A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| 2-(9H-Carbazol-9-yl)ethyl acrylate97 | 2-(9H-Carbazol-9-yl)ethyl acrylate97. Alternative Names: 2-(9H-CARBAZOL-9-YL)ETHYL ACRYLATE97;2-(9h-carbazol-9-yl)ethyl acrylate;2-(9H-Carbazol-9-yl)ethylmethacrylate,9H-Carbazole-9-ethylacrylate;2-(9-Carbazolyl)ethyl acrylate;2-Carbazolylethyl acrylate;9-(2-Hydroxyethyl)carbazole acrylate. CAS No. 6915-68-0. Molecular formula: C17H15NO2. Mole weight: 265.31. Purity: 96%. IUPAC Name: 2-carbazol-9-ylethyl prop-2-enoate. SMILES: C=CC(=O)OCCN1C2=CC=CC=C2C3=CC=CC=C31. |  |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5,7-Triazabicyclo[4.4.0]dec-5-ene Salt | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5,7-Triazabicyclo[4.4.0]dec-5-ene Salt. CAS No. 1346753-09-0. Molecular formula: C23H25N3O4. Mole weight: 407.5g/mol. IUPAC Name: 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CNC2=NCCCN2C1. InChI: InChI=1S/C16H12O4.C7H13N3/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-3-8-7-9-4-2-6-10(7)5-1/h2-9H,1H3,(H,18,19);1-6H2,(H,8,9). | |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5,7-Triazabicyclo[4.4.0]dec-5-ene Salt, ≥98% | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5,7-Triazabicyclo[4.4.0]dec-5-ene Salt, ≥98%. CAS No. 1346753-09-0. Molecular formula: C23H25N3O4. Mole weight: 407.5g/mol. IUPAC Name: 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CNC2=NCCCN2C1. InChI: InChI=1S/C16H12O4.C7H13N3/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-3-8-7-9-4-2-6-10(7)5-1/h2-9H,1H3,(H,18,19);1-6H2,(H,8,9). | |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt. CAS No. 1346753-04-5. Molecular formula: C23H24N2O4. Mole weight: 392.4g/mol. IUPAC Name: 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CC2=NCCCN2C1. InChI: InChI=1S/C16H12O4.C7H12N2/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-3-7-8-4-2-6-9(7)5-1/h2-9H,1H3,(H,18,19);1-6H2. | |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt, ≥98% | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt, ≥98%. CAS No. 1346753-04-5. Molecular formula: C23H24N2O4. Mole weight: 392.4g/mol. IUPAC Name: 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CC2=NCCCN2C1. InChI: InChI=1S/C16H12O4.C7H12N2/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-3-7-8-4-2-6-9(7)5-1/h2-9H,1H3,(H,18,19);1-6H2. | |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt. CAS No. 1346753-05-6. Molecular formula: C25H28N2O4. Mole weight: 420.5g/mol. IUPAC Name: 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CCC2=NCCCN2CC1. InChI: InChI=1S/C16H12O4.C9H16N2/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-2-5-9-10-6-4-8-11(9)7-3-1/h2-9H,1H3,(H,18,19);1-8H2. | |
| 2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt, ≥98% | 2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt, ≥98%. CAS No. 1346753-05-6. Molecular formula: C25H28N2O4. Mole weight: 420.5g/mol. IUPAC Name: 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine;2-(9-oxoxanthen-2-yl)propanoic acid. SMILES: CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CCC2=NCCCN2CC1. InChI: InChI=1S/C16H12O4.C9H16N2/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14;1-2-5-9-10-6-4-8-11(9)7-3-1/h2-9H,1H3,(H,18,19);1-8H2. | |
| 2-(9-Phenyl-9H-carbazol-3-yl)-10,10-dioxide-9H-thioxanthen-9-one | 2-(9-Phenyl-9H-carbazol-3-yl)-10,10-dioxide-9H-thioxanthen-9-one. CAS No. 1623010-64-9. Molecular formula: C31H19NO3S. Mole weight: 485.55. Purity: 99%. | |
| 2A3 | 2A3 (2-aminopyridine-3-carboxylic acid imidazolide) is a T cell activator that specifically binds to CEACAM6 and CEACAM5. 2A3 exhibits enzymatic activity that catalyzes the glucuronidation of specific substrates (e.g., 1-naphthol), and possesses significant cytotoxic activity. When integrated into CAR T cells or used alone, 2A3 acts by inducing cytokine release, degranulation, and direct cytotoxicity. 2A3 kills pancreatic and breast cancer cells with high target antigen expression in vitro, and significantly inhibits the growth of pancreatic cancer xenografts in vivo. 2A3 broadly targets malignant tumors with overexpressed CEACAM5, CEACAM6, or co-expressed both, and shows high expression mainly in tissues such as the liver and colon. 2A3 serves as an important research tool for the immunotherapy of pancreatic and breast cancer[1][2]. 2A3 is a novel SHAPE reagent, which can be used for the analysis of RNA structure both in vitro and in vivo[3]. 2A3 is an electrophilic chemical probe that acylates the 2'-OH in the RNA backbone. 2A3 can be used for RNA SHAPE-MaP experiments and is capable of analyzing the RNA secondary structures at single nucleotide resolution. Uses: Scientific research. Category: Signaling pathways. Alternative Names: 2-aminopyridine-3-carboxylic acid imidazolide. CAS No. 2765091-45-8. Pack Sizes: 10 mM * 1 mL in DMSO; 5 mg; 10 mg; 25 mg; 50 mg; 100 mg. Product ID: HY-164899. |  |
| 2-Abz-Gly-OH HCl | 2-Abz-Gly-OH HCl. Synonyms: 2-(2-Aminobenzamido)Acetic Acid Hydrochloride. Grade: ≥ 99% (TLC). CAS No. 256657-23-5. Molecular formula: C9H10N2O3·HCl. Mole weight: 230.65. |  |
