A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| Poly(4-styrenesulfonic acid) ammonium salt solution | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PSS. CAS No. 29965-34-2. Molecular formula: C8H11NO3S. Mole weight: Mw ~200,000. IUPAC Name: azanium;4-ethenylbenzenesulfonate. SMILES: C=CC1=CC=C(C=C1)S(=O)(=O)[O-].[NH4+]. InChI: InChI=1S/C8H8O3S.H3N/c1-2-7-3-5-8(6-4-7)12(9,10)11;/h2-6H,1H2,(H,9,10,11);1H3. |  |
| Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt | Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt. CAS No. 68037-40-1. | |
| Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt, 4-styrenesulfonic acid/maleic acid (mole ratio: 1/1) | Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt, 4-styrenesulfonic acid/maleic acid (mole ratio: 1/1). CAS No. 68037-40-1. | |
| Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt, molar ratio 3:1 | Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt, molar ratio 3:1. CAS No. 68037-40-1. | |
| Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt solution | Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt solution. CAS No. 68037-40-1. | |
| Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt solution (technical grade) | Poly(4-styrenesulfonic acid-co-maleic acid) sodium salt solution (technical grade). Alternative Names: Styrene/ maleic anhydride copolymer, sulfonated. CAS No. 68037-40-1. Purity: Tech. Product ID: ACM68037401-8. Alfa Chemistry - ISO 9001:32057 Certified. |  |
| Poly(4-styrenesulfonic acid) solution | The hydrophilic polymer contains polar or charged functional groups, making it soluble in water. Alternative Names: PSS. CAS No. 28210-41-5. Molecular formula: [-CH2CH(C6H4SO3H)-]n. Mole weight: Mw ~75,000. IUPAC Name: 4-ethenylbenzenesulfonic acid. SMILES: C=CC1=CC=C(C=C1)S(=O)(=O)O. InChI: InChI=1S/C8H8O3S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h2-6H,1H2,(H,9,10,11). | |
| Poly(4-t-butyl styrene) | Poly(4-t-butyl styrene). Alternative Names: Poly(4-tert-butylstyrene); Poly(p-tert-butylstyrene); 4-tert-butylstyrene homopolymer. CAS No. 26009-55-2. |  |
| Poly(4-tert-butylstyrene) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: PTBS. CAS No. 26009-55-2. Molecular formula: [CH2CH[C6H4C(CH3)3]]n. Mole weight: average Mw 50,000-100,000. SMILES: CC(C)(C)c1ccc(C=C)cc1. | |
| Poly(4-vinylbenzyl chloride) | Poly(4-vinylbenzyl chloride). Alternative Names: Benzene, 1-(chloromethyl)-4-ethenyl-, homopolymer; Styrene, p-(chloromethyl)-, polymers; 4-(Chloromethyl)styrene homopolymer; 4-Vinylbenzyl chloride homopolymer; p-(Chloromethyl)styrene homopolymer; p-Chloromethylstyrene polymer; p-Vinylbenzyl chloride homopolymer; p-Vinylbenzyl chloride polymer; Poly(p-vinylbenzyl chloride); Poly[4-(chloromethyl)styrene]; Poly[p-(chloromethyl)styrene]. CAS No. 29296-32-0. | |
