Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| MOF&[4, 4'- Bipyridine] - 2, 2', 6, 6'- tetracarboxylic acid | MOF&[4, 4'- Bipyridine] - 2, 2', 6, 6'- tetracarboxylic acid. |  |
| MOF&4,4'-Bis(triethoxysilyl)-1,1'-biphenyl | MOF&4,4'-Bis(triethoxysilyl)-1,1'-biphenyl. Molecular formula: C24H38O6Si2. Mole weight: 478.7g/mol. IUPAC Name: triethoxy-[4-(4-triethoxysilylphenyl)phenyl]silane. InChI: InChI=1S/C24H38O6Si2/c1-7-25-31(26-8-2,27-9-3)23-17-13-21(14-18-23)22-15-19-24(20-16-22)32(28-10-4,29-11-5)30-12-6/h13-20H,7-12H2,1-6H3. | |
| MOF&4,4'-Dibromo-2,2'-bipyridine | MOF&4,4'-Dibromo-2,2'-bipyridine. Molecular formula: C10H6Br2N2. Mole weight: 313.98g/mol. IUPAC Name: 4-bromo-2-(4-bromopyridin-2-yl)pyridine. InChI: InChI=1S/C10H6Br2N2/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H. | |
| MOF&4,4'-Dibromo-2,2'-diiodo-1,1'-biphenyl | MOF&4,4'-Dibromo-2,2'-diiodo-1,1'-biphenyl. Molecular formula: C12H6Br2I2. Mole weight: 563.79g/mol. IUPAC Name: 4-bromo-1-(4-bromo-2-iodophenyl)-2-iodobenzene. InChI: InChI=1S/C12H6Br2I2/c13-7-1-3-9(11(15)5-7)10-4-2-8(14)6-12(10)16/h1-6H. | |
| MOF&4,4'-Dihydroxyazobenzene | MOF&4,4'-Dihydroxyazobenzene. Molecular formula: C12H10N2O2. Mole weight: 214.22g/mol. IUPAC Name: 4-[(4-hydroxyphenyl)diazenyl]phenol. InChI: InChI=1S/C12H10N2O2/c15-11-5-1-9(2-6-11)13-14-10-3-7-12(16)8-4-10/h1-8,15-16H. | |
| MOF&4-(4H-1,2,4-Triazol-4-yl)benzoic acid | MOF&4-(4H-1,2,4-Triazol-4-yl)benzoic acid. Molecular formula: C9H7N3O2. Mole weight: 189.17g/mol. IUPAC Name: 4-(1,2,4-triazol-4-yl)benzoic acid. InChI: InChI=1S/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-5-10-11-6-12/h1-6H,(H,13,14). | |
| MOF&4'-(4-Methoxyphenyl)-2,2':6',2''-terpyridine | MOF&4'-(4-Methoxyphenyl)-2,2':6',2''-terpyridine. Molecular formula: C22H17N3O. Mole weight: 339.4g/mol. IUPAC Name: 4-(4-methoxyphenyl)-2,6-dipyridin-2-ylpyridine. InChI: InChI=1S/C22H17N3O/c1-26-18-10-8-16(9-11-18)17-14-21(19-6-2-4-12-23-19)25-22(15-17)20-7-3-5-13-24-20/h2-15H,1H3. | |
| MOF&4,5-Difluorophthalic acid | MOF&4,5-Difluorophthalic acid. Molecular formula: C8H4F2O4. Mole weight: 202.11g/mol. IUPAC Name: 4,5-difluorophthalic acid. InChI: InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14). | |
| MOF&4,7-Dibromobenzo[c][1,2,5]oxadiazole | MOF&4,7-Dibromobenzo[c][1,2,5]oxadiazole. Molecular formula: C6H2Br2N2O. Mole weight: 277.90g/mol. IUPAC Name: 4,7-dibromo-2,1,3-benzoxadiazole. InChI: InChI=1S/C6H2Br2N2O/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H. | |
| MOF&4,9-Dibromoisochromeno[6,5,4-def]isochromene-1,3,6,8-tetraone | MOF&4,9-Dibromoisochromeno[6,5,4-def]isochromene-1,3,6,8-tetraone. Molecular formula: C14H2Br2O6. Mole weight: 425.97g/mol. IUPAC Name: 2,9-dibromo-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone. InChI: InChI=1S/C14H2Br2O6/c15-5-1-3-7-8-4(12(18)22-13(19)9(5)8)2-6(16)10(7)14(20)21-11(3)17/h1-2H. | |
