Grades: ≥ 99% (HPLC). CAS No. 95753-55-2. Molecular formula: C24H20N2O6. Mole weight: 432.43. | |
| Fmoc-4-nitro-L-phenylalanine 4-alkoxybenzyl alcohol resin | Pre-loaded resins for solid phase peptide and organic synthesis. Alternative Names: Fmoc-L-Phe(4-NO2)-Wang resin. | |
| Fmoc-(4-pentynoyl)-OH | Fmoc-(4-pentynoyl)-OH. Molecular formula: C26H28N2O5. Mole weight: 488.5. | |
| Fmoc-4-phenylpiperidine-4-carboxylic acid | Fmoc-4-phenylpiperidine-4-carboxylic acid. Alternative Names: Fmoc-4-phenyl-isonipecotic acid. Grades: ≥ 99% (HPLC). CAS No. 215190-19-5. Molecular formula: C27H25NO4. Mole weight: 427.49. | |
| Fmoc-4-piperidino-L-proline | Fmoc-4-piperidino-L-proline. Alternative Names: Fmoc-L-Pro(4-piperidino)-OH. Grades: ≥ 98% (HPLC). CAS No. 204318-02-5. Molecular formula: C25H28N2O4. Mole weight: 420.50. | |
| Fmoc-(4S)-4-Azido-D-Proline | Fmoc-(4S)-4-Azido-D-Proline. Alternative Names: Fmoc-Pro(4-N3) (2R,4S); Fmoc-(2R,4S)-4-azidoproline. Grades: ≥ 99% (HPLC). CAS No. 2137142-63-1. Molecular formula: C20H18N4O4. Mole weight: 378.40. | |
| Fmoc-4-sulfomethyl-Phe(Tce)-OH | Fmoc-4-sulfomethyl-Phe(Tce)-OH is a stable sulfonyl tyrosine analog derivative suitable for Fmoc-SPPS. Lateral trichloroethyl (Tce) is cleaved by hydrogenolysis (H2/Pd) in the presence of ammonium formate. Alternative Names: L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-[[(2,2,2-trichloroethoxy)sulfonyl]methyl]-; N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-[[(2,2,2-trichloroethoxy)sulfonyl]methyl]-L-phenylalanine; (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(((2,2,2-trichloroethoxy)sulfonyl)methyl)phenyl)propanoic acid. Grades: 95%. CAS No. 1146758-11-3. Molecular formula: C27H24Cl3NO7S. Mole weight: 612.91. | |
| Fmoc-4-(tert-butoxycarbonylmethoxy)-L-phenylalanine | Fmoc-4-(tert-butoxycarbonylmethoxy)-L-phenylalanine. Alternative Names: Fmoc-4-(Boc-methoxy)-L-phenylalanine; (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(2-(tert-butoxy)-2-oxoethoxy)phenyl)propanoic acid. Grades: ≥ 99% (Chiral HPLC). CAS No. 181951-92-8. Molecular formula: C30H31NO7. Mole weight: 517.6. | |
| Fmoc-4-tert-butyl-D-phenylalanine | Fmoc-4-tert-butyl-D-phenylalanine. Alternative Names: Fmoc-D-Phe(4-tBu)-OH; Fmoc-p-tBu-D-Phe-OH; (R)-Fmoc-2-amino-3-(4-tert-butyl-phenylpropionic acid; Fmoc p tBu D Phe OH. Grades: ≥ 99% (HPLC). CAS No. 252049-14-2. Molecular formula: C28H29NO4. Mole weight: 443.53. | |
| Fmoc-4-tert-butyl-L-phenylalanine | Fmoc-4-tert-butyl-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-tBu)-OH; Fmoc-π-tBu-L-Phe-OH; (S)-Fmoc-2-amino-3-(4-tert-butyl-phenyl)propionic acid; Fmoc π tBu L Phe OH. Grades: ≥ 98% (HPLC). CAS No. 213383-02-9. Molecular formula: C28H29NO4. Mole weight: 443.53. | |
| Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine | Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine. Alternative Names: Fmoc-L-Phe(4-COOtBu)-OH; Fmoc-(4-carboxy-tert-butyl)-L-phenylalanine. Grades: ≥ 99% (HPLC). CAS No. 183070-44-2. Molecular formula: C29H29NO6. Mole weight: 487.56. | |
