Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| Cyanoethyl cellulose | Cyanoethyl cellulose. Alternative Names: cellulose,2-cyanoethylether;TRICYANOETHYLCELLULOSE;CELLULOSE, CYANOETHYLATED;CELLULOSE, CYANOETHYLATED POLYMER;CELLULOSE, CYANOETHYL ETHER;CYANOETHYL CELLULOSE;CAT 4687;Cellulose ethylcyanide. CAS No. 9004-41-5. Molecular formula: C6H8N2O. Mole weight: 124.14g/mol. IUPAC Name: 3-(2-cyanoethoxy)propanenitrile. SMILES: C(COCCC#N)C#N. InChI: InChI=1S/C6H8N2O/c7-3-1-5-9-6-2-4-8/h1-2,5-6H2. |  |
| Cyclic Trimethylolpropane Formal Acrylate | Cyclic Trimethylolpropane Formal Acrylate. | |
| Cyclohexyl Methacrylate | Cyclohexyl Methacrylate. | |
| Cyclohexyl Methacrylate | Liquid. Alternative Names: Methacrylic acid cyclohexyl ester. CAS No. 101-43-9. Molecular formula: CH2=C(CH3)COOC6H11. Mole weight: 168.23. IUPAC Name: cyclohexyl 2-methylprop-2-enoate. SMILES: CC(=C)C(=O)OC1CCCCC1. InChI: 1S/C10H16O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h9H,1,3-7H2,2H3. | |
| Cyclohexylmethyldichlorosilane | Cyclohexylmethyldichlorosilane. Alternative Names: DichlorCYclohexylmethylsilanemethylcyclohexyldichlorosilane. CAS No. 5578-42-7. Molecular formula: C7H14Cl2Si. Mole weight: 197.18 g/mol. Purity: 0.97. IUPAC Name: dichloro-cyclohexyl-methylsilane. SMILES: C[Si](C1CCCCC1)(Cl)Cl. | |
| Cyclohexyltrimethoxysilane | Cyclohexyltrimethoxysilane. Alternative Names: Cyclohexyltrimethoxysilane, 17865-54-2, ACMC-1BTZU, SureCN93335, ANW-22944, AKOS015840732, AG-E-28815, KB-49267, C2280, FT-0693178, I14-33808, Silane,cyclohexyltrimethoxy- (8CI,9CI);Cyclohexyltrimethoxysilane;cyclohexane, (trimethoxysilyl)-. CAS No. 17865-54-2. Molecular formula: C9H20O3Si. Mole weight: 204.34. Purity: 97%. IUPAC Name: cyclohexyl(trimethoxy)silane. SMILES: CO[Si](C1CCCCC1)(OC)OC. | |
| Cyclohexyl vinyl ether | Cyclohexyl vinyl ether. Alternative Names: (Vinyloxy)cyclohexane;Cyclohexane, (ethenyloxy)-;VINYLCYCLOHEXYL ETHER;CYCLOHEXYL VINYL ETHER;cyclohexylvinylether95+%;(ETHENYLOXY)CYCLOHEXANE;Cyclohexyl Vinyl Ether (stabilized with KOH);Cyclohexyl vinyl ether ,98%. CAS No. 2182-55-0. Molecular formula: C6H11OCH=CH2. Mole weight: 126.20. IUPAC Name: ethenoxycyclohexane. SMILES: C=COC1CCCCC1. InChI: 1S/C8H14O/c1-2-9-8-6-4-3-5-7-8/h2,8H,1,3-7H2. | |
| Cyclopentadienylmanganese(I) tricarbonyl | Cyclopentadienylmanganese(I) tricarbonyl. Alternative Names: Tricarbonyl(η5-2,4-cyclopentadien-1-yl)manganese. CAS No. 12079-65-1. Molecular formula: C8H5MnO35. Mole weight: 204.06. Purity: 95%+. SMILES: [Mn].[C-]#[O+].[C-]#[O+].[C-]#[O+].[CH]1[CH][CH][CH][CH]1. InChI: InChI=1S/C5H5.3CO.Mn/c1-2-4-5-3-1;3*1-2;/h1-5H. | |
| Cyclopentyltrimethoxysilane | Cyclopentyltrimethoxysilane. Alternative Names: CYCLOPENTYLTRIMETHOXYSILANE, 143487-47-2, ACMC-20albx, SureCN80385, CTK3J3466, AKOS006228007, AG-D-86058, FT-0624274, I14-33056. CAS No. 143487-47-2. Molecular formula: C8H18O3Si. Mole weight: 190.31. Purity: >96%. IUPAC Name: cyclopentyl(trimethoxy)silane. | |
| D(+)-2-Octanol | D(+)-2-Octanol. CAS No. 6169-6-8. Molecular formula: C8H18O. Mole weight: 130.23g/mol. IUPAC Name: (2S)-octan-2-ol. SMILES: CCCCCCC(C)O. InChI: InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3/t8-/m0/s1. | |