| 2'-Ac-Docetaxel | 2'-Ac-Docetaxel is an impurity of Docetaxel, which is a semisynthetic derivative of Paclitaxel used to treat a variety of cancers, including breast, head and neck, stomach, prostate, and non-small cell lung cancer. Synonyms: 2'-O-Acetyldocetaxel; Docetaxel Impurity 57; (2α,5β,7β,10β,13α)-4-(acetyloxy)-13-({(2R,3S)-2-(acetyloxy)-3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoyl}oxy)-1,7,10-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate; Benzenepropanoic acid, α-(acetyloxy)-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-12b-(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,6,11-trihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (αR,βS)-; 2'-acetyldocetaxel. CAS No. 151509-27-2. Molecular formula: C45H55NO15. Mole weight: 849.92. | |
| 2-Acetamido-1,2-dideoxy-galactonojirimycin | 2-Acetamido-1,2-dideoxy-galactonojirimycin is a highly potent small molecule inhibitor. This compound exerts its inhibitory effects by hampering the enzymatic function prevalent in lysosomal storage disorders. Synonyms: DGJNAc; 2-Acetamido-1,5-imino-1,2,5-trideoxy-D-galactitol. CAS No. 117894-14-1. Molecular formula: C8H16N2O4. Mole weight: 204.22. | |
| 2-Acetamido-1,2-dideoxynojirimycin | An analogue of deoxynojirimycin, was found to be a potent inhibitor of a number of N-acetyl glucosaminidases. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 1mg. US Biological Life Sciences. |  Worldwide |
| 2-Acetamido-1,2-dideoxynojirimycin Hydrochloride | 2-Acetamido-1,2-dideoxynojirimycin is an analogue of deoxynojirimycin, was found to be a potent inhibitor of a number of N-acetyl glucosaminidases. Group: Biochemicals. Grades: Highly Purified. CAS No. 1356848-49-1. Pack Sizes: 500ug, 1mg. Molecular Formula: C8H17ClN2O4. US Biological Life Sciences. | Worldwide |
| 2-Acetamido-1,2-dideoxynojirimycin Hydrochloride | 2-Acetamido-1,2-dideoxynojirimycin is an analogue of deoxynojirimycin, was found to be a potent inhibitor of a number of N-acetylglucosaminidases. Synonyms: N-[(3S,4R,5R,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-piperidinyl]acetamide Hydrochloride; 2-Acetamido-1,5-imino-1,2,5-trideoxy-D-glucitol Hydrochloride; Acetamide, N-[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-piperidinyl]-, hydrochloride (1:1). Grade: 97%. CAS No. 1356848-49-1. Molecular formula: C8H17ClN2O4. Mole weight: 240.68. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-5-thio-a-D-glucopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-5-thio-α-D-glucopyranose, a bioactive compound, holds prodigious potential for its indispensability in the synthesis of antibiotics. Additionally, it can be studied further to investigate its therapeutic efficacy in addressing bacterial and fungal infections. Synonyms: 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-5-thio-alpha-D-glucopyranose; SCHEMBL17077284; (2S,3R,4R,5S,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-thiopyran-2,4,5-triyl triacetate. CAS No. 67561-97-1. Molecular formula: C16H23NO9S. Mole weight: 405.42. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-galactopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-galactopyranose is a crucial component extensively used in the research and development of glycosylated compounds and pharmaceutical compounds targeting bacterial or fungal infections. This compound plays a pivotal role in drug discovery and formulation processes. Synonyms: a-D-Galactosamine pentaacetate. CAS No. 10385-50-9. Molecular formula: C16H23NO10. Mole weight: 389.36. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose is an exquisite pharmaceutical compound with formidable antibiotic properties. It can effectively stifl the growth and replication of pernicious bacteria. This compound precisely targets and hampers key enzymes implicated in bacterial cell wall research and development, obliterating their structural fortitude and impeding their unchecked proliferation. Synonyms: 1,2,3,4,6-Penta-O-acetyl-a-D-glucosamine; a-D-Glucosamine pentaacetate; 2-(Acetylamino)-2-deoxy-a-D-glucopyranose 1,3,4,6-tetraacetate. CAS No. 7784-54-5. Molecular formula: C16H23NO10. Mole weight: 389.36. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose, a highly coveted chemical compound within the biomedical industry, presents itself as an activated donor substrate in enzymatic reactions, driving synthesis of oligosaccharides and glycoconjugates alike with stunning efficacy. As an intermediate in antibiotic production, this compound's strong antibacterial properties are widely regarded. Additionally, its usage in the study of potential therapies, including those against cancer, inflammation, and diabetes, markedly amplifies its importance. Synonyms: b-D-Galactosamine pentaacetate. CAS No. 3006-60-8. Molecular formula: C16H23NO10. Mole weight: 389.35. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranosyl PEG5-NHS | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranosyl PEG5-NHS, a functionalized polyethylene glycol (PEG) component widely employed in bioconjugation processes, has the potential to enhance the pharmacokinetic traits of administered drugs or other entities. This is achieved through the modification of the solubility or clearance properties of target molecules. By harboring an NHS ester group, it facilitates the attainment of selective reactions with amine groups on the intended targets. The utilization of 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranosyl PEG5-NHS in conjugation studies provides a platform for successful biofunctionalization outcomes, thereby advancing research and development in the pharmaceutical industry. