Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| O-Phenylphenoxyethyl Acrylate | O-Phenylphenoxyethyl Acrylate. |  |
| OPPEA | OPPEA. Mole weight: 268. | |
| OPPEOA | OPPEOA. Mole weight: 268. | |
| Organic conductive inks kit | Organic conductive inks kit. | |
| Osmium(III) chloride | Osmium(III) chloride. Alternative Names: Osmium(III) trichloride. CAS No. 13444-93-4. Molecular formula: Cl3Os. Mole weight: 296.6. Purity: 99%+. IUPAC Name: Trichloroosmium. SMILES: Cl[Os](Cl)Cl. InChI: InChI=1S/3ClH.Os/h3*1H;/q;+3/p-3. | |
| Osmium(III) chloride hydrate | Osmium(III) chloride hydrate. Alternative Names: Osmium(III) chloride xhydrate. CAS No. 14996-60-2. Molecular formula: Cl3H2OOs. Mole weight: 314.6. Purity: 99%+. IUPAC Name: Trichloroosmium;hydrate. SMILES: O.Cl[Os](Cl)Cl. InChI: InChI=1S/3ClH.H2O.Os/h3*1H;1H2;/q;+3/p-3. | |
| Oxazine 170 perchlorate | Oxazine 170 perchlorate. Alternative Names: 5,9-bis(ethylamino)-10-methyl-benzo[a]phenoxazin-7-iuperchlorate;OXAZINE 120 PERCHLORATE;OXAZINE 170 PERCHLORATE;OXAZINE 720;9-ETHYLAMINO-5-ETHYLIMINO-10-METHYL-5H-BENZO[A]PHENOXAZONIUM PERCHLORATE;3,7-BIS(ETHYLAMINO)-8-METHYL-BENZO[A]PHENOXAZINIUM PERCHL. CAS No. 62669-60-7. Molecular formula: C21H22ClN3O5. Mole weight: 431.9g/mol. IUPAC Name: ethyl-[5-(ethylamino)-10-methylbenzo[a]phenoxazin-9-ylidene]azanium;perchlorate. SMILES: CCNC1=CC2=C(C3=CC=CC=C31)N=C4C=C(C(=[NH+]CC)C=C4O2)C.[O-]Cl(=O)(=O)=O. InChI: InChI=1S/C21H21N3O.ClHO4/c1-4-22-16-11-19-18(10-13(16)3)24-21-15-9-7-6-8-14(15)17(23-5-2)12-20(21)25-19;2-1(3,4)5/h6-12,23H,4-5H2,1-3H3;(H,2,3,4,5). | |
| Oxazole-4-carboxylic acid | Oxazole-4-carboxylic acid. Alternative Names: 1,3-Oxazole-4-carboxylic acid. CAS No. 23012-13-7. Molecular formula: C4H3NO3. Mole weight: 113.0726. Purity: 96%. IUPAC Name: 1,3-oxazole-4-carboxylic acid. InChI: InChI=1S/C4H3NO3/c6-4(7)3-1-8-2-5-3/h1-2H,(H,6,7). | |
| Oxine-copper | GREEN-TO-YELLOW CRYSTALLINE POWDER. Alternative Names: 8-HYDROXYQUINOLINE, COPPER(II) SALT;8-HYDROXYQUINOLINE, CU(II) SALT;8-HYDROXYQUINOLINE COPPER SALT;8-QUINOLINOL COPPER SALT;BIS(8-HYDROXYQUINOLINATO) COPPER(II);BIS(8-QUINOLINOLATO) COPPER(II);CUPRIC 8-QUINOLINATE;CUPRIC 8-OXYQUINOLINE. CAS No. 13014-03-4. Molecular formula: C18H12CuN2O2;C18H14CuN2O2. Mole weight: 353.9g/mol. Purity: Purity >98%. IUPAC Name: copper;quinolin-8-ol. SMILES: C1=CC2=C(C(=C1)O)N=CC=C2.C1=CC2=C(C(=C1)O)N=CC=C2.[Cu]. InChI: InChI=1S/2C9H7NO.Cu/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H. | |
| P-4-pyridinyl-Phosphonic acid | P-4-pyridinyl-Phosphonic acid. Alternative Names: 4-Pyridylphosphonic acid; Phosphonic acid, 4-pyridinyl-. CAS No. 58816-01-6. Molecular formula: C5H6NO3P. Mole weight: 159.08. Purity: 95%. IUPAC Name: pyridin-4-ylphosphonic acid. InChI: InChI=1S/C5H6NO3P/c7-10(8,9)5-1-3-6-4-2-5/h1-4H,(H2,7,8,9). | |
| P51 Polycarbonate 3D Printing Filament | P51 Polycarbonate 3D Printing Filament. | |
| Palladium bromide | Palladium bromide. Alternative Names: Dibromopalladium. CAS No. 13444-94-5. Molecular formula: Br2Pd. Mole weight: 266.23. Purity: 99%. IUPAC Name: dibromopalladium. SMILES: Br[Pd]Br. InChI: InChI=1S/2BrH.Pd/h2*1H;/q;+2/p-2. | |