| DCPDA | DCPDA. Mole weight: 304. | |
| DCPEA | DCPEA. | |
| Decamethylcyclopentasiloxane | Decamethylcyclopentasiloxane (D5) is an organosilicon compound with the formula [(CH3)2SiO]5. It is a colorless and odorless liquid that is slightly volatile. The compound is classified as a cyclomethicone. Such fluids are commonly used in cosmetics, such as deodorants, sunblocks, hair sprays and skin care products. It is becoming more common in hair conditioners, as it makes the hair easier to brush without breakage. It is also used as part of silicone based personal lubricants. D5 is considered an emollient. In Canada, among the volume used in consumer products approximately 70% were for antiperspirants and 20% for hair care products. Alternative Names: Cyclopentasiloxane, decamethyl-;DecaMethylcyclopentasiloxane;2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane;D5 Cyclomethicone. CAS No. 541-02-6. Molecular formula: C10H30O5Si5. Mole weight: 370.77 g/mol. Purity: ≥99%. IUPAC Name: Decamethylcyclopentasiloxane. | |
| Decamethyltetrasiloxane | Decamethyltetrasiloxane. Alternative Names: Decamethyltetrasiloxane. CAS No. 141-62-8. Molecular formula: C10H30O3Si4. Mole weight: 310.69 g/mol. Purity: 0.95. IUPAC Name: [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane. SMILES: C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C. | |
| Decylamine | Decylamine. Alternative Names: 1-Aminodecane, NDA. CAS No. 2016-57-1. Molecular formula: C10H23N. Mole weight: 157.30. Purity: 95%+. IUPAC Name: decan-1-amine. SMILES: CCCCCCCCCCN. InChI: InChI=1S/C10H23N/c1-2-3-4-5-6-7-8-9-10-11/h2-11H2,1H3. | |
| DEGDMA | DEGDMA. Mole weight: 242. | |
| Dense silica coated upconversion nanoparticles (near-infrared light) | Dense silica coated upconversion nanoparticles (near-infrared light). | |
| Dense silica coated upconversion nanoparticles (violet blue light) | Dense silica coated upconversion nanoparticles (violet blue light). | |
| Dense silica coated upconversion nanoparticles (yellow-green light) | Dense silica coated upconversion nanoparticles (yellow-green light). | |
| Devardas alloy | Devardas alloy. Alternative Names: ALLOY ACCORDING TO DEVARDA;ALLOY ACC TO DEVARDA;COPPER ALLOYS;DEVARDAS ALLOY;DEVARDAS ALLOY SILYLATION REAGENT;DEVARDAS METAL;Devardas alloysilylation;DEVARDAS ALLOY, -100 MESH. CAS No. 8049-11-4. Molecular formula: AlCuZn. Mole weight: 155.9g/mol. SMILES: [Al].[Cu].[Zn]. InChI: InChI=1S/Al.Cu.Zn. | |
| Diallyl maleate | Liquid. Alternative Names: MALEIC ACID DIALLYL ESTER;BUTENEDIOIC ACID DIALLYL ESTER;DIALLYL MALEATE;DIALLYL MALLEATE;DI-(2-PROPENYL)MALEATE;2-Butenedioic acid (Z)-, di-2-propenyl ester;2-Butenedioicacid(Z)-,di-2-propenylester;Diallyl (2Z)-2-butenedioate. CAS No. 999-21-3. Molecular formula: CH2=CHCH2OCOCH=CHCOOCH2CH=CH2. Mole weight: 196.20. Purity: ≥ 97%. IUPAC Name: bis(prop-2-enyl) (Z)-but-2-enedioate. SMILES: C=CCOC(=O)\C=C/C(=O)OCC=C. InChI: 1S/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5-. | |