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-glucopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-glucopyranose is a crucial compound commonly used in biomedicine. With its unique chemical properties, it is particularly essential in the development of pharmaceuticals for bacterial infections, as well as investigating drug delivery systems for targeted therapies. Synonyms: b-D-Glucosamine pentaacetate; 1,2,3,4,6-Penta-O-acetyl-b-D-glucosamine. CAS No. 7772-79-4. Molecular formula: C16H23NO10. Mole weight: 389.36. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-mannopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-mannopyranose, a chemical compound with remarkable properties, is widely employed in the synthesis of glycosylated natural products and pharmaceuticals. This compound, boasting a wide range of potential applications, is adept at the development of glycoconjugates for research into diseases particularly bacterial and viral infections. Incorporating 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-mannopyranose into your research endeavors guarantees outstanding results. Synonyms: β-D-Mannopyranose, 2-(acetylamino)-2-deoxy-, 1,3,4,6-tetraacetate; Mannopyranose, 2-acetamido-2-deoxy-, 1,3,4,6-tetraacetate, β-D-; 1,3,4,6-Tetra-O-acetyl-2-acetamido-2-deoxy-β-D-mannopyranose; 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-β-D-mannopyranose; NSC 232059; (2S,3S,4R,5S,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-pyran-2,4,5-triyl triacetate. Grade: ≥95%. CAS No. 6730-10-5. Molecular formula: C16H23NO10. Mole weight: 389.35. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-thioglucopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-thioglucopyranose, commonly known as ATDG, exhibits multifaceted applications in the field of chemistry. It plays a key role in the development of glycopeptide antibiotics, particularly vancomycin, which is renowned for its efficacy against resistant strains of bacteria. With its potential to synthesize chitooligosaccharides, ATDG offers a promising avenue for exploring the biological and pharmaceutical properties of oligosaccharides. Furthermore, this chemical compound acts as a vital reagent in chemical reactions, enabling the synthesis of various multifunctional molecules. Molecular formula: C16H23NO9S. Mole weight: 405.42. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose, a remarkable derivative of D-galactose, boasts an immense presence in the biomedical sector as a substantial chemical intermediate. It serves as the cornerstone for synthesizing a diverse range of pharmaceuticals. Pivotal in the realm of medicinal progress against infectious maladies like bacterial and viral infections, this compound's structural intricacies and exceptional attributes render it an indispensable constituent for producing potent antiviral and antibacterial therapeutic agents. Synonyms: D-Galactosamine pentaacetate; 1,2,3,4,6-Penta-O-acetyl-D-galactosamine. CAS No. 76375-60-5. Molecular formula: C16H23NO10. Mole weight: 389.35. | |
| 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-gluconhydroximo-1,5-lactone | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-gluconhydroximo-1,5-lactone is an esteemed compound agent, seamlessly used to study specific bacterial infections. Its profound potential rests in its unparalleled ability to proficiently impede bacterial expansion by diligently targeting enzymes crucial for cell wall research and development. Synonyms: LogNAc tetraacetate; 2-Acetamido-2-deoxy-D-gluconhydroximo-1,5-lactone-1-3,4,6-tetraacetate. CAS No. 132152-77-3. Molecular formula: C16H22N2O10. Mole weight: 402.35. | |
| 2-Acetamido-1,3,4,6-tetra-O-benzyl-2-deoxy-a-D-glucopyranoside | 2-Acetamido-1,3,4,6-tetra-O-benzyl-2-deoxy-a-D-glucopyranoside is a crucial compound used in the biomedical industry for research purposes. It is employed in studying the synthesis and biological activities of carbohydrates, particularly their interactions with proteins. This compound finds applications in drug development targeting various diseases like cancer, viral infections, and autoimmune disorders. Synonyms: N-((2S,3R,4R,5S,6R)-2,4,5-Tris(benzyloxy)-6-((benzyloxy)methyl)tetrahydro-2H-pyran-3-yl)acetamide; Benzyl 2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-alpha-D-glucopyranoside; Phenylmethyl 2-(Acetylamino)-2-deoxy-3,4,6-tris-O-(phenylmethyl)-alpha-D-glucopyranoside. CAS No. 38416-56-7. Molecular formula: C36H39NO6. Mole weight: 581.70. | |
| 2-Acetamido-1,3,4,6-tetra-O-benzyl-2-deoxy-b-D-thioglucopyranose | 2-Acetamido-1,3,4,6-tetra-O-benzyl-2-deoxy-b-D-thioglucopyranose, a chemical entity, has been extensively researched due to its promising potential in the development of antibacterial and antitumor agents. This compound has been shown to possess remarkable indications for combatting bacterial infections, such as tuberculosis, and cancer. Hence, its therapeutic utility in the treatment of life-threatening ailments is indeed noteworthy. Molecular formula: C36H39NO5S. Mole weight: 597.76. | |
