Alfa Chemistry Materials 2 - Products
Alfa Chemistry Materials is specialized in material chemistry and offers an extensive catalog of materials in a wide range of applications, including Metals and Materials, 3D Printing Materials, Biomaterials.
| Product | Description | |
|---|---|---|
| COF&9,9-Dioctyl-9H-fluorene-2,7-diamine | COF&9,9-Dioctyl-9H-fluorene-2,7-diamine. Molecular formula: C29H44N2. Mole weight: 420.7g/mol. IUPAC Name: 9,9-dioctylfluorene-2,7-diamine. InChI: InChI=1S/C29H44N2/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(30)15-17-25(27)26-18-16-24(31)22-28(26)29/h15-18,21-22H,3-14,19-20,30-31H2,1-2H3. |  |
| COF&9,9'-spirobi[fluoren]-2,2',3,3',6,6',7,7'-octaamine(Hydrochloride) | COF&9,9'-spirobi[fluoren]-2,2',3,3',6,6',7,7'-octaamine(Hydrochloride). | |
| COF&9H-Carbazole,9-hexyl-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | COF&9H-Carbazole,9-hexyl-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-. Molecular formula: C30H43B2NO4. Mole weight: 503.3g/mol. IUPAC Name: 9-hexyl-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole. InChI: InChI=1S/C30H43B2NO4/c1-10-11-12-13-18-33-25-16-14-21(31-34-27(2,3)28(4,5)35-31)19-23(25)24-20-22(15-17-26(24)33)32-36-29(6,7)30(8,9)37-32/h14-17,19-20H,10-13,18H2,1-9H3. | |
| COF&Benzaldehyde, 4,4'-[(2,5-dimethoxy-1,4-phenylene)di-2,1-ethynediyl]bis- | COF&Benzaldehyde, 4,4'-[(2,5-dimethoxy-1,4-phenylene)di-2,1-ethynediyl]bis-. | |
| COF&Benzenamine,3,3'-(1,3-butadiyne-1,4-diyl)bis- | COF&Benzenamine,3,3'-(1,3-butadiyne-1,4-diyl)bis-. | |
| COF&Benzenamine, 4, 4'- (10, 20- diphenyl- 21H, 23H- porphine- 5, 15- diyl) bis- | COF&Benzenamine, 4, 4'- (10, 20- diphenyl- 21H, 23H- porphine- 5, 15- diyl) bis-. | |
| COF&Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis- | COF&Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis-. | |
| COF&Benzenamine,4,4'-(1,2-ethynediyl)bis- | COF&Benzenamine,4,4'-(1,2-ethynediyl)bis-. | |
| COF&Benzenamine, 4,4',4''-(1,3,5-benzenetriyltri-2,1-ethynediyl)tris- | COF&Benzenamine, 4,4',4''-(1,3,5-benzenetriyltri-2,1-ethynediyl)tris-. | |
| COF&Benzenamine,4,4',4''-[1,3,5-benzenetriyltris(oxy)]tris- | COF&Benzenamine,4,4',4''-[1,3,5-benzenetriyltris(oxy)]tris-. | |
| COF&Benzenamine, 4, 4', 4''- (1, 3, 5- triazine- 2, 4, 6- triyl) tris- | COF&Benzenamine, 4, 4', 4''- (1, 3, 5- triazine- 2, 4, 6- triyl) tris-. | |
| COF&Benzenamine, 4, 4', 4''- [1, 3, 5- triazine- 2, 4, 6- triyltris(oxy) ] tris- | COF&Benzenamine, 4, 4', 4''- [1, 3, 5- triazine- 2, 4, 6- triyltris(oxy) ] tris-. | |
| COF&Benzenamine, 4, 4', 4'', 4'''- (1, 2- ethenediylidene) tetrakis- | COF&Benzenamine, 4, 4', 4'', 4'''- (1, 2- ethenediylidene) tetrakis-. | |
| COF&Benzenamine, 4,4',4'',4'''-(1,3,6,8-pyrenetetrayl)tetrakis- | COF&Benzenamine, 4,4',4'',4'''-(1,3,6,8-pyrenetetrayl)tetrakis-. | |