| Diammonium hydrogenphosphate | DryPowder; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid;ODOURLESS WHITE CRYSTALS OR POWDER. Alternative Names: SEC-AMMONIUM HYDROGEN PHOSPHATE;SEC AMMONIUM PHOSPHATE;PHOSPHORUS ICP STANDARD;ammoniummonohydrogenorthophosphate;diammonium;diammoniumacidphosphate;diammoniummonohydrogenphosphate;diammoniumorthophosphate. CAS No. 7783-28-0. Molecular formula: (NH4)2HPO4;(NH4)3PO4;(NH4)2HPO4;H9N2O4P. Mole weight: 132.06g/mol. IUPAC Name: diazanium;hydrogen phosphate. SMILES: [NH4+].[NH4+].OP(=O)([O-])[O-]. InChI: InChI=1S/2H3N.H3O4P/c;;1-5(2,3)4/h2*1H3;(H3,1,2,3,4). | |
| Diamondnaturalmonocrystallinepowd& | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; | |
| Dibenzothiophene | Dibenzothiophene. Alternative Names: Diphenylene sulfide. CAS No. 132-65-0. Molecular formula: C12H8S. Mole weight: 184.26. Purity: >98.0%(GC). IUPAC Name: dibenzothiophene. SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3S2. InChI: InChI=1S/C12H8S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H. | |
| Dibutyl adipate | Dibutyl adipate (DBA) is a plasticizer and a skin conditioning agent in cosmetics that is a mixture of a diester of butyl alcohol and adipic acid. It is soluble in water and organic solvents and does not absorb radiation in the ultraviolet region. Alternative Names: Butyl adipate. CAS No. 105-99-7. Molecular formula: [CH2CH2CO2(CH2)3CH3]2. Mole weight: 258.35. Purity: 99%+. IUPAC Name: Dibutyl hexanedioate. SMILES: CCCCOC(=O)CCCCC(=O)OCCCC. InChI: 1S/C14H26O4/c1-3-5-11-17-13(15)9-7-8-10-14(16)18-12-6-4-2/h3-12H2,1-2H3. | |
| Dibutyldimethoxytin | Dibutyldimethoxytin. Alternative Names: Di-n-Butyldimethoxytin. CAS No. 1067-55-6. Molecular formula: C10H24O2Sn. Mole weight: 295.01. Purity: 95%. IUPAC Name: dibutyl(dimethoxy)stannane. SMILES: CCCC[Sn](CCCC)(OC)OC. InChI: InChI=1S/2C4H9.2CH3O.Sn/c2*1-3-4-2;2*1-2;/h2*1,3-4H2,2H3;2*1H3;/q;2*-1;+2. | |
| Dibutyl fumarate | Dibutyl fumarate. Alternative Names: dibutyl (E)-but-2-enedioate. CAS No. 105-75-9. Molecular formula: C12H20O4. Mole weight: 228.28. Purity: 97%. IUPAC Name: Dibutyl (E)-but-2-enedioate. SMILES: CCCCOC(=O)C=CC(=O)OCCCC. InChI: InChI=1S/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7+. | |
| Dibutyl itaconate | Dibutyl itaconate (DBI) is an itaconate ester that can be prepared by an itaconic acid precursor. Alternative Names: Di(n -butyl) itaconate, Dibutyl itaconate. CAS No. 2155-60-4. Molecular formula: CH3(CH2)3O2CCH2C(=CH2)CO2(CH2)3CH3. Mole weight: 242.31. Purity: ≥ 97%. IUPAC Name: dibutyl 2-methylidenebutanedioate. SMILES: CCCCOC(=O)CC(=C)C(=O)OCCCC. InChI: 1S/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3. | |
| Dibutyl sebacate | Dibutyl sebacate(DBS) is a lipophilic dibutyl ester that can be used as a plasticizer with low solubility in water. Alternative Names: Dibutyl-1,10-decanedioate. CAS No. 109-43-3. Molecular formula: C18H34O4. Mole weight: 314.46. Purity: 98%+. IUPAC Name: Dibutyl decanedioate. SMILES: CCCCOC(=O)CCCCCCCCC(=O)OCCCC. InChI: InChI=1S/C18H34O4/c1-3-5-15-21-17(19)13-11-9-7-8-10-12-14-18(20)22-16-6-4-2/h3-16H2,1-2H3. | |
| Dibutyltin maleate | Dibutyltin maleate. Alternative Names: 3,2-Dioxastannepin-4,7-dione,2,2-dibutyl-1. CAS No. 78-04-6. Molecular formula: C12H20O4Sn. Mole weight: 346.99. | |
