A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| Fmoc-4-tert-butyl-L-phenylalanine 98+% (HPLC) | Fmoc-4-tert-butyl-L-phenylalanine 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g. US Biological Life Sciences. |  Worldwide |
| Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine | Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine. Group: Biochemicals. Alternative Names: Fmoc-L-Phe(4-COOtBu)-OH; Fmoc-(4-carboxy-tert-butyl)-L-phenylalanine. Grades: Highly Purified. CAS No. 183070-44-2. Pack Sizes: 50mg, 100mg, 250mg, 500mg, 1g. US Biological Life Sciences. | Worldwide |
| Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine | Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine. Synonyms: Fmoc-L-Phe(4-COOtBu)-OH; Fmoc-(4-carboxy-tert-butyl)-L-phenylalanine. Grade: ≥ 99% (HPLC). CAS No. 183070-44-2. Molecular formula: C29H29NO6. Mole weight: 487.56. |  |
| Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine 98+% (HPLC) | Fmoc-(4-tert-butyloxycarbonyl)-L-phenylalanine 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-5,5-dimethyl-L-proline | Fmoc-5,5-dimethyl-L-proline. Synonyms: (S)-Fmoc-5,5-dimethyl-pyrrolidine-2-carboxylic acid; (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid. CAS No. 1310680-23-9. Molecular formula: C22H23NO4. Mole weight: 365.4. | |
| Fmoc-5-amino-2-methoxybenzoic acid | Fmoc-5-amino-2-methoxybenzoic acid. Alternative Names: Fmoc-5-amino-2-methoxybenzoic acid, 165073-03-0, AGN-PC-07XSXY, SCHEMBL569486, CTK8F9900, MolPort-006-705-727, AKOS016344762, AB21218, 5-FMOC-AMINO-2-METHOXYBENZOIC ACID, TR-062007, BB 0262235, A-8274, 5-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-2-methoxybenzoic acid, Benzoic acid, 5-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methoxy-. CAS No. 165073-03-0. Purity: 95%. Product ID: ACM165073030. Molecular formula: C23H19NO5. Mole weight: 389.4. IUPAC Name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methoxybenzoic acid. Alfa Chemistry - ISO 9001:32057 Certified. |  |
| Fmoc-5-amino-2-methoxybenzoic acid | Fmoc-5-amino-2-methoxybenzoic acid. Alternative Names: 5-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-2-methoxybenzoic acid; 5-FMOC-AMINO-2-METHOXYBENZOIC ACID; Fmoc-5-amino-2-methoxybenzoic acid. CAS No. 165073-03-3. Purity: 96%. Product ID: ACM165073033. Molecular formula: C23H19NO5. Mole weight: 389.41. IUPAC Name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methoxybenzoic acid. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Fmoc-5-amino-2-methoxybenzoic acid | Fmoc-5-amino-2-methoxybenzoic acid. Group: Biochemicals. Grades: Highly Purified. CAS No. 165073-03-3. Pack Sizes: 500mg, 1g, 2g, 5g, 10g. US Biological Life Sciences. | Worldwide |
| Fmoc-5-amino-2-methoxybenzoic acid 99+% | Fmoc-5-amino-2-methoxybenzoic acid 99+%. Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-5-aminovaleric acid | Fmoc-5-aminovaleric acid. Group: Biochemicals. Alternative Names: Fmoc-5-Ava-OH; Fmoc-5-aminopentanoic acid. Grades: Highly Purified. CAS No. 123622-48-0. Pack Sizes: 2g, 5g, 10g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-5-aminovaleric acid | Fmoc-5-aminovaleric acid. Synonyms: Fmoc-5-Ava-OH; Fmoc-5-aminopentanoic acid; Fmoc 5 Ava OH. Grade: ≥ 99% (HPLC). CAS No. 123622-48-0. Molecular formula: C20H21NO4. Mole weight: 339.39. | |
| Fmoc-5-aminovaleric acid 98+% (HPLC) | Fmoc-5-aminovaleric acid 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-5-hydroxy-Nva-OH | Fmoc-5-hydroxy-Nva-OH. Synonyms: Fmoc-DL-Nva(OH)-OH. CAS No. 2169956-19-6. Molecular formula: C20H21NO5. Mole weight: 355.4. | |