| Poly(4-vinylbiphenyl) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: 4-Vinylbiphenyl homopolymer, Poly(4-phenylstyrene), Poly(4-vinylbiphenyl). CAS No. 25232-08-0. Molecular formula: [CH2CH(C6H4C6H5)]n. Mole weight: average Mw ~115,000 by GPC. SMILES: C=Cc1ccc(cc1)-c2ccccc2. | |
| POLY(4-VINYLBIPHENYL) | POLY(4-VINYLBIPHENYL). Alternative Names: POLY(4-VINYLBIPHENYL); 4-VINYLBIPHENYL POLYMER; POLY(4-VINYLBIPHENYL), AVERAGE MW CA. 11 5,000 (GPC); 4-vinylbiphenyl homopolymer. Grades: 95%. CAS No. 25232-08-0. Molecular formula: [CH2CH(C6H4C6H5)]n. | |
| Poly(4-vinylphenol) | Poly(4-vinylphenol) is used as an antimicrobial surface coating in mutilayered film. Group: Biochemicals. Grades: Highly Purified. CAS No. 24979-70-2. Pack Sizes: 250mg, 2.5g. Molecular Formula: C8H8O, Molecular Weight: 120.15. US Biological Life Sciences. |  Worldwide |
| Poly(4-vinylphenol) | Poly(4-vinylphenol) is a biocompatible polymer widely used in the biomedical industry for drug delivery applications. It serves as a carrier for various drugs, including anticancer agents, antibiotics, and anti-inflammatory drugs, providing controlled release and improved therapeutic efficacy. Its unique properties make it an ideal candidate for targeting specific diseases such as cancer, infections, and inflammatory disorders. Its biocompatibility ensures minimal toxicity and enhanced patient compliance. Alternative Names: PVP, Poly(4-hydroxystyrene). Grades: 95%. CAS No. 24979-70-2. Molecular formula: C8H8O. Mole weight: 120.14900. | |
| Poly(4-Vinylphenol) | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. Alternative Names: PVP, Poly(4-hydroxystyrene). CAS No. 24979-70-2. Molecular formula: (C8H8O)n. Mole weight: Mw ~11,000. Purity: 98%. SMILES: Oc1ccc(C=C)cc1. InChI: 1S/C8H10O/c1-2-7-3-5-8(9)6-4-7/h3-6,9H,2H2,1H3. | |
| Poly(4-vinylphenol-co-2-hydroxyethyl methacrylate) | Poly(4-vinylphenol-co-2-hydroxyethyl methacrylate). Alternative Names: POLY(4-VINYLPHENOL-CO-2-HYDROXYETHYL METHACRYLATE). CAS No. 110123-09-6. Product ID: ACM110123096. Molecular formula: (C14H18O4)n. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Poly(4-vinylphenol-co-methyl methacrylate) | monomer molar fraction = ~ 50%. Alternative Names: PVP-co-PMMA. CAS No. 24979-71-3. Molecular formula: [CH2CH(C6H4OH)]x[CH2C(CH3)(CO2CH3)]y. SMILES: COC(=O)C(C)=C.Oc1ccc(C=C)cc1. | |
| Poly(4-vinylpyridine) | Poly(4-vinylpyridine). Alternative Names: POLY(4-VINYLPYRIDINE);POLY(4-VINYLPYRIDINE), 2% CROSS-LINKED;POLY(4-VINYLPYRIDINE), ~60 MESH;POLY(4-VINYLPYRIDINE) MACRORETICULAR CRO SSLKD. W. 25% DVB;Poly(4-vinylpyridine), 2% cross-linked, ca. 60 mesh, 8.8meq/g;Poly(4-vinylpyridine), cross-linked with. CAS No. 9017-40-7. Molecular formula: N/A. Mole weight: 315.418. Purity: 96%. IUPAC Name: 1,2-di(ethenyl)benzene; 4-ethenylpyridine. SMILES: C=CC1=CC=NC=C1.C=CC1=CC=CC=C1C=C. | |
