Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Graphite | Graphite. Alternative Names: aerodagg;ag1500;as1;at20;atj-s;atj-sgraphite;Black lead;blacklead. CAS No. 7782-42-5. Molecular formula: C. Mole weight: 288.26. Purity: > 99.99%. IUPAC Name: methane. SMILES: [C]. |  |
| Graphite adhesive, alcohol based | Graphite adhesive, alcohol based. | |
| Graphite adhesive, aqueous based | Graphite adhesive, aqueous based. | |
| Graphite, colloidal, lubricant, aerosol spray | Graphite, colloidal, lubricant, aerosol spray. | |
| Graphite conductive adhesive, alcohol based | Graphite conductive adhesive, alcohol based. | |
| Graphite conductive adhesive, aqueous based | Graphite conductive adhesive, aqueous based. | |
| Graphite felt, 1.12cm (0.441in) thick, 99.9% (metals basis) | Graphite felt, 1.12cm (0.441in) thick, 99.9% (metals basis). | |
| Graphite Fluoride | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;Black, o | |
| Graphite foil, 0.13mm (0.005in) thick, 99.8% (metals basis) | Graphite foil, 0.13mm (0.005in) thick, 99.8% (metals basis). | |
| Graphite foil, 0.254mm (0.01in) thick, 99.8% (metals basis) | Graphite foil, 0.254mm (0.01in) thick, 99.8% (metals basis). | |
| Graphite foil, 1mm (0.04in) thick, 97% (metals basis) | Graphite foil, 1mm (0.04in) thick, 97% (metals basis). | |
| Graphite ink for tantalum capacitors | Graphite ink for tantalum capacitors. | |
| Graphite plate, 1.27cm (0.5in) thick | Graphite plate, 1.27cm (0.5in) thick. | |
| Graphite plate, highly oriented pyrolytic graphite (HOPG), 10x10x(1.6min)mm (0.394x0.394x0.079in) | Graphite plate, highly oriented pyrolytic graphite (HOPG), 10x10x(1.6min)mm (0.394x0.394x0.079in). | |
| Graphite plate, highly oriented pyrolytic graphite (HOPG), 10x10x1mm (0.394x0.394x0.039in) | Graphite plate, highly oriented pyrolytic graphite (HOPG), 10x10x1mm (0.394x0.394x0.039in). | |
| Graphite plate, pyrolytic, 1.27x9.98x9.98mm (0.05x0.393x.393in) | Graphite plate, pyrolytic, 1.27x9.98x9.98mm (0.05x0.393x.393in). | |
| Graphite plate, resin impregnated, 6.35mm (0.25in) thick | Graphite plate, resin impregnated, 6.35mm (0.25in) thick. | |
| Graphite powder, nickel coated, -100 mesh, Ni 99.8% (metals basis) | Graphite powder, nickel coated, -100 mesh, Ni 99.8% (metals basis). | |
| Graphite rod, 1.27cm (0.5in) dia x 61cm (24in) long, 99% (metals basis) | Graphite rod, 1.27cm (0.5in) dia x 61cm (24in) long, 99% (metals basis). | |
| Graphite rod, 2.54cm (1.0in) dia x 61cm (24in) long, 99% (metals basis) | Graphite rod, 2.54cm (1.0in) dia x 61cm (24in) long, 99% (metals basis). | |
| Graphite rod, 6.3mm (0.25in) dia. x 61cm (24in) long, 99% (metals basis) | Graphite rod, 6.3mm (0.25in) dia. x 61cm (24in) long, 99% (metals basis). | |
| Graphite tape, square weave, 0.56mm (0.022in) thick x 100mm (3.94in) wide, 99.9% | Graphite tape, square weave, 0.56mm (0.022in) thick x 100mm (3.94in) wide, 99.9%. | |
| Graphite tape, square weave, 0.56mm (0.022in) thick x 25mm (0.98in) wide, 99.9% | Graphite tape, square weave, 0.56mm (0.022in) thick x 25mm (0.98in) wide, 99.9%. | |
