A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| 4-ANISIDINE-2-SS-HYDROXYETHYL SULFONE SULFATE ESTER | 4-ANISIDINE-2-SS-HYDROXYETHYL SULFONE SULFATE ESTER. Uses: Designed for use in research and industrial production. Additional or Alternative Names: 4-ANISIDINE-2-SS-HYDROXYETHYL SULFONE SULFATE ESTER;4-Anisidine-2--hydroxyethyl sulfone sulfate ester;4-ANISIDINE-2-B-HYDROXYETHYLSULFONE SULFATE;2-[(5-Amino-2-methoxyphenyl)-sulfonyl]-ethyl hydrogen sulfate;4-ANISIDINE-2-B-HYDROXYETHYL SULFONE SULFATE E. Product Category: Heterocyclic Organic Compound. CAS No. 52532-52-2. Molecular formula: C9H13NO7S2. Mole weight: 311.334. Purity: 0.96. IUPACName: 2-(5-amino-2-methoxyphenyl)sulfonylethylhydrogensulfate. Canonical SMILES: COC1=C(C=C(C=C1)N)S(=O)(=O)CCOS(=O)(=O)O. Product ID: ACM52532522. Alfa Chemistry ISO 9001:2015 Certified. |  |
| 4-Anisyl chlorodiphenyl methane | 4-Anisyl chlorodiphenyl methane . Group: Biochemicals. Alternative Names: (Chloro (-methoxyphenyl) methylene) dibenzene; MMT-Cl; 4-Methoxytri phenylchloromethane ; p-Monomethoxytrityl chloride. Grades: Highly Purified. CAS No. 14470-28-1. Pack Sizes: 25g, 50g, 100g, 250g, 500g. Molecular Formula: C20H17ClO. US Biological Life Sciences. |  Worldwide |
| 4'-Apo-b-carotenal | 4'-Apo-b-carotenal. Group: Biochemicals. Alternative Names: 4'-Apo-b-caroten-4'-al. Grades: Highly Purified. Pack Sizes: 1mg, 2mg, 5mg. US Biological Life Sciences. | Worldwide |
| 4arm-PEG10K | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). |  |
| 4arm-PEG10K | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG. Molecular formula: average Mn 10000. |  |
| 4arm-PEG10K 2arm-OH 2arm-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG 2arm-OH 2arm-COOH. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K 2arm-OH 2arm-COOH | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K 2arm-OH 2arm-NH2 | HCl Salt, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K 2arm-OH 2arm-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG 2arm-OH 2arm-NH2. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K 3arm-OH 1arm-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG 3arm-OH 1arm-COOH. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K 3arm-OH 1arm-COOH | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K 3arm-OH 1arm-NH2 | HCl Salt, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K 3arm-OH 1arm-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG 3arm-OH 1arm-NH2. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Acrylate | average Mn 10,000. Group: Synthetic polymers for 3d printing. | |
| 4arm-PEG10K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: 3d printing materials poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Acrylate, 4arm-PEG-ACLT. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-COOH | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-COOH, 4arm-PEG-Carboxyl. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Glutaric Acid | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Glutaric Acid. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Glutaric Acid | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Isocyanate | average Mn 10000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Isocyanate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Maleimide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-MAL, 4arm-PEG-Maleimide. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Maleimide | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-NH2 | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-NH2, 4arm-PEG-NH2. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-SH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-SH. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-SH | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Ester | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Ester | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Carboxymethyl Ester, 4arm-PEG-SCM. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Glutaramide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Carboxymethyl Glutaramide. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Succinimidyl Carboxymethyl Glutaramide | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Glutarate | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Succinimidyl Glutarate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Glutarate. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Succinimidyl Succinate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Succinate. Molecular formula: average Mn 10000. | |
| 4arm-PEG10K-Succinimidyl Succinate | pentaerythritol core, average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Vinylsulfone | average Mn 10,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG10K-Vinylsulfone | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-VS, 4arm-PEG-Vinylsulfone. Molecular formula: average Mn 10000. | |
| 4arm-PEG20K 2arm-OH, 2arm-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Molecular formula: average Mn 20000. | |
| 4arm-PEG20K 2arm-OH, 2arm-NH2 | HCl Salt, average Mn 20000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K 3arm-OH, 1arm-NH2 | HCl Salt, average Mn 20000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K 3arm-OH, 1arm-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Acrylate | average Mn 20,000. Group: Synthetic polymers for 3d printing. | |
| 4arm-PEG20K-Acrylate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: 3d printing materials poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Acrylate, 4arm-PEG-ACLT. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-COOH | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-COOH, 4arm-PEG-Carboxyl. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Isocyanate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Isocyanate. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Isocyanate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Maleimide | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Maleimide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-MAL, 4arm-PEG-Maleimide. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-NH2, 4arm-PEG-amine. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-NH2 | HCl Salt, average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-SH | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-SH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-SH. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Ester | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Carboxymethyl Ester. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Ester | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Glutaramide | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Carboxymethyl Glutaramide | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Carboxymethyl Glutaramide. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Succinimidyl Glutarate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Glutarate. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Succinimidyl Glutarate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Succinate | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG20K-Succinimidyl Succinate | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-Succinimidyl Succinate. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Vinylsulfone | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-VS, 4arm-PEG-Vinylsulfone. Molecular formula: average Mn 20000. | |
| 4arm-PEG20K-Vinylsulfone | average Mn 20,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2500-PCL2500 | PEG average Mn 2,500, PCL average Mn 2,500. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2500-PCL2500 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-PCL. Molecular formula: PCL average Mn 2,500 PEG average Mn 2,500. | |
| 4arm-PEG2500-PLA3500 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-PLA. Molecular formula: PCL average Mn 3,500 PEG average Mn 2,500. | |
| 4arm-PEG2500-PLA3500 | PEG average Mn 2,500, PCL average Mn 3,500. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2K-NH2 | average Mn 2,000. Group: Poly(ethylene glycol) and poly(ethylene oxide). | |
| 4arm-PEG2K-NH2 | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Alternative Names: 4arm-PEG-NH2, 4arm-PEG-amine. Molecular formula: average Mn 2000. | |
| 4arm-PEG3K 3arm-OH, 1arm-COOH | Polyethylene glycol (PEG) compounds contain a polyether unit, commonly expressed as R1-(O-CH2-CH2)n-O-R2. They are generally biocompatible, non-toxic and stable in both organic and aqueous solutions, and so are extensively used in biological applications, as well as nanotechnology and materials research. Proteins with PEG chain modifications and compounds encapsulated in PEG liposomes exhibit a longer half-life in vivo than their non-PEGylated counterparts, a phenomenon known as PEG shielding. Functionalised PEG lipids and phospholipids can be used for protein-PEG conjugation. Uses: Activated peg derivatives can be used to modify peptides, proteins, or in other bioconjugation applications. pegylated materials have found broad use in drug delivery systems, virology, and immunology, as the incorporation of peg improves pharmacological properties such as increased water solubility, enhanced resistance to degradation (protein hydrolysis), increased circulation half-life, and reduced antigenicity. in addition to pegylation, activated peg derivatives can also be used to form networks for tissue engineering or drug delivery applications, depending on the architecture and reactivity. Group: Poly(ethylene glycol) and poly(ethylene oxide). Molecular formula: average Mn 3000. | |
Our database is helping our users find suppliers everyday.