| COF&Benzenamine, 4- (4, 4, 5, 5- tetramethyl- 1, 3, 2- dioxaborolan- 2- yl) | COF&Benzenamine, 4- (4, 4, 5, 5- tetramethyl- 1, 3, 2- dioxaborolan- 2- yl). | |
| COF&Benzene, 1,1',1'',1'''-methanetetrayltetrakis[4-ethynyl- | COF&Benzene, 1,1',1'',1'''-methanetetrayltetrakis[4-ethynyl-. | |
| COF&Benzene, 1,2,4,5-tetraethynyl- | COF&Benzene, 1,2,4,5-tetraethynyl-. | |
| COF&Benzene-1,3,5-tricarbohydrazide | COF&Benzene-1,3,5-tricarbohydrazide. Molecular formula: C9H12N6O3. Mole weight: 252.23g/mol. IUPAC Name: benzene-1,3,5-tricarbohydrazide. InChI: InChI=1S/C9H12N6O3/c10-13-7(16)4-1-5(8(17)14-11)3-6(2-4)9(18)15-12/h1-3H,10-12H2,(H,13,16)(H,14,17)(H,15,18). | |
| COF&Benzene-1,3,5-triyltriboronic Acid | COF&Benzene-1,3,5-triyltriboronic Acid. Molecular formula: C6H9B3O6. Mole weight: 209.6g/mol. IUPAC Name: (3,5-diboronophenyl)boronic acid. InChI: InChI=1S/C6H9B3O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3,10-15H. | |
| COF&benzene-1,4-dicarboximidamide dihydrochloride | COF&benzene-1,4-dicarboximidamide dihydrochloride. | |
| COF&Benzo[1, 2- d:4, 5- d'] bisthiazole- 2, 6- diamine | COF&Benzo[1, 2- d:4, 5- d'] bisthiazole- 2, 6- diamine. | |
| COF&Benzonitrile, 4, 4'- (1, 3, 6, 8- tetrahydro- 1, 3, 6, 8- tetraoxobenzo[lmn] [3, 8] phenanthroline- 2,R | COF&Benzonitrile, 4, 4'- (1, 3, 6, 8- tetrahydro- 1, 3, 6, 8- tetraoxobenzo[lmn] [3, 8] phenanthroline- 2,R. | |
| COF&Benzonitrile, 4, 4', 4''- [1, 3, 5- benzenetriyltris(oxy ) ] tris- (9CI) | COF&Benzonitrile, 4, 4', 4''- [1, 3, 5- benzenetriyltris(oxy ) ] tris- (9CI). | |
| COF&Benzonitrile, 4,4',4'',4'''-methanetetrayltetrakis- | COF&Benzonitrile, 4,4',4'',4'''-methanetetrayltetrakis-. | |
| COF&BFBAPy | COF&BFBAPy. | |
| COF&Boronic acid, [2,2'-bipyridine]-4,4'-diylbis- | COF&Boronic acid, [2,2'-bipyridine]-4,4'-diylbis-. Molecular formula: C10H10B2N2O4. Mole weight: 243.8g/mol. IUPAC Name: [2-(4-boronopyridin-2-yl)pyridin-4-yl]boronic acid. InChI: InChI=1S/C10H10B2N2O4/c15-11(16)7-1-3-13-9(5-7)10-6-8(12(17)18)2-4-14-10/h1-6,15-18H. | |
| COF&Boronic acid, B, B'- [2, 2'- bithiophene] - 5, 5'- diylbis- , homopolymer | COF&Boronic acid, B, B'- [2, 2'- bithiophene] - 5, 5'- diylbis- , homopolymer. | |
| COF&COF&9,9'-spirobi[fluoren]-2,2',3,3',6,6',7,7'-octaamine(Hydrochloride) | COF&COF&9,9'-spirobi[fluoren]-2,2',3,3',6,6',7,7'-octaamine(Hydrochloride). | |
| COF&Dipyrazino[2,3-f:2',3'-h]quinoxaline-2,3,6,7,10,11-hexacarbonitrile | COF&Dipyrazino[2,3-f:2',3'-h]quinoxaline-2,3,6,7,10,11-hexacarbonitrile. Molecular formula: C18N12. Mole weight: 384.3g/mol. IUPAC Name: 3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16,17-hexacarbonitrile. InChI: InChI=1S/C18N12/c19-1-7-8(2-20)26-14-13(25-7)15-17(29-10(4-22)9(3-21)27-15)18-16(14)28-11(5-23)12(6-24)30-18. | |