| H2BBTA | H2BBTA. Alternative Names: 1,7-Dihydrobenzo[1,2-d:4,5-d']bis([1,2,3]triazole). CAS No. 7221-63-8. Molecular formula: C6H4N6. Mole weight: 160.14. Purity: 98%. | |
| Hafnium boride | Hafnium boride. Alternative Names: HAFNIUM BORIDE;HAFNIUM DIBORIDE;HAFNIUM BORIDE, 99.5% (METALS BASIS EXCLUDING ZR), ZR ;Hafnium boride, 99% (metals basis);Hafnium boridepowder;HafniuM borid;Hafnium boride powder, -325 mesh, 99% trace metals basis. CAS No. 12007-23-7. Molecular formula: HfB2. Mole weight: 200.11. Purity: 96%. IUPAC Name: boron; hafnium. | |
| Hafnium Carbide | Hafnium Carbide. Molecular formula: HfC2. Purity: 0.999. | |
| Hafnium chloride tetrahydrofuran complex(1:2) | Hafnium chloride tetrahydrofuran complex(1:2). Alternative Names: HAFNIUM CHLORIDE TETRAHYDROFURAN COMPLEX (1:2);TETRACHLOROBIS(TETRAHYDROFURAN)HAFNIUM;hafnium(iv) chloride tetrahydrofuran complex (1:2);Hafnium(IV) chloride tetrahydrofuran complex (1:2),Tetrachlorobis(tetrahydrofuran)hafnium;Tetrachlorobis(tetrahydrofur. CAS No. 21959-05-7. Molecular formula: C8H16Cl4HfO2. Mole weight: 464.5g/mol. IUPAC Name: oxolane;tetrachlorohafnium. SMILES: C1CCOC1.C1CCOC1.Cl[Hf](Cl)(Cl)Cl. InChI: InChI=1S/2C4H8O.4ClH.Hf/c2*1-2-4-5-3-1;;;;;/h2*1-4H2;4*1H;/q;;;;;;+4/p-4. | |
| Hafnium Dioxide | Hafnium Dioxide. Molecular formula: HFO2. Purity: 0.9999. | |
| Hafnium(iv)i-propoxide monoisopropylate | Hafnium(iv)i-propoxide monoisopropylate. Alternative Names: HAFNIUM TETRA-I-PROPOXIDE;HAFNIUM I-PROPOXIDE MONOISOPROPYLATE;HAFNIUM ISOPROPOXIDE MONOISOPROPYLATE;HAFNIUM (IV) I-PROPOXIDE MONOISOPROPYLATE;Hafniumipropoxidemonoisopropylatewhitextl;Hafnium (IV) i-propoxide mono-i-propylate;HAFNIUM (IV) I-PROPOXIDE MON. CAS No. 2171-99-5. Molecular formula: C12H32HfO4. Mole weight: 418.9g/mol. IUPAC Name: hafnium;propan-2-ol. SMILES: CC(C)O.CC(C)O.CC(C)O.CC(C)O.[Hf]. InChI: InChI=1S/4C3H8O.Hf/c4*1-3(2)4;/h4*3-4H,1-2H3. | |
| Hafnium(IV) oxide sputtering target, 101.4mm (4.0in) dia x 6.35mm (0.25in) thick, 99.95% (metals basis excluding Zr) | Hafnium(IV) oxide sputtering target, 101.4mm (4.0in) dia x 6.35mm (0.25in) thick, 99.95% (metals basis excluding Zr). | |
| Hafnium Oxide Nanoparticles / Nanopowder | Hafnium Oxide Nanoparticles / Nanopowder. Alternative Names: Hafnium(IV) oxide. CAS No. 12055-23-1. Molecular formula: HfO2. Mole weight: 210.49. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: Dioxohafnium. SMILES: O=[Hf]=O. InChI: InChI=1S/Hf.2O. | |
| Hafnium oxychloride hydrate | Hafnium oxychloride hydrate. Alternative Names: Chlorohypochlorite,hafnium,hydrate. CAS No. 15461-28-6. Molecular formula: Cl2H2HfO2. Mole weight: 283.4. Purity: 99%+. IUPAC Name: Chloro hypochlorite;hafnium;hydrate. SMILES: O.O(Cl)Cl.[Hf]. InChI: InChI=1S/Cl2O.Hf.H2O/c1-3-2;/h;1H2. | |
