Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Magnesium phosphate hydrate | Magnesium phosphate hydrate. Alternative Names: Phosphoric acid, magnesium salt (2:3), hydrate. CAS No. 53408-95-0. Molecular formula: H2Mg3O9P2. Mole weight: 280.87. Purity: 99%+. IUPAC Name: Trimagnesium;diphosphate;hydrate. SMILES: O.[O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Mg+2].[Mg+2].[Mg+2]. InChI: InChI=1S/3Mg.2H3O4P.H2O/c;2*1-5(2,3)4;/h;2*(H3,1,2,3,4);1H2/q3*+2;/p-6. |  |
| Magnesium sulfate | Magnesium sulfate is an inorganic salt (chemical compound) containing magnesium, sulfur and oxygen, with the formula MgSO4.It is often encountered as the heptahydrate sulfate mineral epsomite (MgSO4·7H2O), commonly called Epsom salt, taking its name from a bitter saline spring in Epsom in Surrey, England, where the salt was produced from the springs that arise where the porous chalk of the North Downs meets non-porous London clay. The monohydrate, MgSO4·H2O is found as the mineral kieserite. The overall global annual usage in the mid-1970s of the monohydrate was 2.3 million tons, of which the majority was used in agriculture.Anhydrous magnesium sulfate is used as a drying agent. The anhydrous form is hygroscopic (readily absorbs water from the air) and is therefore difficult to weigh accurately; the hydrate is often preferred when preparing solutions (for example, in medical preparations). Epsom salt has been traditionally used as a component of bath salts. Epsom salt can also be used as a beauty product. Athletes use it to soothe sore muscles, while gardeners use it to improve crops. Alternative Names: Magnesium sulfate anhydrous. CAS No. 7487-88-9. Molecular formula: MgO4S. Mole weight: 120.37. Purity: 99%+. IUPAC Name: Magnesium;sulfate. SMILES: [O-]S(=O)(=O)[O-].[Mg+2]. InChI: InChI=1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2. | |
| Magnesium sulfate monohydrate | PelletsLargeCrystals. Alternative Names: Magnesium sulphate hydrate. CAS No. 14168-73-1. Molecular formula: H2MgO5S. Mole weight: 138.39. Purity: 99%+. IUPAC Name: Magnesium;sulfate;hydrate. SMILES: O.[O-]S(=O)(=O)[O-].[Mg+2]. InChI: InChI=1S/Mg.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+2;/p-2. | |
| Magnesium tungstate(vi) | Magnesium tungstate(vi). Alternative Names: Magnesium wolframate,of a kind used as a luminophore; AC1MJ20U; CTK8G0719; EINECS 236-999-7; Magnesium tungsten oxide (MgWO4); magnesium dioxido(dioxo)tungsten; AC1NQILX; Magnesium tungstate(VI); Magnesium tungstate. CAS No. 13573-11-0. Molecular formula: MgO4W. Purity: 99%. IUPAC Name: magnesium dioxido(dioxo)tungsten. SMILES: [O-][W](=O)(=O)[O-].[Mg+2]. | |
| Malonic acid | The common technique for producing malonic acid is from chloroacetic acid.Malonic acid undergoes thermal decarboxylation at temperatures of 135-137oC.2. Alternative Names: Propane-1,3-dioic acid. CAS No. 141-82-2. Molecular formula: C3H4O4. Mole weight: 104.06. Purity: 99%. IUPAC Name: Propanedioic acid. SMILES: C(C(=O)O)C(=O)O. InChI: InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7). | |