| Fmoc-5,5-dimethyl-L-proline | Fmoc-5,5-dimethyl-L-proline. Alternative Names: (S)-Fmoc-5,5-dimethyl-pyrrolidine-2-carboxylic acid; (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid. CAS No. 1310680-23-9. Molecular formula: C22H23NO4. Mole weight: 365.4. | |
| Fmoc-5-hydroxy-Nva-OH | Fmoc-5-hydroxy-Nva-OH. Alternative Names: Fmoc-DL-Nva(OH)-OH. CAS No. 2169956-19-6. Molecular formula: C20H21NO5. Mole weight: 355.4. | |
| Fmoc-6,7-dichloro-D-Tic-OH | Fmoc-6,7-dichloro-D-Tic-OH. Molecular formula: C25H19Cl2NO4. Mole weight: 468.33. | |
| Fmoc-6,7-dichloro-L-Tic-OH | Fmoc-6,7-dichloro-L-Tic-OH. Molecular formula: C25H19Cl2NO4. Mole weight: 468.33. | |
| Fmoc-7-aminoheptanoic acid | Fmoc-7-aminoheptanoic acid. Alternative Names: Fmoc-7-Ahp-OH; Fmoc 7 Ahp OH. Grades: ≥ 98% (HPLC). CAS No. 127582-76-7. Molecular formula: C22H25NO4. Mole weight: 367.44. | |
| Fmoc-7-Chloro-L-Tic-OH | Fmoc-7-Chloro-L-Tic-OH. Molecular formula: C25H20ClNO4. Mole weight: 433.88. | |
| Fmoc-8-aminocaprylic acid | Fmoc-8-aminocaprylic acid. Alternative Names: Fmoc-8-aminooctanoic acid; 8-(Fmoc-amino)-caprylic acid. Grades: ≥ 99% (HPLC). CAS No. 126631-93-4. Molecular formula: C23H27NO4. Mole weight: 381.46. | |
| Fmoc-AC4C-OH | Fmoc-AC4C-OH. Alternative Names: 1-(9-Fluorenylmethyloxycarbonyl-amino)-cyclobutyl-1-carboxylic acid; 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid; Fmoc-1-amino-1-cyclobutanecarboxylic acid; Fmoc-cyclovaline; 1-(Fmoc-amino)cyclobutanecarboxylic acid. Grades: ≥ 95%. CAS No. 885951-77-9. Molecular formula: C20H19NO4. Mole weight: 337.37. | |
| Fmoc-Acp-2-Chlorotrityl Resin | 2-Chlorotrityl-Chloride-Resin is less acid-labile than Trityl Resin, and is widely used for solid phase immobilization. It has been used with the Fmoc/tBu methodology in the microwave-assisted solid phase peptide synthesis. | |
| Fmoc-ACPC-OH(1R,2R) | Fmoc-ACPC-OH(1R,2R). Alternative Names: (1R,2R)-2-(9-Fluorenylmethyloxycarbonyl)aminocyclopentane carboxylic acid; (1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid; Fmoc-(1R,2R)-2-aminocyclopentane carboxylic acid; (1R,2R)-Fmoc-Acpc. Grades: ≥ 95% (HPLC). CAS No. 359586-69-9. Molecular formula: C21H21NO4. Mole weight: 351.40. | |
| Fmoc-ACPC-OH(1S,2S) | (1S,2S)-Fmoc-acpc is used in preparation of chimeric (α/β + α)-peptide ligands for BH3-recognition cleft of the cancer-associated protein Bcl-xL. Alternative Names: (1S,2S)-2-(9-Fluorenylmethyloxycarbonyl)aminocyclopentane carboxylic acid; (1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid; Cyclopentanecarboxylic acid,2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-,(1S,2S); (S,S)-Fmoc-trans-2-aminocyclopentanecarboxylic acid-OH; Fmoc-(1S,2S)-2-aminocyclopentane carboxylic acid; (1S,2S)-Fmoc-Acpc. Grades: ≥ 98% (HPLC). CAS No. 359586-64-4. Molecular formula: C21H21NO4. Mole weight: 351.40. | |
| Fmoc-Acp-Wang resin | Excellent resin for the synthesis of peptide acids using Fmoc strategy. Cleavage can be effected by 95% TFA. | |
