Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Diphenylsilanediol | Diphenylsilanediol. Alternative Names: Dihydroxydiphenylsilane. CAS No. 947-42-2. Molecular formula: C12H12O2Si. Mole weight: 216.31. Purity: 95%+. IUPAC Name: Dihydroxy(diphenyl)silane. SMILES: C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(O)O. InChI: InChI=1S/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H. |  |
| Diphenyltin oxide | Diphenyltin oxide. Alternative Names: OXODIPHENYLTIN;DIPHENYLTIN(IV) OXIDE;DIPHENYLTIN OXIDE;Diphenyltinoxidewhitepowder;oxodiphenylstannane;Diphenyltinoxide,98%;oxodiphenyltin(iv);DIPHENY TIN OXIDE. CAS No. 2273-51-0. Molecular formula: C12H10OSn. Mole weight: 288.92g/mol. IUPAC Name: oxo(diphenyl)tin. SMILES: C1=CC=C(C=C1)[Sn](=O)C2=CC=CC=C2. InChI: InChI=1S/2C6H5.O.Sn/c2*1-2-4-6-5-3-1;;/h2*1-5H; | |
| Diphosphorus tetraiodide | Diphosphorus tetraiodide. Alternative Names: hypodiphosphoroustetraiodide;DIPHOSPHORUS TETRAIODIDE;AURORA KA-1083;PHOSPHORUS DIIODIDE;diphosphorous tetraiodide;Hypodiiphosphorus tetraiodide;Tetraiododiphosphine;Diphosphorus tetraiodide,95%. CAS No. 13455-00-0. Molecular formula: P2I4;I4P2. Mole weight: 569.565g/mol. IUPAC Name: diiodophosphanyl(diiodo)phosphane. SMILES: P(P(I)I)(I)I. InChI: InChI=1S/I4P2/c1-5(2)6(3)4. | |
| Dipotassium hexachloropalladate | Dipotassium hexachloropalladate. Alternative Names: Potassium hexachloropalladate(IV). CAS No. 16919-73-6. Molecular formula: Cl6K2Pd. Mole weight: 397.33. Purity: 98%. IUPAC Name: dipotassium;hexachloropalladium(2-). SMILES: Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[K+].[K+]. InChI: InChI=1S/6ClH.2K.Pd/h6*1H;/q;2*+1;+4/p-6. | |
| Dipotassium hydrogenphosphate | Dipotassium phosphate (K2HPO4) (also dipotassium hydrogen orthophosphatepotassium phosphate dibasic) is a highly water-soluble salt which is often used as a fertilizer, food additive and buffering agent. It is a common source of phosphorus and potassium.A dipotassium phosphate solution is formed by the stoichiometric reaction of phosphoric acid with two equivalents of potassium hydroxide:H3PO4 + 2 KOH → K2HPO4 + 2 H2O. Alternative Names: Isolyte;DIPOTASSIUM PHOSPHATE;Mediject P;SEC-POTASSIUM PHOSPHATE;DKP. CAS No. 7758-11-4. Molecular formula: HK2O4P. Mole weight: 174.176g/mol. IUPAC Name: dipotassium;hydrogen phosphate. SMILES: OP(=O)([O-])[O-].[K+].[K+]. InChI: InChI=1S/2K.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q2*+1;/p-2. | |
| Di(propylene glycol)butyl ether | Liquid;COLOURLESS LIQUID. Alternative Names: ARCOSOLV(R) DPNB;BUTYL PROPASOL;DI(PROPYLENE GLYCOL) BUTYL ETHER;DIPROPYLENE GLYCOL MONOBUTYL ETHER;Dipropylene glycol mono-n-butyl ether;DIPROPYLENE GLYCOL NORMAL BUTYL ETHER;DOWANOL(TM) DPNB;DPNB. CAS No. 29911-28-2. Molecular formula: C10H22O3;C10H22O3. Mole weight: 190.28g/mol. IUPAC Name: 1-(1-butoxypropan-2-yloxy)propan-2-ol. SMILES: CCCCOCC(C)OCC(C)O. InChI: InChI=1S/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3. | |