| Maltodextrin | Maltodextrin is a carbohydrate derived from starch. Alternative Names: Dextrin maize starch. CAS No. 9050-36-6. Molecular formula: C12H22O11. Mole weight: 342.3. Purity: 98%. | |
| Manganese(0) carbonyl | Manganese(0) carbonyl. Alternative Names: Decacarbonyl dimanganese(0), Dimanganese(0) decacarbonyl. CAS No. 10170-69-1. Molecular formula: Mn2(CO)10. Mole weight: 389.98. IUPAC Name: carbon monoxide;manganese. SMILES: [Mn].[Mn].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+]. InChI: 1S/10CO.2Mn/c10*1-2;;,QFEOTYVTTQCYAZ-UHFFFAOYSA-N. | |
| Manganese(II)acetate tetrahydrate | Manganese(II)acetate tetrahydrate. Alternative Names: Aceticacid,manganese(2+)salt,tetrahydrate;Manganesediacetate,tetrahydrate;MANGANOUS ACETATE TETRAHYDRATE;MANGANESE(II) ACETATE;MANGANESE(II) ACETATE-4-HYDRATE;MANGANESE (II) ACETATE, HYDROUS;MANGANESE(II) ACETATE TETRAHYDRATE;MANGANESE(+2)ACETATE TETRAHYD. CAS No. 6156-78-1. Molecular formula: C4H14MnO8. Mole weight: 245.09g/mol. IUPAC Name: manganese(2+);diacetate;tetrahydrate. SMILES: CC(=O)[O-].CC(=O)[O-].O.O.O.O.[Mn+2]. InChI: InChI=1S/2C2H4O2.Mn.4H2O/c2*1-2(3)4;;;;;/h2*1H3,(H,3,4);;4*1H2/q;;+2;;;;/p-2. | |
| Manganese(II) chloride | Manganese(II) chloride. Alternative Names: manganese-chloride; Manganese (II) chloride; CTK0H1763; Manganese(II) chloride, 97%; AKOS015904562; ACMC-20akkt; DTXSID9040681; TR-037793; Manganese(II) chloride, 99+%, anhydrous, -80 mesh; Manganous chloride,anhydrous. CAS No. 7773-1-5. Molecular formula: MnCl2;Cl2Mn. Mole weight: 125.838g/mol. IUPAC Name: manganese(2+);dichloride. SMILES: [Cl-].[Cl-].[Mn+2]. InChI: InChI=1S/2ClH.Mn/h2*1H;/q;;+2/p-2. | |
| Manganese(II)cyclohexanebutyrate | Manganese(II)cyclohexanebutyrate. Alternative Names: MANGANOUS CYCLOHEXANEBUTYRATE;MANGANESE CYCLOHEXANEBUTYRATE;MANGANESE(II) CYCLOHEXANEBUTYRATE;cyclohexanebutanoicacid,manganese(2++)salt;manganese hydrogen cyclohexanebutyrate;MANGANESE (II) CYCLOHEXANEBUTYRATE (AAS);Cyclohexanebutyric acid manganese salt. CAS No. 35542-88-2. Molecular formula: C20H34MnO4. Mole weight: 393.4g/mol. IUPAC Name: 4-cyclohexylbutanoate;manganese(2+). SMILES: C1CCC(CC1)CCCC(=O)[O-].C1CCC(CC1)CCCC(=O)[O-].[Mn+2]. InChI: InChI=1S/2C10H18O2.Mn/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12);/q;;+2/p-2. | |
| Manganese(II)hexafluoroacetylacetonate& | Manganese(II)hexafluoroacetylacetonate&. Alternative Names: manganese(II) hexafluoroacetylacetonate trihydrat;Manganese(II) hexafluoro-2,4-pentanedionate trihydrate, 97%. CAS No. 123334-26-9. Molecular formula: C10H8F12MnO7. Mole weight: 523.08g/mol. IUPAC Name: 1,1,1,5,5,5-hexafluoropentane-2,4-dione;manganese(2+);trihydrate. SMILES: [CH-](C(=O)C(F)(F)F)C(=O)C(F)(F)F.[CH-](C(=O)C(F)(F)F)C(=O)C(F)(F)F.O.O.O.[Mn+2]. InChI: InChI=1S/2C5HF6O2.Mn.3H2O/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;;;;/h2*1H;;3*1H2/q2*-1;+2;; | |
| Manganese(III) fluoride | Manganese(III) fluoride. Alternative Names: Manganese trifluoride. CAS No. 7783-53-1. Molecular formula: MnF3. Mole weight: 111.93. Purity: 99%+. IUPAC Name: Trifluoromanganese. SMILES: F[Mn](F)F. InChI: InChI=1S/3FH.Mn/h3*1H;/q;+3/p-3. | |