| Poly(4-vinylpyridine) | Poly(4-vinylpyridine). Alternative Names: 4-VINYL PYRIDINE COPOLYMER;4-VINYL PYRIDINE-DIVINYL BENZENE COPOLYMER;4-VINYL PYRIDINE HOMOPOLYMER;4-VINYLPYRIDINE POLYMER;4VP-DVB;P4VP;POLYVINYL PYRIDINE;POLY(4-VINYLPYRIDINE). CAS No. 25232-41-1. Molecular formula: C21H21N3X2. Mole weight: 150,000 - 200,000. Purity: 96%. IUPAC Name: 4-ethenylpyridine. | |
| Poly(4-Vinylpyridine) | Liquid. Molecular formula: C7H7N. Mole weight: 105.14g/mol. IUPAC Name: 4-ethenylpyridine. SMILES: C=CC1=CC=NC=C1. InChI: InChI=1S/C7H7N/c1-2-7-3-5-8-6-4-7/h2-6H,1H2. | |
| Poly(4-vinylpyridine-co-butyl methacrylate) | Poly(4-vinylpyridine-co-butyl methacrylate). CAS No. 53761-76-5. | |
| Poly(4-vinylpyridine-co-ethylvinylbenzene)cross-linked | Poly(4-vinylpyridine-co-ethylvinylbenzene)cross-linked. CAS No. 127564-81-2. Purity: 96%. Product ID: ACM127564812. Molecular formula: C7H7N. Mole weight: 105.13700. IUPAC Name: Poly(4-vinylpyridine-co-ethylvinylbenzene), cross-linked. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Poly(4-vinylpyridine-co-styrene) | Poly(4-vinylpyridine-co-styrene). CAS No. 26222-40-2. | |
| Poly(4-vinylpyridine-co-styrene) (10 percent Styrene, granular) | Poly(4-vinylpyridine-co-styrene) (10 percent Styrene, granular). CAS No. 26222-40-2. | |
| Poly(4-vinylpyridine-co-styrene) (50% Styrene, average MW~ 400000, powder) | Poly(4-vinylpyridine-co-styrene) (50% Styrene, average MW~ 400000, powder). CAS No. 26222-40-2. | |
| Poly(4-vinylpyridine-co-styrene) powder | Poly(4-vinylpyridine-co-styrene) powder. CAS No. 26222-40-2. | |
| Poly(4-vinylpyridine), cross-linked | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. CAS No. 9017-40-7. Molecular formula: C17H17N. Mole weight: 235.32g/mol. IUPAC Name: 1,2-bis(ethenyl)benzene;4-ethenylpyridine. SMILES: C=CC1=CC=NC=C1.C=CC1=CC=CC=C1C=C. InChI: 1S/C10H10.C7H7N/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-3-5-8-6-4-7/h3-8H,1-2H2;2-6H,1H2. | |
| Poly(4-vinylpyridine),cross-linked,met hyl chloride quaternary salt | Poly(4-vinylpyridine),cross-linked,met hyl chloride quaternary salt. CAS No. 125200-80-8. Product ID: ACM125200808. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Poly(4-vinylpyridine hydrochloride) | Poly(4-vinylpyridine hydrochloride). Alternative Names: PYRIDINE HYDROCHLORIDE POLYMER BOUND;POLY(4-VINYLPYRIDINE HYDROCHLORIDE);POLY(4-VINYLPYRIDINE HYDROCHLORIDE), 2% CROSS-LINKED;4-vinylpyridine hydrochloride homopolymer. CAS No. 29323-87-3. Purity: 96%. | |
| Poly(4-vinylpyridinium p-toluenesulfonate) | Poly(4-vinylpyridinium p-toluenesulfonate). Alternative Names: POLY(4-VINYLPYRIDINIUM P-TOLUENESULFONATE);4-vinylpyridinium/ p-toluenesulfonate copolymer. CAS No. 132759-93-4. Molecular formula: C42H45N3O9S3X2. Mole weight: 832.02. Purity: 96%. IUPAC Name: 4-(1,5-dipyridin-4-ylhexan-3-yl)pyridine;4-methylbenzenesulfonic acid. SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.CC(CC(CCC1=CC=NC=C1)C2=CC=NC=C2)C3=CC=NC=C3. | |