| Fmoc-6,7-dichloro-D-Tic-OH | Fmoc-6,7-dichloro-D-Tic-OH. Molecular formula: C25H19Cl2NO4. Mole weight: 468.33. | |
| Fmoc-6,7-dichloro-L-Tic-OH | Fmoc-6,7-dichloro-L-Tic-OH. Molecular formula: C25H19Cl2NO4. Mole weight: 468.33. | |
| Fmoc-6-aminohexanoic acid | Fmoc-6-aminohexanoic acid. Synonyms: Fmoc-ε-Acp-OH; Fmoc-ε-Ahx-OH; Fmoc ε Acp OH; Fmoc ε Ahx OH. Grade: ≥ 99% (HPLC). CAS No. 88574-06-5. Molecular formula: C21H23NO4. Mole weight: 353.41. | |
| Fmoc-6-aminohexanoic acid | Fmoc-6-aminohexanoic acid. Group: Biochemicals. Alternative Names: Fmoc-ε-Acp-OH; Fmoc-ε-Ahx-OH. Grades: Highly Purified. CAS No. 88574-06-5. Pack Sizes: 25g, 50g, 100g, 250g. US Biological Life Sciences. | Worldwide |
| Fmoc-6-aminohexanoic acid 99+% (HPLC) | Fmoc-6-aminohexanoic acid 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g, 100g, 250g. US Biological Life Sciences. | Worldwide |
| Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester | Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 2g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-6-chloro D-tryptophan | Fmoc-6-chloro D-tryptophan. Group: Biochemicals. Alternative Names: 6-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-tryptophan; Fmoc-6-chloro (R)-tryptophan. Grades: Highly Purified. CAS No. 925916-73-0. Pack Sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Molecular Formula: C26H21ClN2O4. US Biological Life Sciences. | Worldwide |
| Fmoc-6-chloro L-tryptophan | Fmoc-6-chloro L-tryptophan. Group: Biochemicals. Alternative Names: 6-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tryptophan; Fmoc-6-chloro (S)-tryptophan. Grades: Highly Purified. CAS No. 908847-42-7. Pack Sizes: 50mg, 100mg, 250mg, 500mg, 1g. Molecular Formula: C26H21ClN2O4. US Biological Life Sciences. | Worldwide |
| Fmoc-6-piperazin-1-yl-4(3H)-quinazolinone-3-acetic acid | Fmoc-6-piperazin-1-yl-4(3H)-quinazolinone-3-acetic acid. Group: Biochemicals. Alternative Names: Fmoc-Pqa-OH. Grades: Highly Purified. CAS No. 269078-82-2. Pack Sizes: 25mg, 50mg, 100mg, 250mg, 500mg. US Biological Life Sciences. | Worldwide |
| Fmoc-6-piperazin-1-yl-4(3H)-quinazolinone-3-acetic acid 98+% (HPLC) | Fmoc-6-piperazin-1-yl-4(3H)-quinazolinone-3-acetic acid 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g. US Biological Life Sciences. | Worldwide |
| Fmoc-7-aminoheptanoic acid | Fmoc-7-aminoheptanoic acid. Group: Biochemicals. Alternative Names: Fmoc-7-Ahp-OH. Grades: Highly Purified. CAS No. 127582-76-7. Pack Sizes: 2g, 5g, 10g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-7-aminoheptanoic acid | Fmoc-7-aminoheptanoic acid. Synonyms: Fmoc-7-Ahp-OH; Fmoc 7 Ahp OH. Grade: ≥ 98% (HPLC). CAS No. 127582-76-7. Molecular formula: C22H25NO4. Mole weight: 367.44. | |
| Fmoc-7-aminoheptanoic acid 98+% (HPLC) | Fmoc-7-aminoheptanoic acid 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-7-Chloro-L-Tic-OH | Fmoc-7-Chloro-L-Tic-OH. Molecular formula: C25H20ClNO4. Mole weight: 433.88. | |