| Manganese(III) oxide | Manganese(III) oxide. CAS No. 1317-34-6. Molecular formula: Mn2O3;Mn2O3. Mole weight: 157.874g/mol. IUPAC Name: oxo(oxomanganiooxy)manganese. SMILES: O=[Mn]O[Mn]=O. InChI: InChI=1S/2Mn.3O. | |
| Manganese(II)nitrate hydrate | Manganese(II)nitrate hydrate. Alternative Names: MANGANESE(II) NITRATE;MANGANESE(II) NITRATE HYDRATE;Manganese(II) nitrate hydrate, 99.99% metals basis;MANGANESE (II) NITRATE, PURATRONIC, 99.999% (METALS BASIS);Manganese(II) nitrate hydrate, 99.999%;Nitric acid, manganese(2+) salt, hydrate;manganese(II). CAS No. 15710-66-4. Molecular formula: H2MnN2O7. Mole weight: 196.96g/mol. IUPAC Name: manganese(2+);dinitrate;hydrate. SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.[Mn+2]. InChI: InChI=1S/Mn.2NO3.H2O/c;2*2-1(3)4;/h;;;1H2/q+2;2*-1. | |
| Manganese(II) oxide | DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals. CAS No. 1344-43-0. Molecular formula: MnO;MnO. Mole weight: 70.937g/mol. IUPAC Name: oxomanganese. SMILES: O=[Mn]. InChI: InChI=1S/Mn.O. | |
| Manganese(II)perchlorate hydrate,99% | Manganese(II)perchlorate hydrate,99%. Alternative Names: Manganese(II) perchlorate hydrate 99%. CAS No. 698999-57-4. Molecular formula: Cl2H2MnO9. Mole weight: 271.85g/mol. IUPAC Name: manganese(2+);diperchlorate;hydrate. SMILES: O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Mn+2]. InChI: InChI=1S/2ClHO4.Mn.H2O/c2*2-1(3,4)5;;/h2*(H,2,3,4,5);;1H2/q;;+2;/p-2. | |
| Manganese triacetate dihydrate | Manganese triacetate dihydrate. Alternative Names: Manganese(III) acetate dihydrate. CAS No. 19513-05-4. Molecular formula: C6H13MnO8. Mole weight: 268.1. Purity: 95%+. IUPAC Name: Manganese(3+);triacetate;dihydrate. SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].O.O.[Mn+3]. InChI: InChI=1S/3C2H4O2.Mn.2H2O/c3*1-2(3)4;/h3*1H3,(H,3,4);2*1H2/q;+3;/p-3. | |
| Mattiflux Flux Powder | Mattiflux Flux Powder. | |
| m-Carborane | m-Carborane. Alternative Names: 1,7-DICARBADODECARBORANE(12);M-CARBORANE;1,7-Dicarba-closo-dodecaboran;1,7-Dicarba-closo-dodecaborane(12);1,7-Dicarbadodecaboran;1,7-Dicarbadodecaboran(12);1,7-Dicarbadodecaborane;1,7-dicarbadodecaborane(12). CAS No. 16986-24-6. Molecular formula: C2H2B10. Mole weight: 134.2g/mol. Purity: N/A. SMILES: [B]1[B][B][B][B]C2[B]C([B]2)[B][B][B]1. InChI: InChI=1S/C2H2B10/c3-1-4-2(3)6-8-10-12-11-9-7-5-1/h1-2H. | |
| MCM-22 | MCM-22. CAS No. 12173-28-3. | |
| MCM-41 | MCM-41. CAS No. 12173-28-3. | |
| MDMO-PPV | MDMO-PPV is a dialkoxy substituted poly(p-phenylenevinylene) (PPV) based conjugating polymer which has long side chains that form flexible films for organic electronics. It is a piezoresistant polymer with HOMO and LUMO orbital positions at 5.4 and 3.4 eV, respectively. MDMO-PPV forms an active layer that can be used in photoconductive and electroluminescent applications. Alternative Names: Poly[2-methoxy-5-(3',7'-dimethyloctyloxy)-1,4-phenylenevinylene]. CAS No. 177716-59-5. Molecular formula: C21H23ClFNO2. Mole weight: Mn ~120,000. IUPAC Name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one. SMILES: COc1ccc(OCCC(C)CCCC(C)C)cc1C=C. InChI: InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2. | |