| Palladium hydroxide | Palladium hydroxide. Alternative Names: Palladium(II)dihydoxide. CAS No. 12135-22-7. Molecular formula: H2O2Pd. Mole weight: 140.43. Purity: 98%. IUPAC Name: palladium(2+);dihydroxide. SMILES: [OH-].[OH-].[Pd+2]. InChI: InChI=1S/2H2O.Pd/h2*1H2;/q;+2/p-2. | |
| Palladium(II) cyanide | Palladium(II) cyanide. Alternative Names: Palladium dicyanide. CAS No. 2035-66-7. Molecular formula: C2N2Pd. Mole weight: 158.45. Purity: 99%+. IUPAC Name: Palladium(2+);dicyanide. SMILES: [C-]#N.[C-]#N.[Pd+2]. InChI: InChI=1S/2CN.Pd/c2*1-2;/q2*-1;+2. | |
| Palladium(II) hexafluoroacetylacetonate | Palladium(II) hexafluoroacetylacetonate. Alternative Names: Bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')palladium. CAS No. 64916-48-9. Molecular formula: C10H4F12O4Pd. Mole weight: 522.54. Purity: 95%+. IUPAC Name: 1,1,1,5,5,5-Hexafluoro-4-hydroxypent-3-en-2-one;palladium. SMILES: C(=C(C(F)(F)F)O)C(=O)C(F)(F)F.C(=C(C(F)(F)F)O)C(=O)C(F)(F)F.[Pd]. InChI: InChI=1S/2C5H2F6O2.Pd/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1,12H. | |
| Palladium(II) iodide | Palladium(II) iodide. Alternative Names: Palladium(II) diiodide. CAS No. 7790-38-7. Molecular formula: I2Pd. Mole weight: 360.23. Purity: 99%+. IUPAC Name: Diiodopalladium. SMILES: [Pd](I)I. InChI: InChI=1S/2HI.Pd/h2*1H;/q;+2/p-2. | |
| Palladium(II) sulfate | Palladium(II) sulfate. Alternative Names: Palladium(II) sulfate dihydrate. CAS No. 13566-03-5. Molecular formula: PdSO4;O4PdS. Mole weight: 202.49. Purity: 99%+. IUPAC Name: Palladium(2+);sulfate. SMILES: [O-]S(=O)(=O)[O-].[Pd+2]. InChI: InChI=1S/H2O4S.Pd/c1-5(2,3)4;/h(H2,1,2,3,4);/q;+2/p-2. | |
| Palladium Nickel gauze, 50 mesh woven from 0.1578mm (0.0062in) dia wire | Palladium Nickel gauze, 50 mesh woven from 0.1578mm (0.0062in) dia wire. | |
| Palladium Silver foil, 0.025mm (0.001in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.025mm (0.001in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium Silver foil, 0.05mm (0.002in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.05mm (0.002in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium Silver foil, 0.10mm (0.004in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.10mm (0.004in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium Silver foil, 0.127mm (0.005in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.127mm (0.005in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium Silver foil, 0.25mm (0.01in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.25mm (0.01in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium Silver foil, 0.5mm (0.02in) thick, 99.9% (metals basis excluding Pt) | Palladium Silver foil, 0.5mm (0.02in) thick, 99.9% (metals basis excluding Pt). | |
| Palladium single crystal, 9-10mm (0.35-0.39in) dia, 50mm (2.0in) long, (100) orientation, ±2° | DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals, OtherSolid;Solid. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.4g/mol. Purity: 99%, 99.5%, 99.9%, 99.95%, 99.99%, 99.999%. IUPAC Name: palladium. SMILES: [Pd]. InChI: InChI=1S/Pd. | |