| Fmoc-Adc(10)-ol | Fmoc-Adc(10)-ol. Alternative Names: Fmoc-NH-(CH2)10-OH; 10-[(9-Fluorenylmethoxycarbonyl)amino]-1-decanol. CAS No. 1396986-80-3. Molecular formula: C25H33NO3. Mole weight: 395.55. | |
| Fmoc-Adod(12)-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Alternative Names: Fmoc-Adod(12)-Wang Resin; 12-[(9-Fluorenylmethoxycarbonyl)amino]dodecanoic acid p-methoxybenzyl alcohol resin. | |
| Fmoc-AEEA-AEEA-OH | Fmoc-AEEA-AEEA-OH. Alternative Names: Fmoc-AEEA-AEEA; Fmoc-8-amino-3,6-dioxaoctanoyl-8-amino-3,6-dioxaoctanoic acid. Grades: ≥ 99% (HPLC). CAS No. 560088-89-3. Molecular formula: C27H34N2O9. Mole weight: 530.6. | |
| Fmoc Aeg-O-Ally HCl | Fmoc Aeg-O-Ally HCl. Alternative Names: Allyl 2-((2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)ethyl)amino)acetate. CAS No. 406683-69-0. Molecular formula: C22H24N2O4. Mole weight: 380.44. | |
| Fmoc-Aeg-OBn | A backbone for PNA synthesis. Grades: 98%. CAS No. 791778-61-5. Molecular formula: C26H26N2O4. Mole weight: 430.50. | |
| Fmoc-Aeg-OH | A backbone for PNA synthesis. Alternative Names: 2-((2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethyl)amino)acetic acid. Grades: 98%. CAS No. 172405-45-7. Molecular formula: C19H20N2O4. Mole weight: 340.38. | |
| Fmoc-Aeg-OMe | A backbone for PNA synthesis. Alternative Names: N-[2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]ethyl]glycine methyl ester. Grades: 98%. CAS No. 156939-69-4. Molecular formula: C20H22N2O4. Mole weight: 354.41. | |
| Fmoc-Aeg-OtBu HCl | A backbone for PNA synthesis. Alternative Names: N-[2-(Fmoc-amino)-ethyl]-Gly-OtBu HCl; tert-Butyl[2-(Fmoc-amino)ethylamino]acetate hydrochloride; N-[2-(Fmoc-amino)-ethyl]glycine tert-butylester hydrochloride; tert-Butyl [2-(Fmoc-amino)ethylamino]acetate hydrochloride; N-[2-(FMOC-AMINO)-ETHYL]-GLY-O-TBU HCl. Grades: 98%. CAS No. 169396-88-7. Molecular formula: C23H28N2O4·HCl. Mole weight: 432.95. | |
| Fmoc-Ahp(7)-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Alternative Names: Fmoc-Ahp(7)-Wang Resin; 7-[(9-Fluorenylmethoxycarbonyl)amino]heptanoic acid p-methoxybenzyl alcohol resin. | |
| Fmoc-Aib-Aib-OH | Fmoc-Aib-Aib-OH. Alternative Names: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]amino]-2-methylpropanoic acid. CAS No. 139881-77-9. Molecular formula: C23H26N2O5. Mole weight: 410.5. | |
| Fmoc-Aib-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Alternative Names: Fmoc-Aib-Wang Resin; N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2-aminoisobutyric acid p-methoxybenzyl alcohol resin; N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2-methylalanine p-methoxybenzyl alcohol resin. | |
| Fmoc-Ala(2-naphthyl)-Wang resin | Pre-loaded resins for solid phase peptide and organic synthesis. Alternative Names: Fmoc-3-(2-naphthyl)-L-alanine 4-alkoxybenzyl alcohol resin; Fmoc-2-Nal-Wang resin. | |
| Fmoc-Ala(2-Pyr-4-Cl)-OH | Fmoc-Ala(2-Pyr-4-Cl)-OH. Alternative Names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chloropyridin-2-yl)propanoic acid. Grades: 98.0%. CAS No. 2350007-37-1. Molecular formula: C23H19ClN2O4. Mole weight: 422.86. | |