| 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose. CAS No. 1094213-88-3. Molecular formula: C14H20FNO8. Mole weight: 349.31. | |
| 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose. Synonyms: 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-α-L-galactopyranose. CAS No. 115509-87-0. Molecular formula: C14H21NO8. Mole weight: 331.32. | |
| 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose. Synonyms: β-D-Glucopyranose, 2-(acetylamino)-2,6-dideoxy-, 1,3,4-triacetate; 2-(Acetylamino)-2,6-dideoxy-β-D-glucopyranose 1,3,4-triacetate; 1,3,4-Tri-O-acetyl-6-deoxy-β-D-GlcNAc; N-Acetyl-β-D-quinovosamine 1,3,4-triacetate; 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-β-D-glucopyranoside; 1,3,4-tri-O-N-Acetyl-6-desoxy-β-D-glucosamine. Grade: ≥98%. CAS No. 13475-86-0. Molecular formula: C14H21NO8. Mole weight: 331.32. | |
| 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose, an intriguing compound found in the field of biomedicine, exhibits tremendous potential for therapeutic applications. This compound has sparked great interest among researchers due to its remarkable effectiveness in combatting a myriad of ailments. Its utilization in the treatment of cancer, infectious diseases, and inflammation has yielded promising outcomes, further consolidating its standing as a valuable asset in the pursuit of medical advancements. Synonyms: D-Mannopyranose, 2-(acetylamino)-2-deoxy-, 1,3,4-tributanoate. CAS No. 1020166-63-5. Molecular formula: C23H39NO9. Mole weight: 473.56. | |
| 2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-galactopyranose | 2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-galactopyranose is a vital compound in biomedicine utilized for the development of drugs targeting various diseases. With its unique properties, it is commonly employed in the synthesis of antiviral agents and antibiotics. This compound plays a crucial role in combating infectious diseases and contributes to advancements in pharmaceutical research and treatment strategies. Synonyms: D-Galactopyranose, 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 1,3,6-triacetate. CAS No. 120664-90-6. Molecular formula: C14H20FNO8. Mole weight: 349.31. | |
| 2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-glucopyranose | 2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-glucopyranose is an intriguing compound of interest in the biomedical sector, exhibiting immense promise as a foundational building block for curating novel therapeutic agents. Its intricate molecular configuration and distinct characteristics render it an ideal candidate for scientific investigations focusing on the development of carbohydrate-derived medications. Synonyms: D-Glucopyranose, 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 1,3,6-triacetate. CAS No. 116049-57-1. Molecular formula: C14H20FNO8. Mole weight: 349.31. | |
| 2-Acetamido-1,3,6-tri-O-acetyl-2-deoxy-a-D-glucopyranose | N-Acetylglucosamine triacetate, a derivative of 2-deoxyglucose, is a ubiquitous compound within the biomedical industry employed as a crucial precursor for the synthesis of diverse glycosylated molecules, including glycoproteins and glycolipids. Furthermore, it has demonstrated promising therapeutic effects in conditions such as osteoarthritis and inflammatory bowel disease by modulating cellular signaling pathways vital to their pathogenesis, collectively underscoring its therapeutic value. CAS No. 73024-74-5. Molecular formula: C14H21NO9. Mole weight: 347.32. | |
| 2-Acetamido-1,3,6-tri-O-acetyl-6-azido-2,6-dideoxy-D-galactopyranose | 2-Acetamido-1,3,6-tri-O-acetyl-6-azido-2,6-dideoxy-D-galactopyranose, a synthetic sugar derivative, proves to be highly versatile in the production and study of glycoconjugate vaccines and glycosylation. Its applications extend beyond vaccines as well, showcasing its potential as a foundation for novel antimicrobial and antitumor agents. Its intricate and diverse molecular structure allows for in-depth exploration and experimentation in the field of chemical synthesis. CAS No. 657363-19-4. | |
| 2-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-a-D-glucopyranoside | 2-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-a-D-glucopyranoside is an extensively utilized biomedical compound, manifesting intricate properties in research of diverse infectious diseases. Its robust inhibitory actions critically disrupt the replication and amplification of infectious agents by selectively thwarting key enzymes. Synonyms: Benzyl 2-acetamido-3,6-di-O-benzyl-2- deoxy-a-D-glucopyranoside. CAS No. 55287-49-5. Molecular formula: C29H33NO6. Mole weight: 491.58. | |
| 2-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-b-D-glucopyranoside | 2-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-b-D-glucopyranoside is a precursor for glycosylation, facilitating the creation of glycosides. Its outstanding potential for research on combating an array of maladies, encompassing cancer, bacterial infections, and inflammatory disorders. Synonyms: Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-beta-D-glucopyranoside; Benzyl (5xi)-2-acetamido-3,6-di-O-benzyl-2-deoxy-beta-D-lyxo-hexopyranoside. CAS No. 62867-63-4. Molecular formula: C29H33NO6. Mole weight: 491.58. | |