| Halloysite Nanoclay | Kaolin appears as odorless white to yellowish or grayish powder. Contains mainly the clay mineral kaolinite (Al2O3(SiO2)2(H2O)2), a hydrous aluminosilicate. Kaolinite has mp 740-1785°C and density 2.65 g/cm³. Kaoline is insoluble in water but darkens and develops a earthy odor when wet.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals, WetSolid; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; WetSolid; WetSolid, Liquid;WHITE POWDER.;White to yellowish or grayish powder. Odorless.;White to yellowish or grayish powder. [Note: When moistened, darkens & develops a clay-like odor.]. Alternative Names: Aluminum silicate hydroxide, Bolus, Hydrated aluminum silicate, Kaolin, μ-{Hydrogenato(2-)-?O [(hydroxy-?O)(oxo)silyl]silicate}(dioxo)dialuminium dihydrate, Aluminum, dioxo-μ-[silicic acid (H2SiO3)ato(2-)-?O, (hydroxy-?O)oxosilyl ester]-, hydrate (1:2). CAS No. 1332-58-7. Molecular formula: H4Al2O9Si2 · 2 H2O. Mole weight: 294.19 g/mol. Purity: 99%, 99.9%, 99.99%, 99.999%. IUPAC Name: oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl] oxysilane; dihydrate. SMILES: O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O. InChI: InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;; | |
| HD2EODA | HD2EODA. Mole weight: 314. | |
| HDA | HDA. Mole weight: 296. | |
| HDCPMA | HDCPMA. Mole weight: 220. | |
| HDDA | HDDA. Mole weight: 226. | |
| HDDA-TF | HDDA-TF. Mole weight: 226. | |
| HDDMA | HDDMA. Mole weight: 254. | |
| Heptadecafluoro-1-iodooctane | Liquid. CAS No. 507-63-1. Molecular formula: C8F17I. Mole weight: 545.96g/mol. Purity: >98.0%(GC). IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane. SMILES: C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F. InChI: InChI=1S/C8F17I/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26. | |
| Hexa(4-formylphenyl)benzene | Hexa(4-formylphenyl)benzene. CAS No. 1862220-96-9. | |
| Hexaamminecobalt(III) chloride | Hexaamminecobalt(III) chloride. Alternative Names: Hexaamminecobalt(III) trichloride. CAS No. 10534-89-1. Molecular formula: Cl3CoH18N6. Mole weight: 267.47. Purity: 99%+. IUPAC Name: Azane;cobalt(3+);trichloride. SMILES: N.N.N.N.N.N.[Cl-].[Cl-].[Cl-].[Co+3]. InChI: InChI=1S/3ClH.Co.6H3N/h3*1H;6*1H3/q;+3;/p-3. | |
| Hexaammineruthenium(II) chloride | Hexaammineruthenium(II) chloride. Alternative Names: Ruthenium(III) chloride hexaammoniate. CAS No. 15305-72-3. Molecular formula: Cl2H18N6Ru. Mole weight: 274.2. Purity: 99%+. IUPAC Name: Azane;ruthenium(2+);dichloride. SMILES: N.N.N.N.N.N.[Cl-].[Cl-].[Ru+2]. InChI: InChI=1S/2ClH.6H3N.Ru/h2*1H;6*1H3;/q;+2/p-2. | |
| Hexabromobenzene | Monoclinic needles or white powder. Insoluble in water. (NTP, 1992). Alternative Names: Benzene, hexabromo-. CAS No. 87-82-1. Molecular formula: C6Br6. Mole weight: 551.5. Purity: 98%. IUPAC Name: 1,2,3,4,5,6-Hexabromobenzene. SMILES: C1(=C(C(=C(C(=C1Br)Br)Br)Br)Br)Br. InChI: InChI=1S/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9. | |
| Hexachlorodisilane | Hexachlorodisilane. Alternative Names: 1,1,1,2,2,2-Hexachlorodisilane. CAS No. 13465-77-5. Molecular formula: Cl6Si2. Mole weight: 268.9. Purity: 95%+. IUPAC Name: Trichloro(trichlorosilyl)silane. SMILES: [Si]([Si](Cl)(Cl)Cl)(Cl)(Cl)Cl. InChI: InChI=1S/Cl6Si2/c1-7(2,3)8(4,5)6. | |
| hexadecanamide | Solid. Alternative Names: Hexadecanamide, NSC 3327, Palmitamide, Palmitic Amide, Palmitoyl Amide. CAS No. 629-54-9. Molecular formula: C16H33NO. Mole weight: 255.4. Purity: >95%. IUPAC Name: hexadecanamide. SMILES: CCCCCCCCCCCCCCCC(=O)N. InChI: InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18). | |