| MOF&4'-Chloro-2,2':6',2''-terpyridine | MOF&4'-Chloro-2,2':6',2''-terpyridine. Molecular formula: C15H10ClN3. Mole weight: 267.71g/mol. IUPAC Name: 4-chloro-2,6-dipyridin-2-ylpyridine. InChI: InChI=1S/C15H10ClN3/c16-11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13/h1-10H. | |
| MOF&4-Pyridinecarboxaldehyde,2-(4-pyridinylmethylene)hydrazone | MOF&4-Pyridinecarboxaldehyde,2-(4-pyridinylmethylene)hydrazone. | |
| MOF&5,5-Divinyl-2,2-bipyridine | MOF&5,5-Divinyl-2,2-bipyridine. | |
| MOF&5,6-Diamino-1,10-phenanthroline | MOF&5,6-Diamino-1,10-phenanthroline. Molecular formula: C12H10N4. Mole weight: 210.23g/mol. IUPAC Name: 1,10-phenanthroline-5,6-diamine. InChI: InChI=1S/C12H10N4/c13-9-7-3-1-5-15-11(7)12-8(10(9)14)4-2-6-16-12/h1-6H,13-14H2. | |
| MOF&5-(trifluoromethyl)benzene-1,3-dicarboxylic acid | MOF&5-(trifluoromethyl)benzene-1,3-dicarboxylic acid. Molecular formula: C9H5F3O4. Mole weight: 234.13g/mol. IUPAC Name: 5-(trifluoromethyl)benzene-1,3-dicarboxylic acid. InChI: InChI=1S/C9H5F3O4/c10-9(11,12)6-2-4(7(13)14)1-5(3-6)8(15)16/h1-3H,(H,13,14)(H,15,16). | |
| MOF&(6-Cyanopyridin-3-yl)boronic acid | MOF&(6-Cyanopyridin-3-yl)boronic acid. Molecular formula: C6H5BN2O2. Mole weight: 147.93g/mol. IUPAC Name: (6-cyanopyridin-3-yl)boronic acid. InChI: InChI=1S/C6H5BN2O2/c8-3-6-2-1-5(4-9-6)7(10)11/h1-2,4,10-11H. | |
| MOF&6-Methoxy-2-pyrazinecarboxylic acid | MOF&6-Methoxy-2-pyrazinecarboxylic acid. Molecular formula: C6H6N2O3. Mole weight: 154.12g/mol. IUPAC Name: 6-methoxypyrazine-2-carboxylic acid. InChI: InChI=1S/C6H6N2O3/c1-11-5-3-7-2-4(8-5)6(9)10/h2-3H,1H3,(H,9,10). | |
| MOF-74 | Alfa Chemistry produces MOF-74 as part of a comprehensive catalog of 2D materials products. We can guide customers through material characterization and selection. Powder and other forms are available upon request. Request a quote to receive pricing information based on your specifications. Molecular formula: C8H4O8Zn2. Mole weight: 358.893 g/mol. Purity: 99.9995% or higher. | |
| MOF&Al-Fum | MOF&Al-Fum. Alternative Names: MIL-53(Al)-FA; A520. | |
| MOF&Aluminum hydroxide isophthalate MOF (CAU-10, Isophthalate:Al=0.9-1.0) | MOF&Aluminum hydroxide isophthalate MOF (CAU-10, Isophthalate:Al=0.9-1.0). Molecular formula: C8H6AlO5. Mole weight: 209.11g/mol. InChI: InChI=1S/C8H6O4.Al.H2O/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H2/q;+2;/p-2. | |
| MOF&Benzenamine, 4, 4', 4'', 4'''- (1, 2- ethenediylidene) tetrakis- | MOF&Benzenamine, 4, 4', 4'', 4'''- (1, 2- ethenediylidene) tetrakis-. | |
| MOF&Benzenemethanamine, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- | MOF&Benzenemethanamine, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)-. | |
| MOF&Benzoic acid, pentaiodo- | MOF&Benzoic acid, pentaiodo-. | |
| MOF&Bis(1,4-diazabicyclo[2.2.2]octane)tetra(copper(I) iodide) (CuI)4(DABCO)2 | MOF&Bis(1,4-diazabicyclo[2.2.2]octane)tetra(copper(I) iodide) (CuI)4(DABCO)2. | |
| MOF&Bis(N,N'-dimethylpiperazine)tetra[copper(I) iodide] | MOF&Bis(N,N'-dimethylpiperazine)tetra[copper(I) iodide]. Molecular formula: C12H28Cu4I4N4. Mole weight: 990.2g/mol. IUPAC Name: 1,4-dimethylpiperazine;iodocopper. InChI: InChI=1S/2C6H14N2.4Cu.4HI/c2*1-7-3-5-8(2)6-4-7;;;;;;;;/h2*3-6H2,1-2H3;;;;;4*1H/q;;4*+1;;;;/p-4. | |