| Dipropylene Glycol Diacrylate | Dipropylene Glycol Diacrylate. | |
| Dipropylene glycol monomethyl ether | Dipropylene glycol monomethyl ether. Alternative Names: 1-(2-Methoxy-1-methylethoxy)-2-propanol. CAS No. 34590-94-8. Molecular formula: C7H16O3. Mole weight: 148.2. Purity: 95%+. IUPAC Name: 1-(3-Methoxypropoxy)propan-1-ol. SMILES: CCC(O)OCCCOC. InChI: InChI=1S/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3. | |
| Di(propylene glycol)propyl ether | Liquid. Alternative Names: ARCOSOLV(R) DPNP;DOWANOL(TM) DPNP;DPNP;DIPROPYLENE GLYCOL MONOPROPYL ETHER;DIPROPYLENE GLYCOL NORMAL PROPYL ETHER;DI(PROPYLENE GLYCOL) PROPYL ETHER;1-(1-methyl-2-propoxyethoxy)-2-propano;1-(1-methyl-2-propoxyethoxy)-2-Propanol. CAS No. 29911-27-1. Molecular formula: C9H20O3. Mole weight: 176.25g/mol. IUPAC Name: 1-(1-propoxypropan-2-yloxy)propan-2-ol. SMILES: CCCOCC(C)OCC(C)O. InChI: InChI=1S/C9H20O3/c1-4-5-11-7-9(3)12-6-8(2)10/h8-10H,4-7H2,1-3H3. | |
| Dipropyl phthalate | Di-n-propyl phthalate is a colorless liquid. (NTP, 1992). Alternative Names: Di-n-propylphthalate. CAS No. 131-16-8. Molecular formula: C14H18O4. Mole weight: 250.29. Purity: 98%. IUPAC Name: Dipropyl benzene-1,2-dicarboxylate. SMILES: CCCOC(=O)C1=CC=CC=C1C(=O)OCCC. InChI: InChI=1S/C14H18O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h5-8H,3-4,9-10H2,1-2H3. | |
| Di-p-tolylamine | Di-p-tolylamine. Alternative Names: 4-Methyl-N -(4-methylphenyl)benzenamine, 4,4'-Dimethyldiphenylamine, p ,p '-Ditolylamine, Bis(4-methylphenyl)amine. CAS No. 620-93-9. Molecular formula: (CH3C6H4)2NH. Mole weight: 197.28. Purity: >97.0%(GC). IUPAC Name: 4-methyl-N-(4-methylphenyl)aniline. SMILES: Cc1ccc(Nc2ccc(C)cc2)cc1. InChI: 1S/C14H15N/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3. | |
| Dipyridin-2-yldiazene | Dipyridin-2-yldiazene. Alternative Names: 2,2'-Diazene-1,2-diyldipyridine; 2,2'-[(E)-1,2-Diazenediyl]Dipyridine. CAS No. 4109-58-4. Molecular formula: C10H8N4. Mole weight: 184.20. Purity: 97%. | |
| Disodium hydrogenorthophosphate | Sodium phosphate, dibasic appears as a colorless to white crystalline solid. Soluble in water. The primary hazard is the threat to the environment. Immediate steps should be taken to limit spread to the environment. Used as a fertilizer, in pharmaceuticals, in food processing, and for many other uses.;DryPowder; Liquid; PelletsLargeCrystals;Anhydrous disodium hydrogen phosphate is a white, hygroscopic, odourless powder. Hydrated forms available include