| Mechanical exfoliation WS2 on Al2O3 | Dull gray powder or hard, brittle, steel-gray to white metal. Difficult to melt. Mp: 3410°C; bp; 5900°C. Density: 19.3 g/cm³. Used in alloys, light bulb filaments, and cutting tools. Tungsten Dust (for example, from grinding) may present a moderate fire hazard if allowed to accumulate and exposed to an ignition source.;DryPowder; DryPowder, OtherSolid; OtherSolid;GREY-TO-WHITE POWDER.;Physical properties vary depending upon the specific soluble tungsten compound.;Hard, brittle, steel-gray to tin-white solid. CAS No. 7440-33-7. Molecular formula: W. Mole weight: 183.8g/mol. IUPAC Name: tungsten. SMILES: [W]. InChI: InChI=1S/W. | |
| Mechanical exfoliation WS2 on sapphire substrate | Dull gray powder or hard, brittle, steel-gray to white metal. Difficult to melt. Mp: 3410°C; bp; 5900°C. Density: 19.3 g/cm³. Used in alloys, light bulb filaments, and cutting tools. Tungsten Dust (for example, from grinding) may present a moderate fire hazard if allowed to accumulate and exposed to an ignition source.;DryPowder; DryPowder, OtherSolid; OtherSolid;GREY-TO-WHITE POWDER.;Physical properties vary depending upon the specific soluble tungsten compound.;Hard, brittle, steel-gray to tin-white solid. CAS No. 7440-33-7. Molecular formula: W. Mole weight: 183.8g/mol. IUPAC Name: tungsten. SMILES: [W]. InChI: InChI=1S/W. | |
| Mechanical exfoliation WS2 on SiO2 | Dull gray powder or hard, brittle, steel-gray to white metal. Difficult to melt. Mp: 3410°C; bp; 5900°C. Density: 19.3 g/cm³. Used in alloys, light bulb filaments, and cutting tools. Tungsten Dust (for example, from grinding) may present a moderate fire hazard if allowed to accumulate and exposed to an ignition source.;DryPowder; DryPowder, OtherSolid; OtherSolid;GREY-TO-WHITE POWDER.;Physical properties vary depending upon the specific soluble tungsten compound.;Hard, brittle, steel-gray to tin-white solid. CAS No. 7440-33-7. Molecular formula: W. Mole weight: 183.8g/mol. IUPAC Name: tungsten. SMILES: [W]. InChI: InChI=1S/W. | |
| Mechanical exfoliation WSe2 on Al2O3 | Dull gray powder or hard, brittle, steel-gray to white metal. Difficult to melt. Mp: 3410°C; bp; 5900°C. Density: 19.3 g/cm³. Used in alloys, light bulb filaments, and cutting tools. Tungsten Dust (for example, from grinding) may present a moderate fire hazard if allowed to accumulate and exposed to an ignition source.;DryPowder; DryPowder, OtherSolid; OtherSolid;GREY-TO-WHITE POWDER.;Physical properties vary depending upon the specific soluble tungsten compound.;Hard, brittle, steel-gray to tin-white solid. CAS No. 7440-33-7. Molecular formula: W. Mole weight: 183.8g/mol. IUPAC Name: tungsten. SMILES: [W]. InChI: InChI=1S/W. | |
| Mechanical exfoliation WSe2 on sapphire substrate | Dull gray powder or hard, brittle, steel-gray to white metal. Difficult to melt. Mp: 3410°C; bp; 5900°C. Density: 19.3 g/cm³. Used in alloys, light bulb filaments, and cutting tools. Tungsten Dust (for example, from grinding) may present a moderate fire hazard if allowed to accumulate and exposed to an ignition source.;DryPowder; DryPowder, OtherSolid; OtherSolid;GREY-TO-WHITE POWDER.;Physical properties vary depending upon the specific soluble tungsten compound.;Hard, brittle, steel-gray to tin-white solid. CAS No. 7440-33-7. Molecular formula: W. Mole weight: 183.8g/mol. IUPAC Name: tungsten. SMILES: [W]. InChI: InChI=1S/W. | |