| Palladium single crystal, 9-10mm (0.35-0.39in) dia, 50mm (2.0in) long, (110) orientation, ±2° | DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals, OtherSolid;Solid. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.4g/mol. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: palladium. SMILES: [Pd]. InChI: InChI=1S/Pd. | |
| Palladium single crystal, 9-10mm (0.35-0.39in) dia, 50mm (2.0in) long, (111) orientation, ±2° | DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals, OtherSolid;Solid. Alternative Names: Palladium nano-stars, palladium nano stars, PdNSs. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.4g/mol. IUPAC Name: palladium. SMILES: [Pd]. InChI: InChI=1S/Pd. | |
| Palladium single crystal, 9-10mm (0.35-0.39in) dia, 50mm (2.0in) long, random orientation | DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals, OtherSolid;Solid. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.4g/mol. IUPAC Name: palladium. SMILES: [Pd]. InChI: InChI=1S/Pd. | |
| Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (100) orientation, ±0.5° | Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (100) orientation, ±0.5°. CAS No. 7440-5-3. | |
| Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (110) orientation | Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (110) orientation. Alternative Names: palladium nanopowder suspension, aqueous palladium nanoparticle solution, palladium nanofluid. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.42. | |
| Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (111) orientation, ±0.5° | DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals, OtherSolid;Solid. CAS No. 7440-5-3. Molecular formula: Pd. Mole weight: 106.4g/mol. Purity: 99.9%, 99.99%, 99.999%. IUPAC Name: palladium. SMILES: [Pd]. InChI: InChI=1S/Pd. | |
| Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (111) orientation, ±0.5° | Palladium single crystal disc, 10mm (0.39in) dia, 1-2mm (0.04-0.08in) thick, (111) orientation, ±0.5°. CAS No. 7440-5-3. | |
| Pamam dendrimergeneration& | Pamam dendrimergeneration&. Alternative Names: PAMAM DENDRIMERGENERATION&;pamam dendrimer, generation 1.5 solution;PAMAMdendrimer,ethylenediaminecore,generation1.5solution;PAMAM dendriMer, ethylenediaMine core, generation 1.5 solution 20 wt. % in Methanol. CAS No. 202009-64-1. Molecular formula: C110H176N26Na16O44. Mole weight: 2934.6g/mol. Purity: 96%. IUPAC Name: hexadecasodium;3-[2-[3-[2-[3-[2-[bis[3-[2-[bis[3-[2-[bis(2-carboxylatoethyl)amino]ethylamino]-3-oxopropyl]amino]ethylamino]-3-oxopropyl]amino]ethyl-[3-[2-[bis[3-[2-[bis(2-carboxylatoethyl)amino]ethylamino]-3-oxopropyl]amino]ethylamino]-3-oxopropyl]amino]propanoylamino]ethyl-[3-[2-[bis(2-carboxylatoethyl)amino]ethylamino]-3-oxopropyl]amino]propanoylamino]ethyl-(2-carboxylatoethyl)amino]propanoate. SMILES: C(CN(CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCNC(=O)CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])CCC(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-])C(=O)NCCN(CCC(=O)[O-])CCC(=O)[O-].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+]. InChI: InChI=1S/C110H192N26O44.16Na/c137-83(115-33-73-127(53-13-95(149)150)54-14-96(151)152)1-41-123(42-2-84(138)116-34-74-128(55-15-97(153)154)56-16-98(155)156)69-29-111-91(145)9-49-135(50-10-92(146)112-30-70-124(43-3 | |