| 2-Acetamido-1,3-di-O-acetyl-2-deoxy-D-glucopyranose | 2-Acetamido-1,3-di-O-acetyl-2-deoxy-D-glucopyranose, a versatile chemical compound heavily employed in biochemistry research, is noteworthy for its extensive use in the synthesis of glycoproteins. Owing to its unique molecular structure, it serves as an excellent starting material for preparing diverse glycosides and oligosaccharides. Its potential to curb the growth of cancer cells, on the other hand, positions it as a promising candidate for the development of anti-cancer agents, highlighting its significance in the medical field. Molecular formula: C12H19NO8. Mole weight: 305.28. | |
| 2-Acetamido-1,3-di-O-acetyl-4,6-O-benzylidene-2-deoxy-D-glucopyranose | 2-Acetamido-1,3-di-O-acetyl-4,6-O-benzylidene-2-deoxy-D-glucopyranose, a chemical compound of great interest in the biomedical field, bears significant potential in both diagnostic and therapeutic applications. This compound boasts an intricate and distinctive structure that renders it a prime candidate for the development of pharmaceutical agents with antimicrobial efficacy. Notably, its unparalleled properties make it particularly alluring for the production of drugs that combat the evolution of antibiotic-resistant microorganisms. Synonyms: 2-ACETAMIDO-1,3-DI-O-ACETYL-4,6-O-BENZYLIDENE-2-DEOXY-D-GLUCOPYRANOSE; 1423035-26-0; SCHEMBL2502900. CAS No. 1423035-26-0. Molecular formula: C19H23NO8. Mole weight: 393.4. | |
| 2-Acetamido-1,3-di-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside | 2-Acetamido-1,3-di-O-benzyl-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside is a multifaceted biomedical compound with remarkable aptitude in enzymatic modulation, bacterial growth inhibition and precise receptor targeting. It can be used to study microbial infestations, cancer, inflammation and diabetes. Synonyms: Benzyl 2-acetamido-3-O-benzyl-4,6-O-benzylidene-2-deoxy-beta-D-glucopyranoside; N-((4aR,6R,7R,8R,8aS)-6,8-Bis(benzyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxin-7-yl)acetamide. CAS No. 14040-20-1. Molecular formula: C29H31NO6. Mole weight: 489.56. | |
| 2-Acetamido-1,3-thiazole-5-carboxylic acid | 2-Acetamido-1,3-thiazole-5-carboxylic acid. Alternative Names: 2-(Acetylamino)-1,3-thiazole-5-carboxylic acid, 2-Acetamido-5-carboxy-1,3-thiazole. CAS No. 1170060-19-1. Purity: 96%. Product ID: ACM1170060191. Molecular formula: C6H6N2O3S. Mole weight: 186.1904. IUPAC Name: 2-acetamido-1,3-thiazole-5-carboxylic acid. Alfa Chemistry - ISO 9001:32057 Certified. |  |
| 2-Acetamido-1,4-imino-1,2,4-trideoxy-L-arabinitol | 2-Acetamido-1,4-imino-1,2,4-trideoxy-L-arabinitol is a crucial compound in biomedicine. It acts as an inhibitor of bacterial glycosidases, holding great potential in the development of novel antibiotics. With its unique structural characteristics, this compound has shown promising results in treating bacterial infections caused by drug-resistant strains. Its mechanism of action disrupts essential enzymatic activities, making it a valuable tool in combating various drug-resistant bacterial diseases. Synonyms: LABNAc. CAS No. 944329-24-2. Molecular formula: C7H14N2O3. Mole weight: 174.20. | |
| 2-Acetamido-1,5-naphthalenedisulfonate | 2-Acetamido-1,5-naphthalenedisulfonate. CAS No. 137372-20-4. Product ID: ACM137372204. Alfa Chemistry - ISO 9001:32057 Certified. | |
| 2-Acetamido-1,6-di-O-benzyl-3-O-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-2-deoxy-4-O-(b-D-galactopyranosyl)-a-D-glucopyranoside | 2-Acetamido-1,6-di-O-benzyl-3-O-(2,3,4-tri-O-benzyl-b-L-fucopyranosyl)-2-deoxy-4-O-(b-D-galactopyranosyl)-a-D-glucopyranoside, a compound falling under the glycosides category, serves as a significant biomedicine for the treatment of specific ailments. With its distinctive therapeutic attributes, this scientific formulation holds utmost importance in biomedical research and pharmaceutical progress. Its intricate structure contributes to its predominant role in investigating and targeting receptors or pathways associated with diseases, thereby fostering advancements in drug design and development. Synonyms: Benzyl 2-acetamido-6-O-benzyl-3-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-4-(b-D-galactopyranosyl)-2-deoxy-a-D-glucopyranoside; Phenylmethyl O-6-deoxy-2,3,4-tris-O-(phenylmethyl)-α-L-galactopyranosyl-(1→3)-O-[β-D-galactopyranosyl-(1→4)]-2-(acetylamino)-2-deoxy-6-O-(phenylmethyl)-α-D-glucopyranoside; N-((2S,3R,4R,5S,6R)-2-(benzyloxy)-6-((benzyloxy)methyl)-5-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4-(((2S,3S,4R,5R,6S)-3,4,5-tris(benzyloxy)-6-methyltetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-3-yl)acetamide. CAS No. 71208-05-4. Molecular formula: C55H65NO15. Mole weight: 980.13. | |
| 2-Acetamido-1,6-di-O-benzyl-3-O-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-4-O-[2-O-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-3,4,6-tri-O-benzyl-b-D-galactopyranosyl]-2-deoxy-D-glucopyranoside | 2-Acetamido-1,6-di-O-benzyl-3-O-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-4-O-[2-O-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-3,4,6-tri-O-benzyl-b-D-galactopyranosyl]-2-deoxy-D-glucopyranoside is a compound used in biomedicine for the research of certain diseases. It has potential applications in the development of antiviral drugs due to its inhibitory effects against viral replication. Additionally, it shows promise in the treatment of autoimmune disorders by modulating immune responses. CAS No. 60920-97-0. Molecular formula: C103H111NO19. Mole weight: 1667.03. | |