| COF&Dipyrido[3,2-a:2',3'-c]phenazine | COF&Dipyrido[3,2-a:2',3'-c]phenazine. Molecular formula: C18H10N4. Mole weight: 282.3g/mol. IUPAC Name: quinoxalino[2,3-f][1,10]phenanthroline. InChI: InChI=1S/C18H10N4/c1-2-8-14-13(7-1)21-17-11-5-3-9-19-15(11)16-12(18(17)22-14)6-4-10-20-16/h1-10H. | |
| COF&Ferrocene-1,1'-dicarbaldehyde | COF&Ferrocene-1,1'-dicarbaldehyde. | |
| COF&Melem | COF&Melem. Molecular formula: C6H6N10. Mole weight: 218.18g/mol. IUPAC Name: 11-imino-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,7,9-pentaene-3,7-diamine. InChI: InChI=1S/C6H6N10/c7-1-10-4-12-2(8)14-6-15-3(9)13-5(11-1)16(4)6/h(H6,7,8,9,10,11,12,13,14,15). | |
| COF&N1,N3,N5-tris(4-aminophenyl)benzene-1,3,5-tricarboxamide | COF&N1,N3,N5-tris(4-aminophenyl)benzene-1,3,5-tricarboxamide. Molecular formula: C27H24N6O3. Mole weight: 480.5g/mol. IUPAC Name: 1-N,3-N,5-N-tris(4-aminophenyl)benzene-1,3,5-tricarboxamide. InChI: InChI=1S/C27H24N6O3/c28-19-1-7-22(8-2-19)31-25(34)16-13-17(26(35)32-23-9-3-20(29)4-10-23)15-18(14-16)27(36)33-24-11-5-21(30)6-12-24/h1-15H,28-30H2,(H,31,34)(H,32,35)(H,33,36). | |
| COF&N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine | COF&N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine. Molecular formula: C30H28N6. Mole weight: 472.6g/mol. IUPAC Name: 4-N-[4-(4-amino-N-(4-aminophenyl)anilino)phenyl]-4-N-(4-aminophenyl)benzene-1,4-diamine. InChI: InChI=1S/C30H28N6/c31-21-1-9-25(10-2-21)35(26-11-3-22(32)4-12-26)29-17-19-30(20-18-29)36(27-13-5-23(33)6-14-27)28-15-7-24(34)8-16-28/h1-20H,31-34H2. | |
| COF&Pyrazine-2,5-diamine | COF&Pyrazine-2,5-diamine. Molecular formula: C4H6N4. Mole weight: 110.12g/mol. IUPAC Name: pyrazine-2,5-diamine. InChI: InChI=1S/C4H6N4/c5-3-1-7-4(6)2-8-3/h1-2H,(H2,6,7)(H2,5,8). | |
| COF&Pyrazine-2,6-diamine(Hydrochloride) | COF&Pyrazine-2,6-diamine(Hydrochloride). | |
| COF&Pyridine-2,4-diamine | COF&Pyridine-2,4-diamine. Molecular formula: C5H7N3. Mole weight: 109.13g/mol. IUPAC Name: pyridine-2,4-diamine. InChI: InChI=1S/C5H7N3/c6-4-1-2-8-5(7)3-4/h1-3H,(H4,6,7,8). | |
| COF&Pyridine-2,4-dicarbonitrile | COF&Pyridine-2,4-dicarbonitrile. Molecular formula: C7H3N3. Mole weight: 129.12g/mol. IUPAC Name: pyridine-2,4-dicarbonitrile. InChI: InChI=1S/C7H3N3/c8-4-6-1-2-10-7(3-6)5-9/h1-3H. | |
| COF&Pyridine-3,5-diamine | COF&Pyridine-3,5-diamine. Molecular formula: C5H7N3. Mole weight: 109.13g/mol. IUPAC Name: pyridine-3,5-diamine. InChI: InChI=1S/C5H7N3/c6-4-1-5(7)3-8-2-4/h1-3H,6-7H2. | |
| COF&Pyrimidine-4,6-dicarbonitrile | COF&Pyrimidine-4,6-dicarbonitrile. Molecular formula: C6H2N4. Mole weight: 130.11g/mol. IUPAC Name: pyrimidine-4,6-dicarbonitrile. InChI: InChI=1S/C6H2N4/c7-2-5-1-6(3-8)10-4-9-5/h1,4H. | |
| COF&(S)-2,2'-dihydroxy-1,1'-binaphthyl-3,3'-dialdehyde | COF&(S)-2,2'-dihydroxy-1,1'-binaphthyl-3,3'-dialdehyde. | |