| Pamam dendrimer,generation 2 solution | Pamam dendrimer,generation 2 solution. Alternative Names: pamam dendrimer, generation 2 solution;PAMAMdendrimer,ethylenediaminecore,generation2.0solution;PAMAM dendriMer, ethylenediaMine core, generation 2.0 solution 20 wt. % in Methanol. CAS No. 93376-66-0. Molecular formula: C142H288N58O28. Mole weight: 3256.2g/mol. IUPAC Name: N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-[2-[3-[[3-[2-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]ethylamino]-3-oxopropyl]-[2-[3-[[3-[2-[bis[3-[2-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]ethylamino]-3-oxopropyl]amino]ethylamino]-3-oxopropyl]-[2-[bis[3-[2-[bis[3-[2-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]ethylamino]-3-oxopropyl]amino]ethylamino]-3-oxopropyl]amino]ethyl]amino]propanoylamino]ethyl]amino]propanoylamino]ethyl]amino]propanamide. SMILES: C(CN(CCC(=O)NCCN)CCNC(=O)CCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCNC(=O)CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)C(=O)NCCN. InChI: InChI=1S/C142H288N58O28/c143-29-45-159-115(201)1-73-187(74-2-116(202)160-46-30-144)101-61-175-131(217)17-89-195(90-18-132(218)176-62-102-188(75-3-117(203)161-47-31-145)76-4-118(204)162-48-32-146)109-69-183-139(225)25-97-199(98-26-140(226)184-70-110-196(91-19-133( | |
| Paraffin wax | Paraffin wax. Alternative Names: TISSUEPREP 2 EMBEDDING MEDIA;PATHOPREP 546;PATHOPREP568;PATHOPREP580;paraffinwaxfume;waxes:paraffin;Paraffin waxes and Hydrocarbon waxes;SYNTHETIC WAX. CAS No. 8002-74-2. Molecular formula: C31H64. Mole weight: 0. Purity: 96%. | |
| PBDB-T | Band gap: 1.8 eV. Alternative Names: PBDB-T, PBDTBDD, Poly[(2,6-(4,8-bis(5-(2-ethylhexyl)thiophen-2-yl)-benzo[1,2-b:4,5-b']dithiophene))-alt-(5,5-(1',3'-di-2-thienyl-5',7'-bis(2-ethylhexyl)benzo[1',2'-c:4',5'-c']dithiophene-4,8-dione)]. CAS No. 1415929-80-4. Molecular formula: (C68H78O2S8)n. | |
| PbS Quantum Dots | PbS Quantum Dots. Alternative Names: PbS QDs, PbS core-type quantum dots, oleic acid coated, CANdot, Fluorescent lead sulfide nanocrystals, artificial atoms. CAS No. 1314-87-0. Molecular formula: PbS. Mole weight: 239.27. Purity: LeadSulfidePbSQuantumDot-1000nm|LeadSulfidePbSQuantumDot-1100nm|LeadSulfidePbSQuantumDot-1200nm|LeadSulfidePbSQuantumDot-1400nm|LeadSulfidePbSQuantumDot-1500nm|LeadSulfidePbSQuantumDot-1600nm|LeadSulfidePbSQuantumDot-850nm. IUPAC Name: sulfanylidenelead. SMILES: S=[Pb]. InChI: InChI=1S/Pb.S. | |
| PBTTT-C14 | PBTTT-C14 is a semiconducting material which is used as a hole transporting material (HTM). It has an ordered structure and crystal orientation which result in a high performance conducting material. Alternative Names: Poly[2,5-bis(3-tetradecylthiophen-2-yl)thieno[3,2-b]thiophene]. CAS No. 888491-19-8. Molecular formula: (C42H62S4)n. | |