| MEH-PPV | Conducting polymer in solar cells and carbon nanotube OLEDs. Useful in producing bright and efficient white polymeric light emitting diodes. Filter before application. Alternative Names: MEH-PPV, Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene]. CAS No. 138184-36-8. Molecular formula: (C18H28O2)n. | |
| Mesoporous silica coated upconversion nanoparticles (violet blue light) | Mesoporous silica coated upconversion nanoparticles (violet blue light). | |
| Mesoporous silica coated upconversion nanoparticles (yellow-green light) | Mesoporous silica coated upconversion nanoparticles (yellow-green light). | |
| Mesoporous SiO2 coated Upconverting Nanoparticles(Purple blue light) | Mesoporous SiO2 coated Upconverting Nanoparticles(Purple blue light). | |
| Mesoporous SiO2 coated Upconverting Nanoparticles(UV light) | Mesoporous SiO2 coated Upconverting Nanoparticles(UV light). | |
| Mesoporous SiO2 coated Upconverting Nanoparticles(Yellow green light) | Mesoporous SiO2 coated Upconverting Nanoparticles(Yellow green light). | |
| Meso-Tetra(4-carboxyphenyl)porphine | Meso-Tetra(4-carboxyphenyl)porphine. Alternative Names: 4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis-benzoicacid. CAS No. 14609-54-2. Molecular formula: C48H30N4O8. Mole weight: 790.77. Purity: 97%. IUPAC Name: 4-[10,15,20-tris(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoicacid. SMILES: C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=C(C=C9)C(=O)O)N3)C(=O)O. InChI: InChI=1S/C48H30N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60). | |
| MESO-Tetra(4-carboxyphenyl)porphine ferric chloride TCPP-Fe(3+) | MESO-Tetra(4-carboxyphenyl)porphine ferric chloride TCPP-Fe(3+). CAS No. 55266-17-6. | |
| Meso-Tetra(4-cyanobenzyl)porphine | Meso-Tetra(4-cyanobenzyl)porphine. Alternative Names: 5,10,15,20-Tetra(4-cyanophenyl)porphyrin; 4,4',4'',4'''-(Porphyrin-5,10,15,20-tetrayl)tetrabenzonitrile. CAS No. 14609-51-9. Molecular formula: C48H26N8. Mole weight: 714.77. Purity: 95%+. | |
| meso-Tetrakis(2-pyridyl)porphine | meso-Tetrakis(2-pyridyl)porphine. Alternative Names: TPyP(2)?. CAS No. 40904-90-3. Molecular formula: C40H26N8. Mole weight: 618.69. Purity: 95%. | |
| meso-Tetrakis(4-formylphenyl)porphyrin | meso-Tetrakis(4-formylphenyl)porphyrin. CAS No. 150805-46-2. Mole weight: white powder. | |
| meso-Tetrakis(p-sulfophenyl)porphine tetrasodium salt | meso-Tetrakis(p-sulfophenyl)porphine tetrasodium salt. Alternative Names: 5,10,15,20-Tetrakis(4-Sodiosulfophenyl)-21H,23H-Porphyrin. CAS No. 39050-26-5. Molecular formula: C44H30N4O12S4Na4. Mole weight: 1239.10. Purity: 98%. IUPAC Name: tetrasodium;4-[10,15,20-tris(4-sulfonatophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonate. InChI: InChI=1S/C44H30N4O12S4.4Na/c49-61(50,51)29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(12-4-26)62(52,53)54)37-21-23-39(47-37)44(28-7-15-32(16-8-28)64(58,59)60)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(14-6-27)63(55,56)57;;;;/h1-24,45,48H,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60);;;;/q;4*+1/p-4. | |