| Dichloro(1,5-cyclooctadiene)palladium(II) | Dichloro(1,5-cyclooctadiene)palladium(II). Alternative Names: Dichloro[(1,2,5,6-eta)-1,5-cyclooctadiene]-palladiu. CAS No. 12107-56-1. Molecular formula: C8H12Cl2Pd. Mole weight: 285.51. Purity: 98%. IUPAC Name: (1Z,5Z)-cycloocta-1,5-diene;dichloropalladium. SMILES: C1CC=CCCC=C1.Cl[Pd]Cl. InChI: InChI=1S/C8H12.2ClH.Pd/c1-2-4-6-8-7-5-3-1;/h1-2,7-8H,3-6H2;2*1H;/q;+2/p-2/b2-1-,8-7-. | |
| Dicyclopentadiene Acrylate | Dicyclopentadiene Acrylate. | |
| Dicycl Opentadiene Methacrylate | Dicycl Opentadiene Methacrylate. | |
| Didecylamine | Octadecyltrichlorosilane appears as a colorless liquid with a pungent odor. Decomposed by water to hydrochloric acid with the evolution of heat. Corrosive to metals and tissue. Used to make various silicon containing compounds. CAS No. 112-04-9. Molecular formula: C18H37Cl3Si. Mole weight: 387.9g/mol. IUPAC Name: trichloro(octadecyl)silane. SMILES: CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl. InChI: InChI=1S/C18H37Cl3Si/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(19,20)21/h2-18H2,1H3. | |
| Diethyl adipate | DBS can be used as a plasticizer for the formation of ethylcellulose based coating membranes which can be potentially used in drug delivery systems. It may also be used as a plasticizer during the fabrication of electronic artificial tongue sensors for analyzing the intensity of olive oils. Alternative Names: Adipic acid, diethyl ester;Hexanedioic acid, 1,6-diethyl ester;Hexanedioic acid, diethyl ester. CAS No. 141-28-6. Molecular formula: C10H18O4. Mole weight: 202.25. Purity: ≥ 97%. IUPAC Name: Diethyl hexanedioate. SMILES: CCOC(=O)CCCCC(=O)OCC. InChI: VIZORQUEIQEFRT-UHFFFAOYSA-N. | |
| Diethylene Glycol(200)Dlacrylate | Diethylene Glycol(200)Dlacrylate. | |
| Diethylene glycol dibenzoate | Plasticizer. Alternative Names: Diglycol dibenzoate. CAS No. 120-55-8. Molecular formula: C18H18O5. Mole weight: 314.3. Purity: 98%. IUPAC Name: 2-(2-Benzoyloxyethoxy)ethyl benzoate. SMILES: C1=CC=C(C=C1)C(=O)OCCOCCOC(=O)C2=CC=CC=C2. InChI: InChI=1S/C18H18O5/c19-17(15-7-3-1-4-8-15)22-13-11-21-12-14-23-18(20)16-9-5-2-6-10-16/h1-10H,11-14H2. | |
| Diethylene Glycol Dimethacrylate | Diethylene Glycol Dimethacrylate. | |
| Diethylene glycol divinyl ether | Liquid. Alternative Names: Bis(2-vinyloxyethyl)ether;DIETHYLENGLYCOLDIVINYLETHER;DIETHYLENE GLYCOL DIVINYL ETHER;DIVINYL DIETHYLENE GLYCOL DIETHER;1,1-[oxybis(ethyleneoxy)]diethylene;1-(2-[2-(Vinyloxy)ethoxy]ethoxy)ethylene;1,1-[oxybis(2,1-ethanediyloxy)bis]ethene;1,1'-[oxybis(2,1-. CAS No. 764-99-8. Molecular formula: C8H14O3. Mole weight: 158.19g/mol. IUPAC Name: 1-ethenoxy-2-(2-ethenoxyethoxy)ethane. SMILES: C=COCCOCCOC=C. InChI: InChI=1S/C8H14O3/c1-3-9-5-7-11-8-6-10-4-2/h3-4H,1-2,5-8H2. | |
| Diethylgermanium dichloride | Diethylgermanium dichloride. Alternative Names: DIETHYLGERMANIUM DICHLORIDE;DIETHYLDICHLOROGERMANE;DICHLORODIETHYLGERMANE;Diethyldichlorogermanium;Diethylgermaniumdichloride,min.97%;Diethylgermanium dichloride, min. 97%;Dichlorodiethylgermane,97%;Diethylgermanium dichloride 97%. CAS No. 13314-52-8. Molecular formula: C4H10Cl2Ge. Mole weight: 201.7g/mol. IUPAC Name: dichloro(diethyl)germane. SMILES: CC[Ge](CC)(Cl)Cl. InChI: InChI=1S/C4H10Cl2Ge/c1-3-7(5,6)4-2/h3-4H2,1-2H3. | |