| Fmoc-7-hydroxy-(s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | Fmoc-7-hydroxy-(s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. CAS No. 178432-49-0. Purity: 95%. Product ID: ACM178432490. Molecular formula: C25H21NO5. Mole weight: 415.44. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Fmoc-8-amino-1,4-dioxa-spiro[4,5]decane-8-carboxylic acid | Fmoc-8-amino-1,4-dioxa-spiro[4,5]decane-8-carboxylic acid. Group: Biochemicals. Grades: Highly Purified. CAS No. 369403-24-7. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-8-amino-1,4-dioxa-spiro[4,5]decane-8-carboxylic acid 98+% (HPLC) | Fmoc-8-amino-1,4-dioxa-spiro[4,5]decane-8-carboxylic acid 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-8-amino-3,6-dioxaoctanoic acid | Fmoc-8-amino-3,6-dioxaoctanoic acid (Fmoc-NH-PEG2-CH2COOH) is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Fmoc-8-amino-3,6-dioxaoctanoic acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Uses: Scientific research. Category: Signaling pathways. Alternative Names: Fmoc-NH-PEG2-CH2COOH. CAS No. 166108-71-0. Pack Sizes: 1 g; 5 g; 10 g; 25 g. Product ID: HY-W007713. |  |
| Fmoc-8-aminocaprylic acid | Fmoc-8-aminocaprylic acid. Synonyms: Fmoc-8-aminooctanoic acid; 8-(Fmoc-amino)-caprylic acid. Grade: ≥ 99% (HPLC). CAS No. 126631-93-4. Molecular formula: C23H27NO4. Mole weight: 381.46. | |
| Fmoc-8-aminocaprylic acid | Fmoc-8-aminocaprylic acid. Group: Biochemicals. Alternative Names: Fmoc-8-aminooctanoic acid; 8-(Fmoc-amino)-caprylic acid. Grades: Highly Purified. CAS No. 126631-93-4. Pack Sizes: 1g, 2g, 5g, 10g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-8-aminocaprylic acid 99+% (HPLC) | Fmoc-8-aminocaprylic acid 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-9-Amino-4,7-Dioxanonanoic acid | Fmoc-9-Amino-4,7-Dioxanonanoic acid. CAS No. 872679-70-4. Molecular formula: C22H25NO6. Mole weight: 399.4g/mol. IUPAC Name: 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid. SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCC(=O)O. InChI: InChI=1S/C22H25NO6/c24-21(25)9-11-27-13-14-28-12-10-23-22(26)29-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,23,26)(H,24,25). |  |
| Fmoc-9-amino-4,7-dioxanonanoic acid, 98% | Fmoc-9-amino-4,7-dioxanonanoic acid, 98%. CAS No. 872679-70-4. Molecular formula: C22H25NO6. Mole weight: 399.4g/mol. IUPAC Name: 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid. SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCC(=O)O. InChI: InChI=1S/C22H25NO6/c24-21(25)9-11-27-13-14-28-12-10-23-22(26)29-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,23,26)(H,24,25). | |
| Fmoc-9-aminononanoic acid | Fmoc-9-aminononanoic acid. Synonyms: Fmoc-9-Anc-OH; Fmoc 9 Anc OH. Grade: ≥ 98% (HPLC). CAS No. 212688-52-3. Molecular formula: C24H29NO4. Mole weight: 395.49. | |
| Fmoc-9-aminononanoic acid | Fmoc-9-aminononanoic acid. Group: Biochemicals. Grades: Highly Purified. CAS No. 212688-52-3. Pack Sizes: 1g, 2g, 5g. Molecular Formula: C24H29NO4. US Biological Life Sciences. | Worldwide |
| FMOC-9-AMINONONANOIC ACID | FMOC-9-AMINONONANOIC ACID. CAS No. 212688-52-3. Product ID: ACM212688523. Molecular formula: C24H29NO4. Mole weight: 395.49. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Fmoc-9-aminononanoic acid 98+% (HPLC) | Fmoc-9-aminononanoic acid 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-a-allyl-DL-glycine | Fmoc-a-allyl-DL-glycine. Group: Biochemicals. Alternative Names: Fmoc-DL-Gly(a-allyl)-OH; Fmoc-DL-2-amino-4-pentenoic acid. Grades: Highly Purified. CAS No. 221884-63-5. Pack Sizes: 100mg, 250mg, 500mg, 1g. US Biological Life Sciences. | Worldwide |
| Fmoc-a-allyl-DL-glycine 99+% | Fmoc-a-allyl-DL-glycine 99+%. Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g, 25g. US Biological Life Sciences. | Worldwide |