the dihydrate: a white crystalline, odourless solid; the heptahydrate: white, odourless, efflorescent crystals or granular powder; and the dodecahydrate: white, efflorescent, odourless powder or crystals;WHITE OR COLOURLESS HYGROSCOPIC CRYSTALS OR POWDER. Alternative Names: DIBASIC SODIUM PHOSPHATE;DINATRII PHOSPHAS DIHYDRICUS;DINATRII PHOSPHAS ANHYDRICUS;DISODIUM PHOSHATE;DISODIUM PHOSPHATE DIHYDRATE;DISODIUM PHOSPHATE;DI-SODIUM HYDROGEN ORTHOPHOSPHATE;DI-SODIUM HYDROGEN ORTHOPHOSPHATE 2H2O. CAS No. 7558-79-4. Molecular formula: Anhydrous:Na2HPO4; Hydrate: Na2HPO4? nH2O (n = 2, 7 or 12);HO4PNa2;Na2HPO4;HNa2O4P. Mole weight: 141.959g/mol. IUPAC Name: disodium;hydrogen phosphate. SMILES: OP(=O)([O-])[O-].[Na+].[Na+]. InChI: InChI=1S/2Na.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q2*+1;/p-2. | |
| Dispersant for Carbon nanotubes Resin solutions | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, | |
| Disperse orange 3 | WetSolid. Alternative Names: CI 11005;DISPERSE ORANGE 3;4-(4-NITROPHENYLAZO)ANILINE;4-(4-nitro-phenylazo)-phenylamine;4-[(4-nitrophenyl)azo]-benzenamin;4-[(4-nitrophenyl)azo]-Benzenamine;4'-Nitro-4-aminoazobenzene;4'-Nitro-4-amino-azobenzene. CAS No. 730-40-5. Molecular formula: C12H10N4O2. Mole weight: 242.23g/mol. IUPAC Name: 4-[(4-nitrophenyl)diazenyl]aniline. SMILES: C1=CC(=CC=C1N)N=NC2=CC=C(C=C2)[N+](=O)[O-]. InChI: InChI=1S/C12H10N4O2/c13-9-1-3-10(4-2-9)14-15-11-5-7-12(8-6-11)16(17)18/h1-8H,13H2. | |
| Disperse orange 3 methacrylamide | Disperse orange 3 methacrylamide. CAS No. 58142-15-7. Molecular formula: C16H14N4O3. Mole weight: 310.31g/mol. IUPAC Name: 2-methyl-N-[4-[(4-nitrophenyl)diazenyl]phenyl]prop-2-enamide. SMILES: CC(=C)C(=O)NC1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-]. InChI: InChI=1S/C16H14N4O3/c1-11(2)16(21)17-12-3-5-13(6-4-12)18-19-14-7-9-15(10-8-14)20(22)23/h3-10H,1H2,2H3,(H,17,21). | |
| Disperse Red 1 | Disperse Red 1. Alternative Names: 2-(ethyl(4-((4-nitrophenyl)azo)phenyl)amino)ethanol;2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]-ethano;2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]-Ethanol;4-Nitro-4-(ethyl(2-hydroxyethyl)amino)azobenzene;4-Nitro-4'-[N-ethyl-N-(2-hydroxy-ethyl)amino]azo-. CAS No. 2872-52-8. Molecular formula: C16H18N4O3. Mole weight: 314.34g/mol. IUPAC Name: 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol. SMILES: CCN(CCO)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-]. InChI: InChI=1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3. | |