| PCDTBT | PCDTBT is a carbozole based semiconducting co-polymer that is used as a donor material with a low band gap and a power efficiency of 9%. It has a quantum efficiency close to 100% that makes it a viable alternative of P3HT for a wide range of photovoltaics based applications. Alternative Names: Poly[[9-(1-octylnonyl)-9H-carbazole-2,7-diyl]-2,5-thiophenediyl-2,1,3-benzothiadiazole-4,7-diyl-2,5-thiophenediyl]. CAS No. 958261-50-2. Molecular formula: (C43H47N3S3)nC12H10. | |
| PCPDTBT | PCPDTBT is a low band gap polymer that is used as a donor material with a high photovoltaic efficiency. It can form blends with a variety of conducting polymers which can be used to enhance the power conversion efficiency (PCE) in an electrochemical device. Alternative Names: Poly[2,6-(4,4-bis-(2-ethylhexyl)-4H-cyclopenta [2,1-b;3,4-b']dithiophene)-alt-4,7(2,1,3-benzothiadiazole)]. CAS No. 920515-34-0. Molecular formula: (C31H38N2S3)n. | |
| PDCDT | PDCDT. Alternative Names: N N-BIS(2 5-DI-T-BU-PHENYL)-3 4 9 10-;N,N-bis(2,5-di-T-bu-phenyl)-3,4,9,10-perylenedic;N,N-bis(2,5-di-T-butylphenyl)-3,4*9,10-perylened;N,N-BIS(2,5-DI-T-BU-PHENYL)-3,4,9,10-PE RYLENEDICARBOXIMIDE;2,9-BIS(2,5-BIS(1,1-DIMETHYLETHYL)PHENYL)-ANTRA(2,19-DEF:6. CAS No. 83054-80-2. Molecular formula: C52H50N2O4. Mole weight: 767g/mol. IUPAC Name: 7,18-bis(2,5-ditert-butylphenyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone. SMILES: CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)N2C(=O)C3=C4C(=CC=C5C4=C(C=C3)C6=C7C5=CC=C8C7=C(C=C6)C(=O)N(C8=O)C9=C(C=CC(=C9)C(C)(C)C)C(C)(C)C)C2=O. InChI: InChI=1S/C52H50N2O4/c1-49(2,3)27-13-23-37(51(7,8)9)39(25-27)53-45(55)33-19-15-29-31-17-21-35-44-36(22-18-32(42(31)44)30-16-20-34(46(53)56)43(33)41(29)30)48(58)54(47(35)57)40-26-28(50(4,5)6)14-24-38(40)52(10,11)12/h13-26H,1-12H3. | |
| Pd/graphene nanocomposite | Pd/graphene nanocomposite. | |
| Pd/reduced graphene oxide nanocomposite | Pd/reduced graphene oxide nanocomposite. | |
| PDTSTPD | HOMO: -5.6 eVLUMO: -3.8 eVUV absorption: λmax = 670 nm; Eg = 1.73 eVSolubility: This polymer can be dissolved easily in chloroform, chlorobenzene, dichlorobenzene. Alternative Names: Poly[(5,6-dihydro-5-octyl-4,6-dioxo-4H-thieno[3,4-c]pyrrole-1,3-diyl)[4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b';]dithiophene-2,6-diyl]]. CAS No. 1279109-93-1. Molecular formula: (C38H53NO2S3Si)n. | |
| PEG(200)DA, 10-30 cps | PEG(200)DA, 10-30 cps. Mole weight: 302. | |
| PEG(200)DA, 15-30 cps | PEG(200)DA, 15-30 cps. Mole weight: 308. | |
| PEG(400)DA, 30-70 cps | PEG(400)DA, 30-70 cps. Mole weight: 508. | |
| PEG(400)DA, 45-65 cps | PEG(400)DA, 45-65 cps. Mole weight: 508. | |
| PEG(600)DA, 50-110 cps | PEG(600)DA, 50-110 cps. Mole weight: 742. | |
| PEG(600)DA, 80-120 cps | PEG(600)DA, 80-120 cps. Mole weight: 708. | |
| PEG -COOH Modified Upconverting Nanoparticles (green light) | PEG -COOH Modified Upconverting Nanoparticles (green light). | |
| PEG-COOH modified upconverting nanoparticles (near-infrared light) | PEG-COOH modified upconverting nanoparticles (near-infrared light). | |