| COF&Silane,(1,2,3,4,5,6-benzenehexaylhexa-2,1-ethynediyl)hexakis[trimethyl- | COF&Silane,(1,2,3,4,5,6-benzenehexaylhexa-2,1-ethynediyl)hexakis[trimethyl-. | |
| COF&Silane, (1,3,6,8-pyrenetetrayltetra-2,1-ethynediyl)tetrakis[trimethyl- | COF&Silane, (1,3,6,8-pyrenetetrayltetra-2,1-ethynediyl)tetrakis[trimethyl-. | |
| COF&tetrakis(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)silane | COF&tetrakis(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)silane. Molecular formula: C48H64B4O8Si. Mole weight: 840.4g/mol. IUPAC Name: tetrakis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane. InChI: InChI=1S/C48H64B4O8Si/c1-41(2)42(3,4)54-49(53-41)33-17-25-37(26-18-33)61(38-27-19-34(20-28-38)50-55-43(5,6)44(7,8)56-50,39-29-21-35(22-30-39)51-57-45(9,10)46(11,12)58-51)40-31-23-36(24-32-40)52-59-47(13,14)48(15,16)60-52/h17-32H,1-16H3. | |
| COF&tetrakis[4-(4'-cyanophenyl)phenyl]ethene | COF&tetrakis[4-(4'-cyanophenyl)phenyl]ethene. | |
| COF&Tetrakis(4-ethynylphenyl)ethane | COF&Tetrakis(4-ethynylphenyl)ethane. Molecular formula: C34H20. Mole weight: 428.5g/mol. IUPAC Name: 1-ethynyl-4-[1,2,2-tris(4-ethynylphenyl)ethenyl]benzene. InChI: InChI=1S/C34H20/c1-5-25-9-17-29(18-10-25)33(30-19-11-26(6-2)12-20-30)34(31-21-13-27(7-3)14-22-31)32-23-15-28(8-4)16-24-32/h1-4,9-24H. | |
| COF&Tetrakis(4-ethynylphenyl)silane | COF&Tetrakis(4-ethynylphenyl)silane. Molecular formula: C32H20Si. Mole weight: 432.6g/mol. IUPAC Name: tetrakis(4-ethynylphenyl)silane. InChI: InChI=1S/C32H20Si/c1-5-25-9-17-29(18-10-25)33(30-19-11-26(6-2)12-20-30,31-21-13-27(7-3)14-22-31)32-23-15-28(8-4)16-24-32/h1-4,9-24H. | |
| COF&Tetrakis(4-hydroxyphenyl)methane | COF&Tetrakis(4-hydroxyphenyl)methane. | |
| COF&Thieno[3,2-b]thiophene-2,5-dicarbaldehyde | COF&Thieno[3,2-b]thiophene-2,5-dicarbaldehyde. Molecular formula: C8H4O2S2. Mole weight: 196.3g/mol. IUPAC Name: thieno[3,2-b]thiophene-2,5-dicarbaldehyde. InChI: InChI=1S/C8H4O2S2/c9-3-5-1-7-8(11-5)2-6(4-10)12-7/h1-4H. | |
| COF&TIPS-pentacene | COF&TIPS-pentacene. | |
| COF&Tricyclo[3.3.1.13,7]decane, 1,3,5,7-tetrakis(4-aminophenyl)- | COF&Tricyclo[3.3.1.13,7]decane, 1,3,5,7-tetrakis(4-aminophenyl)-. | |
| COF&Triphenylamine-4,4',4 | COF&Triphenylamine-4,4',4. | |
| COF&Tris(4-ethynylphenyl) amine | COF&Tris(4-ethynylphenyl) amine. | |
| COF&Tris-(p-cyanophenyl)amin-Radikalkation | COF&Tris-(p-cyanophenyl)amin-Radikalkation. | |
| Collagen | Collagen. | |
| Collagen from bovine achilles tendon | Collagen from bovine achilles tendon. CAS No. 9007-34-5. | |
| Collagen, Type I solution from rat tail | Collagen, Type I solution from rat tail. CAS No. 9007-34-5. | |
| Colloidal graphite powder | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid; | |