| Poly(4-vinylpyridinium poly(hydrogen | Poly(4-vinylpyridinium poly(hydrogen. Alternative Names: POLY(4-VINYLPYRIDINIUM POLY(HYDROGEN. CAS No. 79821-63-9. Molecular formula: C21H26F3N3. Mole weight: 377.4g/mol. IUPAC Name: 4-(1,5-dipyridin-4-ylhexan-3-yl)pyridine;trihydrofluoride. SMILES: CC(CC(CCC1=CC=NC=C1)C2=CC=NC=C2)C3=CC=NC=C3.F.F.F. InChI: InChI=1S/C21H23N3.3FH/c1-17(19-6-12-23-13-7-19)16-21(20-8-14-24-15-9-20)3-2-18-4-10-22-11-5-18;;;/h4-15,17,21H,2-3,16H2,1H3;3*1H. | |
| Poly[4-vinylpyridinium poly(hydrogen fluoride)] | Poly[4-vinylpyridinium poly(hydrogen fluoride)]. Alternative Names: Hydrofluoric acid, homopolymer, compd. with 4-ethenylpyridine homopolymer; Pyridine, 4-ethenyl-, homopolymer, compd. with hydrofluoric acid homopolymer. Grades: 95%. CAS No. 130495-33-9. Molecular formula: (C7H7N)x.x(FH)x. | |
| Poly(5-(2-ethylhexyloxy)-2-methoxy-cyanoterephthalylidene) | CN-PPV can be used for a variety of applications such as organic light emitting diodes (OLEDs), and organic solar cells. CAS No. 194292-84-7. | |
| Poly(5-(3,7-dimethyloctyloxy)-2-methoxy-cyanoterephthalylidene) | Light emitting conjugated polymer. CAS No. 320725-67-5. | |
| Poly[5-methoxy-2-(3-sulfopropoxy)-1,4-phenylenevinylene] potassium salt solution | Poly[5-methoxy-2-(3-sulfopropoxy)-1,4-phenylenevinylene] potassium salt solution (APPV) is a sulfonated phenylenevinylene (PPV) that acts as a high sensitive water soluble photo-luminescent (PL) polymer. It has an anionic π-conjugation that allows it to have a high fluorescence quantum yield. Alternative Names: MPS-PPV potassium salt. Molecular formula: (C12H13KO5S)n. | |
| Poly[6-[4-(4-cyanophenyl)phenoxy]hexyl | Poly[6-[4-(4-cyanophenyl)phenoxy]hexyl. Alternative Names: POLY[6-[4-(4-CYANOPHENYL)PHENOXY]HEXYL. CAS No. 117318-92-0. Molecular formula: H2O. Mole weight: 18.01528;g/mol. Purity: 96%. IUPAC Name: oxidane. SMILES: O. | |
| Poly[(6-morpholino-1,3,5-triazine-2,4-diyl)-((2,2,6,6-tetramethyl-4-piperidyl)imino)hexamethylene-((2,2,6,6-tetramethyl-4-piperidyl)imino)] | Poly[(6-morpholino-1,3,5-triazine-2,4-diyl)-((2,2,6,6-tetramethyl-4-piperidyl)imino)hexamethylene-((2,2,6,6-tetramethyl-4-piperidyl)imino)]. Alternative Names: poly[(6-morpholino-1,3,5-triazine-2,4-diyl)-((2,2,6,6-tetramethyl-4-piperidyl)imino)hexamethylene-((2,2,6,6-tetramethyl-4-piperidyl)imino)]; HALS3346; Poly[(6-morpholino-1,3,5-triazine-2,4-diyl)-((2,2,6,6-tetramethyl-4-piperidyl)imino)hexamethylene-((2,2,6. Grades: 95%. CAS No. 90751-07-8. Molecular formula: (C31H56N8O)n. | |