| Disperse red 19 | Disperse red 19. Alternative Names: 2,2'-[[4-[(4-nitrophenyl)azo]phenyl]imino]bis-ethano;CI 11130;DISPERSE RED 19;disperse red 19 (C.I. 11130);2,2-[[4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol;Disperse Red 19, pure;Ethanol, 2,2-[[4-[(4-nitrophenyl)azo]phenyl]imino]bis-;2,2-(4-Nitroazobenz. CAS No. 2734-52-3. Molecular formula: C16H18N4O4. Mole weight: 330.34g/mol. IUPAC Name: 2-[N-(2-hydroxyethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethanol. SMILES: C1=CC(=CC=C1N=NC2=CC=C(C=C2)[N+](=O)[O-])N(CCO)CCO. InChI: InChI=1S/C16H18N4O4/c21-11-9-19(10-12-22)15-5-1-13(2-6-15)17-18-14-3-7-16(8-4-14)20(23)24/h1-8,21-22H,9-12H2. | |
| Disperse red 1 methacrylate95 | Disperse red 1 methacrylate95. Alternative Names: DISPERSE RED 1 METHACRYLATE95. CAS No. 103553-48-6. Molecular formula: C20H22N4O4. Mole weight: 382.4g/mol. IUPAC Name: 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 2-methylprop-2-enoate. SMILES: CCN(CCOC(=O)C(=C)C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-]. InChI: InChI=1S/C20H22N4O4/c1-4-23(13-14-28-20(25)15(2)3)18-9-5-16(6-10-18)21-22-17-7-11-19(12-8-17)24(26)27/h5-12H,2,4,13-14H2,1,3H3. | |
| DiTMPTA, 400-700 cps | DiTMPTA, 400-700 cps. Mole weight: 466. | |
| Di-TMPTA, 400-800 cps | Di-TMPTA, 400-800 cps. Mole weight: N/A. | |
| DiTMPTA, 700-900 cps | DiTMPTA, 700-900 cps. Mole weight: 466. | |
| Di-TMPTA, 800-1500 cps | Di-TMPTA, 800-1500 cps. Mole weight: 482. | |
| Di TMPTTA | Di TMPTTA. | |
| Docosanol | Liquid; OtherSolid; OtherSolid, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid;Solid. Alternative Names: Behenyl alcohol. CAS No. 661-19-8. Molecular formula: C22H46O. Mole weight: 326.56. Purity: 99%+. IUPAC Name: docosan-1-ol. SMILES: CCCCCCCCCCCCCCCCCCCCCCO. InChI: InChI=1S/C22H46O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23/h23H,2-22H2,1H3. | |
| Dodecamethylcyclohexasilane | Dodecamethylcyclohexasilane. Alternative Names: 1,1,2,2,3,3,4,4,5,5,6,6-Dodecamethyl-1,2,3,4,5,6-hexasilinane. CAS No. 4098-30-0. Molecular formula: (Si(CH3)2)6. Mole weight: 348.92. Purity: 95%+. IUPAC Name: 1,1,2,2,3,3,4,4,5,5,6,6-Dodecamethylhexasilinane. SMILES: C[Si]1([Si]([Si]([Si]([Si]([Si]1(C)C)(C)C)(C)C)(C)C)(C)C)C. InChI: InChI=1S/C12H36Si6/c1-13(2)14(3,4)16(7,8)18(11,12)17(9,10)15(13,5)6/h1-12H3. | |
| Dodecamethylpentasiloxane | Dodecamethylpentasiloxane. Alternative Names: Brn 1792965 Pentasiloxane, 1,1,1,3,3,5,5,7,7,9,9,9-Dodecamethyl- Pentasiloxane, Dodecamethyl- 1,1,1,3,3,5,5,7,7,9,9,9-Dodecamethylpentasiloxane Dodecamethyl-Pentasiloxan Pentasiloxane, Dodecamethyl- Dodecamethyl-2,4,6,8-Tetraoxa-1,3,5,7,9-Pentasilanane Dodecamethylnanepentasiloxane Penta(Dimethylsiloxane) Dodecamethylpentasiloxane,97% Dodecamethylpentasiloxane 4-04-00-04124 (Beilstein Handbook Reference) Brn 1792965 Pentasiloxane, 1,1,1,3,3,5,5,7,7,9,9,9-Dodecamethyl- Pentasiloxane, Dodecamethyl- Dodecamethylpentasiloxane Dodecamethylpentasiloxane Kf96L2Cs Pentasiloxane,Dodecamethyl- (6Ci,7Ci,8Ci,9Ci). CAS No. 141-63-9. Molecular formula: C12H36O4Si5. Mole weight: 384.84 g/mol. Purity: 0.95. IUPAC Name: bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-dimethylsilane. SMILES: C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C. | |