| Fmoc-a-aminoisobutyric acid 99+% (HPLC) | Fmoc-a-aminoisobutyric acid 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g, 25g, 100g. US Biological Life Sciences. | Worldwide |
| Fmoc-a,b-dehydro-2-aminobutyric acid ≥97% (HPLC) | Fmoc-a,b-dehydro-2-aminobutyric acid ≥97% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-a,b-dehydro-phenylalanine 98+% (HPLC) | Fmoc-a,b-dehydro-phenylalanine 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-AC4C-OH | Fmoc-AC4C-OH. Synonyms: 1-(9-Fluorenylmethyloxycarbonyl-amino)-cyclobutyl-1-carboxylic acid; 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid; Fmoc-1-amino-1-cyclobutanecarboxylic acid; Fmoc-cyclovaline; 1-(Fmoc-amino)cyclobutanecarboxylic acid. Grade: ≥ 95%. CAS No. 885951-77-9. Molecular formula: C20H19NO4. Mole weight: 337.37. | |
| Fmoc-Acp-2-Chlorotrityl Resin | 2-Chlorotrityl-Chloride-Resin is less acid-labile than Trityl Resin, and is widely used for solid phase immobilization. It has been used with the Fmoc/tBu methodology in the microwave-assisted solid phase peptide synthesis. | |
| Fmoc-ACPC-OH(1R,2R) | Fmoc-ACPC-OH(1R,2R). Synonyms: (1R,2R)-2-(9-Fluorenylmethyloxycarbonyl)aminocyclopentane carboxylic acid; (1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid; Fmoc-(1R,2R)-2-aminocyclopentane carboxylic acid; (1R,2R)-Fmoc-Acpc. Grade: ≥ 95% (HPLC). CAS No. 359586-69-9. Molecular formula: C21H21NO4. Mole weight: 351.40. | |
| Fmoc-ACPC-OH(1S,2S) | (1S,2S)-Fmoc-acpc is used in preparation of chimeric (α/β + α)-peptide ligands for BH3-recognition cleft of the cancer-associated protein Bcl-xL. Synonyms: (1S,2S)-2-(9-Fluorenylmethyloxycarbonyl)aminocyclopentane carboxylic acid; (1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid; Cyclopentanecarboxylic acid,2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-,(1S,2S); (S,S)-Fmoc-trans-2-aminocyclopentanecarboxylic acid-OH; Fmoc-(1S,2S)-2-aminocyclopentane carboxylic acid; (1S,2S)-Fmoc-Acpc. Grade: ≥ 98% (HPLC). CAS No. 359586-64-4. Molecular formula: C21H21NO4. Mole weight: 351.40. | |
| Fmoc-Acp-Wang resin | Excellent resin for the synthesis of peptide acids using Fmoc strategy. Cleavage can be effected by 95% TFA. | |
| Fmoc-Adc(10)-ol | Fmoc-Adc(10)-ol. Synonyms: Fmoc-NH-(CH2)10-OH; 10-[(9-Fluorenylmethoxycarbonyl)amino]-1-decanol. CAS No. 1396986-80-3. Molecular formula: C25H33NO3. Mole weight: 395.55. | |
| Fmoc-Ado-Ado-OPfp, Fmoc-AEEA-AEEA-OPfp, 17-(9-Fluorenylmethyloxycarbonyl-amino)-9-aza-3,6,12,15-tetraoxa-10-on-heptadecanoic acid pentafluorophenyl ester | Fmoc-Ado-Ado-OPfp, Fmoc-AEEA-AEEA-OPfp, 17-(9-Fluorenylmethyloxycarbonyl-amino)-9-aza-3,6,12,15-tetraoxa-10-on-heptadecanoic acid pentafluorophenyl ester. Product ID: ACMA00007516. Alfa Chemistry - ISO 9001:32057 Certified. | |
| Fmoc-Adod(12)-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Synonyms: Fmoc-Adod(12)-Wang Resin; 12-[(9-Fluorenylmethoxycarbonyl)amino]dodecanoic acid p-methoxybenzyl alcohol resin. | |
| Fmoc-AEEA-AEEA-OH | Fmoc-AEEA-AEEA-OH. Synonyms: Fmoc-AEEA-AEEA; Fmoc-8-amino-3,6-dioxaoctanoyl-8-amino-3,6-dioxaoctanoic acid. Grade: ≥ 99% (HPLC). CAS No. 560088-89-3. Molecular formula: C27H34N2O9. Mole weight: 530.6. | |
| Fmoc-AEEP-OH | Fmoc-AEEP-OH. Group: Biochemicals. Grades: Highly Purified. CAS No. 872679-70-4. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-AEEP-OH 98+% (HPLC) | Fmoc-AEEP-OH 98+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc Aeg-O-Ally HCl | Fmoc Aeg-O-Ally HCl. Synonyms: Allyl 2-((2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)ethyl)amino)acetate. CAS No. 406683-69-0. Molecular formula: C22H24N2O4. Mole weight: 380.44. | |