| Hexadecanedioic Acid | Solid. Alternative Names: Hexadecane-1,16-dioic acid. CAS No. 505-54-4. Molecular formula: C16H30O4. Mole weight: 286.41. Purity: 98%. IUPAC Name: Hexadecanedioic acid. SMILES: C(CCCCCCCC(=O)O)CCCCCCC(=O)O. InChI: InChI=1S/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20). | |
| Hexadecanol | Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, Liquid; PelletsLargeCrystals, OtherSolid; WetSolid, OtherSolid;Solid;Solid;white solid/odourless. Alternative Names: N-cetyl alcohol. CAS No. 36653-82-4. Molecular formula: C16H34O. Mole weight: 242.42. Purity: 99%+. IUPAC Name: hexadecan-1-ol. SMILES: CCCCCCCCCCCCCCCCO. InChI: InChI=1S/C16H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h17H,2-16H2,1H3. | |
| Hexadecylamine | Hexadecylamine is a white solid. (NTP, 1992);Liquid. Alternative Names: 1-Aminohexadecane, Cetylamine, HAD. CAS No. 143-27-1. Molecular formula: C16H35N. Mole weight: 241.46. Purity: 98%+. IUPAC Name: hexadecan-1-amine. SMILES: CCCCCCCCCCCCCCCCN. InChI: InChI=1S/C16H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h2-17H2,1H3. | |
| Hexadecyltriethoxysilane | Hexadecyltriethoxysilane. Alternative Names: Triethoxy(hexadecyl)silane. CAS No. 16415-13-7. Molecular formula: C22H48O3Si. Mole weight: 388.71. Purity: >85%. IUPAC Name: triethoxy(hexadecyl)silane. SMILES: CCCCCCCCCCCCCCCC[Si](OCC)(OCC)OCC. | |
| Hexadecyltrimethoxysilane | Hexadecyltrimethoxysilane. Alternative Names: 1-(Trimethoxysilyl)hexadecane. CAS No. 16415-12-6. Molecular formula: C19H42O3Si. Mole weight: 346.6. Purity: 95%+. IUPAC Name: Hexadecyl(trimethoxy)silane. SMILES: CCCCCCCCCCCCCCCC[Si](OC)(OC)OC. InChI: InChI=1S/C19H42O3Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(20-2,21-3)22-4/h5-19H2,1-4H3. | |
| Hexa(ethylene glycol)mono-11-(acetylthio)undecyl ether,95% | Hexa(ethylene glycol)mono-11-(acetylthio)undecyl ether,95%. Alternative Names: HEXA(ETHYLENE GLYCOL)MONO-11-(ACETYLTHIO)UNDECYL ETHER, 95%. CAS No. 130727-53-6. Molecular formula: C25H50O8S. Mole weight: 510.7g/mol. IUPAC Name: S-[11-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]undecyl] ethanethioate. SMILES: CC(=O)SCCCCCCCCCCCOCCOCCOCCOCCOCCOCCO. InChI: InChI=1S/C25H50O8S/c1-25(27)34-24-10-8-6-4-2-3-5-7-9-12-28-14-16-30-18-20-32-22-23-33-21-19-31-17-15-29-13-11-26/h26H,2-24H2,1H3. | |
| Hexakis(4- carboxyphenyl) benzene | Hexakis(4- carboxyphenyl) benzene. CAS No. 83536-16-7. Molecular formula: C48H30O12. Mole weight: 798.7g/mol. IUPAC Name: 4-[2,3,4,5,6-pentakis(4-carboxyphenyl)phenyl]benzoic acid. InChI: InChI=1S/C48H30O12/c49-43(50)31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)44(51)52)40(28-7-19-34(20-8-28)46(55)56)42(30-11-23-36(24-12-30)48(59)60)41(29-9-21-35(22-10-29)47(57)58)39(37)27-5-17-33(18-6-27)45(53)54/h1-24H,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60). | |
| hexakis[4- (carboxyphenyl) oxamethyl] - 3- oxapentane | hexakis[4- (carboxyphenyl) oxamethyl] - 3- oxapentane. CAS No. 1359740-26-3. | |