| Dodecanol | Dodecanol is a colorless thick liquid with a sweet odor. Floats on water. Freezing point is 75°F. (USCG, 1999);Liquid; OtherSolid, Liquid; WetSolid;Liquid;Liquid;Solid;COLOURLESS LIQUID OR WHITE CRYSTALS WITH CHARACTERISTIC ODOUR.;Colourless liquid above 21?°, fatty odour. Alternative Names: 1-Hydroxydodecane. CAS No. 112-53-8. Molecular formula: C12H26O. Mole weight: 186.33. Purity: 99%+. IUPAC Name: dodecan-1-ol. SMILES: CCCCCCCCCCCCO. InChI: InChI=1S/C12H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13/h13H,2-12H2,1H3. | |
| Dodecylamine | Dodecanamine appears as a yellow liquid with an ammonia-like odor. Insoluble in water and less dense than water. Hence floats on water. Contact may irritate skin, eyes and mucous membranes. May be toxic by ingestion, inhalation or skin absorption. Used to make other chemicals.;Liquid; OtherSolid;WHITE CRYSTALLINE POWDER WITH CHARACTERISTIC ODOUR. Alternative Names: 1-Aminododecane, Laurylamine. CAS No. 124-22-1. Molecular formula: C12H27N. Mole weight: 185.35. Purity: 98%+. IUPAC Name: dodecan-1-amine. SMILES: CCCCCCCCCCCCN. InChI: InChI=1S/C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13/h2-13H2,1H3. | |
| Dodecyldimethylchlorosilane | Dodecyldimethylchlorosilane. Alternative Names: chloro-dodecyl-dimethylsilane. CAS No. 66604-31-7. Molecular formula: C14H31ClSi. Mole weight: 262.94 g/mol. Purity: 0.97. IUPAC Name: chloro-dodecyl-dimethylsilane. SMILES: CCCCCCCCCCCC[Si](C)(C)Cl. | |
| Dodecylmethyldichlorosilane | Dodecylmethyldichlorosilane. Alternative Names: DichlorododecylMethylsilane; EINECS 242-286-1; n-dodecylmethyldichlorosilane; Silane,dichlorododecylmethyl; methyldodecyldichlorosilane; Dichlor-dodecyl-methyl-silan; ZAADUWCLWTWDSZ-UHFFFAOYSA; DICHLORO-N-DODECYLMETHYLSILANE. CAS No. 18407-07-3. Molecular formula: C13H28Cl2Si. Mole weight: 283.36 g/mol. Purity: 0.97. IUPAC Name: dichloro-dodecyl-methylsilane. SMILES: CCCCCCCCCCCC[Si](C)(Cl)Cl. | |
| Dodecyltrimethoxysilane | It is a long-chain silane with three methoxy groups. It is soluble in a variety of ordinary solvents. It is mainly used as a waterproof agent with superior hydrophobicity. Alternative Names: 1-(Trimethoxysilyl)dodecane. CAS No. 3069-21-4. Molecular formula: C15H34O3Si. Mole weight: 290.52. Purity: 95%. IUPAC Name: dodecyl(trimethoxy)silane. SMILES: CCCCCCCCCCCC[Si](OC)(OC)OC. | |
| DPGDA, 6-12 cps | DPGDA, 6-12 cps. Mole weight: 242. | |