| Diethylhexyl Acrylate | Diethylhexyl Acrylate. | |
| Diethylhexyl azelate | Liquid. Alternative Names: BIS(2-ETHYLHEXYL) AZELATE;BIS(2-ETHYLHEXYL) NONANEDIOATE;AZELAIC ACID DIOCTYL ESTER;AZELAIC ACID BIS(2-ETHYLHEXYL) ESTER;AZELAIC ACID DI(2-ETHYLHEXYL) ESTER;DI(2-ETHYLHEXYL) AZELATE;DIOCTYL AZELATE;DIISOOCYL AZELATE. CAS No. 103-24-2. Molecular formula: C25H48O4. Mole weight: 412.6g/mol. Purity: >75.0%(GC). IUPAC Name: bis(2-ethylhexyl) nonanedioate. SMILES: CCCCC(CC)COC(=O)CCCCCCCC(=O)OCC(CC)CCCC. InChI: InChI=1S/C25H48O4/c1-5-9-16-22(7-3)20-28-24(26)18-14-12-11-13-15-19-25(27)29-21-23(8-4)17-10-6-2/h22-23H,5-21H2,1-4H3. | |
| Diethylmethylsilane | Diethylmethylsilane. Alternative Names: Diethylmethylsilane, Silane, diethylmethyl-, 282588_ALDRICH, MolPort-003-929-172, EINECS 212-080-6, CID6327653, 760-32-7. CAS No. 760-32-7. Molecular formula: C5H14Si. Mole weight: 102.25 g/mol. Purity: 0.94. IUPAC Name: diethyl(methyl)silicon. SMILES: CC[Si](C)CC. | |
| Diethyl phthalate | Diethyl phthalate appears as a clear, colorless liquid without significant odor. More dense than water and insoluble in water. Hence sinks in water. Primary hazard is to the environment. Spread to the environment should be immediately stopped. Easily penetrates soil, contaminates groundwater and nearby waterways. Flash point 325°F. Severely irritates eyes and mildly irritates skin. Used in the manufacture of perfumes, plastics, mosquito repellents and many other products.;Liquid;COLOURLESS OILY LIQUID.;Colorless to water-white, oily liquid with a very slight, aromatic odor.;Colorless to water-white, oily liquid with a very slight, aromatic odor. [pesticide]. Alternative Names: Diethyl-1,2-benzenedicarboxylate. CAS No. 84-66-2. Molecular formula: C12H14O4. Mole weight: 222.24. Purity: 95%+. IUPAC Name: Diethyl benzene-1,2-dicarboxylate. SMILES: CCOC(=O)C1=CC=CC=C1C(=O)OCC. InChI: InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3. | |
| Diethyl sebacate | Plasticizer. Alternative Names: Ethyl sebacate. CAS No. 110-40-7. Molecular formula: C14H26O4. Mole weight: 258.35. Purity: 98%+. IUPAC Name: Diethyl decanedioate. SMILES: CCOC(=O)CCCCCCCCC(=O)OCC. InChI: InChI=1S/C14H26O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2/h3-12H2,1-2H3. | |
| Diethyl succinate | It is the diethyl ester of succinate. Alternative Names: Clorius. CAS No. 123-25-1. Molecular formula: C8H14O4. Mole weight: 174.19. Purity: 99%. IUPAC Name: Diethyl butanedioate. SMILES: CCOC(=O)CCC(=O)OCC. InChI: InChI=1S/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3. | |
| Dihydrogen hexahydroxyplatinate | Dihydrogen hexahydroxyplatinate. Alternative Names: Hydrogen hexahydroxyplatinate(IV). CAS No. 51850-20-5. Molecular formula: H8O6Pt. Mole weight: 299.14. Purity: 98%. IUPAC Name: hydron; platinum; hexahydroxide. | |