| Hexamethyldistannane | Hexamethyldistannane. Alternative Names: HEXAMETHYLDISTANNANE;HEXAMETHYLDITIN;HEXAMETHYLDITIN(IV);((CH3)3Sn)2;1,1,1,2,2,2-Hexamethyldistannane;1,1,1,2,2,2-Hexamethyl-distannane;Distannane, hexamethyl-;hexamethyl-distannan. CAS No. 661-69-8. Molecular formula: C6H18Sn2. Mole weight: 327.6g/mol. SMILES: C[Sn](C)C.C[Sn](C)C. InChI: InChI=1S/6CH3.2Sn/h6*1H3; | |
| Hexaphenyldisiloxane | Hexaphenyldisiloxane. Alternative Names: Disiloxane,1,1,1,3,3,3-Hexaphenyl-Bis(Triphenylsilyl)Ethernsc12574Disiloxane,Hexaphenyl-. CAS No. 1829-40-9. Molecular formula: C36H30OSi2. Mole weight: 534.8 g/mol. Purity: >96%. IUPAC Name: triphenyl(triphenylsilyloxy)silane. SMILES: C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6. | |
| Hexaphthalic acid | Hexaphthalic acid. Alternative Names: [1,1':4',1'':4'',1''':4''',1'''':4'''',1'''''-Sexiphenyl]-4,4'''''-dicarboxylic acid. CAS No. 1246015-46-2. Molecular formula: C38H26O4. Mole weight: 546.61. Purity: 95%. IUPAC Name: 4-[4-[4-[4-[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]phenyl]benzoic acid. InChI: InChI=1S/C38H26O4/c39-37(40)35-21-17-33(18-22-35)31-13-9-29(10-14-31)27-5-1-25(2-6-27)26-3-7-28(8-4-26)30-11-15-32(16-12-30)34-19-23-36(24-20-34)38(41)42/h1-24H,(H,39,40)(H,41,42). | |
| Hexyl methacrylate | Hexyl methacrylate. Alternative Names: Hexyl methacrylate, n -Hexyl methacrylate, Hexyl 2-methyl-2-propenoate. CAS No. 142-09-6. Molecular formula: C10H18O2. Mole weight: 170.25. Purity: ≥ 97%. IUPAC Name: hexyl 2-methylprop-2-enoate. SMILES: CCCCCCOC(=O)C(C)=C. InChI: 1S/C10H18O2/c1-4-5-6-7-8-12-10(11)9(2)3/h2,4-8H2,1,3H3. | |
| Hexylmethyldichlorosilane | Hexylmethyldichlorosilane. Alternative Names: Hexylmethyldichlorosilane; N-HEXYLMETHYLDICHLOROSILANE. CAS No. 14799-94-1. Molecular formula: C7H16Cl2Si. Mole weight: 199.19 g/mol. Purity: 95%+. IUPAC Name: dichloro-hexyl-methylsilane. SMILES: CCCCCC[Si](C)(Cl)Cl. | |
| Hexyltriethoxysilane | Hexyltriethoxysilane. Alternative Names: Hexyltriethoxysilane. CAS No. 18166-37-5. Molecular formula: C12H28O3Si. Mole weight: 248.44. Purity: 95%. IUPAC Name: triethoxy(hexyl)silane. SMILES: CCCCCC[Si](OCC)(OCC)OCC. | |
| High purity aluminum | High purity aluminum. Molecular formula: Al. Purity: 99.99%-99.9999%. | |
| High purity antimony | High purity antimony. Molecular formula: Sb. Purity: 99.999%-99.99999%. | |
| High purity bismuth | High purity bismuth. Molecular formula: Bi. Purity: 99.999%-99.9999%. | |
| High purity cadmium | High purity cadmium. Molecular formula: Cd. Purity: 99.999%-99.99999%. | |
| High purity Carboxyl SWCNTs aqueous dispersion | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, | |
| High purity chromium | High purity chromium. Molecular formula: Cr. Purity: 99.9%-99.99%. | |
| High purity cobalt | High purity cobalt. Molecular formula: Co. Purity: 0.9999. | |
| High purity copper | High purity copper. Molecular formula: Cu. Purity: 99.9%-99.9999%. | |
| High purity germanium | High purity germanium. Molecular formula: Ge. Purity: 99.999%-99.9999%. | |
| High purity gold | High purity gold. Molecular formula: Au. Purity: 99.99%-99.999%. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.