| 2-Acetamido-1-nitro-3,5,6-trifluorobenzene | 2-Acetamido-1-nitro-3,5,6-trifluorobenzene. Group: Biochemicals. Grades: Highly Purified. CAS No. 388-11-4. Pack Sizes: 100mg, 250mg. Molecular Formula: C8H5F3N2O3, Molecular Weight: 234.13. US Biological Life Sciences. | Worldwide |
| 2-Acetamido-2- (1- (Tert-Butoxycarbonyl) Piperidin-4-Yl) Propanoic Acid | 2-Acetamido-2- (1- (Tert-Butoxycarbonyl) Piperidin-4-Yl) Propanoic Acid. Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g. US Biological Life Sciences. | Worldwide |
| 2-Acetamido-2-(2-(2-amino-3-hydroxyphenyl)-2-oxoethyl)malonic Acid Diethyl Ester | 2-Acetamido-2-(2-(2-amino-3-hydroxyphenyl)-2-oxoethyl)malonic Acid Diethyl Ester is an UV degradation product of 3-Hydroxy Kynurenine (H943695), a metabolite of tryptophan. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 5mg, 25mg. Molecular Formula: C17H22N2O7. US Biological Life Sciences. | Worldwide |
| 2-Acetamido-2,4-dideoxy-4-fluoro-a-D-glucopyranose | 2-Acetamido-2,4-dideoxy-4-fluoro-a-D-glucopyranose is a pivotal compound extensively utilized in the biomedical sector, demonstrating remarkable antimicrobial efficacy. It assumes a paramount position in combating select bacterial infections, thereby serving as an invaluable asset within the domain of antibiotic formulation and therapeutic agent design. Its profound impact on the mitigation of infectious diseases reinforces its indispensability in the ongoing battle against such maladies. Synonyms: 4-F-GlcNAc. CAS No. 129728-87-6. Molecular formula: C8H14FNO5. Mole weight: 223.20. | |
| 2-Acetamido-2,4-dideoxy-4-fluoro-D-galactopyranose | 2-Acetamido-2,4-dideoxy-4-fluoro-D-galactopyranose is a valuable compound widely used in the biomedical industry. This compound exhibits potential therapeutic effects in treating various diseases, especially those caused by pathogenic bacteria. Additionally, it serves as a crucial precursor in the synthesis of drugs targeting antibiotic-resistant strains. Synonyms: D-Galactopyranose, 2-(acetylamino)-2,4-dideoxy-4-fluoro-. CAS No. 129728-92-3. Molecular formula: C8H14FNO5. Mole weight: 223.20. | |
| 2-Acetamido-2,4-dideoxy-4-fluoro-D-glucopyranose | 2-Acetamido-2,4-dideoxy-4-fluoro-D-glucopyranose, a synthetic monosaccharide, boasts broad-spectrum antibacterial properties and has emerged as a promising therapeutic agent to combat infectious diseases. Its unique chemical structure and mechanism of action, which block bacterial cell wall biosynthesis, enable it to combat resistant bacterial strains that evade conventional antibiotics. Therefore, this sugar molecule has the potential to treat a wide range of bacterial infections and mitigate the growing threat of antimicrobial resistance. CAS No. 115973-75-6. Molecular formula: C8H14FNO5. Mole weight: 223.20. | |
| 2-Acetamido-2,4-dideoxy-D-xylo-hexose | 2-Acetamido-2,4-dideoxy-D-xylo-hexose is a crucial component in biomedicine used for its therapeutic properties. With its ability to inhibit bacterial cell wall synthesis, it serves as an effective antibiotic in treating various infections caused by susceptible bacteria. Additionally, it shows promising results as an anti-inflammatory agent, making it potential for managing diseases characterized by inflammation. Synonyms: D-xylo-Hexose, 2-(acetylamino)-2,4-dideoxy-; 2-(Acetylamino)-2,4-dideoxy-D-xylo-hexose. CAS No. 40555-55-3. Molecular formula: C8H15NO5. Mole weight: 205.21. | |
| 2-Acetamido-2,6-dideoxy-D-galactose | 2-Acetamido-2,6-dideoxy-D-galactose, an essential constituent in the production of diverse breeds of antimicrobials, embraces macrolides and aminoglycosides. Nevertheless, it also performs a crucial role as an antagonist of N-acetylglucosamine transferase, a pivotal enzyme that facilitates the synthesis of intricate glycoproteins. Moreover, scientific scrutiny has demonstrated that 2-Acetamido-2,6-dideoxy-D-galactose exhibits promising prospects in the treatment of specified bacterial infections and malignant neoplastic diseases. Synonyms: N-Acetyl-D-fucosamine. CAS No. 35233-39-7. Molecular formula: C8H15NO5. Mole weight: 205.21. | |
| 2-Acetamido-2,6-dideoxy-L-galactose | 2-Acetamido-2,6-dideoxy-L-galactose, a monosaccharide derivative, has been investigated thoroughly for its diverse applications in the field of bacterial inhibition. Scientific studies reveal a substantial inhibitory potential of this derivative against numerous bacterial strains such as the notorious Staphylococcus aureus, which is responsible for causing infections. Apart from its anti-bacterial properties, it adds further significance as a potential precursor in the production of glycopeptide antibiotics. With remarkable results, this derivative holds tremendous promise in the advancement of new antibiotics. Synonyms: N-Acetyl-L-fucosamine. CAS No. 49694-69-1. Molecular formula: C8H15NO5. Mole weight: 205.21. | |