| MOF&COF-42 | MOF&COF-42. | |
| MOF&COF-LZU-1 | MOF&COF-LZU-1. | |
| MOF&Di(1H-pyrrol-2-yl)methane | MOF&Di(1H-pyrrol-2-yl)methane. Molecular formula: C9H10N2. Mole weight: 146.19g/mol. IUPAC Name: 2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole. InChI: InChI=1S/C9H10N2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1-6,10-11H,7H2. | |
| MOF&Diethyl [2,2'-bipyridine]-4,4'-dicarboxylate | MOF&Diethyl [2,2'-bipyridine]-4,4'-dicarboxylate. Molecular formula: C16H16N2O4. Mole weight: 300.31g/mol. IUPAC Name: ethyl 2-(4-ethoxycarbonylpyridin-2-yl)pyridine-4-carboxylate. InChI: InChI=1S/C16H16N2O4/c1-3-21-15(19)11-5-7-17-13(9-11)14-10-12(6-8-18-14)16(20)22-4-2/h5-10H,3-4H2,1-2H3. | |
| MOF&Dipyrido[3,2-a:2',3'-c]phenazine | MOF&Dipyrido[3,2-a:2',3'-c]phenazine. Molecular formula: C18H10N4. Mole weight: 282.3g/mol. IUPAC Name: quinoxalino[2,3-f][1,10]phenanthroline. InChI: InChI=1S/C18H10N4/c1-2-8-14-13(7-1)21-17-11-5-3-9-19-15(11)16-12(18(17)22-14)6-4-10-20-16/h1-10H. | |
| MOF&(E)-1,2-bis(4-(1H-tetrazol-5-yl)phenyl)diazene | MOF&(E)-1,2-bis(4-(1H-tetrazol-5-yl)phenyl)diazene. | |
| MOF&Ethanedione, di-4-pyridinyl- | MOF&Ethanedione, di-4-pyridinyl-. | |
| MOF& HCOF-1 | MOF& HCOF-1. | |
| MOF&Iron azobenzene tetracarboxylic, Porous [PCN-250(Fe)] | MOF&Iron azobenzene tetracarboxylic, Porous [PCN-250(Fe)]. | |
| MOF&Iron(III) 1,3,5-benzenetricarboxylate hydrate, porous (F-free MIL-100(Fe), KRICT F100) [Iron trimesate] | MOF&Iron(III) 1,3,5-benzenetricarboxylate hydrate, porous (F-free MIL-100(Fe), KRICT F100) [Iron trimesate]. Mole weight: 280.98g/mol. IUPAC Name: benzene-1,3,5-tricarboxylate;iron(3+);hydrate. InChI: InChI=1S/C9H6O6.Fe.H2O/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;;/h1-3H,(H,10,11)(H,12,13)(H,14,15);;1H2/q;+3;/p-3. | |
| MOF&MIL-100(Cr) | MOF&MIL-100(Cr). Alternative Names: NA. | |
| MOF&MIL-101(Cr)-SO3H | MOF&MIL-101(Cr)-SO3H. Alternative Names: NA. | |
| MOF&MIL-101(Fe) | MOF&MIL-101(Fe). Alternative Names: NA. | |
| MOF&MIL-125(Ti)-NH | MOF&MIL-125(Ti)-NH. Alternative Names: NA. | |
| MOF&MIL-53(Cr) | MOF&MIL-53(Cr). Alternative Names: NA. | |
| MOF&MIL-53(Fe) | MOF&MIL-53(Fe). Alternative Names: NA. | |
| MOF&MIL-88B(Fe) | MOF&MIL-88B(Fe). Alternative Names: NA. | |
| MOF&MOF-808 | MOF&MOF-808. Alternative Names: NA. | |
| MOF&NH2-MIL-101(Fe) | MOF&NH2-MIL-101(Fe). Alternative Names: NA. | |
| MOF&Pyrene,1,2,3,6,7,8-hexahydro- | MOF&Pyrene,1,2,3,6,7,8-hexahydro-. Molecular formula: C16H16. Mole weight: 208.30g/mol. IUPAC Name: 1,2,3,6,7,8-hexahydropyrene. InChI: InChI=1S/C16H16/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h7-10H,1-6H2. | |
| MOF&Pyridine-2,4,5-triamine | MOF&Pyridine-2,4,5-triamine. Molecular formula: C5H8N4. Mole weight: 124.14g/mol. IUPAC Name: pyridine-2,4,5-triamine. InChI: InChI=1S/C5H8N4/c6-3-1-5(8)9-2-4(3)7/h1-2H,7H2,(H4,6,8,9). | |