| Diisobutyl adipate | Diisobutyl adipate is a bis(2-methylpropyl) ester of adipic acid that is used as a plasticizer and a fatty acid in synthetic oils. Alternative Names: Hexanedioic acid 1,6-bis(2-methylpropyl) ester, NSC 6343. CAS No. 141-04-8. Molecular formula: C14H26O4. Mole weight: 258.35. Purity: 99%. IUPAC Name: bis(2-methylpropyl) hexanedioate. SMILES: CC(C)COC(=O)CCCCC(=O)OCC(C)C. InChI: 1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3. | |
| Diisobutyl fumarate | Diisobutyl fumarate. Alternative Names: Diisobutyl fumarate. CAS No. 7283-69-4. Molecular formula: (CH3)2CHCH2O2CCH=CHCO2CH2CH(CH3)2. Mole weight: 228.28. Purity: BP 192-230deg/8 mm. IUPAC Name: bis(2-methylpropyl) (E)-but-2-enedioate. SMILES: CC(C)COC(=O)\C=C\C(=O)OCC(C)C. InChI: 1S/C12H20O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3/b6-5+. | |
| Diisodecyl adipate | Plasticizer. Alternative Names: DIDA (plasticizer). CAS No. 27178-16-1. Molecular formula: C26H50O4. Mole weight: 426.67. Purity: ≥ 97%. IUPAC Name: bis(8-methylnonyl) hexanedioate. SMILES: CC(C)CCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC(C)C. InChI: 1S/C26H50O4/c1-23(2)17-11-7-5-9-15-21-29-25(27)19-13-14-20-26(28)30-22-16-10-6-8-12-18-24(3)4/h23-24H,5-22H2,1-4H3. | |
| Dilithium tetrabromonickelate(II) solution | Dilithium tetrabromonickelate(II) solution. Alternative Names: 13826-95-4;Dilithium tetrabromonickelate(II);Dilithium tetrabromonickelate(II), 0.5M solution in THF, AcroSeal(R);di-Lithium tetrabromonickelate(II);AGN-PC-0NF0DX;DTXSID20453236;Lithium tetrabromonickelate(II) solution;Dilithium tetrabromonickelate(II) solution. CAS No. 13826-95-4. Molecular formula: Br4Li2Ni. Mole weight: 392.189g/mol. IUPAC Name: dilithium;tetrabromonickel(2-). SMILES: [Li+].[Li+].[Ni-2](Br)(Br)(Br)Br. InChI: InChI=1S/4BrH.2Li.Ni/h4*1H;;;/q;;;;2*+1;+2/p-4. | |
| Dimethyl 1,3-adamantanedicarboxylate | Dimethyl 1,3-adamantanedicarboxylate. Alternative Names: DMADC. CAS No. 1459-95-6. Molecular formula: C14H20O4. Mole weight: 252.31g/mol. IUPAC Name: dimethyl adamantane-1,3-dicarboxylate. SMILES: COC(=O)[C@]12CC3CC(C1)C[C@@](C3)(C2)C(=O)OC. InChI: 1S/C14H20O4/c1-17-11(15)13-4-9-3-10(5-13)7-14(6-9,8-13)12(16)18-2/h9-10H,3-8H2,1-2H3/t9-,10+,13+,14-. | |
| Dimethyl[4-[1,7,7-tris(4-dimethylaminophenyl)-2,4,6-heptatrienylidene]-2,5-cyclohexadien-1-ylidene]ammonium perchlorate | Dimethyl[4-[1,7,7-tris(4-dimethylaminophenyl)-2,4,6-heptatrienylidene]-2,5-cyclohexadien-1-ylidene]ammonium perchlorate. Alternative Names: DIMETHYL[4-[1,7,7-TRIS(4-DIMETHYLAMINOPHENYL)-2,4,6-HEPTATRIENYLIDENE]-2,5-CYCLOHEXADIEN-1-YLIDENE]AMMONIUM PERCHLORATE;IR-895, 97%;dimethyl{4-[1,7,7-tris(4-dimethylaminophenyl)-2,4,6-heptatrienylidene]-2,5-cyclohexadien-1-ylidene}ammonium perchlorate;dim. CAS No. 34411-77-3. Molecular formula: C39H45ClN4O4. Mole weight: 669.2g/mol. IUPAC Name: dimethyl-[4-[(2E,4E)-1,7,7-tris[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]cyclohexa-2,5-dien-1-ylidene]azanium;perchlorate. SMILES: CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C=CC=CC=C(C3=CC=C(C=C3)N(C)C)C4=CC=C(C=C4)N(C)C.[O-]Cl(=O)(=O)=O. InChI: InChI=1S/C39H45N4.ClHO4/c1-40(2)34-22-14-30(15-23-34)38(31-16-24-35(25-17-31)41(3)4)12-10-9-11-13-39(32-18-26-36(27-19-32)42(5)6)33-20-28-37(29-21-33)43(7)8;2-1(3,4)5/h9-29H,1-8H3;(H,2,3,4,5)/q+1;/p-1. | |