| Metaboric acid | Metaboric acid. Alternative Names: METABORIC ACID;BHO2;Boric acid (HBO2);boricacid(hbo2);HBO2;Hydroxyoxoboron;Metaboric acid 99%. CAS No. 13460-50-9. Molecular formula: BHO2. Mole weight: 43.82g/mol. IUPAC Name: oxoborinic acid. SMILES: B(=O)O. InChI: InChI=1S/BHO2/c2-1-3/h2H. | |
| Methoxy(2EO)ethylene Glycol Acrylate | Methoxy(2EO)ethylene Glycol Acrylate. | |
| Methoxy (2EO)Ethylene Glycol Methacrylate | Methoxy (2EO)Ethylene Glycol Methacrylate. | |
| Methoxymethyltrimethylsilane | Methoxymethyltrimethylsilane. Alternative Names: Trimethylsilylmethyl Methyl Ether. CAS No. 14704-14-4. Molecular formula: C5H14OSi. Mole weight: 118.25 g/mol. Purity: >95%. IUPAC Name: methoxymethyl(trimethyl)silane. SMILES: COC[Si](C)(C)C. | |
| Methoxy Polyethylene Glycol 350 Monomethacrylate | Methoxy Polyethylene Glycol 350 Monomethacrylate. | |
| Methoxy Polyethylene Glycol 550 Monomethacrylate | Methoxy Polyethylene Glycol 550 Monomethacrylate. | |
| Methyl 2-hydroxyethyl cellulose | The polymer product is a polymer that is derived from natural sources, with or without chemical modification. Alternative Names: HYDROXYETHYL METHYL CELLULOSE;CELLULOSE METHYL HYDROXYETHYL ETHER;METHYL HYDROXYETHYL CELLULOSE;METHYL 2-HYDROXYETHYL CELLULOSE;Cellulose,2-hydroxyethylmethylether;Hydroxythyl Methyl Cellulose;HydroxythylMethylCellulose(Hemc). CAS No. 9032-42-2. Molecular formula: C34H66O24. Mole weight: 858.9g/mol. IUPAC Name: ethane-1,2-diol;(2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[(2S,3R,4S,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;(2S,3S,4R,5S,6S)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2R,3S,4R,5S,6S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane. SMILES: COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC.C(CO)O.C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O. InChI: InChI=1S/C20H38O11.C12H22O11.C2H6O2/c1-21-9-11-13(23-3)15(24-4)18(27-7)20(30-11)31-14-12(10-22-2)29-19(28-8)17(26-6)16(14)25-5;13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17;3-1-2-4/h11-20H,9-10H2,1-8H3;3-20H,1-2H2;3-4H,1-2H2/t11-,12-,13-,14-,15+,16+,17-,18-,19-,20+;3-,4-,5-,6+,7-,8-,9-,10-,11-,12+;/m00./s1. | |
| Methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate | Methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate. Alternative Names: METHYL 8,9,10-TRINORBORNA-5-ENE-2-CARBOXYLATE;METHYL BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXYLATE;METHYL 5-NORBORNENE-2-CARBOXYLATE;BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXYLIC ACID METHYL ESTER;8,9,10-TRINORBORNA-5-ENE-2-CARBOXYLIC ACID METHYL ESTER;5-NORBORNENE-2-CA. CAS No. 6203-8-3. Molecular formula: C9H12O2. Mole weight: 152.19g/mol. IUPAC Name: methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate. SMILES: COC(=O)C1CC2CC1C=C2. InChI: InChI=1S/C9H12O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3. | |