| Fmoc-Ala(4-Pyr-3-F)-OH | Fmoc-Ala(4-Pyr-3-F)-OH. Alternative Names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluoropyridin-4-yl)propanoic acid. CAS No. 2349542-06-7. Molecular formula: C23H19FN2O4. Mole weight: 406.41. | |
| Fmoc-Ala-Aib-OH | Fmoc-Ala-Aib-OH. Alternative Names: Fmoc-β-Ala-Aib-OH; (S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanamido)-2-methylpropanoic acid; Alanine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanyl]-2-methyl- (9CI). CAS No. 107076-70-0. Molecular formula: C22H24N2O5. Mole weight: 396.44. | |
| Fmoc-Ala-Ala-Asn(Trt)-PAB | Fmoc-Ala-Ala-Asn(Trt)-PAB is a compound used in solid-phase peptide synthesis. It includes a protected tripeptide sequence (two alanines and a trityl-protected asparagine) and a p-aminobenzyl (PAB) linker. The Fmoc and Trt protecting groups safeguard the amino and amide side chains during synthesis, preventing unwanted reactions. The PAB linker can be cleaved under specific conditions, making it useful for designing controlled-release drugs or peptide-based molecules. This combination is often used in the preparation of complex peptides or drug delivery systems. Alternative Names: Ala-Ala-Asn(Trt)-PAB; (9H-Fluoren-9-yl)methyl ((S)-1-(((S)-1-(((S)-1-((4-(hydroxymethyl)phenyl)amino)-1,4-dioxo-4-(tritylamino)butan-2-yl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)carbamate; N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanyl-N1-[4-(hydroxymethyl)phenyl]-N5-(triphenylmethyl)-L-aspartamide; Fmoc-Ala-Ala-Asn(Trt)Ph-OH. Grades: ≥95%. CAS No. 1834515-99-9. Molecular formula: C51H49N5O7. Mole weight: 843.96. | |
| Fmoc-Ala-Ala-Asn(Trt)-PAB-PNP | Fmoc-Ala-Ala-Asn(Trt)-PAB-PNP is a reagent used in peptide synthesis. It features an Fmoc-protected dipeptide (Ala-Ala), with asparagine (Asn) protected by a trityl (Trt) group. The p-aminobenzyl (PAB) linker allows for controlled cleavage, and the p-nitrophenyl (PNP) group can be used for detection or cleavage purposes. This compound facilitates the synthesis and manipulation of peptides, useful in biochemical research and drug development. Alternative Names: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanyl-N1-[4-[[[(4-nitrophenoxy)carbonyl]oxy]methyl]phenyl]-N4-(triphenylmethyl)-L-aspartamide; (9H-Fluoren-9-yl)methyl ((S)-1-(((S)-1-(((S)-1-((4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenyl)amino)-1,4-dioxo-4-(tritylamino)butan-2-yl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)carbamate. Grades: ≥95%. CAS No. 1438853-39-4. Molecular formula: C58H52N6O11. Mole weight: 1009.07. | |
| Fmoc-Ala-Ala-OPFP | Fmoc-Ala-Ala-OPFP. Molecular formula: C27H21F5N2O5. Mole weight: 548.46. | |
| Fmoc-Ala-Ala-Osu | Fmoc-Ala-Ala-Osu. Molecular formula: C25H25N3O7. Mole weight: 479.48. | |
| Fmoc-Ala-aldehyde | Fmoc-Ala-aldehyde. Alternative Names: (S)-(9H-Fluoren-9-yl)methyl (1-oxopropan-2-yl)carbamate. Grades: 95%. CAS No. 146803-41-0. Molecular formula: C18H17NO3. Mole weight: 295.33. | |
Our database is helping our users find suppliers everyday.