| DPGDA, 7-13 cps | DPGDA, 7-13 cps. Mole weight: 242. | |
| DPGDA-TF | DPGDA-TF. Mole weight: 242. | |
| DPHA, 3000-7000 cps | DPHA, 3000-7000 cps. Mole weight: 579. | |
| DPHA, 4000-7000 cps | DPHA, 4000-7000 cps. Mole weight: 579. | |
| DPHA, 7000-10000 cps | DPHA, 7000-10000 cps. Mole weight: 579. | |
| DP-PTCDI | DP-PTCDI. CAS No. 128-65-4. Molecular formula: C36H18N2O4. Mole weight: 542.5g/mol. IUPAC Name: 7,18-diphenyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone. SMILES: C1=CC=C(C=C1)N2C(=O)C3=C4C(=CC=C5C4=C(C=C3)C6=C7C5=CC=C8C7=C(C=C6)C(=O)N(C8=O)C9=CC=CC=C9)C2=O. InChI: InChI=1S/C36H18N2O4/c39-33-25-15-11-21-23-13-17-27-32-28(36(42)38(35(27)41)20-9-5-2-6-10-20)18-14-24(30(23)32)22-12-16-26(31(25)29(21)22)34(40)37(33)19-7-3-1-4-8-19/h1-18H. | |
| DTT-2,6-dicarboxylic acid | DTT-2,6-dicarboxylic acid. Alternative Names: H2DTDC. CAS No. 502764-53-6. Molecular formula: C10H4O4S3. Mole weight: 284.33. Purity: 96%. IUPAC Name: 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarboxylic acid. InChI: InChI=1S/C10H4O4S3/c11-9(12)5-1-3-7(16-5)8-4(15-3)2-6(17-8)10(13)14/h1-2H,(H,11,12)(H,13,14). | |
| Duplex 2209, 20 mesh woven from 0.3mm (0.012mm) dia wire | Duplex 2209, 20 mesh woven from 0.3mm (0.012mm) dia wire. | |
| Duplex 2209, 40 mesh woven from 0.2mm (0.008mm) dia wire | Duplex 2209, 40 mesh woven from 0.2mm (0.008mm) dia wire. | |
| Duplex 2209, 60 mesh woven from 0.15mm (0.006mm) dia wire | Duplex 2209, 60 mesh woven from 0.15mm (0.006mm) dia wire. | |
| Dysprosium fluoride | Dysprosium fluoride. Molecular formula: DyF3. Mole weight: 219.50g/mol. Purity: 0.999. IUPAC Name: dysprosium(3+);trifluoride. InChI: InChI=1S/Dy.3FH/h;3*1H/q+3;;;/p-3. | |
| Eghoxylated Bisphenol-A Diacrylate | Eghoxylated Bisphenol-A Diacrylate. | |
| Eicosanoic acid | Liquid; OtherSolid;Solid. Alternative Names: Arachidic acid. CAS No. 506-30-9. Molecular formula: C20H40O2. Mole weight: 312.53. Purity: 99%+. IUPAC Name: icosanoic acid. SMILES: CCCCCCCCCCCCCCCCCCCC(=O)O. InChI: InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22). | |
| EOEOEA | EOEOEA. Mole weight: 188. | |
| Epifluorohydrin | Epifluorohydrin is a clear colorless liquid. (NTP, 1992). Alternative Names: 1,2-Epoxy-3-fluoropropane. CAS No. 503-09-3. Molecular formula: C3H5FO. Mole weight: 76.07g/mol. IUPAC Name: 2-(fluoromethyl)oxirane. SMILES: FCC1CO1. InChI: 1S/C3H5FO/c4-1-3-2-5-3/h3H,1-2H2. | |
| Epoxidized Soybean Oil Acrylate | Epoxidized Soybean Oil Acrylate. | |
| ε-Caprolactone | ε-caprolactone is a cyclic ester. Ring opening polymerization of ε-caprolactone initiated by, tributylin n butoxide, ethyl magnesium bromide, or samarium acetate or heteropolyacid, leads to the formation of poly caprolactone (PCL). Alternative Names: 6-Caprolactone monomer, 6-Hexanolactone, 2-Oxepanone. CAS No. 502-44-3. Molecular formula: C6H10O2. Mole weight: 114.14. IUPAC Name: oxepan-2-one. SMILES: O=C1CCCCCO1. InChI: 1S/C6H10O2/c7-6-4-2-1-3-5-8-6/h1-5H2. | |