| Methyl Cellulose | Methyl cellulose is a methyl ether derivative of cellulose - the main component of plant cell walls. It is a white, odorless, and tasteless powder that is soluble in cold water but insoluble in hot water. Methyl cellulose is used in the food industry as a thickener, stabilizer, and emulsifier. It is also used in construction, as a binder in wall coatings and cement, and in pharmaceuticals as a substitute for gelatin in capsule formulations. In addition, methyl cellulose is used in the cosmetics industry as an ingredient in shampoos, hair conditioners, and other hair care products, as well as in personal lubricants and artificial tears. Alternative Names: MODIFIED CELLULOSE;MODIFIED CELLULOSE, MC;TYLOSE(R) MH 300;TYLOSE(R) MH 1000;adulsin;bagolax;bufaptomethalose;bulkaloid. CAS No. 9004-67-5. Molecular formula: C29H54O16. Mole weight: 454.5g/mol. IUPAC Name: (5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane. SMILES: COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC. InChI: InChI=1S/C20H38O11/c1-21-9-11-13(23-3)15(24-4)18(27-7)20(30-11)31-14-12(10-22-2)29-19(28-8)17(26-6)16(14)25-5/h11-20H,9-10H2,1-8H3/t11?,12?,13?,14-,15?,16?,17?,18?,19?,20+/m1/s1. | |
| Methyl methacrylate crosspolymer | Methyl methacrylate crosspolymer. Alternative Names: METHYL METHACRYLATE CROSSPOLYMER;POLY(METHYL METHACRYLATE-CO-ETHYLENE GLY COL DIMETHACRYLATE), 20 MICRON;POLY(METHYL METHACRYLATE-CO-ETHYLENE GLY COL DIMETHACRYLATE), 50 MICRON;POLY(METHYL METHACRYLATE-CO-ETHYLENE GLY COL DIMETHACRYLATE), 8 MICRON;2-Prope. CAS No. 25777-71-3. Molecular formula: C15H22O6. Mole weight: 298.33g/mol. IUPAC Name: methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OC.CC(=C)C(=O)OCCOC(=O)C(=C)C. InChI: InChI=1S/C10H14O4.C5H8O2/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-4(2)5(6)7-3/h1,3,5-6H2,2,4H3;1H2,2-3H3. | |
| Methyl-PEG3-bromide | Methyl-PEG3-bromide. CAS No. 72593-77-2. Molecular formula: C7H15BrO3. Mole weight: 227.1g/mol. Purity: 95%+. IUPAC Name: 1-[2-(2-bromoethoxy)ethoxy]-2-methoxyethane. SMILES: COCCOCCOCCBr. InChI: InChI=1S/C7H15BrO3/c1-9-4-5-11-7-6-10-3-2-8/h2-7H2,1H3. | |
| Methylterephthalic acid | Methylterephthalic acid. CAS No. 5156-1-4. Molecular formula: C9H8O4. Mole weight: 180.16g/mol. IUPAC Name: 2-methylterephthalic acid. InChI: InChI=1S/C9H8O4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13). | |
| Methyltin trichloride | DryPowder; Liquid. Alternative Names: methyl-titrichloride;methyltrichloro-stannan;methyltrichlorostannane;monomethyltintrichloride;trichloromethyl-stannan;trichloromethyltin;METHYLTRICHLOROTIN;METHYLTIN TRICHLORIDE. CAS No. 993-16-8. Molecular formula: CH3Cl3Sn. Mole weight: 240.1g/mol. IUPAC Name: trichloro(methyl)stannane. SMILES: C[Sn](Cl)(Cl)Cl. InChI: InChI=1S/CH3.3ClH.Sn/h1H3;3*1H;/q;;;;+3/p-3. | |
| Methyltris(Trimethylsiloxy)Silane | Methyltris(Trimethylsiloxy)Silane. Alternative Names: 1,1,1,3,5,5,5-Heptamethyl-3-(trimethylsilyloxy)trisiloxane. CAS No. 17928-28-8. Molecular formula: C10H30O3Si4. Mole weight: 310.69 g/mol. Purity: 95%+. IUPAC Name: trimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilane. SMILES: C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C. | |