| MOF&(silanetetrayltetrakis(benzene-4,1-diyl))tetraphosphonic acid | MOF&(silanetetrayltetrakis(benzene-4,1-diyl))tetraphosphonic acid. | |
| MOF&TpPa-1 | MOF&TpPa-1. | |
| MOF&Trimethyl [2,2':6',2''-terpyridine]-4,4',4''-tricarboxylate | MOF&Trimethyl [2,2':6',2''-terpyridine]-4,4',4''-tricarboxylate. Molecular formula: C21H17N3O6. Mole weight: 407.4g/mol. IUPAC Name: methyl 2,6-bis(4-methoxycarbonylpyridin-2-yl)pyridine-4-carboxylate. InChI: InChI=1S/C21H17N3O6/c1-28-19(25)12-4-6-22-15(8-12)17-10-14(21(27)30-3)11-18(24-17)16-9-13(5-7-23-16)20(26)29-2/h4-11H,1-3H3. | |
| MOF&UIO-66-COOH | MOF&UIO-66-COOH. | |
| MOF&UIO-66-SO3H | MOF&UIO-66-SO3H. Alternative Names: NA. | |
| MOF&ZIF-90 | MOF&ZIF-90. Alternative Names: NA. | |
| MOF&Zirconium, tetra-μ -hydroxytetra-μ -oxohexakis[μ-[[1,1':4',1''-terphenyl]-4,4''-dicarboxylato(2-)-κO4:κO'4]]hexa- | MOF&Zirconium, tetra-μ -hydroxytetra-μ -oxohexakis[μ-[[1,1':4',1''-terphenyl]-4,4''-dicarboxylato(2-)-κO4:κO'4]]hexa-. Alternative Names: NA. | |
| Molecular sieve | Sodium aluminosilicate is a fine white powder. Many ordinary rocks (feldspars) are aluminosilicates. Aluminosilicates with more open three-dimensional structures than the feldspars are called zeolites. The openings in zeolites appear as polyhedral cavities connected by tunnels. Zeolites act as catalysts by absorbing small molecules in their interior cavities and holding them in proximity so that reaction among them occurs sooner.;DryPowder; DryPowder, OtherSolid; OtherSolid; PelletsLargeCrystals. Alternative Names: CRYSTALLINE SODIUM POTASSIUM ALUMINOSILICATE;HYDRANAL(R)-MOLECULAR SIEVE;ALUMINUM SODIUM SILICATE;ALUMINUM CALCIUM SODIUM SILICATE;SODIUM ALUMINIUM SILICATE;SODIUM ALUMINOSILICATE;SODIUM ALUMINUM SILICATE;P 820 A. CAS No. 1344-00-9. Molecular formula: AlNaO6Si2. Mole weight: 202.14g/mol. IUPAC Name: aluminum;sodium;dioxido(oxo)silane. SMILES: [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3]. InChI: InChI=1S/Al.Na.2O3Si/c;;2*1-4(2)3/q+3;+1;2*-2. | |
| Molybdenum boride | Molybdenum boride. Alternative Names: 5584AF; Molybdenum boride, powder, -325 mesh, 99.5% trace metals basis; 12006-98-3; Molybdenum boride (MoB); I14-55281; Molybdenum monoboride; EINECS 234-492-5; I14-99008. CAS No. 12006-98-3. Molecular formula: BMo. Mole weight: 106.76g/mol. IUPAC Name: boranylidynemolybdenum. SMILES: B#[Mo]. InChI: InChI=1S/B.Mo. | |
| Molybdenum disilicide | Molybdenum disilicide. CAS No. 12136-78-6. Molecular formula: MoSi2. Mole weight: 152.1g/mol. SMILES: [Si]=[Mo]=[Si]. InChI: InChI=1S/Mo.2Si. | |
| Molybdenum disulfide quantum dots | Molybdenum disulfide quantum dots. | |
| Molybdenum oxide nanoparticle ink | Solid content: 2.3 - 2.7wt% crystalline MoO3 in ethanol. Alternative Names: MoO3 Dispersion,MoO3 ink,MoO3 nanoparticle ink,MoO3 suspension. | |
| Molybdenum silicide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.250in) thick, 99.5% (metals basis) | Molybdenum silicide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.250in) thick, 99.5% (metals basis). CAS No. 12136-78-6. Molecular formula: MoSi2. Mole weight: 152.1g/mol. SMILES: [Si]=[Mo]=[Si]. InChI: InChI=1S/Mo.2Si. | |