| Poly[9,9-bis-(2-ethylhexyl)-9H-fluorene-2,7-diyl] | Organic Semiconductor Laser Materials PFO forms a π-conjugating polymeric system that can produce blue EL devices which include organic light emitting diodes (OLEDs), optical fibers and molecular electronic devices. Alternative Names: POLY(9 9-BIS-(2-ETHYLHEXYL)-9H-FLUORENE&; POLY(9,9-DI-(2'-ETHYLHEXYL)FLUORENYL-2,&; Poly[9,9-di-(2'-ethylhexyl)fluorenyl-2,7-diyl]; Poly[9,9-bis-(2-ethylhexyl)-9H-fluorene-2,7-diyl]. Grades: 95%. CAS No. 188201-16-3. Molecular formula: (C29H40)n. | |
| Poly[(9,9-bis(3'-(N,N-dimethylamino)propyl)-2,7-fluorene)-alt-2,7-(9,9-ioctylfluorene)] | Poly[(9,9-bis(3'-(N,N-dimethylamino)propyl)-2,7-fluorene)-alt-2,7-(9,9-ioctylfluorene)]. Alternative Names: PFN. CAS No. 673474-74-3. Molecular formula: (C52H70N2)n. | |
| Poly[9,9-bis(4-(2-ethylhexyl)phenyl)fluorene-alt-co-6,7-bis(4-(hexyloxy)phenyl)-4,9-di(thiophen-2-yl)-thiadiazoloquinoxaline] | Poly[9,9-bis(4-(2-ethylhexyl)phenyl)fluorene-alt-co-6,7-bis(4-(hexyloxy)phenyl)-4,9-di(thiophen-2-yl)-thiadiazoloquinoxaline]. Alternative Names: PFTTQ. Molecular formula: (C81H86N4O4S3)n. | |
| Poly(9,9-di-(2-ethylhexyl)-9H-fluorene-2,7-vinylene) | Poly(9,9-di-(2-ethylhexyl)-9H-fluorene-2,7-vinylene) is a fluorescent conjugating polymer which can be combined with nanoparticles to form a nanocomposite for optoelectronics applications. It can also be used in the formation of a cathode material for organic light emitting diodes (OLEDs). Alternative Names: PFV. Molecular formula: (C31H42)n. | |
| Poly[(9,9-di-(2-ethylhexyl)-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)] | Poly[(9,9-di-(2-ethylhexyl)-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)]. Alternative Names: PFV. Molecular formula: (C31H42)m(C17H24O2)n. | |
| Poly[9,9-di(2'-ethylhexyl)fluoren-2,7-yleneethynylene] | Poly[9,9-di(2'-ethylhexyl)fluoren-2,7-yleneethynylene]. | |
| Poly[9,9-di(3',7'-dimethyloctyl)fluoren-2,7-yleneethynylene] | Poly[9,9-di(3',7'-dimethyloctyl)fluoren-2,7-yleneethynylene]. | |
| Poly[9,9-didodecylfluroenyl-2,7-yleneethylnylene] | Conducting polymer. Exhibits blue photo- and electroluminescence. | |
| Poly((9,9-dihexyl-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)), 90:10 mole ratio | Poly((9,9-dihexyl-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)), 90:10 mole ratio. Alternative Names: Poly(FV-co-MEHPV). Molecular formula: (C27H34)m(C17H24O2)n. | |
| Poly((9,9-dihexyl-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)), 95:5 mole ratio | Poly((9,9-dihexyl-9H-fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)), 95:5 mole ratio. Alternative Names: Poly(FV-co-MEHPV). Molecular formula: (C27H34)m(C17H24O2)n. | |
| Poly[(9,9-dihexylfluoren-2,7-diyl)-co-(9-ethylcarbazol-2,7-diyl)] | Poly[(9,9-dihexylfluoren-2,7-diyl)-co-(9-ethylcarbazol-2,7-diyl)]. Alternative Names: PFH-EC. Mole weight: >20. | |
| Poly[(9,9-dihexylfluoren-2,7-diyl)-co-(anthracen-9,10-diyl)] | Poly[(9,9-dihexylfluoren-2,7-diyl)-co-(anthracen-9,10-diyl)]. Alternative Names: Poly[(9,9-dihexylfluoren-2,7-diyl)-co-(anthracen-9,10-diyl)]. CAS No. 474975-22-9. Mole weight: >20. Purity: 96%. | |