| Methyl vinyl ether-monoethyl maleate copolymer | Methyl vinyl ether-monoethyl maleate copolymer. Alternative Names: POLY(METHYL VINYL ETHER-ALT-MALEIC ACID MONOETHYL ESTER);VINYL METHYL ETHER-MONOETHYL MALEATE;2-butenedioicacid(z)-,monoethylester,polymerwithmethoxyethane;2-Butenedioicacid(Z)-,monoethylester,polymerwithmethoxyethene;ethylesterofpvm/macopolymer;poly(mety. CAS No. 25087-06-3. Molecular formula: C9H14O5. Mole weight: 202.2g/mol. IUPAC Name: (Z)-4-ethoxy-4-oxobut-2-enoic acid;methoxyethene. SMILES: CCOC(=O)C=CC(=O)O.COC=C. InChI: InChI=1S/C6H8O4.C3H6O/c1-2-10-6(9)4-3-5(7)8;1-3-4-2/h3-4H,2H2,1H3,(H,7,8);3H,1H2,2H3/b4-3-. | |
| Misch Metal, 99.0% min. rare earth content | Misch Metal, 99.0% min. rare earth content. CAS No. 62379-61-7. Molecular formula: CeLaNdPr. Mole weight: 564.17g/mol. IUPAC Name: cerium;lanthanum;neodymium;praseodymium. SMILES: [La].[Ce].[Pr].[Nd]. InChI: InChI=1S/Ce.La.Nd.Pr. | |
| Misch Metal, 99.8% min. rare earth content, trapezoidal ingot, dry | Misch Metal, 99.8% min. rare earth content, trapezoidal ingot, dry. CAS No. 62379-61-7. Molecular formula: CeLaNdPr. Mole weight: 564.17g/mol. IUPAC Name: cerium;lanthanum;neodymium;praseodymium. SMILES: [La].[Ce].[Pr].[Nd]. InChI: InChI=1S/Ce.La.Nd.Pr. | |
| Mn3O4/graphene nanocomposite | Mn3O4/graphene nanocomposite. | |
| Mn3O4/reduced graphene oxide nanocomposite | Mn3O4/reduced graphene oxide nanocomposite. | |
| Modified Epoxy Acrylate | Modified Epoxy Acrylate. | |
| MOF | MOF. Mole weight: white powder. | |
| MOF&1,1',1'',1'''-ethene-1,1,2,2-tetrayltetrakis(4-methylbenzene) | MOF&1,1',1'',1'''-ethene-1,1,2,2-tetrayltetrakis(4-methylbenzene). | |
| MOF&1,1':2',1''-Terphenyl, 4,4''-dibromo-3',4',5',6'-tetrakis(4-bromophenyl)- | MOF&1,1':2',1''-Terphenyl, 4,4''-dibromo-3',4',5',6'-tetrakis(4-bromophenyl)-. | |
| MOF&1,1',2,2'-tetrakis(4-bromophenyl)ethene | MOF&1,1',2,2'-tetrakis(4-bromophenyl)ethene. | |
| MOF&1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene | MOF&1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene. | |
| MOF&1,1'-(5'-(4-acetylphenyl)-[1,1':3',1''-terphenyl]-4,4''-diyl)diethanone | MOF&1,1'-(5'-(4-acetylphenyl)-[1,1':3',1''-terphenyl]-4,4''-diyl)diethanone. | |
| MOF&[1,1'-Binaphthalene]-2,2'-diamine | MOF&[1,1'-Binaphthalene]-2,2'-diamine. Molecular formula: C20H16N2. Mole weight: 284.4g/mol. IUPAC Name: 1-(2-aminonaphthalen-1-yl)naphthalen-2-amine. InChI: InChI=1S/C20H16N2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12H,21-22H2. | |
| MOF&[1,1-bis(4-N,N-dimethylphenyl)-2,2-bis(4-bromophenyl)]ethylene | MOF&[1,1-bis(4-N,N-dimethylphenyl)-2,2-bis(4-bromophenyl)]ethylene. | |
| MOF&1,1-diphenyl-2,2-di(4-bromomethyl-phenyl)ethylene | MOF&1,1-diphenyl-2,2-di(4-bromomethyl-phenyl)ethylene. | |
| MOF&1,1-diphenyl-2,2-di(p-bromophenyl)ethylene | MOF&1,1-diphenyl-2,2-di(p-bromophenyl)ethylene. | |
| MOF&1,2-Benzenedicarbonitrile, 4,5-diamino- | MOF&1,2-Benzenedicarbonitrile, 4,5-diamino-. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.