| -PEGCOOH Modified Upconverting Nanoparticles (near-infrared light) | -PEGCOOH Modified Upconverting Nanoparticles (near-infrared light). | |
| PEG-COOH Modified Upconverting Nanoparticles (purple-blue light) | PEG-COOH Modified Upconverting Nanoparticles (purple-blue light). | |
| PEG -COOH Modified Upconverting Nanoparticles (UV light) | PEG -COOH Modified Upconverting Nanoparticles (UV light). | |
| PEG-COOH Modified Upconverting Nanoparticles (Yellow green light) | PEG-COOH Modified Upconverting Nanoparticles (Yellow green light). | |
| PEG modified Upconverting Nanoparticles(green light) | PEG modified Upconverting Nanoparticles(green light). | |
| PEG modified upconverting nanoparticles(near-infrared light) | PEG modified upconverting nanoparticles(near-infrared light). | |
| PEG modified Upconverting Nanoparticles(Purple blue light) | PEG modified Upconverting Nanoparticles(Purple blue light). | |
| PEG modified Upconverting Nanoparticles(UV light) | PEG modified Upconverting Nanoparticles(UV light). | |
| PEG modified upconverting nanoparticles(yellow-green light) | PEG modified upconverting nanoparticles(yellow-green light). | |
| PEG-NH2 Modified Upconverting Nanoparticles (green light) | PEG-NH2 Modified Upconverting Nanoparticles (green light). | |
| PEG-NH2 Modified Upconverting Nanoparticles (near-infrared light) | PEG-NH2 Modified Upconverting Nanoparticles (near-infrared light). | |
| PEG-NH2 Modified Upconverting Nanoparticles (purple-blue light) | PEG-NH2 Modified Upconverting Nanoparticles (purple-blue light). | |
| PEG-NH2 Modified Upconverting Nanoparticles (UV light) | PEG-NH2 Modified Upconverting Nanoparticles (UV light). | |
| PEG-NH2 Modified Upconverting Nanoparticles (Yellow green light) | PEG-NH2 Modified Upconverting Nanoparticles (Yellow green light). | |
| Pentaacrylate | Pentaacrylate. | |
| Pentaammine(trifluoromethanesulfonato)osmium(III) triflate | Pentaammine(trifluoromethanesulfonato)osmium(III) triflate. Alternative Names: Pentaammine(triflato)osmium(III) triflate. CAS No. 83781-30-0. Molecular formula: C3H15F9N5O9OsS3. Mole weight: 722.6. Purity: 99%+. IUPAC Name: Azane;osmium;trifluoromethanesulfonate. SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].N.N.N.N.N.[Os]. InChI: InChI=1S/3CHF3O3S.5H3N.Os/c3*2-1(3,4)8(5,6)7;/h3*(H,5,6,7);5*1H3;/p-3. | |
| Pentacene | TGA/DSC Lot specific traces available upon request. Alternative Names: Lin-Naphthoanthracene; 2,3:6,7-Dibenzanthracene. CAS No. 135-48-8. Molecular formula: C22H14. Mole weight: 278.34. Purity: 98%. IUPAC Name: Pentacene. SMILES: C1=CC=C2C=C3C=C4C=C5C=CC=CC5=CC4=CC3=CC2=C1. InChI: InChI=1S/C22H14/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1/h1-14H. | |
| Pentadecylamine | Pentadecylamine appears as a flake solid. (EPA, 1998). CAS No. 2570-26-5. Molecular formula: C15H33N. Mole weight: 227.43g/mol. IUPAC Name: pentadecan-1-amine. SMILES: CCCCCCCCCCCCCCCN. InChI: InChI=1S/C15H33N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16/h2-16H2,1H3. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.