| Dimethyl adipate | Plasticizer. Alternative Names: Dibasicesters. CAS No. 627-93-0. Molecular formula: C8H14O4. Mole weight: 174.19. Purity: 98%. IUPAC Name: Dimethyl hexanedioate. SMILES: COC(=O)CCCCC(=O)OC. InChI: InChI=1S/C8H14O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H2,1-2H3. | |
| (Dimethylamino)trimethyltin | (Dimethylamino)trimethyltin. Alternative Names: Dimethylaminotrimethylstannane;Stannanamine, pentamethyl-;PENTAMETHYLSTANNANAMINE;TRIMETHYLSTANNYLDIMETHYLAMIDE;(DIMETHYLAMINO)TRIMETHYLTIN;(Dimethylamino)trimethyltin(IV), technical grade;(dimethylamino)trimethyltin(iv);N-Methyl-N-(trimethylstannyl)metha. CAS No. 993-50-0. Molecular formula: C5H15NSn. Mole weight: 207.89g/mol. IUPAC Name: N-methyl-N-trimethylstannylmethanamine. SMILES: CN(C)[Sn](C)(C)C. InChI: InChI=1S/C2H6N.3CH3.Sn/c1-3-2;;;;/h1-2H3;3*1H3;/q-1;;;;+1. | |
| Dimethyl azelate | Dimethyl azelate. Alternative Names: Nonanedioic acid, 1,9-dimethyl ester. CAS No. 1732-10-1. Molecular formula: C11H20O4. Mole weight: 216.27. Purity: 98%. IUPAC Name: Dimethyl nonanedioate. SMILES: COC(=O)CCCCCCCC(=O)OC. InChI: InChI=1S/C11H20O4/c1-14-10(12)8-6-4-3-5-7-9-11(13)15-2/h3-9H2,1-2H3. | |
| Dimethyl Dodecanedioate | Dimethyl Dodecanedioate. Alternative Names: 1,12-Dimethyl dodecanedioate. CAS No. 1731-79-9. Molecular formula: C14H26O4. Mole weight: 258.35. Purity: 98%. IUPAC Name: dimethyl dodecanedioate. SMILES: COC(=O)CCCCCCCCCCC(=O)OC. InChI: InChI=1S/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3. | |
| Dimethyl sebacate | Dimethyl sebacate (DMS) is a plasticizer that can be synthesized by esterification of sebacic acid. Alternative Names: Sebacic acid dimethyl ester, NSC 9415, Decanedioic acid 1,10-dimethyl ester, Dimethyl decanedioate. CAS No. 106-79-6. Molecular formula: CH3OCO(CH2)8COOCH3. Mole weight: 230.30. Purity: 94%. IUPAC Name: Dimethyl decanedioate. SMILES: COC(=O)CCCCCCCCC(=O)OC. InChI: 1S/C12H22O4/c1-15-11(13)9-7-5-3-4-6-8-10-12(14)16-2/h3-10H2,1-2H3. | |
| Dimethylselenide | Liquid. Alternative Names: SELENIUM DIMETHYL;(CH3)2Se;(Methylselanyl)methane;dimethyl-selenid;Methane, selenobis-;methane,selenobis-;Methyl selenium;Methylselanylmethane. CAS No. 593-79-3. Molecular formula: C2H6Se. Mole weight: 109.04g/mol. IUPAC Name: methylselanylmethane. SMILES: C[Se]C. InChI: InChI=1S/C2H6Se/c1-3-2/h1-2H3. | |
| Dimethyltin dichloride | Dimethyltin dichloride. Alternative Names: DICHLORODIMETHYLSTANNANE;DICHLORODIMETHYLTIN;DIMETHYL-TIN-CHLORIDE;DIMETHYLTIN DICHLORIDE;DIMETHYLTIN(IV) DICHLORIDE;DIMETHYLDICHLOROTIN;(CH3)2SnCl2;Dichlorid dimethylcinicity. CAS No. 753-73-1. Molecular formula: C2H6Cl2Sn. Mole weight: 219.68. Purity: 99%. IUPAC Name: dichloro(dimethyl)stannane. SMILES: C[Sn](C)(Cl)Cl. | |
| Dimethyltin oxide | Dimethyltin oxide. Alternative Names: Dimethyl(oxo)tin. CAS No. 2273-45-2. Molecular formula: C2H6OSn. Mole weight: 164.78. Purity: 97%. IUPAC Name: Dimethyl(oxo)tin. SMILES: C[Sn](=O)C. InChI: InChI=1S/2CH3.O.Sn/h2*1H3. | |
| Dioxane Glycol Dimethacrylate | Dioxane Glycol Dimethacrylate. | |