| Poly(9,9-di-n-dodecylfluorenyl-2,7-diyl) | PFDD is used as a semiconducting polymer for use in the development of organic thin film transistors (OTFTs) and organic light emitting diodes(OLEDs). It forms a composite with carbon nanomaterials for obtaining high tensile films with improved conductivity. Uses: Pfdd is used as a semiconducting polymer for use in the development of organic thin film transistors (otfts) and organic light emitting diodes(oleds). Alternative Names: PFD, Poly(9,9-di-n-dodecylfluorene). Grades: 95%. CAS No. 248256-53-3. | |
| Poly(9,9-di-n-hexylfluorenyl-2,7-vinylene) | Poly(9,9-di-n-hexylfluorenyl-2,7-vinylene). | |
| Poly(9,9-di-n-octylfluorenyl-2,7-diyl) | Poly(9,9-di-n-octylfluorenyl-2,7-diyl) (PFO) is a blue light emitting fluorescent polymer with high electroluminescence quantum yield and chemical stability. It can form an emissive layer on the surface of the optoelectronic devices. Molecular formula: C8H9(C29H40)nC8H9. Mole weight: ≥20. | |
| Poly(9.9-Di-N-octylfluorenyl-2,7diyl) | Poly(9.9-Di-N-octylfluorenyl-2,7diyl). CAS No: 195456-48-5 |  Sarchem Laboratories New Jersey NJ |
| Poly[(9,9-di-n-octylfluorenyl-2,7-diyl)-alt-(benzo[2,1,3]thiadia-zol-4,8-diyl)], Mw 10,000-100,000 by GPC | Poly[(9,9-di-n-octylfluorenyl-2,7-diyl)-alt-(benzo[2,1,3]thiadia-zol-4,8-diyl)], Mw 10,000-100,000 by GPC. CAS No. 210347-52-7. | |
| Poly(9,9-dioctyl-9H-fluorene-2,7-diyl) | Polyfluorenes (PFs) are one of the most important PLED materials, showing a strong blue fluorescence stabilized by its rigid, conjugated structure. Alternative Names: PFO,Poly(9,9- dioctylfluorene),Poly(9,9-di-n-octylfluorenyl-2,7-diyl). Molecular formula: C8H9(C29H40)nC8H9. | |
| Poly(9 9-dioctylfluoren& | Poly(9 9-dioctylfluoren&. Alternative Names: POLY(9 9-DIOCTYLFLUOREN&;POLY(9,9-DIOCTYL-2,7-DI-1-PROPYNYL-9H-FLUO RENE). CAS No. 278176-17-3. | |
| Poly[(9,9-dioctylfluorene-2,7-diyl)-alt-(N,N'-diphenylbenzidine-N,N'-diyl], Mw 10,000-100,000 by GPC | Poly[(9,9-dioctylfluorene-2,7-diyl)-alt-(N,N'-diphenylbenzidine-N,N'-diyl], Mw 10,000-100,000 by GPC. CAS No. 484032-91-9. | |
| Poly[(9,9-dioctylfluorenyl-2,7-diyl)-alt-(2-methoxy-5-(2-ethylhexyloxy)phenylenevinylene-1,4-diyl)], Mw 10,000-100,000 by GPC | Poly[(9,9-dioctylfluorenyl-2,7-diyl)-alt-(2-methoxy-5-(2-ethylhexyloxy)phenylenevinylene-1,4-diyl)], Mw 10,000-100,000 by GPC. CAS No. 1383605-56-8. | |
| Poly[(9,9-dioctylfluorenyl-2,7-diyl)-alt-(4,4'-(N-(4-butylphenyl), Mw 10,000-100,000 by GPC | Gallium is a silvery-white liquid at room temperature. Ingestion of this material may be toxic. It is corrosive to aluminum. If exposed to high temperatures, gallium may emit toxic fumes which may form a corrosive alkaline solution with water. It is soluble in most acids and alkalis. It is used as a semiconductor material.;OtherSolid; PelletsLargeCrystals. CAS No. 223569-31-1. Molecular formula: Ga. Mole weight: 69.72g/mol. IUPAC Name: gallium. SMILES: [Ga]. InChI: InChI=1S/Ga. | |