| Erbium fluoride | Erbium fluoride. Molecular formula: ErF3;ErF3. Mole weight: 224.25g/mol. Purity: 0.9999. IUPAC Name: trifluoroerbium. InChI: InChI=1S/Er.3FH/h;3*1H/q+3;;;/p-3. | |
| Erbium Oxide | Erbium Oxide. Molecular formula: Er2O3. Purity: 0.9999. | |
| Ethidium bromide-N N-bisacrylamide | Ethidium bromide-N N-bisacrylamide. Alternative Names: ETHIDIUM BROMIDE-N N-BISACRYLAMIDE;3,8-bisacrylamido-5-ethyl-6-phenylphenanthridinium bromide;3,8-Bisacrylamido-5-ethyl-6-phenylphenanthridiniumbromide,3,8-Bisacryloylethidiumbromide. CAS No. 480438-67-3. Molecular formula: C27H24BrN3O2. Mole weight: 502.4g/mol. IUPAC Name: N-[5-ethyl-6-phenyl-3-(prop-2-enoylamino)phenanthridin-5-ium-8-yl]prop-2-enamide;bromide. SMILES: CC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)NC(=O)C=C)NC(=O)C=C.[Br-]. InChI: InChI=1S/C27H23N3O2.BrH/c1-4-25(31)28-19-12-14-21-22-15-13-20(29-26(32)5-2)17-24(22)30(6-3)27(23(21)16-19)18-10-8-7-9-11-18;/h4-5,7-17H,1-2,6H2,3H3,(H,28,31);1H. | |
| Ethoxy Ethylene Glycol Acrylate | Ethoxy Ethylene Glycol Acrylate. | |
| Ethoxy Ethylene Glycol Methacrylate | Ethoxy Ethylene Glycol Methacrylate. | |
| Ethoxylated, Bisphenol A Dimethacrylate, 1100 cps | Ethoxylated, Bisphenol A Dimethacrylate, 1100 cps. | |
| Ethoxylated, Bisphenol A Dimethacrylate, 700 cps | Ethoxylated, Bisphenol A Dimethacrylate, 700 cps. | |
| Ethoxylated Neopentyl Glycol Diacrylate | Ethoxylated Neopentyl Glycol Diacrylate. | |
| Ethoxylated Nonyl Phenol Acrylate | Ethoxylated Nonyl Phenol Acrylate. | |
| Ethoxylated Pentaerythritol Tetraacrylate | Ethoxylated Pentaerythritol Tetraacrylate. | |
| Ethyl acetoacetatesodium salt | Ethyl acetoacetatesodium salt. Alternative Names: Cyclopentane-1,2-Dicarboximde;ETHYL ACETOACETATE, SODIUM SALT, TECH.,9 5%;ca85%,balancemainlysodiumacetate;Ethyl acetoacetate, sodium salt, balance mainly sodium acetate, ca. 85%;ETHYL ACETOACETATE, SODIUM SALT, CA 85%, BALANCE MAINLY SODIUM ACETATE;Ethyl. CAS No. 20412-62-8. Molecular formula: C6H10NaO3. Mole weight: 153.13g/mol. SMILES: CCOC(=O)CC(=O)C.[Na]. InChI: InChI=1S/C6H10O3.Na/c1-3-9-6(8)4-5(2)7;/h3-4H2,1-2H3. | |
| Ethyldimethylchlorosilane | Ethyldimethylchlorosilane. Alternative Names: chloro-ethyl-dimethylsilane. CAS No. 6917-76-6. Molecular formula: C4H11ClSi. Mole weight: 122.67. Purity: 97%. IUPAC Name: chloro-ethyl-dimethylsilane. SMILES: CC[Si](C)(C)Cl. | |