| Dipentaerythritol Pentaacrylate/Hexaacrylate | Dipentaerythritol Pentaacrylate/Hexaacrylate. | |
| Diphenylethyne-3,3',5,5'-tetracarboxylic acid | Diphenylethyne-3,3',5,5'-tetracarboxylic acid. CAS No. 957014-38-9. | |
| Diphenylgermanium dichloride | Diphenylgermanium dichloride. Alternative Names: dichlorodiphenyl-german;DIPHENYLDICHLOROGERMANE;DIPHENYLGERMANIUM DICHLORIDE;dichlorodiphenylgermane;Diphenylgermanium dichloride, 98+%;Diphenylgermanium dichloride,95%;Dichlorodiphenylgermanium;Diphenyldichlorogermanium. CAS No. 1613-66-7. Molecular formula: C12H10Cl2Ge. Mole weight: 297.7g/mol. IUPAC Name: dichloro(diphenyl)germane. SMILES: C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(Cl)Cl. InChI: InChI=1S/C12H10Cl2Ge/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H. | |
| Diphenyliodonium hexafluorophosphate | Diphenyliodonium hexafluorophosphate. Alternative Names: DPIHFP. CAS No. 58109-40-3. Molecular formula: (C6H5)2I(PF6). Mole weight: 426.08. Purity: 96%. IUPAC Name: di(phenyl)iodanium. SMILES: F[P-](F)(F)(F)(F)F.[I+](c1ccccc1)c2ccccc2. InChI: 1S/C12H10I.F6P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2,3,4,5)6/h1-10H;/q+1;-1. | |
| Diphenyliodonium nitrate | Diphenyliodonium nitrate (DPIN) is a photoacid generator (PAG) that goes through photolysis reaction which can be used in the lithographic formation of UV reactive polymers. It can also be used in forming a light tuned self-assembled polyelectrolytic structures. Alternative Names: DPIN. CAS No. 722-56-5. Molecular formula: (C6H5)2INO3. Mole weight: 343.12. IUPAC Name: diphenyliodanium;nitrate. SMILES: [O-][N+]([O-])=O.[I+](c1ccccc1)c2ccccc2. InChI: 1S/C12H10I.NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;/q+1;-1. | |
| Diphenyliodonium p-toluenesulfonate | Diphenyliodonium p-toluenesulfonate. Alternative Names: DPIpTS. CAS No. 6293-66-9. Molecular formula: (C6H5)2IC6H4(SO3)CH3. Mole weight: 452.3g/mol. IUPAC Name: diphenyliodanium;4-methylbenzenesulfonate. SMILES: Cc1ccc(cc1)S([O-])(=O)=O.[I+](c2ccccc2)c3ccccc3. InChI: 1S/C12H10I.C7H8O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6-2-4-7(5-3-6)11(8,9)10/h1-10H;2-5H,1H3,(H,8,9,10)/q+1;/p-1. | |
| Diphenyliodonium trifluoromethanesulfonate | Diphenyliodonium trifluoromethanesulfonate. Alternative Names: DIPHENYLIODONIUM TRIFLATE;DIPHENYLIODONIUM TRIFLUOROMETHANESULFONATE;DIPHENYLIODONIUM TRIFLUOROMETHANESULPHONATE;DIPHENYLIODONIUM TRIFLATE, 99+%, ELECTRO;Diphenyliodonium trifluoromethanesulphonate 98%;Diphenyliodoniumtrifluoromethanesulphonate98%;Dipheny. CAS No. 66003-76-7. Molecular formula: C13H10F3IO3S. Mole weight: 430.18. Purity: 96%. IUPAC Name: diphenyliodanium;trifluoromethanesulfonate. SMILES: C1=CC=C(C=C1)[I+]C2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-]. | |
| Diphenylsilane | Diphenylsilane. Alternative Names: Diphenylsilane, Silane, diphenyl-, 148482_ALDRICH, NSC33013, EINECS 212-271-4, NSC 33013, NSC168693, 775-12-2, 17950-94-6. CAS No. 775-12-2. Molecular formula: C12H12Si. Mole weight: 184.31 g/mol. Purity: 0.97. IUPAC Name: di(phenyl)silicon. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.