| 2-Acetamido-2,6-dideoxy-L-mannose | 2-Acetamido-2,6-dideoxy-L-mannose, a carbohydrate compound with potential antibacterial properties, exhibits inhibitory effects against bacterial growth. With Pseudomonas aeruginosa being a common culprit of hospital-acquired infections, this compound has been subjected to laboratory tests; the research aims to determine its efficacy as a candidate for antibiotic drug intervention concerning different bacterial infections. Synonyms: 2,6-Dideoxy-2-Acetamido-L-Mannopyranose; 2,6-Dideoxy-2-Acetamido-L-Mannopyranoside; 2,6-Dideoxy-2-Acetamido-L-Mannose; 2,6-Dideoxy-2-Acetamido-Mannopyranose; 2,6-Dideoxy-2-Acetamido-Mannopyranoside; 2,6-Dideoxy-2-Acetamido-Mannose; 2-Acetamido-2,6-Dideoxy-L-Mannopyranose; 2-Acetamido-2,6-Dideoxy-L-Mannopyranoside; 2-Acetamido-2,6-Dideoxy-L-Mannose; 2-Acetamido-2,6-Dideoxy-Mannopyranose; 2-Acetamido-2,6-Dideoxy-Mannopyranoside; 2-Acetamido-2,6-Dideoxy-Mannose; L-RhaNAc; N-Acetyl-L-Rhamnosamine; N-Acetyl-Rhamnosamine; RhaNAc; SCHEMBL22748638; CHEBI:181398; C21056; N-[(3R,4S,5R,6S)-2,4,5-trihydroxy-6-methyloxan-3-yl]acetamide. Molecular formula: C8H15NO5. Mole weight: 205.21. | |
| 2-Acetamido-2,6-dideoxy-L-talose | 2-Acetamido-2,6-dideoxy-L-talose is an amino sugar found in the capsular polysaccharide obtained from Alteromonas Nigrifaciens. Synonyms: N-Acetyl-6-deoxy-L-talosamine; 2-(Acetylamino)-2,6-dideoxy-L-talose. Grade: 97%. CAS No. 49694-70-4. Molecular formula: C8H15NO6. Mole weight: 205.21. | |
| 2-Acetamido-2-deoxy-1,3,4,6-tetra-0-acetyl-α-D-glucopyranose | 2-Acetamido-2-deoxy-1,3,4,6-tetra-0-acetyl-α-D-glucopyranose. Synonyms: D-Glucopyranose, 2-(acetylamino)-2-deoxy-, 1,3,4,6-tetraacetate; 1,3,4,6-Tetra-O-acetyl-2-(acetylamino)-2-deoxyhexopyranose. CAS No. 14086-90-9. Molecular formula: C16H23NO10. Mole weight: 389.35. | |
| 2-Acetamido-2-deoxy-1,4,6-tri-O-acetyl-3-O-(2,3,4-tri-O-acetyl-a-L-fucopyranosyl)-D-glucopyranose | 2-Acetamido-2-deoxy-1,4,6-tri-O-acetyl-3-O-(2,3,4-tri-O-acetyl-a-L-fucopyranosyl)-D-glucopyranose is an extensively studied compound with vast potential in the realm of biomedicine. Revered for its exceptional medicinal properties, this chemical has shown remarkable efficacy in battling diverse ailments, spanning from malignant tumors to stubborn bacterial invasions. Counted as an invaluable asset within the pharmaceutical domain, it propels groundbreaking drug discoveries, fueling the advancement of innovative therapeutic approaches. Synonyms: 2-(Acetylamino)-2-deoxy-3-O-(2,3,4-tri-O-acetyl-6-deoxy-a-L-galactopyranosyl)-D-glucopyranose 1,4,6-triacetate; D-Glucopyranose, 2-(acetylamino)-2-deoxy-3-O-(2,3,4-tri-O-acetyl-6-deoxy-α-L-galactopyranosyl)-, 1,4,6-triacetate; (2S,3S,4R,5R,6S)-2-(((3R,4R,5S,6R)-3-Acetamido-2,5-diacetoxy-6-(acetoxymethyl)tetrahydro-2H-pyran-4-yl)oxy)-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate; 2-Acetamido-2-deoxy-3-O-(α-L-fucopyranosyl)-D-glucopyranose Pentaacetate. CAS No. 309263-13-6. Molecular formula: C26H37NO16. Mole weight: 619.57. | |
| 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-N[N-(benzyloxycarbonyl)-ε-aminocaproyl]-β-D-glucopyranosylamine | Ligand for wheat germ agglutinin. Uses: Ligand for wheat germ agglutinin. Synonyms: [6-Oxo-6-[[3,4,6-tri-O-acetyl-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]amino]hexyl]carbamic Acid Phenylmethyl Ester; 2-Acetamido-3,4,6-tri-O-acetyl-N-[N-(benzyloxycarbonyl)-ε-aminocaproyl]-2-deoxy-β-D-glucopyranosylamine. Grade: 97%. CAS No. 56146-88-4. Molecular formula: C28H39N3O11. Mole weight: 593.62. | |
| 2-Acetamido-2-deoxy-3,4,6-tri-O-methyl-D-glucose | Acetochloramine, also referred to as 2-Acetamido-2-deoxy-3,4,6-tri-O-methyl-D-glucose, is an organic molecule with significant applications in antibiotic production. Its versatile properties make it a preferred precursor molecule in glycopeptide synthesis. The compound additionally offers antibacterial actions, providing an effective treatment option for infections caused by Staphylococcus aureus strains. The multifaceted nature of Acetochloramine renders it instrumental in various scientific and medical fields, enhancing research in the quest for new antibiotics. Synonyms: N-Acetyl-3,4,6-tri-O-methyl-D-glucosamine. CAS No. 115002-36-3. Molecular formula: C11H21NO6. Mole weight: 263.29. | |
| 2-Acetamido-2-deoxy-3,6-di-O-methyl-D-glucose | 2-Acetamido-2-deoxy-3,6-di-O-methyl-D-glucose is a remarkable compound originating from glucose, finding extensive application in the biomedical sector. Synonyms: 3,6-Di-O-methyl-N-acetyl-D-glucosamine. CAS No. 95010-44-9. Molecular formula: C10H19NO6. Mole weight: 249.26. | |
| 2-Acetamido-2-deoxy-3-O-(2-O-sulfo-beta-D-gluco-4-enepyranosyluronic acid)-4-O-sulfo-D-galactose,3na | 2-Acetamido-2-deoxy-3-O-(2-O-sulfo-beta-D-gluco-4-enepyranosyluronic acid)-4-O-sulfo-D-galactose,3na. Alternative Names: CHONDROITIN UNSATURATED DISACCHARIDE DELTADI-DISB, TRISODIUM SALT;DELTA DI-DISB;DELTAUA-2S->GALNAC-4S, 3NA;DELTA-UA-2S->GALNAC-4S NA3;2-ACETAMIDO-2-DEOXY-3-O-(2-O-SULFO-BETA-D-GLUCO-4-ENEPYRANOSYLURONIC ACID)-4-O-SULFO-D-GALACTOSE, 3NA;chondroitin disacc. CAS No. 136132-71-3. Product ID: ACM136132713. Molecular formula: C14H18NNa3O17S2. Mole weight: 605.39. Alfa Chemistry - ISO 9001:32057 Certified. | |
| 2-Acetamido-2-deoxy-3-O-(2-O-sulfo-beta-D-gluco-4-enepyranosyluronic acid)-D-galactose,2na | 2-Acetamido-2-deoxy-3-O-(2-O-sulfo-beta-D-gluco-4-enepyranosyluronic acid)-D-galactose,2na. CAS No. 149368-04-7. Product ID: ACM149368047. Molecular formula: C14H19NNa2O14S. Mole weight: 503.34. Alfa Chemistry - ISO 9001:32057 Certified. | |