| Ethyldimethylsilane | Ethyldimethylsilane. Alternative Names: Silane,ethyldimethyl-Ethyl(Dimethyl)Silyl. CAS No. 758-21-4. Molecular formula: C4H12Si. Mole weight: 88.22 g/mol. Purity: 0.97. IUPAC Name: ethyl(dimethyl)silicon. SMILES: CC[Si](C)C. | |
| Ethylene Glycol Monobutyl Ether Acrylate | Ethylene Glycol Monobutyl Ether Acrylate. | |
| Ethylene Glycol Monobutyl Ether Methacrylate | Ethylene Glycol Monobutyl Ether Methacrylate. | |
| Ethyl Methyl Carbonate | Liquid. Alternative Names: Carbonic Acid Ethyl Methyl Ester. CAS No. 623-53-0. Molecular formula: C4H8O3. Mole weight: 104.11. Purity: >98.0%(GC). IUPAC Name: ethyl methyl carbonate. SMILES: CCOC(=O)OC. InChI: InChI=1S/C4H8O3/c1-3-7-4(5)6-2/h3H2,1-2H3. | |
| Ethyl methyl sulfone | Ethyl methyl sulfone. Alternative Names: METHYLSULFONYLETHANE;ETHYL METHYL SULFONE;1-(Methylsulfonyl)ethane;Ethyl methyl sulphone;Methyl ethyl sulfone;1-mesylethane;Ethyl Methyl sulfone for alternative energy applications, 97%. CAS No. 594-43-4. Molecular formula: C3H8O2S. Mole weight: 108.16g/mol. IUPAC Name: 1-methylsulfonylethane. SMILES: CCS(=O)(=O)C. InChI: InChI=1S/C3H8O2S/c1-3-6(2,4)5/h3H2,1-2H3. | |
| Ethyl trans-alpha-cyano-3-indoleacrylate | Ethyl trans-alpha-cyano-3-indoleacrylate. Alternative Names: ETHYL TRANS-ALPHA-CYANO-3-INDOLEACRYLATE;ethyl trans-α-cyano-3-indoleacrylate;Ethyl(2E)-2-cyano-3-(1H-indolyl-3-yl)acrylate. CAS No. 62309-96-0. Molecular formula: C14H12N2O2. Mole weight: 240.26g/mol. Purity: 96%. IUPAC Name: ethyl (E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoate. SMILES: CCOC(=O)C(=CC1=CNC2=CC=CC=C21)C#N. InChI: InChI=1S/C14H12N2O2/c1-2-18-14(17)10(8-15)7-11-9-16-13-6-4-3-5-12(11)13/h3-7,9,16H,2H2,1H3/b10-7+. | |
| Ethyltriacetoxysilane | Triacetoxysilyl ethyl does not contain any additives such as catalysts, stabilizers or adhesion promoters. Usually used as a curing agent. Alternative Names: Ethyltriacetoxysilane; [diacetyloxy(ethyl)silyl] acetate; Triacetoxy(Ethyl)Silane; (Triacetoxy)ethylsilane. CAS No. 17689-77-9. Molecular formula: C8H14O6Si. Mole weight: 243.28 g/mol. Purity: 0.95. IUPAC Name: [diacetyloxy(ethyl)silyl]acetate. SMILES: CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C. | |
| Ethyltrimethylammonium Iodide | Ethyltrimethylammonium Iodide. Alternative Names: ACMC-1AN2M; EthyltrimethylammoniumIodide; AKOS015833263; LS-18019; Trimethylathylammoniumjodid; MFCD00054229; Ammonium, ethyltrimethyl-, iodide; Ethanaminium, N,N,N-trimethyl-, iodide; Trimethylethylammonium iodide; Ethanaminium,N,N,N-trimethyl-, iodide (1:1). CAS No. 51-93-4. Molecular formula: C5H14IN. Mole weight: 215.08. Purity: >98.0%T. IUPAC Name: ethyl(trimethyl)azanium;iodide. SMILES: CC[N+](C)(C)C.[I-]. InChI: InChI=1S/C5H14N.HI/c1-5-6(2,3)4;/h5H2,1-4H3;1H/q+1;/p-1. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.