| Poly[(9,9-dioctylfluorenyl-2,7-diyl)-alt-(N,N'-bis{p-butylphenyl}-1,1'-biphenylene-4,4'-diamine)] | Poly[(9,9-dioctylfluorenyl-2,7-diyl)-alt-(N,N'-bis{p-butylphenyl}-1,1'-biphenylene-4,4'-diamine)]. CAS No. 1115424-53-7. Product ID: ACM1115424537. Molecular formula: (C61H74N2)n. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Poly(9,9-dioctylfluorenyl-2,7-diyl) end capped with dimethylphenyl, Mw 10,000-100,000 by GPC | Poly(9,9-dioctylfluorenyl-2,7-diyl) end capped with dimethylphenyl, Mw 10,000-100,000 by GPC. CAS No. 195456-48-5. | |
| Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole) | Blue light emitting polymer. Alternative Names: Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole). CAS No. 856893-75-9. Molecular formula: (C42H43N)N. Mole weight: average 9.195. | |
| Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole) | Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole). Uses: For analytical and research use. CAS No. 856893-75-9. Catalog: AP856893759. |  |
| Poly(9-anthracenylmethyl acrylate) | Poly(9-anthracenylmethyl acrylate). | |
| Poly(9-anthracenylmethyl methacrylate) | Poly(9-anthracenylmethyl methacrylate). Molecular formula: C21H22O2. Mole weight: 306.4g/mol. IUPAC Name: anthracen-9-ylmethyl 2,2-dimethylbutanoate. SMILES: CCC(C)(C)C(=O)OCC1=C2C=CC=CC2=CC3=CC=CC=C31. InChI: InChI=1S/C21H22O2/c1-4-21(2,3)20(22)23-14-19-17-11-7-5-9-15(17)13-16-10-6-8-12-18(16)19/h5-13H,4,14H2,1-3H3. | |
| Poly(9H-carbazole-9-ethyl acrylate) | Poly(9H-carbazole-9-ethyl acrylate). Uses: For analytical and research use. CAS No. 69678-49-5. Catalog: AP69678495. | |
| Poly(9H-carbazole-9-ethyl methacrylate) | Poly(9H-carbazole-9-ethyl methacrylate). | |
| Poly(9H-carbazole-9-ethyl acrylate) | Poly(9H-carbazole-9-ethyl acrylate). Alternative Names: POLY(9H-CARBAZOLE-9-ETHYL ACRYLATE);poly[2-(9h-carbazol-9-yl)ethyl acrylate]. CAS No. 69678-49-5. Molecular formula: (C17H15NO2)n. Purity: 96%. | |
| Poly(9-vinylcarbazole) | Poly(9-vinylcarbazole). Uses: For analytical and research use. CAS No. 25067-59-8. Catalog: AP25067598. | |
| Poly(9-vinylcarbazole) | Poly(9-vinylcarbazole) (PVK) is a conductive polymer which is mainly used as a hole transporting medium at high efficiencies with low driving voltage. It can also be used as an anode for hole injection and can act as an effective charge transferring gate by co-doping it with organic dyes. Alternative Names: PVK. CAS No. 25067-59-8. Molecular formula: C14H11N. Mole weight: 193.24g/mol. IUPAC Name: 9-ethenylcarbazole. SMILES: C=CN1C2=CC=CC=C2C3=CC=CC=C31. InChI: 1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2,KKFHAJHLJHVUDM-UHFFFAOYSA-N. | |
Our database is helping our users find suppliers everyday.