| Monolayer Graphene Powder Chemical method | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, Other | |
| mono-Methyl cis-5-norbornene-endo-2,3-dicarboxylate | mono-Methyl cis-5-norbornene-endo-2,3-dicarboxylate. Alternative Names: MONO-METHYL CIS-5-NORBORNENE-ENDO-2,3-DICARBOXYLATE;mono-Methyl cis-5-norbornene-endo-2,3-dicarboxylate 95%. CAS No. 96185-91-0. Molecular formula: C10H12O4. Mole weight: 196.2. Purity: 96%. IUPAC Name: 2-amino-3-(1H-imidazol-5-yl)propanoic acid. SMILES: [H]C1(C2CC(C=C2)C1([H])C(=O)OC)C(O)=O. InChI: 1S/C10H12O4/c1-14-10(13)8-6-3-2-5(4-6)7(8)9(11)12/h2-3,5-8H,4H2,1H3,(H,11,12)/t5-,6+,7-,8+/m1/s1. | |
| Mononuclear water-soluble CdTe quantum dots (carboxy amino modification) | Mononuclear water-soluble CdTe quantum dots (carboxy amino modification). | |
| MoS2 single-layer quantum dot powder | MoS2 single-layer quantum dot powder. | |
| MoS2 single-layer quantum dot solution | MoS2 single-layer quantum dot solution. | |
| MoSe2 Crystal | MoSe2 Crystal. Alternative Names: MOLYBDENUM SELENIDE;MOLYBDENUM (IV) SELENIDE;molybdenum diselenide;Molybdenum(IV)selenide(99.9%-Mo);MOLYBDENUM(IV) SELENIDE: 99.9%;Molybdenum(IV) selenide, 99.9% (metals basis);Molydenum selenide;Nsc378344. CAS No. 12058-18-3. Molecular formula: MoSe2;MoSe2. Mole weight: 253.9g/mol. Purity: 99.995%. IUPAC Name: bis(selanylidene)molybdenum. SMILES: [Se]=[Mo]=[Se]. InChI: InChI=1S/Mo.2Se. | |
| MoSe2 single-layer quantum dot powder | MoSe2 single-layer quantum dot powder. | |
| MoSe2 single-layer quantum dot solution | MoSe2 single-layer quantum dot solution. | |
| MPDDA | MPDDA. Mole weight: 226. | |
| M-Terphenyl | M-terphenyl is a yellow solid. mp: 86-87° C, bp: 365°C. Density: 1.195 g/cm³. Insoluble in water. Usually shipped as a solid mixture with its isomers o-terphenyl and p-terphenyl that is used as a heat-transfer fluid.;Colorless or light-yellow solid.;Yellow solid (needles). Alternative Names: m-Diphenylbenzene. CAS No. 92-06-8. Molecular formula: C18H14. Mole weight: 230.3. Purity: 99%. IUPAC Name: 1,3-Diphenylbenzene. SMILES: C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC=C3. InChI: InChI=1S/C18H14/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-14H. | |
| Mullite | DryPowder; OtherSolid; PelletsLargeCrystals. Alternative Names: mullite(al6o5(sio4)2);MULLIT;MULLITE;ALUMINUM OXIDE-SILICON OXIDE;ALUMINUM SILICATE, POWDER;92700, MULLITE (LATTICE SPACING, OTHER P;MULLITE, LATTICE SPACING AND OTHER PARAMETERS(CRM STANDARD);REFRACTORYMULLITEFIBRE. CAS No. 1302-93-8. Molecular formula: Al6O13Si2;Al6O13Si2. Mole weight: 426.05g/mol. IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane. SMILES: O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Si]=O.O=[Si]=O. InChI: InChI=1S/6Al.2O2Si.9O/c;;;;;;2*1-3-2;;;;;;;; | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.