| 2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-a-D-galactopyranosyl)-D-galactopyranose | 2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactopyranose is a compound widely employed in the biomedical sector, exhibiting implications for the reserch of specific ailments engendered by pathogenic microorganisms. Its remarkable configuration and characteristics render it an auspicious contender for the pharmaceutical domain, particularly in regard to antimicrobial therapeutics engineered to battle bacterial contagions. Synonyms: Forssman disaccharide; GalNAc-a-1,3-GalNAc; 2-Acetamido-3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-2-deoxy-D-galactopyranose; alpha-D-GalpNAc-(1->3)-D-GalpNAc; alpha-D-GalNAc-(1->3)-D-GalNAc; alpha-D-N-acetylgalactosaminyl-(1->3)-D-N-acetylgalactosamine. Grade: ≥97%. CAS No. 62026-07-7. Molecular formula: C16H28N2O11. Mole weight: 424.40. | |
| 2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-D-galactose | 2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-D-galactose is a versatile compound extensively used in the biomedical industry as a building block for synthesizing glycosidic compounds. Its unique chemical structure provides a platform for developing therapeutic molecules targeting various diseases including cancer, inflammation, and infectious diseases. Synonyms: GlcNAc-b-1,3-GalNAc; 2-(Acetylamino)-3-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-D-galactose; GlcNAcβ1-3GalNAc. CAS No. 95673-98-6. Molecular formula: C16H28N2O11. Mole weight: 424.40. | |
| 2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactose | 2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactose is a carbohydrate compound within the biomedical sector, employed for the synthesis of glycoconjugates and glycoproteins. This compound exhibits immense potential in the realms of drug delivery and targeted therapies research. Synonyms: Gal-a-1,3-GalNAc; 2-(Acetylamino)-2-deoxy-3-O-α-D-galactopyranosyl-D-galactose; Galactose, 2-acetamido-2-deoxy-3-O-α-D-galactopyranosyl-; 2-Acetamido-2-deoxy-3-O-(α-d-galactopyranosyl)-d-galactose; α-Galactosyl-(1→3)-N-acetylgalactosamine. CAS No. 60283-31-0. Molecular formula: C14H25NO11. Mole weight: 383.35. | |
| 2-Acetamido-2-deoxy-3-O-(a-L-fucopyranosyl)-D-glucopyranose | 2-Acetamido-2-deoxy-3-O-(α-L-fucopyranosyl)-D-glucopyranose is a highly significant compound within the biomedical sector, employed as a facilitator in the research and development of targeted drugs and therapeutic methodologies tailored to cellular receptors and signaling pathways. Synonyms: 3-Fucosyl GlcNAc; 2-(Acetylamino)-2-deoxy-3-O-(6-deoxy-a-L-galactopyranosyl)-D-glucopyranose; Fuc-a-1,3-GlcNAc. CAS No. 52630-68-9. Molecular formula: C14H25NO10. Mole weight: 367.35. | |
| 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranosyl-1-O-L-serine | It is a cancer associated carbohydrate tumor antigen. Synonyms: Serinyl T Epitope; Galactosyl Tn Antigen; Serinyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranoside; 3-(O-b-D-galactosyl)-N-acetyl-a-D-galactosaminyl-1-O-serine; O-[2-(Acetylamino)-2-deoxy-3-O-b-D-galactopyranosyl-a-D-galactopyranosyl]-L-serine; O-(3-O-beta-D-galactosyl-N-acetyl-alpha-D-galactosaminyl)-L-serine; beta-D-Galp-(1->3)-alpha-D-GalpNAc-O-Ser; T Epitope, Serinyl. Grade: ≥95%. CAS No. 60280-57-1. Molecular formula: C17H30N2O13. Mole weight: 470.43. | |
| 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranosyl-1-O-L-threonine | 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranosyl-1-O-L-threonine is a remarkable biomedical compound exploring theresearch of therapeutic applications, exhibiting its pulsating potential in unraveling the intricate intricacies of diverse ailments like cancer and infectious diseases. Synonyms: 3-O-b-D-Galactosyl-N-acetyl-a-D-galactosaminyl-1-O-L-threonine; T Epitope, Threonyl; O-[2-(Acetylamino)-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranosyl]-L-threonine; Thomsen-Friedenreich antigen-threonine conjugate; Threonine O-linked TF antigen. CAS No. 60280-58-2. Molecular formula: C18H32N2O13. Mole weight: 484.45. | |
| 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-D-galactopyranose | 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-D-galactopyranose is a highly significant compound within the biomedical sector, exhibiting exceptional utility for the research and development of antiviral agents specifically designed to combat influenza A viruses. Additionally, it has remarkable properties in restraining tumor cell proliferation and thwarting metastatic progression. Synonyms: T-antigen; Galβ1-3GalNAc; β1-3 Galactosyl-N-acetyl galactosamine; Galacto-N-biose; Thomsen-Fridenreich antigen; TF epitope; beta-D-Galactosyl-(1->3)-N-acetyl-D-galactosamine; 2-(Acetylamino)-2-deoxy-3-O-β-D-galactopyranosyl-D-galactopyranose; Galactopyranose, 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-, D-; 2-Acetamido-2-deoxy-3-O-(β-D-galactopyranosyl)-D-galactopyranose. Grade: ≥94%. CAS No. 20972-29-6. Molecular formula: C14H25NO11. Mole weight: 383.35. | |
Our database is helping our users find suppliers everyday.