| Conductive Flexible TPU Filament | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; We | |
| Conductive Graphene Filament,3D Printing Materials | Carbon black oil appears as a dark colored liquid with a petroleum-like odor. Less dense than water and insoluble in water. Vapors heavier than air.;Carbon, activated is a black grains that have been treated to improve absorptive ability. May heat spontaneously if not properly cooled after manufacture.;Carbon, animal or vegetable origin appears as a black powder or granular mixed with a tar or starch and water binder pressed into regular lumps or briquettes. Heats slowly and ignites in air especially if wet.;Graphite (natural) appears as a mineral form of the element carbon. Hexagonal crystals or thin leaf-like layers. Steel-gray to black with a metallic luster and a greasy feel. An electrical conductor. Used for high-temperature crucibles, as a lubricant and in "lead" pencils.;DryPowder; DryPowder, Liquid; DryPowder, PelletsLargeCrystals; DryPowder, PelletsLargeCrystals, WetSolid, OtherSolid, Liquid; DryPowder, WetSolid, Liquid; Liquid; OtherSolid; OtherSolid, GasVapor, Liquid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid, Liquid; WetSolid; WetSolid, Liquid;OtherSolid; PelletsLargeCrystals;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals; PelletsLargeCrystals, OtherSolid; WetSolid;DryPowder; DryPowder, OtherSolid; DryPowder, PelletsLargeCrystals; DryPowder, WetSolid; Liquid; OtherSolid; PelletsLargeCrystals; PelletsLargeCrysta | |
| Conductive silver printing ink, resistivity 30 - 35 μΩ-cm | Conductive silver printing ink, resistivity 30 - 35 μΩ-cm. | |
| Conductive silver printing ink, resistivity 5-6 μΩ cm | Conductive silver printing ink, resistivity 5-6 μΩ cm. | |
| -COOH modified upconverting nanoparticles (green light) | -COOH modified upconverting nanoparticles (green light). | |
| -COOH Modified Upconverting Nanoparticles (near-infrared light) | -COOH Modified Upconverting Nanoparticles (near-infrared light). | |
| -COOH Modified Upconverting Nanoparticles (purple-blue light) | -COOH Modified Upconverting Nanoparticles (purple-blue light). | |
| -COOH Modified Upconverting Nanoparticles (UV light) | -COOH Modified Upconverting Nanoparticles (UV light). | |
| -COOH modified upconverting nanoparticles (Yellow green light) | -COOH modified upconverting nanoparticles (Yellow green light). | |
| Copper Beryllium foil, alloy C17200, 0.15mm (0.006in) thick | Copper Beryllium foil, alloy C17200, 0.15mm (0.006in) thick. | |
| Copper Beryllium foil, alloy C17200, 0.25mm (0.01in) thick | Copper Beryllium foil, alloy C17200, 0.25mm (0.01in) thick. | |
| Copper Beryllium foil, alloy C17200, 0.4mm (0.016in) thick | Copper Beryllium foil, alloy C17200, 0.4mm (0.016in) thick. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.