| Fmoc-Aeg-OBn | A backbone for PNA synthesis. Grade: 98%. CAS No. 791778-61-5. Molecular formula: C26H26N2O4. Mole weight: 430.50. | |
| Fmoc-Aeg-OH | A backbone for PNA synthesis. Synonyms: 2-((2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethyl)amino)acetic acid. Grade: 98%. CAS No. 172405-45-7. Molecular formula: C19H20N2O4. Mole weight: 340.38. | |
| Fmoc-Aeg-OMe | A backbone for PNA synthesis. Synonyms: N-[2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]ethyl]glycine methyl ester. Grade: 98%. CAS No. 156939-69-4. Molecular formula: C20H22N2O4. Mole weight: 354.41. | |
| Fmoc-Aeg-OtBu HCl | A backbone for PNA synthesis. Synonyms: N-[2-(Fmoc-amino)-ethyl]-Gly-OtBu HCl; tert-Butyl[2-(Fmoc-amino)ethylamino]acetate hydrochloride; N-[2-(Fmoc-amino)-ethyl]glycine tert-butylester hydrochloride; tert-Butyl [2-(Fmoc-amino)ethylamino]acetate hydrochloride; N-[2-(FMOC-AMINO)-ETHYL]-GLY-O-TBU HCl. Grade: 98%. CAS No. 169396-88-7. Molecular formula: C23H28N2O4·HCl. Mole weight: 432.95. | |
| Fmoc-Agp(Boc)2-OH | Fmoc-Agp(Boc)2-OH. Group: Biochemicals. Alternative Names: (S)-N-Fmoc-N,N'-bis-Boc-2-amino-3-guanidino propionic acid. Grades: Highly Purified. CAS No. 313232-63-2. Pack Sizes: 100mg, 250mg, 500mg, 1g. US Biological Life Sciences. | Worldwide |
| Fmoc-Agp(Boc)2-OH ≥97% (HPLC) | Fmoc-Agp(Boc)2-OH ≥97% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Fmoc-Ahp(7)-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Synonyms: Fmoc-Ahp(7)-Wang Resin; 7-[(9-Fluorenylmethoxycarbonyl)amino]heptanoic acid p-methoxybenzyl alcohol resin. | |
| Fmoc-Aib-Aib-OH | Fmoc-Aib-Aib-OH. Synonyms: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]amino]-2-methylpropanoic acid. CAS No. 139881-77-9. Molecular formula: C23H26N2O5. Mole weight: 410.5. | |
| Fmoc-Aib-Alko Resin | Wang resins are the standard supports for the preparation of peptide acids by the Fmoc batch solid phase synthesis strategy. Fmoc amino acids are pre-loaded to Wang resins so that that epimerization and dipeptide formation are minimized. Synonyms: Fmoc-Aib-Wang Resin; N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2-aminoisobutyric acid p-methoxybenzyl alcohol resin; N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2-methylalanine p-methoxybenzyl alcohol resin. | |
| Fmoc-Ala(2-naphthyl)-Wang resin | Pre-loaded resins for solid phase peptide and organic synthesis. Synonyms: Fmoc-3-(2-naphthyl)-L-alanine 4-alkoxybenzyl alcohol resin; Fmoc-2-Nal-Wang resin. | |
| Fmoc-Ala(2-Pyr-4-Cl)-OH | Fmoc-Ala(2-Pyr-4-Cl)-OH. Synonyms: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chloropyridin-2-yl)propanoic acid. Grade: 98.0%. CAS No. 2350007-37-1. Molecular formula: C23H19ClN2O4. Mole weight: 422.86. | |
| Fmoc-Ala(4-Pyr-3-F)-OH | Fmoc-Ala(4-Pyr-3-F)-OH. Synonyms: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluoropyridin-4-yl)propanoic acid. CAS No. 2349542-06-7. Molecular formula: C23H19FN2O4. Mole weight: 406.41. | |
| Fmoc-Ala-Aib-OH | Fmoc-Ala-Aib-OH. Synonyms: Fmoc-β-Ala-Aib-OH; (S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanamido)-2-methylpropanoic acid; Alanine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanyl]-2-methyl- (9CI). CAS No. 107076-70-0. Molecular formula: C22H24N2O5. Mole weight: 396.44. | |
Our database is helping our users find suppliers everyday.
